Created starter files for the project.

venv/Lib/site-packages/numpy/core/tests/_locales.py

@@ -0,0 +1,74 @@
+"""Provide class for testing in French locale
+
+"""
+import sys
+import locale
+
+import pytest
+
+__ALL__ = ['CommaDecimalPointLocale']
+
+
+def find_comma_decimal_point_locale():
+    """See if platform has a decimal point as comma locale.
+
+    Find a locale that uses a comma instead of a period as the
+    decimal point.
+
+    Returns
+    -------
+    old_locale: str
+        Locale when the function was called.
+    new_locale: {str, None)
+        First French locale found, None if none found.
+
+    """
+    if sys.platform == 'win32':
+        locales = ['FRENCH']
+    else:
+        locales = ['fr_FR', 'fr_FR.UTF-8', 'fi_FI', 'fi_FI.UTF-8']
+
+    old_locale = locale.getlocale(locale.LC_NUMERIC)
+    new_locale = None
+    try:
+        for loc in locales:
+            try:
+                locale.setlocale(locale.LC_NUMERIC, loc)
+                new_locale = loc
+                break
+            except locale.Error:
+                pass
+    finally:
+        locale.setlocale(locale.LC_NUMERIC, locale=old_locale)
+    return old_locale, new_locale
+
+
+class CommaDecimalPointLocale:
+    """Sets LC_NUMERIC to a locale with comma as decimal point.
+
+    Classes derived from this class have setup and teardown methods that run
+    tests with locale.LC_NUMERIC set to a locale where commas (',') are used as
+    the decimal point instead of periods ('.'). On exit the locale is restored
+    to the initial locale. It also serves as context manager with the same
+    effect. If no such locale is available, the test is skipped.
+
+    .. versionadded:: 1.15.0
+
+    """
+    (cur_locale, tst_locale) = find_comma_decimal_point_locale()
+
+    def setup(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def teardown(self):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)
+
+    def __enter__(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def __exit__(self, type, value, traceback):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)

venv/Lib/site-packages/numpy/core/tests/data/umath-validation-set-README

@@ -0,0 +1,15 @@
+Steps to validate transcendental functions:
+1) Add a file 'umath-validation-set-<ufuncname>', where ufuncname is name of
+   the function in NumPy you want to validate
+2) The file should contain 4 columns: dtype,input,expected output,ulperror
+    a. dtype: one of np.float16, np.float32, np.float64
+    b. input: floating point input to ufunc in hex. Example: 0x414570a4
+       represents 12.340000152587890625
+    c. expected output: floating point output for the corresponding input in hex.
+       This should be computed using a high(er) precision library and then rounded to
+       same format as the input.
+    d. ulperror: expected maximum ulp error of the function. This
+       should be same across all rows of the same dtype. Otherwise, the function is
+       tested for the maximum ulp error among all entries of that dtype.
+3) Add file umath-validation-set-<ufuncname> to the test file test_umath_accuracy.py
+   which will then validate your ufunc.

venv/Lib/site-packages/numpy/core/tests/data/umath-validation-set-cos

@@ -0,0 +1,665 @@
+dtype,input,output,ulperrortol
+## +ve denormals ##
+np.float32,0x004b4716,0x3f800000,2
+np.float32,0x007b2490,0x3f800000,2
+np.float32,0x007c99fa,0x3f800000,2
+np.float32,0x00734a0c,0x3f800000,2
+np.float32,0x0070de24,0x3f800000,2
+np.float32,0x007fffff,0x3f800000,2
+np.float32,0x00000001,0x3f800000,2
+## -ve denormals ##
+np.float32,0x80495d65,0x3f800000,2
+np.float32,0x806894f6,0x3f800000,2
+np.float32,0x80555a76,0x3f800000,2
+np.float32,0x804e1fb8,0x3f800000,2
+np.float32,0x80687de9,0x3f800000,2
+np.float32,0x807fffff,0x3f800000,2
+np.float32,0x80000001,0x3f800000,2
+## +/-0.0f, +/-FLT_MIN +/-FLT_MAX ##
+np.float32,0x00000000,0x3f800000,2
+np.float32,0x80000000,0x3f800000,2
+np.float32,0x00800000,0x3f800000,2
+np.float32,0x80800000,0x3f800000,2
+## 1.00f + 0x00000001 ##
+np.float32,0x3f800000,0x3f0a5140,2
+np.float32,0x3f800001,0x3f0a513f,2
+np.float32,0x3f800002,0x3f0a513d,2
+np.float32,0xc090a8b0,0xbe4332ce,2
+np.float32,0x41ce3184,0x3f4d1de1,2
+np.float32,0xc1d85848,0xbeaa8980,2
+np.float32,0x402b8820,0xbf653aa3,2
+np.float32,0x42b4e454,0xbf4a338b,2
+np.float32,0x42a67a60,0x3c58202e,2
+np.float32,0x41d92388,0xbed987c7,2
+np.float32,0x422dd66c,0x3f5dcab3,2
+np.float32,0xc28f5be6,0xbf5688d8,2
+np.float32,0x41ab2674,0xbf53aa3b,2
+np.float32,0x3f490fdb,0x3f3504f3,2
+np.float32,0xbf490fdb,0x3f3504f3,2
+np.float32,0x3fc90fdb,0xb33bbd2e,2
+np.float32,0xbfc90fdb,0xb33bbd2e,2
+np.float32,0x40490fdb,0xbf800000,2
+np.float32,0xc0490fdb,0xbf800000,2
+np.float32,0x3fc90fdb,0xb33bbd2e,2
+np.float32,0xbfc90fdb,0xb33bbd2e,2
+np.float32,0x40490fdb,0xbf800000,2
+np.float32,0xc0490fdb,0xbf800000,2
+np.float32,0x40c90fdb,0x3f800000,2
+np.float32,0xc0c90fdb,0x3f800000,2
+np.float32,0x4016cbe4,0xbf3504f3,2
+np.float32,0xc016cbe4,0xbf3504f3,2
+np.float32,0x4096cbe4,0x324cde2e,2
+np.float32,0xc096cbe4,0x324cde2e,2
+np.float32,0x4116cbe4,0xbf800000,2
+np.float32,0xc116cbe4,0xbf800000,2
+np.float32,0x40490fdb,0xbf800000,2
+np.float32,0xc0490fdb,0xbf800000,2
+np.float32,0x40c90fdb,0x3f800000,2
+np.float32,0xc0c90fdb,0x3f800000,2
+np.float32,0x41490fdb,0x3f800000,2
+np.float32,0xc1490fdb,0x3f800000,2
+np.float32,0x407b53d2,0xbf3504f1,2
+np.float32,0xc07b53d2,0xbf3504f1,2
+np.float32,0x40fb53d2,0xb4b5563d,2
+np.float32,0xc0fb53d2,0xb4b5563d,2
+np.float32,0x417b53d2,0xbf800000,2
+np.float32,0xc17b53d2,0xbf800000,2
+np.float32,0x4096cbe4,0x324cde2e,2
+np.float32,0xc096cbe4,0x324cde2e,2
+np.float32,0x4116cbe4,0xbf800000,2
+np.float32,0xc116cbe4,0xbf800000,2
+np.float32,0x4196cbe4,0x3f800000,2
+np.float32,0xc196cbe4,0x3f800000,2
+np.float32,0x40afede0,0x3f3504f7,2
+np.float32,0xc0afede0,0x3f3504f7,2
+np.float32,0x412fede0,0x353222c4,2
+np.float32,0xc12fede0,0x353222c4,2
+np.float32,0x41afede0,0xbf800000,2
+np.float32,0xc1afede0,0xbf800000,2
+np.float32,0x40c90fdb,0x3f800000,2
+np.float32,0xc0c90fdb,0x3f800000,2
+np.float32,0x41490fdb,0x3f800000,2
+np.float32,0xc1490fdb,0x3f800000,2
+np.float32,0x41c90fdb,0x3f800000,2
+np.float32,0xc1c90fdb,0x3f800000,2
+np.float32,0x40e231d6,0x3f3504f3,2
+np.float32,0xc0e231d6,0x3f3504f3,2
+np.float32,0x416231d6,0xb319a6a2,2
+np.float32,0xc16231d6,0xb319a6a2,2
+np.float32,0x41e231d6,0xbf800000,2
+np.float32,0xc1e231d6,0xbf800000,2
+np.float32,0x40fb53d2,0xb4b5563d,2
+np.float32,0xc0fb53d2,0xb4b5563d,2
+np.float32,0x417b53d2,0xbf800000,2
+np.float32,0xc17b53d2,0xbf800000,2
+np.float32,0x41fb53d2,0x3f800000,2
+np.float32,0xc1fb53d2,0x3f800000,2
+np.float32,0x410a3ae7,0xbf3504fb,2
+np.float32,0xc10a3ae7,0xbf3504fb,2
+np.float32,0x418a3ae7,0x35b08908,2
+np.float32,0xc18a3ae7,0x35b08908,2
+np.float32,0x420a3ae7,0xbf800000,2
+np.float32,0xc20a3ae7,0xbf800000,2
+np.float32,0x4116cbe4,0xbf800000,2
+np.float32,0xc116cbe4,0xbf800000,2
+np.float32,0x4196cbe4,0x3f800000,2
+np.float32,0xc196cbe4,0x3f800000,2
+np.float32,0x4216cbe4,0x3f800000,2
+np.float32,0xc216cbe4,0x3f800000,2
+np.float32,0x41235ce2,0xbf3504ef,2
+np.float32,0xc1235ce2,0xbf3504ef,2
+np.float32,0x41a35ce2,0xb53889b6,2
+np.float32,0xc1a35ce2,0xb53889b6,2
+np.float32,0x42235ce2,0xbf800000,2
+np.float32,0xc2235ce2,0xbf800000,2
+np.float32,0x412fede0,0x353222c4,2
+np.float32,0xc12fede0,0x353222c4,2
+np.float32,0x41afede0,0xbf800000,2
+np.float32,0xc1afede0,0xbf800000,2
+np.float32,0x422fede0,0x3f800000,2
+np.float32,0xc22fede0,0x3f800000,2
+np.float32,0x413c7edd,0x3f3504f4,2
+np.float32,0xc13c7edd,0x3f3504f4,2
+np.float32,0x41bc7edd,0x33800add,2
+np.float32,0xc1bc7edd,0x33800add,2
+np.float32,0x423c7edd,0xbf800000,2
+np.float32,0xc23c7edd,0xbf800000,2
+np.float32,0x41490fdb,0x3f800000,2
+np.float32,0xc1490fdb,0x3f800000,2
+np.float32,0x41c90fdb,0x3f800000,2
+np.float32,0xc1c90fdb,0x3f800000,2
+np.float32,0x42490fdb,0x3f800000,2
+np.float32,0xc2490fdb,0x3f800000,2
+np.float32,0x4155a0d9,0x3f3504eb,2
+np.float32,0xc155a0d9,0x3f3504eb,2
+np.float32,0x41d5a0d9,0xb5b3bc81,2
+np.float32,0xc1d5a0d9,0xb5b3bc81,2
+np.float32,0x4255a0d9,0xbf800000,2
+np.float32,0xc255a0d9,0xbf800000,2
+np.float32,0x416231d6,0xb319a6a2,2
+np.float32,0xc16231d6,0xb319a6a2,2
+np.float32,0x41e231d6,0xbf800000,2
+np.float32,0xc1e231d6,0xbf800000,2
+np.float32,0x426231d6,0x3f800000,2
+np.float32,0xc26231d6,0x3f800000,2
+np.float32,0x416ec2d4,0xbf3504f7,2
+np.float32,0xc16ec2d4,0xbf3504f7,2
+np.float32,0x41eec2d4,0x353ef0a7,2
+np.float32,0xc1eec2d4,0x353ef0a7,2
+np.float32,0x426ec2d4,0xbf800000,2
+np.float32,0xc26ec2d4,0xbf800000,2
+np.float32,0x417b53d2,0xbf800000,2
+np.float32,0xc17b53d2,0xbf800000,2
+np.float32,0x41fb53d2,0x3f800000,2
+np.float32,0xc1fb53d2,0x3f800000,2
+np.float32,0x427b53d2,0x3f800000,2
+np.float32,0xc27b53d2,0x3f800000,2
+np.float32,0x4183f268,0xbf3504e7,2
+np.float32,0xc183f268,0xbf3504e7,2
+np.float32,0x4203f268,0xb6059a13,2
+np.float32,0xc203f268,0xb6059a13,2
+np.float32,0x4283f268,0xbf800000,2
+np.float32,0xc283f268,0xbf800000,2
+np.float32,0x418a3ae7,0x35b08908,2
+np.float32,0xc18a3ae7,0x35b08908,2
+np.float32,0x420a3ae7,0xbf800000,2
+np.float32,0xc20a3ae7,0xbf800000,2
+np.float32,0x428a3ae7,0x3f800000,2
+np.float32,0xc28a3ae7,0x3f800000,2
+np.float32,0x41908365,0x3f3504f0,2
+np.float32,0xc1908365,0x3f3504f0,2
+np.float32,0x42108365,0xb512200d,2
+np.float32,0xc2108365,0xb512200d,2
+np.float32,0x42908365,0xbf800000,2
+np.float32,0xc2908365,0xbf800000,2
+np.float32,0x4196cbe4,0x3f800000,2
+np.float32,0xc196cbe4,0x3f800000,2
+np.float32,0x4216cbe4,0x3f800000,2
+np.float32,0xc216cbe4,0x3f800000,2
+np.float32,0x4296cbe4,0x3f800000,2
+np.float32,0xc296cbe4,0x3f800000,2
+np.float32,0x419d1463,0x3f3504ef,2
+np.float32,0xc19d1463,0x3f3504ef,2
+np.float32,0x421d1463,0xb5455799,2
+np.float32,0xc21d1463,0xb5455799,2
+np.float32,0x429d1463,0xbf800000,2
+np.float32,0xc29d1463,0xbf800000,2
+np.float32,0x41a35ce2,0xb53889b6,2
+np.float32,0xc1a35ce2,0xb53889b6,2
+np.float32,0x42235ce2,0xbf800000,2
+np.float32,0xc2235ce2,0xbf800000,2
+np.float32,0x42a35ce2,0x3f800000,2
+np.float32,0xc2a35ce2,0x3f800000,2
+np.float32,0x41a9a561,0xbf3504ff,2
+np.float32,0xc1a9a561,0xbf3504ff,2
+np.float32,0x4229a561,0x360733d0,2
+np.float32,0xc229a561,0x360733d0,2
+np.float32,0x42a9a561,0xbf800000,2
+np.float32,0xc2a9a561,0xbf800000,2
+np.float32,0x41afede0,0xbf800000,2
+np.float32,0xc1afede0,0xbf800000,2
+np.float32,0x422fede0,0x3f800000,2
+np.float32,0xc22fede0,0x3f800000,2
+np.float32,0x42afede0,0x3f800000,2
+np.float32,0xc2afede0,0x3f800000,2
+np.float32,0x41b6365e,0xbf3504f6,2
+np.float32,0xc1b6365e,0xbf3504f6,2
+np.float32,0x4236365e,0x350bb91c,2
+np.float32,0xc236365e,0x350bb91c,2
+np.float32,0x42b6365e,0xbf800000,2
+np.float32,0xc2b6365e,0xbf800000,2
+np.float32,0x41bc7edd,0x33800add,2
+np.float32,0xc1bc7edd,0x33800add,2
+np.float32,0x423c7edd,0xbf800000,2
+np.float32,0xc23c7edd,0xbf800000,2
+np.float32,0x42bc7edd,0x3f800000,2
+np.float32,0xc2bc7edd,0x3f800000,2
+np.float32,0x41c2c75c,0x3f3504f8,2
+np.float32,0xc1c2c75c,0x3f3504f8,2
+np.float32,0x4242c75c,0x354bbe8a,2
+np.float32,0xc242c75c,0x354bbe8a,2
+np.float32,0x42c2c75c,0xbf800000,2
+np.float32,0xc2c2c75c,0xbf800000,2
+np.float32,0x41c90fdb,0x3f800000,2
+np.float32,0xc1c90fdb,0x3f800000,2
+np.float32,0x42490fdb,0x3f800000,2
+np.float32,0xc2490fdb,0x3f800000,2
+np.float32,0x42c90fdb,0x3f800000,2
+np.float32,0xc2c90fdb,0x3f800000,2
+np.float32,0x41cf585a,0x3f3504e7,2
+np.float32,0xc1cf585a,0x3f3504e7,2
+np.float32,0x424f585a,0xb608cd8c,2
+np.float32,0xc24f585a,0xb608cd8c,2
+np.float32,0x42cf585a,0xbf800000,2
+np.float32,0xc2cf585a,0xbf800000,2
+np.float32,0x41d5a0d9,0xb5b3bc81,2
+np.float32,0xc1d5a0d9,0xb5b3bc81,2
+np.float32,0x4255a0d9,0xbf800000,2
+np.float32,0xc255a0d9,0xbf800000,2
+np.float32,0x42d5a0d9,0x3f800000,2
+np.float32,0xc2d5a0d9,0x3f800000,2
+np.float32,0x41dbe958,0xbf350507,2
+np.float32,0xc1dbe958,0xbf350507,2
+np.float32,0x425be958,0x365eab75,2
+np.float32,0xc25be958,0x365eab75,2
+np.float32,0x42dbe958,0xbf800000,2
+np.float32,0xc2dbe958,0xbf800000,2
+np.float32,0x41e231d6,0xbf800000,2
+np.float32,0xc1e231d6,0xbf800000,2
+np.float32,0x426231d6,0x3f800000,2
+np.float32,0xc26231d6,0x3f800000,2
+np.float32,0x42e231d6,0x3f800000,2
+np.float32,0xc2e231d6,0x3f800000,2
+np.float32,0x41e87a55,0xbf3504ef,2
+np.float32,0xc1e87a55,0xbf3504ef,2
+np.float32,0x42687a55,0xb552257b,2
+np.float32,0xc2687a55,0xb552257b,2
+np.float32,0x42e87a55,0xbf800000,2
+np.float32,0xc2e87a55,0xbf800000,2
+np.float32,0x41eec2d4,0x353ef0a7,2
+np.float32,0xc1eec2d4,0x353ef0a7,2
+np.float32,0x426ec2d4,0xbf800000,2
+np.float32,0xc26ec2d4,0xbf800000,2
+np.float32,0x42eec2d4,0x3f800000,2
+np.float32,0xc2eec2d4,0x3f800000,2
+np.float32,0x41f50b53,0x3f3504ff,2
+np.float32,0xc1f50b53,0x3f3504ff,2
+np.float32,0x42750b53,0x360a6748,2
+np.float32,0xc2750b53,0x360a6748,2
+np.float32,0x42f50b53,0xbf800000,2
+np.float32,0xc2f50b53,0xbf800000,2
+np.float32,0x41fb53d2,0x3f800000,2
+np.float32,0xc1fb53d2,0x3f800000,2
+np.float32,0x427b53d2,0x3f800000,2
+np.float32,0xc27b53d2,0x3f800000,2
+np.float32,0x42fb53d2,0x3f800000,2
+np.float32,0xc2fb53d2,0x3f800000,2
+np.float32,0x4200ce28,0x3f3504f6,2
+np.float32,0xc200ce28,0x3f3504f6,2
+np.float32,0x4280ce28,0x34fdd672,2
+np.float32,0xc280ce28,0x34fdd672,2
+np.float32,0x4300ce28,0xbf800000,2
+np.float32,0xc300ce28,0xbf800000,2
+np.float32,0x4203f268,0xb6059a13,2
+np.float32,0xc203f268,0xb6059a13,2
+np.float32,0x4283f268,0xbf800000,2
+np.float32,0xc283f268,0xbf800000,2
+np.float32,0x4303f268,0x3f800000,2
+np.float32,0xc303f268,0x3f800000,2
+np.float32,0x420716a7,0xbf3504f8,2
+np.float32,0xc20716a7,0xbf3504f8,2
+np.float32,0x428716a7,0x35588c6d,2
+np.float32,0xc28716a7,0x35588c6d,2
+np.float32,0x430716a7,0xbf800000,2
+np.float32,0xc30716a7,0xbf800000,2
+np.float32,0x420a3ae7,0xbf800000,2
+np.float32,0xc20a3ae7,0xbf800000,2
+np.float32,0x428a3ae7,0x3f800000,2
+np.float32,0xc28a3ae7,0x3f800000,2
+np.float32,0x430a3ae7,0x3f800000,2
+np.float32,0xc30a3ae7,0x3f800000,2
+np.float32,0x420d5f26,0xbf3504e7,2
+np.float32,0xc20d5f26,0xbf3504e7,2
+np.float32,0x428d5f26,0xb60c0105,2
+np.float32,0xc28d5f26,0xb60c0105,2
+np.float32,0x430d5f26,0xbf800000,2
+np.float32,0xc30d5f26,0xbf800000,2
+np.float32,0x42108365,0xb512200d,2
+np.float32,0xc2108365,0xb512200d,2
+np.float32,0x42908365,0xbf800000,2
+np.float32,0xc2908365,0xbf800000,2
+np.float32,0x43108365,0x3f800000,2
+np.float32,0xc3108365,0x3f800000,2
+np.float32,0x4213a7a5,0x3f350507,2
+np.float32,0xc213a7a5,0x3f350507,2
+np.float32,0x4293a7a5,0x3661deee,2
+np.float32,0xc293a7a5,0x3661deee,2
+np.float32,0x4313a7a5,0xbf800000,2
+np.float32,0xc313a7a5,0xbf800000,2
+np.float32,0x4216cbe4,0x3f800000,2
+np.float32,0xc216cbe4,0x3f800000,2
+np.float32,0x4296cbe4,0x3f800000,2
+np.float32,0xc296cbe4,0x3f800000,2
+np.float32,0x4316cbe4,0x3f800000,2
+np.float32,0xc316cbe4,0x3f800000,2
+np.float32,0x4219f024,0x3f3504d8,2
+np.float32,0xc219f024,0x3f3504d8,2
+np.float32,0x4299f024,0xb69bde6c,2
+np.float32,0xc299f024,0xb69bde6c,2
+np.float32,0x4319f024,0xbf800000,2
+np.float32,0xc319f024,0xbf800000,2
+np.float32,0x421d1463,0xb5455799,2
+np.float32,0xc21d1463,0xb5455799,2
+np.float32,0x429d1463,0xbf800000,2
+np.float32,0xc29d1463,0xbf800000,2
+np.float32,0x431d1463,0x3f800000,2
+np.float32,0xc31d1463,0x3f800000,2
+np.float32,0x422038a3,0xbf350516,2
+np.float32,0xc22038a3,0xbf350516,2
+np.float32,0x42a038a3,0x36c6cd61,2
+np.float32,0xc2a038a3,0x36c6cd61,2
+np.float32,0x432038a3,0xbf800000,2
+np.float32,0xc32038a3,0xbf800000,2
+np.float32,0x42235ce2,0xbf800000,2
+np.float32,0xc2235ce2,0xbf800000,2
+np.float32,0x42a35ce2,0x3f800000,2
+np.float32,0xc2a35ce2,0x3f800000,2
+np.float32,0x43235ce2,0x3f800000,2
+np.float32,0xc3235ce2,0x3f800000,2
+np.float32,0x42268121,0xbf3504f6,2
+np.float32,0xc2268121,0xbf3504f6,2
+np.float32,0x42a68121,0x34e43aac,2
+np.float32,0xc2a68121,0x34e43aac,2
+np.float32,0x43268121,0xbf800000,2
+np.float32,0xc3268121,0xbf800000,2
+np.float32,0x4229a561,0x360733d0,2
+np.float32,0xc229a561,0x360733d0,2
+np.float32,0x42a9a561,0xbf800000,2
+np.float32,0xc2a9a561,0xbf800000,2
+np.float32,0x4329a561,0x3f800000,2
+np.float32,0xc329a561,0x3f800000,2
+np.float32,0x422cc9a0,0x3f3504f8,2
+np.float32,0xc22cc9a0,0x3f3504f8,2
+np.float32,0x42acc9a0,0x35655a50,2
+np.float32,0xc2acc9a0,0x35655a50,2
+np.float32,0x432cc9a0,0xbf800000,2
+np.float32,0xc32cc9a0,0xbf800000,2
+np.float32,0x422fede0,0x3f800000,2
+np.float32,0xc22fede0,0x3f800000,2
+np.float32,0x42afede0,0x3f800000,2
+np.float32,0xc2afede0,0x3f800000,2
+np.float32,0x432fede0,0x3f800000,2
+np.float32,0xc32fede0,0x3f800000,2
+np.float32,0x4233121f,0x3f3504e7,2
+np.float32,0xc233121f,0x3f3504e7,2
+np.float32,0x42b3121f,0xb60f347d,2
+np.float32,0xc2b3121f,0xb60f347d,2
+np.float32,0x4333121f,0xbf800000,2
+np.float32,0xc333121f,0xbf800000,2
+np.float32,0x4236365e,0x350bb91c,2
+np.float32,0xc236365e,0x350bb91c,2
+np.float32,0x42b6365e,0xbf800000,2
+np.float32,0xc2b6365e,0xbf800000,2
+np.float32,0x4336365e,0x3f800000,2
+np.float32,0xc336365e,0x3f800000,2
+np.float32,0x42395a9e,0xbf350507,2
+np.float32,0xc2395a9e,0xbf350507,2
+np.float32,0x42b95a9e,0x36651267,2
+np.float32,0xc2b95a9e,0x36651267,2
+np.float32,0x43395a9e,0xbf800000,2
+np.float32,0xc3395a9e,0xbf800000,2
+np.float32,0x423c7edd,0xbf800000,2
+np.float32,0xc23c7edd,0xbf800000,2
+np.float32,0x42bc7edd,0x3f800000,2
+np.float32,0xc2bc7edd,0x3f800000,2
+np.float32,0x433c7edd,0x3f800000,2
+np.float32,0xc33c7edd,0x3f800000,2
+np.float32,0x423fa31d,0xbf3504d7,2
+np.float32,0xc23fa31d,0xbf3504d7,2
+np.float32,0x42bfa31d,0xb69d7828,2
+np.float32,0xc2bfa31d,0xb69d7828,2
+np.float32,0x433fa31d,0xbf800000,2
+np.float32,0xc33fa31d,0xbf800000,2
+np.float32,0x4242c75c,0x354bbe8a,2
+np.float32,0xc242c75c,0x354bbe8a,2
+np.float32,0x42c2c75c,0xbf800000,2
+np.float32,0xc2c2c75c,0xbf800000,2
+np.float32,0x4342c75c,0x3f800000,2
+np.float32,0xc342c75c,0x3f800000,2
+np.float32,0x4245eb9c,0x3f350517,2
+np.float32,0xc245eb9c,0x3f350517,2
+np.float32,0x42c5eb9c,0x36c8671d,2
+np.float32,0xc2c5eb9c,0x36c8671d,2
+np.float32,0x4345eb9c,0xbf800000,2
+np.float32,0xc345eb9c,0xbf800000,2
+np.float32,0x42490fdb,0x3f800000,2
+np.float32,0xc2490fdb,0x3f800000,2
+np.float32,0x42c90fdb,0x3f800000,2
+np.float32,0xc2c90fdb,0x3f800000,2
+np.float32,0x43490fdb,0x3f800000,2
+np.float32,0xc3490fdb,0x3f800000,2
+np.float32,0x424c341a,0x3f3504f5,2
+np.float32,0xc24c341a,0x3f3504f5,2
+np.float32,0x42cc341a,0x34ca9ee6,2
+np.float32,0xc2cc341a,0x34ca9ee6,2
+np.float32,0x434c341a,0xbf800000,2
+np.float32,0xc34c341a,0xbf800000,2
+np.float32,0x424f585a,0xb608cd8c,2
+np.float32,0xc24f585a,0xb608cd8c,2
+np.float32,0x42cf585a,0xbf800000,2
+np.float32,0xc2cf585a,0xbf800000,2
+np.float32,0x434f585a,0x3f800000,2
+np.float32,0xc34f585a,0x3f800000,2
+np.float32,0x42527c99,0xbf3504f9,2
+np.float32,0xc2527c99,0xbf3504f9,2
+np.float32,0x42d27c99,0x35722833,2
+np.float32,0xc2d27c99,0x35722833,2
+np.float32,0x43527c99,0xbf800000,2
+np.float32,0xc3527c99,0xbf800000,2
+np.float32,0x4255a0d9,0xbf800000,2
+np.float32,0xc255a0d9,0xbf800000,2
+np.float32,0x42d5a0d9,0x3f800000,2
+np.float32,0xc2d5a0d9,0x3f800000,2
+np.float32,0x4355a0d9,0x3f800000,2
+np.float32,0xc355a0d9,0x3f800000,2
+np.float32,0x4258c518,0xbf3504e6,2
+np.float32,0xc258c518,0xbf3504e6,2
+np.float32,0x42d8c518,0xb61267f6,2
+np.float32,0xc2d8c518,0xb61267f6,2
+np.float32,0x4358c518,0xbf800000,2
+np.float32,0xc358c518,0xbf800000,2
+np.float32,0x425be958,0x365eab75,2
+np.float32,0xc25be958,0x365eab75,2
+np.float32,0x42dbe958,0xbf800000,2
+np.float32,0xc2dbe958,0xbf800000,2
+np.float32,0x435be958,0x3f800000,2
+np.float32,0xc35be958,0x3f800000,2
+np.float32,0x425f0d97,0x3f350508,2
+np.float32,0xc25f0d97,0x3f350508,2
+np.float32,0x42df0d97,0x366845e0,2
+np.float32,0xc2df0d97,0x366845e0,2
+np.float32,0x435f0d97,0xbf800000,2
+np.float32,0xc35f0d97,0xbf800000,2
+np.float32,0x426231d6,0x3f800000,2
+np.float32,0xc26231d6,0x3f800000,2
+np.float32,0x42e231d6,0x3f800000,2
+np.float32,0xc2e231d6,0x3f800000,2
+np.float32,0x436231d6,0x3f800000,2
+np.float32,0xc36231d6,0x3f800000,2
+np.float32,0x42655616,0x3f3504d7,2
+np.float32,0xc2655616,0x3f3504d7,2
+np.float32,0x42e55616,0xb69f11e5,2
+np.float32,0xc2e55616,0xb69f11e5,2
+np.float32,0x43655616,0xbf800000,2
+np.float32,0xc3655616,0xbf800000,2
+np.float32,0x42687a55,0xb552257b,2
+np.float32,0xc2687a55,0xb552257b,2
+np.float32,0x42e87a55,0xbf800000,2
+np.float32,0xc2e87a55,0xbf800000,2
+np.float32,0x43687a55,0x3f800000,2
+np.float32,0xc3687a55,0x3f800000,2
+np.float32,0x426b9e95,0xbf350517,2
+np.float32,0xc26b9e95,0xbf350517,2
+np.float32,0x42eb9e95,0x36ca00d9,2
+np.float32,0xc2eb9e95,0x36ca00d9,2
+np.float32,0x436b9e95,0xbf800000,2
+np.float32,0xc36b9e95,0xbf800000,2
+np.float32,0x426ec2d4,0xbf800000,2
+np.float32,0xc26ec2d4,0xbf800000,2
+np.float32,0x42eec2d4,0x3f800000,2
+np.float32,0xc2eec2d4,0x3f800000,2
+np.float32,0x436ec2d4,0x3f800000,2
+np.float32,0xc36ec2d4,0x3f800000,2
+np.float32,0x4271e713,0xbf3504f5,2
+np.float32,0xc271e713,0xbf3504f5,2
+np.float32,0x42f1e713,0x34b10321,2
+np.float32,0xc2f1e713,0x34b10321,2
+np.float32,0x4371e713,0xbf800000,2
+np.float32,0xc371e713,0xbf800000,2
+np.float32,0x42750b53,0x360a6748,2
+np.float32,0xc2750b53,0x360a6748,2
+np.float32,0x42f50b53,0xbf800000,2
+np.float32,0xc2f50b53,0xbf800000,2
+np.float32,0x43750b53,0x3f800000,2
+np.float32,0xc3750b53,0x3f800000,2
+np.float32,0x42782f92,0x3f3504f9,2
+np.float32,0xc2782f92,0x3f3504f9,2
+np.float32,0x42f82f92,0x357ef616,2
+np.float32,0xc2f82f92,0x357ef616,2
+np.float32,0x43782f92,0xbf800000,2
+np.float32,0xc3782f92,0xbf800000,2
+np.float32,0x427b53d2,0x3f800000,2
+np.float32,0xc27b53d2,0x3f800000,2
+np.float32,0x42fb53d2,0x3f800000,2
+np.float32,0xc2fb53d2,0x3f800000,2
+np.float32,0x437b53d2,0x3f800000,2
+np.float32,0xc37b53d2,0x3f800000,2
+np.float32,0x427e7811,0x3f3504e6,2
+np.float32,0xc27e7811,0x3f3504e6,2
+np.float32,0x42fe7811,0xb6159b6f,2
+np.float32,0xc2fe7811,0xb6159b6f,2
+np.float32,0x437e7811,0xbf800000,2
+np.float32,0xc37e7811,0xbf800000,2
+np.float32,0x4280ce28,0x34fdd672,2
+np.float32,0xc280ce28,0x34fdd672,2
+np.float32,0x4300ce28,0xbf800000,2
+np.float32,0xc300ce28,0xbf800000,2
+np.float32,0x4380ce28,0x3f800000,2
+np.float32,0xc380ce28,0x3f800000,2
+np.float32,0x42826048,0xbf350508,2
+np.float32,0xc2826048,0xbf350508,2
+np.float32,0x43026048,0x366b7958,2
+np.float32,0xc3026048,0x366b7958,2
+np.float32,0x43826048,0xbf800000,2
+np.float32,0xc3826048,0xbf800000,2
+np.float32,0x4283f268,0xbf800000,2
+np.float32,0xc283f268,0xbf800000,2
+np.float32,0x4303f268,0x3f800000,2
+np.float32,0xc303f268,0x3f800000,2
+np.float32,0x4383f268,0x3f800000,2
+np.float32,0xc383f268,0x3f800000,2
+np.float32,0x42858487,0xbf350504,2
+np.float32,0xc2858487,0xbf350504,2
+np.float32,0x43058487,0x363ea8be,2
+np.float32,0xc3058487,0x363ea8be,2
+np.float32,0x43858487,0xbf800000,2
+np.float32,0xc3858487,0xbf800000,2
+np.float32,0x428716a7,0x35588c6d,2
+np.float32,0xc28716a7,0x35588c6d,2
+np.float32,0x430716a7,0xbf800000,2
+np.float32,0xc30716a7,0xbf800000,2
+np.float32,0x438716a7,0x3f800000,2
+np.float32,0xc38716a7,0x3f800000,2
+np.float32,0x4288a8c7,0x3f350517,2
+np.float32,0xc288a8c7,0x3f350517,2
+np.float32,0x4308a8c7,0x36cb9a96,2
+np.float32,0xc308a8c7,0x36cb9a96,2
+np.float32,0x4388a8c7,0xbf800000,2
+np.float32,0xc388a8c7,0xbf800000,2
+np.float32,0x428a3ae7,0x3f800000,2
+np.float32,0xc28a3ae7,0x3f800000,2
+np.float32,0x430a3ae7,0x3f800000,2
+np.float32,0xc30a3ae7,0x3f800000,2
+np.float32,0x438a3ae7,0x3f800000,2
+np.float32,0xc38a3ae7,0x3f800000,2
+np.float32,0x428bcd06,0x3f3504f5,2
+np.float32,0xc28bcd06,0x3f3504f5,2
+np.float32,0x430bcd06,0x3497675b,2
+np.float32,0xc30bcd06,0x3497675b,2
+np.float32,0x438bcd06,0xbf800000,2
+np.float32,0xc38bcd06,0xbf800000,2
+np.float32,0x428d5f26,0xb60c0105,2
+np.float32,0xc28d5f26,0xb60c0105,2
+np.float32,0x430d5f26,0xbf800000,2
+np.float32,0xc30d5f26,0xbf800000,2
+np.float32,0x438d5f26,0x3f800000,2
+np.float32,0xc38d5f26,0x3f800000,2
+np.float32,0x428ef146,0xbf350526,2
+np.float32,0xc28ef146,0xbf350526,2
+np.float32,0x430ef146,0x3710bc40,2
+np.float32,0xc30ef146,0x3710bc40,2
+np.float32,0x438ef146,0xbf800000,2
+np.float32,0xc38ef146,0xbf800000,2
+np.float32,0x42908365,0xbf800000,2
+np.float32,0xc2908365,0xbf800000,2
+np.float32,0x43108365,0x3f800000,2
+np.float32,0xc3108365,0x3f800000,2
+np.float32,0x43908365,0x3f800000,2
+np.float32,0xc3908365,0x3f800000,2
+np.float32,0x42921585,0xbf3504e6,2
+np.float32,0xc2921585,0xbf3504e6,2
+np.float32,0x43121585,0xb618cee8,2
+np.float32,0xc3121585,0xb618cee8,2
+np.float32,0x43921585,0xbf800000,2
+np.float32,0xc3921585,0xbf800000,2
+np.float32,0x4293a7a5,0x3661deee,2
+np.float32,0xc293a7a5,0x3661deee,2
+np.float32,0x4313a7a5,0xbf800000,2
+np.float32,0xc313a7a5,0xbf800000,2
+np.float32,0x4393a7a5,0x3f800000,2
+np.float32,0xc393a7a5,0x3f800000,2
+np.float32,0x429539c5,0x3f350536,2
+np.float32,0xc29539c5,0x3f350536,2
+np.float32,0x431539c5,0x373bab34,2
+np.float32,0xc31539c5,0x373bab34,2
+np.float32,0x439539c5,0xbf800000,2
+np.float32,0xc39539c5,0xbf800000,2
+np.float32,0x4296cbe4,0x3f800000,2
+np.float32,0xc296cbe4,0x3f800000,2
+np.float32,0x4316cbe4,0x3f800000,2
+np.float32,0xc316cbe4,0x3f800000,2
+np.float32,0x4396cbe4,0x3f800000,2
+np.float32,0xc396cbe4,0x3f800000,2
+np.float32,0x42985e04,0x3f3504d7,2
+np.float32,0xc2985e04,0x3f3504d7,2
+np.float32,0x43185e04,0xb6a2455d,2
+np.float32,0xc3185e04,0xb6a2455d,2
+np.float32,0x43985e04,0xbf800000,2
+np.float32,0xc3985e04,0xbf800000,2
+np.float32,0x4299f024,0xb69bde6c,2
+np.float32,0xc299f024,0xb69bde6c,2
+np.float32,0x4319f024,0xbf800000,2
+np.float32,0xc319f024,0xbf800000,2
+np.float32,0x4399f024,0x3f800000,2
+np.float32,0xc399f024,0x3f800000,2
+np.float32,0x429b8243,0xbf3504ea,2
+np.float32,0xc29b8243,0xbf3504ea,2
+np.float32,0x431b8243,0xb5cb2eb8,2
+np.float32,0xc31b8243,0xb5cb2eb8,2
+np.float32,0x439b8243,0xbf800000,2
+np.float32,0xc39b8243,0xbf800000,2
+np.float32,0x435b2047,0x3f3504c1,2
+np.float32,0x42a038a2,0xb5e4ca7e,2
+np.float32,0x432038a2,0xbf800000,2
+np.float32,0x4345eb9b,0xbf800000,2
+np.float32,0x42c5eb9b,0xb5de638c,2
+np.float32,0x42eb9e94,0xb5d7fc9b,2
+np.float32,0x4350ea79,0x3631dadb,2
+np.float32,0x42dbe957,0xbf800000,2
+np.float32,0x425be957,0xb505522a,2
+np.float32,0x435be957,0x3f800000,2
+np.float32,0x46027eb2,0x3e7d94c9,2
+np.float32,0x4477baed,0xbe7f1824,2
+np.float32,0x454b8024,0x3e7f5268,2
+np.float32,0x455d2c09,0x3e7f40cb,2
+np.float32,0x4768d3de,0xba14b4af,2
+np.float32,0x46c1e7cd,0x3e7fb102,2
+np.float32,0x44a52949,0xbe7dc9d5,2
+np.float32,0x4454633a,0x3e7dbc7d,2
+np.float32,0x4689810b,0x3e7eb02b,2
+np.float32,0x473473cd,0xbe7eef6f,2
+np.float32,0x44a5193f,0x3e7e1b1f,2
+np.float32,0x46004b36,0x3e7dac59,2
+np.float32,0x467f604b,0x3d7ffd3a,2
+np.float32,0x45ea1805,0x3dffd2e0,2
+np.float32,0x457b6af3,0x3dff7831,2
+np.float32,0x44996159,0xbe7d85f4,2
+np.float32,0x47883553,0xbb80584e,2
+np.float32,0x44e19f0c,0xbdffcfe6,2
+np.float32,0x472b3bf6,0xbe7f7a82,2
+np.float32,0x4600bb4e,0x3a135e33,2
+np.float32,0x449f4556,0x3e7e42e5,2
+np.float32,0x474e9420,0x3dff77b2,2
+np.float32,0x45cbdb23,0x3dff7240,2
+np.float32,0x44222747,0x3dffb039,2
+np.float32,0x4772e419,0xbdff74b8,2

venv/Lib/site-packages/numpy/core/tests/data/umath-validation-set-exp

@@ -0,0 +1,412 @@
+dtype,input,output,ulperrortol
+## +ve denormals ##
+np.float32,0x004b4716,0x3f800000,3
+np.float32,0x007b2490,0x3f800000,3
+np.float32,0x007c99fa,0x3f800000,3
+np.float32,0x00734a0c,0x3f800000,3
+np.float32,0x0070de24,0x3f800000,3
+np.float32,0x00495d65,0x3f800000,3
+np.float32,0x006894f6,0x3f800000,3
+np.float32,0x00555a76,0x3f800000,3
+np.float32,0x004e1fb8,0x3f800000,3
+np.float32,0x00687de9,0x3f800000,3
+## -ve denormals ##
+np.float32,0x805b59af,0x3f800000,3
+np.float32,0x807ed8ed,0x3f800000,3
+np.float32,0x807142ad,0x3f800000,3
+np.float32,0x80772002,0x3f800000,3
+np.float32,0x8062abcb,0x3f800000,3
+np.float32,0x8045e31c,0x3f800000,3
+np.float32,0x805f01c2,0x3f800000,3
+np.float32,0x80506432,0x3f800000,3
+np.float32,0x8060089d,0x3f800000,3
+np.float32,0x8071292f,0x3f800000,3
+## floats that output a denormal ##
+np.float32,0xc2cf3fc1,0x00000001,3
+np.float32,0xc2c79726,0x00000021,3
+np.float32,0xc2cb295d,0x00000005,3
+np.float32,0xc2b49e6b,0x00068c4c,3
+np.float32,0xc2ca8116,0x00000008,3
+np.float32,0xc2c23f82,0x000001d7,3
+np.float32,0xc2cb69c0,0x00000005,3
+np.float32,0xc2cc1f4d,0x00000003,3
+np.float32,0xc2ae094e,0x00affc4c,3
+np.float32,0xc2c86c44,0x00000015,3
+## random floats between -87.0f and 88.0f ##
+np.float32,0x4030d7e0,0x417d9a05,3
+np.float32,0x426f60e8,0x6aa1be2c,3
+np.float32,0x41a1b220,0x4e0efc11,3
+np.float32,0xc20cc722,0x26159da7,3
+np.float32,0x41c492bc,0x512ec79d,3
+np.float32,0x40980210,0x42e73a0e,3
+np.float32,0xbf1f7b80,0x3f094de3,3
+np.float32,0x42a678a4,0x7b87a383,3
+np.float32,0xc20f3cfd,0x25a1c304,3
+np.float32,0x423ff34c,0x6216467f,3
+np.float32,0x00000000,0x3f800000,3
+## floats that cause an overflow ##
+np.float32,0x7f06d8c1,0x7f800000,3
+np.float32,0x7f451912,0x7f800000,3
+np.float32,0x7ecceac3,0x7f800000,3
+np.float32,0x7f643b45,0x7f800000,3
+np.float32,0x7e910ea0,0x7f800000,3
+np.float32,0x7eb4756b,0x7f800000,3
+np.float32,0x7f4ec708,0x7f800000,3
+np.float32,0x7f6b4551,0x7f800000,3
+np.float32,0x7d8edbda,0x7f800000,3
+np.float32,0x7f730718,0x7f800000,3
+np.float32,0x42b17217,0x7f7fff84,3
+np.float32,0x42b17218,0x7f800000,3
+np.float32,0x42b17219,0x7f800000,3
+np.float32,0xfef2b0bc,0x00000000,3
+np.float32,0xff69f83e,0x00000000,3
+np.float32,0xff4ecb12,0x00000000,3
+np.float32,0xfeac6d86,0x00000000,3
+np.float32,0xfde0cdb8,0x00000000,3
+np.float32,0xff26aef4,0x00000000,3
+np.float32,0xff6f9277,0x00000000,3
+np.float32,0xff7adfc4,0x00000000,3
+np.float32,0xff0ad40e,0x00000000,3
+np.float32,0xff6fd8f3,0x00000000,3
+np.float32,0xc2cff1b4,0x00000001,3
+np.float32,0xc2cff1b5,0x00000000,3
+np.float32,0xc2cff1b6,0x00000000,3
+np.float32,0x7f800000,0x7f800000,3
+np.float32,0xff800000,0x00000000,3
+np.float32,0x4292f27c,0x7480000a,3
+np.float32,0x42a920be,0x7c7fff94,3
+np.float32,0x41c214c9,0x50ffffd9,3
+np.float32,0x41abe686,0x4effffd9,3
+np.float32,0x4287db5a,0x707fffd3,3
+np.float32,0x41902cbb,0x4c800078,3
+np.float32,0x42609466,0x67ffffeb,3
+np.float32,0x41a65af5,0x4e7fffd1,3
+np.float32,0x417f13ff,0x4affffc9,3
+np.float32,0x426d0e6c,0x6a3504f2,3
+np.float32,0x41bc8934,0x507fff51,3
+np.float32,0x42a7bdde,0x7c0000d6,3
+np.float32,0x4120cf66,0x46b504f6,3
+np.float32,0x4244da8f,0x62ffff1a,3
+np.float32,0x41a0cf69,0x4e000034,3
+np.float32,0x41cd2bec,0x52000005,3
+np.float32,0x42893e41,0x7100009e,3
+np.float32,0x41b437e1,0x4fb50502,3
+np.float32,0x41d8430f,0x5300001d,3
+np.float32,0x4244da92,0x62ffffda,3
+np.float32,0x41a0cf63,0x4dffffa9,3
+np.float32,0x3eb17218,0x3fb504f3,3
+np.float32,0x428729e8,0x703504dc,3
+np.float32,0x41a0cf67,0x4e000014,3
+np.float32,0x4252b77d,0x65800011,3
+np.float32,0x41902cb9,0x4c800058,3
+np.float32,0x42a0cf67,0x79800052,3
+np.float32,0x4152b77b,0x48ffffe9,3
+np.float32,0x41265af3,0x46ffffc8,3
+np.float32,0x42187e0b,0x5affff9a,3
+np.float32,0xc0d2b77c,0x3ab504f6,3
+np.float32,0xc283b2ac,0x10000072,3
+np.float32,0xc1cff1b4,0x2cb504f5,3
+np.float32,0xc05dce9e,0x3d000000,3
+np.float32,0xc28ec9d2,0x0bfffea5,3
+np.float32,0xc23c893a,0x1d7fffde,3
+np.float32,0xc2a920c0,0x027fff6c,3
+np.float32,0xc1f9886f,0x2900002b,3
+np.float32,0xc2c42920,0x000000b5,3
+np.float32,0xc2893e41,0x0dfffec5,3
+np.float32,0xc2c4da93,0x00000080,3
+np.float32,0xc17f1401,0x3400000c,3
+np.float32,0xc1902cb6,0x327fffaf,3
+np.float32,0xc27c4e3b,0x11ffffc5,3
+np.float32,0xc268e5c5,0x157ffe9d,3
+np.float32,0xc2b4e953,0x0005a826,3
+np.float32,0xc287db5a,0x0e800016,3
+np.float32,0xc207db5a,0x2700000b,3
+np.float32,0xc2b2d4fe,0x000ffff1,3
+np.float32,0xc268e5c0,0x157fffdd,3
+np.float32,0xc22920bd,0x2100003b,3
+np.float32,0xc2902caf,0x0b80011e,3
+np.float32,0xc1902cba,0x327fff2f,3
+np.float32,0xc2ca6625,0x00000008,3
+np.float32,0xc280ece8,0x10fffeb5,3
+np.float32,0xc2918f94,0x0b0000ea,3
+np.float32,0xc29b43d5,0x077ffffc,3
+np.float32,0xc1e61ff7,0x2ab504f5,3
+np.float32,0xc2867878,0x0effff15,3
+np.float32,0xc2a2324a,0x04fffff4,3
+#float64
+## near zero ##
+np.float64,0x8000000000000000,0x3ff0000000000000,1
+np.float64,0x8010000000000000,0x3ff0000000000000,1
+np.float64,0x8000000000000001,0x3ff0000000000000,1
+np.float64,0x8360000000000000,0x3ff0000000000000,1
+np.float64,0x9a70000000000000,0x3ff0000000000000,1
+np.float64,0xb9b0000000000000,0x3ff0000000000000,1
+np.float64,0xb810000000000000,0x3ff0000000000000,1
+np.float64,0xbc30000000000000,0x3ff0000000000000,1
+np.float64,0xb6a0000000000000,0x3ff0000000000000,1
+np.float64,0x0000000000000000,0x3ff0000000000000,1
+np.float64,0x0010000000000000,0x3ff0000000000000,1
+np.float64,0x0000000000000001,0x3ff0000000000000,1
+np.float64,0x0360000000000000,0x3ff0000000000000,1
+np.float64,0x1a70000000000000,0x3ff0000000000000,1
+np.float64,0x3c30000000000000,0x3ff0000000000000,1
+np.float64,0x36a0000000000000,0x3ff0000000000000,1
+np.float64,0x39b0000000000000,0x3ff0000000000000,1
+np.float64,0x3810000000000000,0x3ff0000000000000,1
+## underflow ##
+np.float64,0xc0c6276800000000,0x0000000000000000,1
+np.float64,0xc0c62d918ce2421d,0x0000000000000000,1
+np.float64,0xc0c62d918ce2421e,0x0000000000000000,1
+np.float64,0xc0c62d91a0000000,0x0000000000000000,1
+np.float64,0xc0c62d9180000000,0x0000000000000000,1
+np.float64,0xc0c62dea45ee3e06,0x0000000000000000,1
+np.float64,0xc0c62dea45ee3e07,0x0000000000000000,1
+np.float64,0xc0c62dea40000000,0x0000000000000000,1
+np.float64,0xc0c62dea60000000,0x0000000000000000,1
+np.float64,0xc0875f1120000000,0x0000000000000000,1
+np.float64,0xc0875f113c30b1c8,0x0000000000000000,1
+np.float64,0xc0875f1140000000,0x0000000000000000,1
+np.float64,0xc093480000000000,0x0000000000000000,1
+np.float64,0xffefffffffffffff,0x0000000000000000,1
+np.float64,0xc7efffffe0000000,0x0000000000000000,1
+## overflow ##
+np.float64,0x40862e52fefa39ef,0x7ff0000000000000,1
+np.float64,0x40872e42fefa39ef,0x7ff0000000000000,1
+## +/- INF, +/- NAN ##
+np.float64,0x7ff0000000000000,0x7ff0000000000000,1
+np.float64,0xfff0000000000000,0x0000000000000000,1
+np.float64,0x7ff8000000000000,0x7ff8000000000000,1
+np.float64,0xfff8000000000000,0xfff8000000000000,1
+## output denormal ##
+np.float64,0xc087438520000000,0x0000000000000001,1
+np.float64,0xc08743853f2f4461,0x0000000000000001,1
+np.float64,0xc08743853f2f4460,0x0000000000000001,1
+np.float64,0xc087438540000000,0x0000000000000001,1
+## between -745.13321910 and 709.78271289 ##
+np.float64,0xbff760cd14774bd9,0x3fcdb14ced00ceb6,1
+np.float64,0xbff760cd20000000,0x3fcdb14cd7993879,1
+np.float64,0xbff760cd00000000,0x3fcdb14d12fbd264,1
+np.float64,0xc07f1cf360000000,0x130c1b369af14fda,1
+np.float64,0xbeb0000000000000,0x3feffffe00001000,1
+np.float64,0xbd70000000000000,0x3fefffffffffe000,1
+np.float64,0xc084fd46e5c84952,0x0360000000000139,1
+np.float64,0xc084fd46e5c84953,0x035ffffffffffe71,1
+np.float64,0xc084fd46e0000000,0x0360000b9096d32c,1
+np.float64,0xc084fd4700000000,0x035fff9721d12104,1
+np.float64,0xc086232bc0000000,0x0010003af5e64635,1
+np.float64,0xc086232bdd7abcd2,0x001000000000007c,1
+np.float64,0xc086232bdd7abcd3,0x000ffffffffffe7c,1
+np.float64,0xc086232be0000000,0x000ffffaf57a6fc9,1
+np.float64,0xc086233920000000,0x000fe590e3b45eb0,1
+np.float64,0xc086233938000000,0x000fe56133493c57,1
+np.float64,0xc086233940000000,0x000fe5514deffbbc,1
+np.float64,0xc086234c98000000,0x000fbf1024c32ccb,1
+np.float64,0xc086234ca0000000,0x000fbf0065bae78d,1
+np.float64,0xc086234c80000000,0x000fbf3f623a7724,1
+np.float64,0xc086234ec0000000,0x000fbad237c846f9,1
+np.float64,0xc086234ec8000000,0x000fbac27cfdec97,1
+np.float64,0xc086234ee0000000,0x000fba934cfd3dc2,1
+np.float64,0xc086234ef0000000,0x000fba73d7f618d9,1
+np.float64,0xc086234f00000000,0x000fba54632dddc0,1
+np.float64,0xc0862356e0000000,0x000faae0945b761a,1
+np.float64,0xc0862356f0000000,0x000faac13eb9a310,1
+np.float64,0xc086235700000000,0x000faaa1e9567b0a,1
+np.float64,0xc086236020000000,0x000f98cd75c11ed7,1
+np.float64,0xc086236ca0000000,0x000f8081b4d93f89,1
+np.float64,0xc086236cb0000000,0x000f8062b3f4d6c5,1
+np.float64,0xc086236cc0000000,0x000f8043b34e6f8c,1
+np.float64,0xc086238d98000000,0x000f41220d9b0d2c,1
+np.float64,0xc086238da0000000,0x000f4112cc80a01f,1
+np.float64,0xc086238d80000000,0x000f414fd145db5b,1
+np.float64,0xc08624fd00000000,0x000cbfce8ea1e6c4,1
+np.float64,0xc086256080000000,0x000c250747fcd46e,1
+np.float64,0xc08626c480000000,0x000a34f4bd975193,1
+np.float64,0xbf50000000000000,0x3feff800ffeaac00,1
+np.float64,0xbe10000000000000,0x3fefffffff800000,1
+np.float64,0xbcd0000000000000,0x3feffffffffffff8,1
+np.float64,0xc055d589e0000000,0x38100004bf94f63e,1
+np.float64,0xc055d58a00000000,0x380ffff97f292ce8,1
+np.float64,0xbfd962d900000000,0x3fe585a4b00110e1,1
+np.float64,0x3ff4bed280000000,0x400d411e7a58a303,1
+np.float64,0x3fff0b3620000000,0x401bd7737ffffcf3,1
+np.float64,0x3ff0000000000000,0x4005bf0a8b145769,1
+np.float64,0x3eb0000000000000,0x3ff0000100000800,1
+np.float64,0x3d70000000000000,0x3ff0000000001000,1
+np.float64,0x40862e42e0000000,0x7fefff841808287f,1
+np.float64,0x40862e42fefa39ef,0x7fefffffffffff2a,1
+np.float64,0x40862e0000000000,0x7feef85a11e73f2d,1
+np.float64,0x4000000000000000,0x401d8e64b8d4ddae,1
+np.float64,0x4009242920000000,0x40372a52c383a488,1
+np.float64,0x4049000000000000,0x44719103e4080b45,1
+np.float64,0x4008000000000000,0x403415e5bf6fb106,1
+np.float64,0x3f50000000000000,0x3ff00400800aab55,1
+np.float64,0x3e10000000000000,0x3ff0000000400000,1
+np.float64,0x3cd0000000000000,0x3ff0000000000004,1
+np.float64,0x40562e40a0000000,0x47effed088821c3f,1
+np.float64,0x40562e42e0000000,0x47effff082e6c7ff,1
+np.float64,0x40562e4300000000,0x47f00000417184b8,1
+np.float64,0x3fe8000000000000,0x4000ef9db467dcf8,1
+np.float64,0x402b12e8d4f33589,0x412718f68c71a6fe,1
+np.float64,0x402b12e8d4f3358a,0x412718f68c71a70a,1
+np.float64,0x402b12e8c0000000,0x412718f59a7f472e,1
+np.float64,0x402b12e8e0000000,0x412718f70c0eac62,1
+##use 1th entry
+np.float64,0x40631659AE147CB4,0x4db3a95025a4890f,1
+np.float64,0xC061B87D2E85A4E2,0x332640c8e2de2c51,1
+np.float64,0x405A4A50BE243AF4,0x496a45e4b7f0339a,1
+np.float64,0xC0839898B98EC5C6,0x0764027828830df4,1
+#use 2th entry
+np.float64,0xC072428C44B6537C,0x2596ade838b96f3e,1
+np.float64,0xC053057C5E1AE9BF,0x3912c8fad18fdadf,1
+np.float64,0x407E89C78328BAA3,0x6bfe35d5b9a1a194,1
+np.float64,0x4083501B6DD87112,0x77a855503a38924e,1
+#use 3th entry
+np.float64,0x40832C6195F24540,0x7741e73c80e5eb2f,1
+np.float64,0xC083D4CD557C2EC9,0x06b61727c2d2508e,1
+np.float64,0x400C48F5F67C99BD,0x404128820f02b92e,1
+np.float64,0x4056E36D9B2DF26A,0x4830f52ff34a8242,1
+#use 4th entry
+np.float64,0x4080FF700D8CBD06,0x70fa70df9bc30f20,1
+np.float64,0x406C276D39E53328,0x543eb8e20a8f4741,1
+np.float64,0xC070D6159BBD8716,0x27a4a0548c904a75,1
+np.float64,0xC052EBCF8ED61F83,0x391c0e92368d15e4,1
+#use 5th entry
+np.float64,0xC061F892A8AC5FBE,0x32f807a89efd3869,1
+np.float64,0x4021D885D2DBA085,0x40bd4dc86d3e3270,1
+np.float64,0x40767AEEEE7D4FCF,0x605e22851ee2afb7,1
+np.float64,0xC0757C5D75D08C80,0x20f0751599b992a2,1
+#use 6th entry
+np.float64,0x405ACF7A284C4CE3,0x499a4e0b7a27027c,1
+np.float64,0xC085A6C9E80D7AF5,0x0175914009d62ec2,1
+np.float64,0xC07E4C02F86F1DAE,0x1439269b29a9231e,1
+np.float64,0x4080D80F9691CC87,0x7088a6cdafb041de,1
+#use 7th entry
+np.float64,0x407FDFD84FBA0AC1,0x6deb1ae6f9bc4767,1
+np.float64,0x40630C06A1A2213D,0x4dac7a9d51a838b7,1
+np.float64,0x40685FDB30BB8B4F,0x5183f5cc2cac9e79,1
+np.float64,0x408045A2208F77F4,0x6ee299e08e2aa2f0,1
+#use 8th entry
+np.float64,0xC08104E391F5078B,0x0ed397b7cbfbd230,1
+np.float64,0xC031501CAEFAE395,0x3e6040fd1ea35085,1
+np.float64,0xC079229124F6247C,0x1babf4f923306b1e,1
+np.float64,0x407FB65F44600435,0x6db03beaf2512b8a,1
+#use 9th entry
+np.float64,0xC07EDEE8E8E8A5AC,0x136536cec9cbef48,1
+np.float64,0x4072BB4086099A14,0x5af4d3c3008b56cc,1
+np.float64,0x4050442A2EC42CB4,0x45cd393bd8fad357,1
+np.float64,0xC06AC28FB3D419B4,0x2ca1b9d3437df85f,1
+#use 10th entry
+np.float64,0x40567FC6F0A68076,0x480c977fd5f3122e,1
+np.float64,0x40620A2F7EDA59BB,0x4cf278e96f4ce4d7,1
+np.float64,0xC085044707CD557C,0x034aad6c968a045a,1
+np.float64,0xC07374EA5AC516AA,0x23dd6afdc03e83d5,1
+#use 11th entry
+np.float64,0x4073CC95332619C1,0x5c804b1498bbaa54,1
+np.float64,0xC0799FEBBE257F31,0x1af6a954c43b87d2,1
+np.float64,0x408159F19EA424F6,0x7200858efcbfc84d,1
+np.float64,0x404A81F6F24C0792,0x44b664a07ce5bbfa,1
+#use 12th entry
+np.float64,0x40295FF1EFB9A741,0x4113c0e74c52d7b0,1
+np.float64,0x4073975F4CC411DA,0x5c32be40b4fec2c1,1
+np.float64,0x406E9DE52E82A77E,0x56049c9a3f1ae089,1
+np.float64,0x40748C2F52560ED9,0x5d93bc14fd4cd23b,1
+#use 13th entry
+np.float64,0x4062A553CDC4D04C,0x4d6266bfde301318,1
+np.float64,0xC079EC1D63598AB7,0x1a88cb184dab224c,1
+np.float64,0xC0725C1CB3167427,0x25725b46f8a081f6,1
+np.float64,0x407888771D9B45F9,0x6353b1ec6bd7ce80,1
+#use 14th entry
+np.float64,0xC082CBA03AA89807,0x09b383723831ce56,1
+np.float64,0xC083A8961BB67DD7,0x0735b118d5275552,1
+np.float64,0xC076BC6ECA12E7E3,0x1f2222679eaef615,1
+np.float64,0xC072752503AA1A5B,0x254eb832242c77e1,1
+#use 15th entry
+np.float64,0xC058800792125DEC,0x371882372a0b48d4,1
+np.float64,0x4082909FD863E81C,0x7580d5f386920142,1
+np.float64,0xC071616F8FB534F9,0x26dbe20ef64a412b,1
+np.float64,0x406D1AB571CAA747,0x54ee0d55cb38ac20,1
+#use 16th entry
+np.float64,0x406956428B7DAD09,0x52358682c271237f,1
+np.float64,0xC07EFC2D9D17B621,0x133b3e77c27a4d45,1
+np.float64,0xC08469BAC5BA3CCA,0x050863e5f42cc52f,1
+np.float64,0x407189D9626386A5,0x593cb1c0b3b5c1d3,1
+#use 17th entry
+np.float64,0x4077E652E3DEB8C6,0x6269a10dcbd3c752,1
+np.float64,0x407674C97DB06878,0x605485dcc2426ec2,1
+np.float64,0xC07CE9969CF4268D,0x16386cf8996669f2,1
+np.float64,0x40780EE32D5847C4,0x62a436bd1abe108d,1
+#use 18th entry
+np.float64,0x4076C3AA5E1E8DA1,0x60c62f56a5e72e24,1
+np.float64,0xC0730AFC7239B9BE,0x24758ead095cec1e,1
+np.float64,0xC085CC2B9C420DDB,0x0109cdaa2e5694c1,1
+np.float64,0x406D0765CB6D7AA4,0x54e06f8dd91bd945,1
+#use 19th entry
+np.float64,0xC082D011F3B495E7,0x09a6647661d279c2,1
+np.float64,0xC072826AF8F6AFBC,0x253acd3cd224507e,1
+np.float64,0x404EB9C4810CEA09,0x457933dbf07e8133,1
+np.float64,0x408284FBC97C58CE,0x755f6eb234aa4b98,1
+#use 20th entry
+np.float64,0x40856008CF6EDC63,0x7d9c0b3c03f4f73c,1
+np.float64,0xC077CB2E9F013B17,0x1d9b3d3a166a55db,1
+np.float64,0xC0479CA3C20AD057,0x3bad40e081555b99,1
+np.float64,0x40844CD31107332A,0x7a821d70aea478e2,1
+#use 21th entry
+np.float64,0xC07C8FCC0BFCC844,0x16ba1cc8c539d19b,1
+np.float64,0xC085C4E9A3ABA488,0x011ff675ba1a2217,1
+np.float64,0x4074D538B32966E5,0x5dfd9d78043c6ad9,1
+np.float64,0xC0630CA16902AD46,0x3231a446074cede6,1
+#use 22th entry
+np.float64,0xC06C826733D7D0B7,0x2b5f1078314d41e1,1
+np.float64,0xC0520DF55B2B907F,0x396c13a6ce8e833e,1
+np.float64,0xC080712072B0F437,0x107eae02d11d98ea,1
+np.float64,0x40528A6150E19EFB,0x469fdabda02228c5,1
+#use 23th entry
+np.float64,0xC07B1D74B6586451,0x18d1253883ae3b48,1
+np.float64,0x4045AFD7867DAEC0,0x43d7d634fc4c5d98,1
+np.float64,0xC07A08B91F9ED3E2,0x1a60973e6397fc37,1
+np.float64,0x407B3ECF0AE21C8C,0x673e03e9d98d7235,1
+#use 24th entry
+np.float64,0xC078AEB6F30CEABF,0x1c530b93ab54a1b3,1
+np.float64,0x4084495006A41672,0x7a775b6dc7e63064,1
+np.float64,0x40830B1C0EBF95DD,0x76e1e6eed77cfb89,1
+np.float64,0x407D93E8F33D8470,0x6a9adbc9e1e4f1e5,1
+#use 25th entry
+np.float64,0x4066B11A09EFD9E8,0x504dd528065c28a7,1
+np.float64,0x408545823723AEEB,0x7d504a9b1844f594,1
+np.float64,0xC068C711F2CA3362,0x2e104f3496ea118e,1
+np.float64,0x407F317FCC3CA873,0x6cf0732c9948ebf4,1
+#use 26th entry
+np.float64,0x407AFB3EBA2ED50F,0x66dc28a129c868d5,1
+np.float64,0xC075377037708ADE,0x21531a329f3d793e,1
+np.float64,0xC07C30066A1F3246,0x174448baa16ded2b,1
+np.float64,0xC06689A75DE2ABD3,0x2fad70662fae230b,1
+#use 27th entry
+np.float64,0x4081514E9FCCF1E0,0x71e673b9efd15f44,1
+np.float64,0xC0762C710AF68460,0x1ff1ed7d8947fe43,1
+np.float64,0xC0468102FF70D9C4,0x3be0c3a8ff3419a3,1
+np.float64,0xC07EA4CEEF02A83E,0x13b908f085102c61,1
+#use 28th entry
+np.float64,0xC06290B04AE823C4,0x328a83da3c2e3351,1
+np.float64,0xC0770EB1D1C395FB,0x1eab281c1f1db5fe,1
+np.float64,0xC06F5D4D838A5BAE,0x29500ea32fb474ea,1
+np.float64,0x40723B3133B54C5D,0x5a3c82c7c3a2b848,1
+#use 29th entry
+np.float64,0x4085E6454CE3B4AA,0x7f20319b9638d06a,1
+np.float64,0x408389F2A0585D4B,0x7850667c58aab3d0,1
+np.float64,0xC0382798F9C8AE69,0x3dc1c79fe8739d6d,1
+np.float64,0xC08299D827608418,0x0a4335f76cdbaeb5,1
+#use 30th entry
+np.float64,0xC06F3DED43301BF1,0x2965670ae46750a8,1
+np.float64,0xC070CAF6BDD577D9,0x27b4aa4ffdd29981,1
+np.float64,0x4078529AD4B2D9F2,0x6305c12755d5e0a6,1
+np.float64,0xC055B14E75A31B96,0x381c2eda6d111e5d,1
+#use 31th entry
+np.float64,0x407B13EE414FA931,0x6700772c7544564d,1
+np.float64,0x407EAFDE9DE3EC54,0x6c346a0e49724a3c,1
+np.float64,0xC08362F398B9530D,0x07ffeddbadf980cb,1
+np.float64,0x407E865CDD9EEB86,0x6bf866cac5e0d126,1
+#use 32th entry
+np.float64,0x407FB62DBC794C86,0x6db009f708ac62cb,1
+np.float64,0xC063D0BAA68CDDDE,0x31a3b2a51ce50430,1
+np.float64,0xC05E7706A2231394,0x34f24bead6fab5c9,1
+np.float64,0x4083E3A06FDE444E,0x79527b7a386d1937,1

venv/Lib/site-packages/numpy/core/tests/data/umath-validation-set-log

@@ -0,0 +1,118 @@
+dtype,input,output,ulperrortol
+## +ve denormals ##
+np.float32,0x004b4716,0xc2afbc1b,4
+np.float32,0x007b2490,0xc2aec01e,4
+np.float32,0x007c99fa,0xc2aeba17,4
+np.float32,0x00734a0c,0xc2aee1dc,4
+np.float32,0x0070de24,0xc2aeecba,4
+np.float32,0x007fffff,0xc2aeac50,4
+np.float32,0x00000001,0xc2ce8ed0,4
+## -ve denormals ##
+np.float32,0x80495d65,0xffc00000,4
+np.float32,0x806894f6,0xffc00000,4
+np.float32,0x80555a76,0xffc00000,4
+np.float32,0x804e1fb8,0xffc00000,4
+np.float32,0x80687de9,0xffc00000,4
+np.float32,0x807fffff,0xffc00000,4
+np.float32,0x80000001,0xffc00000,4
+## +/-0.0f, +/-FLT_MIN +/-FLT_MAX ##
+np.float32,0x00000000,0xff800000,4
+np.float32,0x80000000,0xff800000,4
+np.float32,0x7f7fffff,0x42b17218,4
+np.float32,0x80800000,0xffc00000,4
+np.float32,0xff7fffff,0xffc00000,4
+## 1.00f + 0x00000001 ##
+np.float32,0x3f800000,0x00000000,4
+np.float32,0x3f800001,0x33ffffff,4
+np.float32,0x3f800002,0x347ffffe,4
+np.float32,0x3f7fffff,0xb3800000,4
+np.float32,0x3f7ffffe,0xb4000000,4
+np.float32,0x3f7ffffd,0xb4400001,4
+np.float32,0x402df853,0x3f7ffffe,4
+np.float32,0x402df854,0x3f7fffff,4
+np.float32,0x402df855,0x3f800000,4
+np.float32,0x402df856,0x3f800001,4
+np.float32,0x3ebc5ab0,0xbf800001,4
+np.float32,0x3ebc5ab1,0xbf800000,4
+np.float32,0x3ebc5ab2,0xbf800000,4
+np.float32,0x3ebc5ab3,0xbf7ffffe,4
+np.float32,0x423ef575,0x407768ab,4
+np.float32,0x427b8c61,0x408485dd,4
+np.float32,0x4211e9ee,0x406630b0,4
+np.float32,0x424d5c41,0x407c0fed,4
+np.float32,0x42be722a,0x4091cc91,4
+np.float32,0x42b73d30,0x4090908b,4
+np.float32,0x427e48e2,0x4084de7f,4
+np.float32,0x428f759b,0x4088bba3,4
+np.float32,0x41629069,0x4029a0cc,4
+np.float32,0x4272c99d,0x40836379,4
+np.float32,0x4d1b7458,0x4197463d,4
+np.float32,0x4f10c594,0x41ace2b2,4
+np.float32,0x4ea397c2,0x41a85171,4
+np.float32,0x4fefa9d1,0x41b6769c,4
+np.float32,0x4ebac6ab,0x41a960dc,4
+np.float32,0x4f6efb42,0x41b0e535,4
+np.float32,0x4e9ab8e7,0x41a7df44,4
+np.float32,0x4e81b5d1,0x41a67625,4
+np.float32,0x5014d9f2,0x41b832bd,4
+np.float32,0x4f02175c,0x41ac07b8,4
+np.float32,0x7f034f89,0x42b01c47,4
+np.float32,0x7f56d00e,0x42b11849,4
+np.float32,0x7f1cd5f6,0x42b0773a,4
+np.float32,0x7e979174,0x42af02d7,4
+np.float32,0x7f23369f,0x42b08ba2,4
+np.float32,0x7f0637ae,0x42b0277d,4
+np.float32,0x7efcb6e8,0x42b00897,4
+np.float32,0x7f7907c8,0x42b163f6,4
+np.float32,0x7e95c4c2,0x42aefcba,4
+np.float32,0x7f4577b2,0x42b0ed2d,4
+np.float32,0x3f49c92e,0xbe73ae84,4
+np.float32,0x3f4a23d1,0xbe71e2f8,4
+np.float32,0x3f4abb67,0xbe6ee430,4
+np.float32,0x3f48169a,0xbe7c5532,4
+np.float32,0x3f47f5fa,0xbe7cfc37,4
+np.float32,0x3f488309,0xbe7a2ad8,4
+np.float32,0x3f479df4,0xbe7ebf5f,4
+np.float32,0x3f47cfff,0xbe7dbec9,4
+np.float32,0x3f496704,0xbe75a125,4
+np.float32,0x3f478ee8,0xbe7f0c92,4
+np.float32,0x3f4a763b,0xbe7041ce,4
+np.float32,0x3f47a108,0xbe7eaf94,4
+np.float32,0x3f48136c,0xbe7c6578,4
+np.float32,0x3f481c17,0xbe7c391c,4
+np.float32,0x3f47cd28,0xbe7dcd56,4
+np.float32,0x3f478be8,0xbe7f1bf7,4
+np.float32,0x3f4c1f8e,0xbe67e367,4
+np.float32,0x3f489b0c,0xbe79b03f,4
+np.float32,0x3f4934cf,0xbe76a08a,4
+np.float32,0x3f4954df,0xbe75fd6a,4
+np.float32,0x3f47a3f5,0xbe7ea093,4
+np.float32,0x3f4ba4fc,0xbe6a4b02,4
+np.float32,0x3f47a0e1,0xbe7eb05c,4
+np.float32,0x3f48c30a,0xbe78e42f,4
+np.float32,0x3f48cab8,0xbe78bd05,4
+np.float32,0x3f4b0569,0xbe6d6ea4,4
+np.float32,0x3f47de32,0xbe7d7607,4
+np.float32,0x3f477328,0xbe7f9b00,4
+np.float32,0x3f496dab,0xbe757f52,4
+np.float32,0x3f47662c,0xbe7fddac,4
+np.float32,0x3f48ddd8,0xbe785b80,4
+np.float32,0x3f481866,0xbe7c4bff,4
+np.float32,0x3f48b119,0xbe793fb6,4
+np.float32,0x3f48c7e8,0xbe78cb5c,4
+np.float32,0x3f4985f6,0xbe7503da,4
+np.float32,0x3f483fdf,0xbe7b8212,4
+np.float32,0x3f4b1c76,0xbe6cfa67,4
+np.float32,0x3f480b2e,0xbe7c8fa8,4
+np.float32,0x3f48745f,0xbe7a75bf,4
+np.float32,0x3f485bda,0xbe7af308,4
+np.float32,0x3f47a660,0xbe7e942c,4
+np.float32,0x3f47d4d5,0xbe7da600,4
+np.float32,0x3f4b0a26,0xbe6d56be,4
+np.float32,0x3f4a4883,0xbe712924,4
+np.float32,0x3f4769e7,0xbe7fca84,4
+np.float32,0x3f499702,0xbe74ad3f,4
+np.float32,0x3f494ab1,0xbe763131,4
+np.float32,0x3f476b69,0xbe7fc2c6,4
+np.float32,0x3f4884e8,0xbe7a214a,4
+np.float32,0x3f486945,0xbe7aae76,4

venv/Lib/site-packages/numpy/core/tests/data/umath-validation-set-sin

@@ -0,0 +1,660 @@
+dtype,input,output,ulperrortol
+## +ve denormals ##
+np.float32,0x004b4716,0x004b4716,2
+np.float32,0x007b2490,0x007b2490,2
+np.float32,0x007c99fa,0x007c99fa,2
+np.float32,0x00734a0c,0x00734a0c,2
+np.float32,0x0070de24,0x0070de24,2
+np.float32,0x007fffff,0x007fffff,2
+np.float32,0x00000001,0x00000001,2
+## -ve denormals ##
+np.float32,0x80495d65,0x80495d65,2
+np.float32,0x806894f6,0x806894f6,2
+np.float32,0x80555a76,0x80555a76,2
+np.float32,0x804e1fb8,0x804e1fb8,2
+np.float32,0x80687de9,0x80687de9,2
+np.float32,0x807fffff,0x807fffff,2
+np.float32,0x80000001,0x80000001,2
+## +/-0.0f, +/-FLT_MIN +/-FLT_MAX ##
+np.float32,0x00000000,0x00000000,2
+np.float32,0x80000000,0x80000000,2
+np.float32,0x00800000,0x00800000,2
+np.float32,0x80800000,0x80800000,2
+## 1.00f ##
+np.float32,0x3f800000,0x3f576aa4,2
+np.float32,0x3f800001,0x3f576aa6,2
+np.float32,0x3f800002,0x3f576aa7,2
+np.float32,0xc090a8b0,0x3f7b4e48,2
+np.float32,0x41ce3184,0x3f192d43,2
+np.float32,0xc1d85848,0xbf7161cb,2
+np.float32,0x402b8820,0x3ee3f29f,2
+np.float32,0x42b4e454,0x3f1d0151,2
+np.float32,0x42a67a60,0x3f7ffa4c,2
+np.float32,0x41d92388,0x3f67beef,2
+np.float32,0x422dd66c,0xbeffb0c1,2
+np.float32,0xc28f5be6,0xbf0bae79,2
+np.float32,0x41ab2674,0x3f0ffe2b,2
+np.float32,0x3f490fdb,0x3f3504f3,2
+np.float32,0xbf490fdb,0xbf3504f3,2
+np.float32,0x3fc90fdb,0x3f800000,2
+np.float32,0xbfc90fdb,0xbf800000,2
+np.float32,0x40490fdb,0xb3bbbd2e,2
+np.float32,0xc0490fdb,0x33bbbd2e,2
+np.float32,0x3fc90fdb,0x3f800000,2
+np.float32,0xbfc90fdb,0xbf800000,2
+np.float32,0x40490fdb,0xb3bbbd2e,2
+np.float32,0xc0490fdb,0x33bbbd2e,2
+np.float32,0x40c90fdb,0x343bbd2e,2
+np.float32,0xc0c90fdb,0xb43bbd2e,2
+np.float32,0x4016cbe4,0x3f3504f3,2
+np.float32,0xc016cbe4,0xbf3504f3,2
+np.float32,0x4096cbe4,0xbf800000,2
+np.float32,0xc096cbe4,0x3f800000,2
+np.float32,0x4116cbe4,0xb2ccde2e,2
+np.float32,0xc116cbe4,0x32ccde2e,2
+np.float32,0x40490fdb,0xb3bbbd2e,2
+np.float32,0xc0490fdb,0x33bbbd2e,2
+np.float32,0x40c90fdb,0x343bbd2e,2
+np.float32,0xc0c90fdb,0xb43bbd2e,2
+np.float32,0x41490fdb,0x34bbbd2e,2
+np.float32,0xc1490fdb,0xb4bbbd2e,2
+np.float32,0x407b53d2,0xbf3504f5,2
+np.float32,0xc07b53d2,0x3f3504f5,2
+np.float32,0x40fb53d2,0x3f800000,2
+np.float32,0xc0fb53d2,0xbf800000,2
+np.float32,0x417b53d2,0xb535563d,2
+np.float32,0xc17b53d2,0x3535563d,2
+np.float32,0x4096cbe4,0xbf800000,2
+np.float32,0xc096cbe4,0x3f800000,2
+np.float32,0x4116cbe4,0xb2ccde2e,2
+np.float32,0xc116cbe4,0x32ccde2e,2
+np.float32,0x4196cbe4,0x334cde2e,2
+np.float32,0xc196cbe4,0xb34cde2e,2
+np.float32,0x40afede0,0xbf3504ef,2
+np.float32,0xc0afede0,0x3f3504ef,2
+np.float32,0x412fede0,0xbf800000,2
+np.float32,0xc12fede0,0x3f800000,2
+np.float32,0x41afede0,0xb5b222c4,2
+np.float32,0xc1afede0,0x35b222c4,2
+np.float32,0x40c90fdb,0x343bbd2e,2
+np.float32,0xc0c90fdb,0xb43bbd2e,2
+np.float32,0x41490fdb,0x34bbbd2e,2
+np.float32,0xc1490fdb,0xb4bbbd2e,2
+np.float32,0x41c90fdb,0x353bbd2e,2
+np.float32,0xc1c90fdb,0xb53bbd2e,2
+np.float32,0x40e231d6,0x3f3504f3,2
+np.float32,0xc0e231d6,0xbf3504f3,2
+np.float32,0x416231d6,0x3f800000,2
+np.float32,0xc16231d6,0xbf800000,2
+np.float32,0x41e231d6,0xb399a6a2,2
+np.float32,0xc1e231d6,0x3399a6a2,2
+np.float32,0x40fb53d2,0x3f800000,2
+np.float32,0xc0fb53d2,0xbf800000,2
+np.float32,0x417b53d2,0xb535563d,2
+np.float32,0xc17b53d2,0x3535563d,2
+np.float32,0x41fb53d2,0x35b5563d,2
+np.float32,0xc1fb53d2,0xb5b5563d,2
+np.float32,0x410a3ae7,0x3f3504eb,2
+np.float32,0xc10a3ae7,0xbf3504eb,2
+np.float32,0x418a3ae7,0xbf800000,2
+np.float32,0xc18a3ae7,0x3f800000,2
+np.float32,0x420a3ae7,0xb6308908,2
+np.float32,0xc20a3ae7,0x36308908,2
+np.float32,0x4116cbe4,0xb2ccde2e,2
+np.float32,0xc116cbe4,0x32ccde2e,2
+np.float32,0x4196cbe4,0x334cde2e,2
+np.float32,0xc196cbe4,0xb34cde2e,2
+np.float32,0x4216cbe4,0x33ccde2e,2
+np.float32,0xc216cbe4,0xb3ccde2e,2
+np.float32,0x41235ce2,0xbf3504f7,2
+np.float32,0xc1235ce2,0x3f3504f7,2
+np.float32,0x41a35ce2,0x3f800000,2
+np.float32,0xc1a35ce2,0xbf800000,2
+np.float32,0x42235ce2,0xb5b889b6,2
+np.float32,0xc2235ce2,0x35b889b6,2
+np.float32,0x412fede0,0xbf800000,2
+np.float32,0xc12fede0,0x3f800000,2
+np.float32,0x41afede0,0xb5b222c4,2
+np.float32,0xc1afede0,0x35b222c4,2
+np.float32,0x422fede0,0x363222c4,2
+np.float32,0xc22fede0,0xb63222c4,2
+np.float32,0x413c7edd,0xbf3504f3,2
+np.float32,0xc13c7edd,0x3f3504f3,2
+np.float32,0x41bc7edd,0xbf800000,2
+np.float32,0xc1bc7edd,0x3f800000,2
+np.float32,0x423c7edd,0xb4000add,2
+np.float32,0xc23c7edd,0x34000add,2
+np.float32,0x41490fdb,0x34bbbd2e,2
+np.float32,0xc1490fdb,0xb4bbbd2e,2
+np.float32,0x41c90fdb,0x353bbd2e,2
+np.float32,0xc1c90fdb,0xb53bbd2e,2
+np.float32,0x42490fdb,0x35bbbd2e,2
+np.float32,0xc2490fdb,0xb5bbbd2e,2
+np.float32,0x4155a0d9,0x3f3504fb,2
+np.float32,0xc155a0d9,0xbf3504fb,2
+np.float32,0x41d5a0d9,0x3f800000,2
+np.float32,0xc1d5a0d9,0xbf800000,2
+np.float32,0x4255a0d9,0xb633bc81,2
+np.float32,0xc255a0d9,0x3633bc81,2
+np.float32,0x416231d6,0x3f800000,2
+np.float32,0xc16231d6,0xbf800000,2
+np.float32,0x41e231d6,0xb399a6a2,2
+np.float32,0xc1e231d6,0x3399a6a2,2
+np.float32,0x426231d6,0x3419a6a2,2
+np.float32,0xc26231d6,0xb419a6a2,2
+np.float32,0x416ec2d4,0x3f3504ef,2
+np.float32,0xc16ec2d4,0xbf3504ef,2
+np.float32,0x41eec2d4,0xbf800000,2
+np.float32,0xc1eec2d4,0x3f800000,2
+np.float32,0x426ec2d4,0xb5bef0a7,2
+np.float32,0xc26ec2d4,0x35bef0a7,2
+np.float32,0x417b53d2,0xb535563d,2
+np.float32,0xc17b53d2,0x3535563d,2
+np.float32,0x41fb53d2,0x35b5563d,2
+np.float32,0xc1fb53d2,0xb5b5563d,2
+np.float32,0x427b53d2,0x3635563d,2
+np.float32,0xc27b53d2,0xb635563d,2
+np.float32,0x4183f268,0xbf3504ff,2
+np.float32,0xc183f268,0x3f3504ff,2
+np.float32,0x4203f268,0x3f800000,2
+np.float32,0xc203f268,0xbf800000,2
+np.float32,0x4283f268,0xb6859a13,2
+np.float32,0xc283f268,0x36859a13,2
+np.float32,0x418a3ae7,0xbf800000,2
+np.float32,0xc18a3ae7,0x3f800000,2
+np.float32,0x420a3ae7,0xb6308908,2
+np.float32,0xc20a3ae7,0x36308908,2
+np.float32,0x428a3ae7,0x36b08908,2
+np.float32,0xc28a3ae7,0xb6b08908,2
+np.float32,0x41908365,0xbf3504f6,2
+np.float32,0xc1908365,0x3f3504f6,2
+np.float32,0x42108365,0xbf800000,2
+np.float32,0xc2108365,0x3f800000,2
+np.float32,0x42908365,0x3592200d,2
+np.float32,0xc2908365,0xb592200d,2
+np.float32,0x4196cbe4,0x334cde2e,2
+np.float32,0xc196cbe4,0xb34cde2e,2
+np.float32,0x4216cbe4,0x33ccde2e,2
+np.float32,0xc216cbe4,0xb3ccde2e,2
+np.float32,0x4296cbe4,0x344cde2e,2
+np.float32,0xc296cbe4,0xb44cde2e,2
+np.float32,0x419d1463,0x3f3504f8,2
+np.float32,0xc19d1463,0xbf3504f8,2
+np.float32,0x421d1463,0x3f800000,2
+np.float32,0xc21d1463,0xbf800000,2
+np.float32,0x429d1463,0xb5c55799,2
+np.float32,0xc29d1463,0x35c55799,2
+np.float32,0x41a35ce2,0x3f800000,2
+np.float32,0xc1a35ce2,0xbf800000,2
+np.float32,0x42235ce2,0xb5b889b6,2
+np.float32,0xc2235ce2,0x35b889b6,2
+np.float32,0x42a35ce2,0x363889b6,2
+np.float32,0xc2a35ce2,0xb63889b6,2
+np.float32,0x41a9a561,0x3f3504e7,2
+np.float32,0xc1a9a561,0xbf3504e7,2
+np.float32,0x4229a561,0xbf800000,2
+np.float32,0xc229a561,0x3f800000,2
+np.float32,0x42a9a561,0xb68733d0,2
+np.float32,0xc2a9a561,0x368733d0,2
+np.float32,0x41afede0,0xb5b222c4,2
+np.float32,0xc1afede0,0x35b222c4,2
+np.float32,0x422fede0,0x363222c4,2
+np.float32,0xc22fede0,0xb63222c4,2
+np.float32,0x42afede0,0x36b222c4,2
+np.float32,0xc2afede0,0xb6b222c4,2
+np.float32,0x41b6365e,0xbf3504f0,2
+np.float32,0xc1b6365e,0x3f3504f0,2
+np.float32,0x4236365e,0x3f800000,2
+np.float32,0xc236365e,0xbf800000,2
+np.float32,0x42b6365e,0x358bb91c,2
+np.float32,0xc2b6365e,0xb58bb91c,2
+np.float32,0x41bc7edd,0xbf800000,2
+np.float32,0xc1bc7edd,0x3f800000,2
+np.float32,0x423c7edd,0xb4000add,2
+np.float32,0xc23c7edd,0x34000add,2
+np.float32,0x42bc7edd,0x34800add,2
+np.float32,0xc2bc7edd,0xb4800add,2
+np.float32,0x41c2c75c,0xbf3504ef,2
+np.float32,0xc1c2c75c,0x3f3504ef,2
+np.float32,0x4242c75c,0xbf800000,2
+np.float32,0xc242c75c,0x3f800000,2
+np.float32,0x42c2c75c,0xb5cbbe8a,2
+np.float32,0xc2c2c75c,0x35cbbe8a,2
+np.float32,0x41c90fdb,0x353bbd2e,2
+np.float32,0xc1c90fdb,0xb53bbd2e,2
+np.float32,0x42490fdb,0x35bbbd2e,2
+np.float32,0xc2490fdb,0xb5bbbd2e,2
+np.float32,0x42c90fdb,0x363bbd2e,2
+np.float32,0xc2c90fdb,0xb63bbd2e,2
+np.float32,0x41cf585a,0x3f3504ff,2
+np.float32,0xc1cf585a,0xbf3504ff,2
+np.float32,0x424f585a,0x3f800000,2
+np.float32,0xc24f585a,0xbf800000,2
+np.float32,0x42cf585a,0xb688cd8c,2
+np.float32,0xc2cf585a,0x3688cd8c,2
+np.float32,0x41d5a0d9,0x3f800000,2
+np.float32,0xc1d5a0d9,0xbf800000,2
+np.float32,0x4255a0d9,0xb633bc81,2
+np.float32,0xc255a0d9,0x3633bc81,2
+np.float32,0x42d5a0d9,0x36b3bc81,2
+np.float32,0xc2d5a0d9,0xb6b3bc81,2
+np.float32,0x41dbe958,0x3f3504e0,2
+np.float32,0xc1dbe958,0xbf3504e0,2
+np.float32,0x425be958,0xbf800000,2
+np.float32,0xc25be958,0x3f800000,2
+np.float32,0x42dbe958,0xb6deab75,2
+np.float32,0xc2dbe958,0x36deab75,2
+np.float32,0x41e231d6,0xb399a6a2,2
+np.float32,0xc1e231d6,0x3399a6a2,2
+np.float32,0x426231d6,0x3419a6a2,2
+np.float32,0xc26231d6,0xb419a6a2,2
+np.float32,0x42e231d6,0x3499a6a2,2
+np.float32,0xc2e231d6,0xb499a6a2,2
+np.float32,0x41e87a55,0xbf3504f8,2
+np.float32,0xc1e87a55,0x3f3504f8,2
+np.float32,0x42687a55,0x3f800000,2
+np.float32,0xc2687a55,0xbf800000,2
+np.float32,0x42e87a55,0xb5d2257b,2
+np.float32,0xc2e87a55,0x35d2257b,2
+np.float32,0x41eec2d4,0xbf800000,2
+np.float32,0xc1eec2d4,0x3f800000,2
+np.float32,0x426ec2d4,0xb5bef0a7,2
+np.float32,0xc26ec2d4,0x35bef0a7,2
+np.float32,0x42eec2d4,0x363ef0a7,2
+np.float32,0xc2eec2d4,0xb63ef0a7,2
+np.float32,0x41f50b53,0xbf3504e7,2
+np.float32,0xc1f50b53,0x3f3504e7,2
+np.float32,0x42750b53,0xbf800000,2
+np.float32,0xc2750b53,0x3f800000,2
+np.float32,0x42f50b53,0xb68a6748,2
+np.float32,0xc2f50b53,0x368a6748,2
+np.float32,0x41fb53d2,0x35b5563d,2
+np.float32,0xc1fb53d2,0xb5b5563d,2
+np.float32,0x427b53d2,0x3635563d,2
+np.float32,0xc27b53d2,0xb635563d,2
+np.float32,0x42fb53d2,0x36b5563d,2
+np.float32,0xc2fb53d2,0xb6b5563d,2
+np.float32,0x4200ce28,0x3f3504f0,2
+np.float32,0xc200ce28,0xbf3504f0,2
+np.float32,0x4280ce28,0x3f800000,2
+np.float32,0xc280ce28,0xbf800000,2
+np.float32,0x4300ce28,0x357dd672,2
+np.float32,0xc300ce28,0xb57dd672,2
+np.float32,0x4203f268,0x3f800000,2
+np.float32,0xc203f268,0xbf800000,2
+np.float32,0x4283f268,0xb6859a13,2
+np.float32,0xc283f268,0x36859a13,2
+np.float32,0x4303f268,0x37059a13,2
+np.float32,0xc303f268,0xb7059a13,2
+np.float32,0x420716a7,0x3f3504ee,2
+np.float32,0xc20716a7,0xbf3504ee,2
+np.float32,0x428716a7,0xbf800000,2
+np.float32,0xc28716a7,0x3f800000,2
+np.float32,0x430716a7,0xb5d88c6d,2
+np.float32,0xc30716a7,0x35d88c6d,2
+np.float32,0x420a3ae7,0xb6308908,2
+np.float32,0xc20a3ae7,0x36308908,2
+np.float32,0x428a3ae7,0x36b08908,2
+np.float32,0xc28a3ae7,0xb6b08908,2
+np.float32,0x430a3ae7,0x37308908,2
+np.float32,0xc30a3ae7,0xb7308908,2
+np.float32,0x420d5f26,0xbf350500,2
+np.float32,0xc20d5f26,0x3f350500,2
+np.float32,0x428d5f26,0x3f800000,2
+np.float32,0xc28d5f26,0xbf800000,2
+np.float32,0x430d5f26,0xb68c0105,2
+np.float32,0xc30d5f26,0x368c0105,2
+np.float32,0x42108365,0xbf800000,2
+np.float32,0xc2108365,0x3f800000,2
+np.float32,0x42908365,0x3592200d,2
+np.float32,0xc2908365,0xb592200d,2
+np.float32,0x43108365,0xb612200d,2
+np.float32,0xc3108365,0x3612200d,2
+np.float32,0x4213a7a5,0xbf3504df,2
+np.float32,0xc213a7a5,0x3f3504df,2
+np.float32,0x4293a7a5,0xbf800000,2
+np.float32,0xc293a7a5,0x3f800000,2
+np.float32,0x4313a7a5,0xb6e1deee,2
+np.float32,0xc313a7a5,0x36e1deee,2
+np.float32,0x4216cbe4,0x33ccde2e,2
+np.float32,0xc216cbe4,0xb3ccde2e,2
+np.float32,0x4296cbe4,0x344cde2e,2
+np.float32,0xc296cbe4,0xb44cde2e,2
+np.float32,0x4316cbe4,0x34ccde2e,2
+np.float32,0xc316cbe4,0xb4ccde2e,2
+np.float32,0x4219f024,0x3f35050f,2
+np.float32,0xc219f024,0xbf35050f,2
+np.float32,0x4299f024,0x3f800000,2
+np.float32,0xc299f024,0xbf800000,2
+np.float32,0x4319f024,0xb71bde6c,2
+np.float32,0xc319f024,0x371bde6c,2
+np.float32,0x421d1463,0x3f800000,2
+np.float32,0xc21d1463,0xbf800000,2
+np.float32,0x429d1463,0xb5c55799,2
+np.float32,0xc29d1463,0x35c55799,2
+np.float32,0x431d1463,0x36455799,2
+np.float32,0xc31d1463,0xb6455799,2
+np.float32,0x422038a3,0x3f3504d0,2
+np.float32,0xc22038a3,0xbf3504d0,2
+np.float32,0x42a038a3,0xbf800000,2
+np.float32,0xc2a038a3,0x3f800000,2
+np.float32,0x432038a3,0xb746cd61,2
+np.float32,0xc32038a3,0x3746cd61,2
+np.float32,0x42235ce2,0xb5b889b6,2
+np.float32,0xc2235ce2,0x35b889b6,2
+np.float32,0x42a35ce2,0x363889b6,2
+np.float32,0xc2a35ce2,0xb63889b6,2
+np.float32,0x43235ce2,0x36b889b6,2
+np.float32,0xc3235ce2,0xb6b889b6,2
+np.float32,0x42268121,0xbf3504f1,2
+np.float32,0xc2268121,0x3f3504f1,2
+np.float32,0x42a68121,0x3f800000,2
+np.float32,0xc2a68121,0xbf800000,2
+np.float32,0x43268121,0x35643aac,2
+np.float32,0xc3268121,0xb5643aac,2
+np.float32,0x4229a561,0xbf800000,2
+np.float32,0xc229a561,0x3f800000,2
+np.float32,0x42a9a561,0xb68733d0,2
+np.float32,0xc2a9a561,0x368733d0,2
+np.float32,0x4329a561,0x370733d0,2
+np.float32,0xc329a561,0xb70733d0,2
+np.float32,0x422cc9a0,0xbf3504ee,2
+np.float32,0xc22cc9a0,0x3f3504ee,2
+np.float32,0x42acc9a0,0xbf800000,2
+np.float32,0xc2acc9a0,0x3f800000,2
+np.float32,0x432cc9a0,0xb5e55a50,2
+np.float32,0xc32cc9a0,0x35e55a50,2
+np.float32,0x422fede0,0x363222c4,2
+np.float32,0xc22fede0,0xb63222c4,2
+np.float32,0x42afede0,0x36b222c4,2
+np.float32,0xc2afede0,0xb6b222c4,2
+np.float32,0x432fede0,0x373222c4,2
+np.float32,0xc32fede0,0xb73222c4,2
+np.float32,0x4233121f,0x3f350500,2
+np.float32,0xc233121f,0xbf350500,2
+np.float32,0x42b3121f,0x3f800000,2
+np.float32,0xc2b3121f,0xbf800000,2
+np.float32,0x4333121f,0xb68f347d,2
+np.float32,0xc333121f,0x368f347d,2
+np.float32,0x4236365e,0x3f800000,2
+np.float32,0xc236365e,0xbf800000,2
+np.float32,0x42b6365e,0x358bb91c,2
+np.float32,0xc2b6365e,0xb58bb91c,2
+np.float32,0x4336365e,0xb60bb91c,2
+np.float32,0xc336365e,0x360bb91c,2
+np.float32,0x42395a9e,0x3f3504df,2
+np.float32,0xc2395a9e,0xbf3504df,2
+np.float32,0x42b95a9e,0xbf800000,2
+np.float32,0xc2b95a9e,0x3f800000,2
+np.float32,0x43395a9e,0xb6e51267,2
+np.float32,0xc3395a9e,0x36e51267,2
+np.float32,0x423c7edd,0xb4000add,2
+np.float32,0xc23c7edd,0x34000add,2
+np.float32,0x42bc7edd,0x34800add,2
+np.float32,0xc2bc7edd,0xb4800add,2
+np.float32,0x433c7edd,0x35000add,2
+np.float32,0xc33c7edd,0xb5000add,2
+np.float32,0x423fa31d,0xbf35050f,2
+np.float32,0xc23fa31d,0x3f35050f,2
+np.float32,0x42bfa31d,0x3f800000,2
+np.float32,0xc2bfa31d,0xbf800000,2
+np.float32,0x433fa31d,0xb71d7828,2
+np.float32,0xc33fa31d,0x371d7828,2
+np.float32,0x4242c75c,0xbf800000,2
+np.float32,0xc242c75c,0x3f800000,2
+np.float32,0x42c2c75c,0xb5cbbe8a,2
+np.float32,0xc2c2c75c,0x35cbbe8a,2
+np.float32,0x4342c75c,0x364bbe8a,2
+np.float32,0xc342c75c,0xb64bbe8a,2
+np.float32,0x4245eb9c,0xbf3504d0,2
+np.float32,0xc245eb9c,0x3f3504d0,2
+np.float32,0x42c5eb9c,0xbf800000,2
+np.float32,0xc2c5eb9c,0x3f800000,2
+np.float32,0x4345eb9c,0xb748671d,2
+np.float32,0xc345eb9c,0x3748671d,2
+np.float32,0x42490fdb,0x35bbbd2e,2
+np.float32,0xc2490fdb,0xb5bbbd2e,2
+np.float32,0x42c90fdb,0x363bbd2e,2
+np.float32,0xc2c90fdb,0xb63bbd2e,2
+np.float32,0x43490fdb,0x36bbbd2e,2
+np.float32,0xc3490fdb,0xb6bbbd2e,2
+np.float32,0x424c341a,0x3f3504f1,2
+np.float32,0xc24c341a,0xbf3504f1,2
+np.float32,0x42cc341a,0x3f800000,2
+np.float32,0xc2cc341a,0xbf800000,2
+np.float32,0x434c341a,0x354a9ee6,2
+np.float32,0xc34c341a,0xb54a9ee6,2
+np.float32,0x424f585a,0x3f800000,2
+np.float32,0xc24f585a,0xbf800000,2
+np.float32,0x42cf585a,0xb688cd8c,2
+np.float32,0xc2cf585a,0x3688cd8c,2
+np.float32,0x434f585a,0x3708cd8c,2
+np.float32,0xc34f585a,0xb708cd8c,2
+np.float32,0x42527c99,0x3f3504ee,2
+np.float32,0xc2527c99,0xbf3504ee,2
+np.float32,0x42d27c99,0xbf800000,2
+np.float32,0xc2d27c99,0x3f800000,2
+np.float32,0x43527c99,0xb5f22833,2
+np.float32,0xc3527c99,0x35f22833,2
+np.float32,0x4255a0d9,0xb633bc81,2
+np.float32,0xc255a0d9,0x3633bc81,2
+np.float32,0x42d5a0d9,0x36b3bc81,2
+np.float32,0xc2d5a0d9,0xb6b3bc81,2
+np.float32,0x4355a0d9,0x3733bc81,2
+np.float32,0xc355a0d9,0xb733bc81,2
+np.float32,0x4258c518,0xbf350500,2
+np.float32,0xc258c518,0x3f350500,2
+np.float32,0x42d8c518,0x3f800000,2
+np.float32,0xc2d8c518,0xbf800000,2
+np.float32,0x4358c518,0xb69267f6,2
+np.float32,0xc358c518,0x369267f6,2
+np.float32,0x425be958,0xbf800000,2
+np.float32,0xc25be958,0x3f800000,2
+np.float32,0x42dbe958,0xb6deab75,2
+np.float32,0xc2dbe958,0x36deab75,2
+np.float32,0x435be958,0x375eab75,2
+np.float32,0xc35be958,0xb75eab75,2
+np.float32,0x425f0d97,0xbf3504df,2
+np.float32,0xc25f0d97,0x3f3504df,2
+np.float32,0x42df0d97,0xbf800000,2
+np.float32,0xc2df0d97,0x3f800000,2
+np.float32,0x435f0d97,0xb6e845e0,2
+np.float32,0xc35f0d97,0x36e845e0,2
+np.float32,0x426231d6,0x3419a6a2,2
+np.float32,0xc26231d6,0xb419a6a2,2
+np.float32,0x42e231d6,0x3499a6a2,2
+np.float32,0xc2e231d6,0xb499a6a2,2
+np.float32,0x436231d6,0x3519a6a2,2
+np.float32,0xc36231d6,0xb519a6a2,2
+np.float32,0x42655616,0x3f35050f,2
+np.float32,0xc2655616,0xbf35050f,2
+np.float32,0x42e55616,0x3f800000,2
+np.float32,0xc2e55616,0xbf800000,2
+np.float32,0x43655616,0xb71f11e5,2
+np.float32,0xc3655616,0x371f11e5,2
+np.float32,0x42687a55,0x3f800000,2
+np.float32,0xc2687a55,0xbf800000,2
+np.float32,0x42e87a55,0xb5d2257b,2
+np.float32,0xc2e87a55,0x35d2257b,2
+np.float32,0x43687a55,0x3652257b,2
+np.float32,0xc3687a55,0xb652257b,2
+np.float32,0x426b9e95,0x3f3504cf,2
+np.float32,0xc26b9e95,0xbf3504cf,2
+np.float32,0x42eb9e95,0xbf800000,2
+np.float32,0xc2eb9e95,0x3f800000,2
+np.float32,0x436b9e95,0xb74a00d9,2
+np.float32,0xc36b9e95,0x374a00d9,2
+np.float32,0x426ec2d4,0xb5bef0a7,2
+np.float32,0xc26ec2d4,0x35bef0a7,2
+np.float32,0x42eec2d4,0x363ef0a7,2
+np.float32,0xc2eec2d4,0xb63ef0a7,2
+np.float32,0x436ec2d4,0x36bef0a7,2
+np.float32,0xc36ec2d4,0xb6bef0a7,2
+np.float32,0x4271e713,0xbf3504f1,2
+np.float32,0xc271e713,0x3f3504f1,2
+np.float32,0x42f1e713,0x3f800000,2
+np.float32,0xc2f1e713,0xbf800000,2
+np.float32,0x4371e713,0x35310321,2
+np.float32,0xc371e713,0xb5310321,2
+np.float32,0x42750b53,0xbf800000,2
+np.float32,0xc2750b53,0x3f800000,2
+np.float32,0x42f50b53,0xb68a6748,2
+np.float32,0xc2f50b53,0x368a6748,2
+np.float32,0x43750b53,0x370a6748,2
+np.float32,0xc3750b53,0xb70a6748,2
+np.float32,0x42782f92,0xbf3504ee,2
+np.float32,0xc2782f92,0x3f3504ee,2
+np.float32,0x42f82f92,0xbf800000,2
+np.float32,0xc2f82f92,0x3f800000,2
+np.float32,0x43782f92,0xb5fef616,2
+np.float32,0xc3782f92,0x35fef616,2
+np.float32,0x427b53d2,0x3635563d,2
+np.float32,0xc27b53d2,0xb635563d,2
+np.float32,0x42fb53d2,0x36b5563d,2
+np.float32,0xc2fb53d2,0xb6b5563d,2
+np.float32,0x437b53d2,0x3735563d,2
+np.float32,0xc37b53d2,0xb735563d,2
+np.float32,0x427e7811,0x3f350500,2
+np.float32,0xc27e7811,0xbf350500,2
+np.float32,0x42fe7811,0x3f800000,2
+np.float32,0xc2fe7811,0xbf800000,2
+np.float32,0x437e7811,0xb6959b6f,2
+np.float32,0xc37e7811,0x36959b6f,2
+np.float32,0x4280ce28,0x3f800000,2
+np.float32,0xc280ce28,0xbf800000,2
+np.float32,0x4300ce28,0x357dd672,2
+np.float32,0xc300ce28,0xb57dd672,2
+np.float32,0x4380ce28,0xb5fdd672,2
+np.float32,0xc380ce28,0x35fdd672,2
+np.float32,0x42826048,0x3f3504de,2
+np.float32,0xc2826048,0xbf3504de,2
+np.float32,0x43026048,0xbf800000,2
+np.float32,0xc3026048,0x3f800000,2
+np.float32,0x43826048,0xb6eb7958,2
+np.float32,0xc3826048,0x36eb7958,2
+np.float32,0x4283f268,0xb6859a13,2
+np.float32,0xc283f268,0x36859a13,2
+np.float32,0x4303f268,0x37059a13,2
+np.float32,0xc303f268,0xb7059a13,2
+np.float32,0x4383f268,0x37859a13,2
+np.float32,0xc383f268,0xb7859a13,2
+np.float32,0x42858487,0xbf3504e2,2
+np.float32,0xc2858487,0x3f3504e2,2
+np.float32,0x43058487,0x3f800000,2
+np.float32,0xc3058487,0xbf800000,2
+np.float32,0x43858487,0x36bea8be,2
+np.float32,0xc3858487,0xb6bea8be,2
+np.float32,0x428716a7,0xbf800000,2
+np.float32,0xc28716a7,0x3f800000,2
+np.float32,0x430716a7,0xb5d88c6d,2
+np.float32,0xc30716a7,0x35d88c6d,2
+np.float32,0x438716a7,0x36588c6d,2
+np.float32,0xc38716a7,0xb6588c6d,2
+np.float32,0x4288a8c7,0xbf3504cf,2
+np.float32,0xc288a8c7,0x3f3504cf,2
+np.float32,0x4308a8c7,0xbf800000,2
+np.float32,0xc308a8c7,0x3f800000,2
+np.float32,0x4388a8c7,0xb74b9a96,2
+np.float32,0xc388a8c7,0x374b9a96,2
+np.float32,0x428a3ae7,0x36b08908,2
+np.float32,0xc28a3ae7,0xb6b08908,2
+np.float32,0x430a3ae7,0x37308908,2
+np.float32,0xc30a3ae7,0xb7308908,2
+np.float32,0x438a3ae7,0x37b08908,2
+np.float32,0xc38a3ae7,0xb7b08908,2
+np.float32,0x428bcd06,0x3f3504f2,2
+np.float32,0xc28bcd06,0xbf3504f2,2
+np.float32,0x430bcd06,0x3f800000,2
+np.float32,0xc30bcd06,0xbf800000,2
+np.float32,0x438bcd06,0x3517675b,2
+np.float32,0xc38bcd06,0xb517675b,2
+np.float32,0x428d5f26,0x3f800000,2
+np.float32,0xc28d5f26,0xbf800000,2
+np.float32,0x430d5f26,0xb68c0105,2
+np.float32,0xc30d5f26,0x368c0105,2
+np.float32,0x438d5f26,0x370c0105,2
+np.float32,0xc38d5f26,0xb70c0105,2
+np.float32,0x428ef146,0x3f3504c0,2
+np.float32,0xc28ef146,0xbf3504c0,2
+np.float32,0x430ef146,0xbf800000,2
+np.float32,0xc30ef146,0x3f800000,2
+np.float32,0x438ef146,0xb790bc40,2
+np.float32,0xc38ef146,0x3790bc40,2
+np.float32,0x42908365,0x3592200d,2
+np.float32,0xc2908365,0xb592200d,2
+np.float32,0x43108365,0xb612200d,2
+np.float32,0xc3108365,0x3612200d,2
+np.float32,0x43908365,0xb692200d,2
+np.float32,0xc3908365,0x3692200d,2
+np.float32,0x42921585,0xbf350501,2
+np.float32,0xc2921585,0x3f350501,2
+np.float32,0x43121585,0x3f800000,2
+np.float32,0xc3121585,0xbf800000,2
+np.float32,0x43921585,0xb698cee8,2
+np.float32,0xc3921585,0x3698cee8,2
+np.float32,0x4293a7a5,0xbf800000,2
+np.float32,0xc293a7a5,0x3f800000,2
+np.float32,0x4313a7a5,0xb6e1deee,2
+np.float32,0xc313a7a5,0x36e1deee,2
+np.float32,0x4393a7a5,0x3761deee,2
+np.float32,0xc393a7a5,0xb761deee,2
+np.float32,0x429539c5,0xbf3504b1,2
+np.float32,0xc29539c5,0x3f3504b1,2
+np.float32,0x431539c5,0xbf800000,2
+np.float32,0xc31539c5,0x3f800000,2
+np.float32,0x439539c5,0xb7bbab34,2
+np.float32,0xc39539c5,0x37bbab34,2
+np.float32,0x4296cbe4,0x344cde2e,2
+np.float32,0xc296cbe4,0xb44cde2e,2
+np.float32,0x4316cbe4,0x34ccde2e,2
+np.float32,0xc316cbe4,0xb4ccde2e,2
+np.float32,0x4396cbe4,0x354cde2e,2
+np.float32,0xc396cbe4,0xb54cde2e,2
+np.float32,0x42985e04,0x3f350510,2
+np.float32,0xc2985e04,0xbf350510,2
+np.float32,0x43185e04,0x3f800000,2
+np.float32,0xc3185e04,0xbf800000,2
+np.float32,0x43985e04,0xb722455d,2
+np.float32,0xc3985e04,0x3722455d,2
+np.float32,0x4299f024,0x3f800000,2
+np.float32,0xc299f024,0xbf800000,2
+np.float32,0x4319f024,0xb71bde6c,2
+np.float32,0xc319f024,0x371bde6c,2
+np.float32,0x4399f024,0x379bde6c,2
+np.float32,0xc399f024,0xb79bde6c,2
+np.float32,0x429b8243,0x3f3504fc,2
+np.float32,0xc29b8243,0xbf3504fc,2
+np.float32,0x431b8243,0xbf800000,2
+np.float32,0xc31b8243,0x3f800000,2
+np.float32,0x439b8243,0x364b2eb8,2
+np.float32,0xc39b8243,0xb64b2eb8,2
+np.float32,0x435b2047,0xbf350525,2
+np.float32,0x42a038a2,0xbf800000,2
+np.float32,0x432038a2,0x3664ca7e,2
+np.float32,0x4345eb9b,0x365e638c,2
+np.float32,0x42c5eb9b,0xbf800000,2
+np.float32,0x42eb9e94,0xbf800000,2
+np.float32,0x4350ea79,0x3f800000,2
+np.float32,0x42dbe957,0x3585522a,2
+np.float32,0x425be957,0xbf800000,2
+np.float32,0x435be957,0xb605522a,2
+np.float32,0x476362a2,0xbd7ff911,2
+np.float32,0x464c99a4,0x3e7f4d41,2
+np.float32,0x4471f73d,0x3e7fe1b0,2
+np.float32,0x445a6752,0x3e7ef367,2
+np.float32,0x474fa400,0x3e7f9fcd,2
+np.float32,0x45c1e72f,0xbe7fc7af,2
+np.float32,0x4558c91d,0x3e7e9f31,2
+np.float32,0x43784f94,0xbdff6654,2
+np.float32,0x466e8500,0xbe7ea0a3,2
+np.float32,0x468e1c25,0x3e7e22fb,2
+np.float32,0x44ea6cfc,0x3dff70c3,2
+np.float32,0x4605126c,0x3e7f89ef,2
+np.float32,0x4788b3c6,0xbb87d853,2
+np.float32,0x4531b042,0x3dffd163,2
+np.float32,0x43f1f71d,0x3dfff387,2
+np.float32,0x462c3fa5,0xbd7fe13d,2
+np.float32,0x441c5354,0xbdff76b4,2
+np.float32,0x44908b69,0x3e7dcf0d,2
+np.float32,0x478813ad,0xbe7e9d80,2
+np.float32,0x441c4351,0x3dff937b,2

venv/Lib/site-packages/numpy/core/tests/test__exceptions.py

@@ -0,0 +1,42 @@
+"""
+Tests of the ._exceptions module. Primarily for exercising the __str__ methods.
+"""
+import numpy as np
+
+_ArrayMemoryError = np.core._exceptions._ArrayMemoryError
+
+class TestArrayMemoryError:
+    def test_str(self):
+        e = _ArrayMemoryError((1023,), np.dtype(np.uint8))
+        str(e)  # not crashing is enough
+
+    # testing these properties is easier than testing the full string repr
+    def test__size_to_string(self):
+        """ Test e._size_to_string """
+        f = _ArrayMemoryError._size_to_string
+        Ki = 1024
+        assert f(0) == '0 bytes'
+        assert f(1) == '1 bytes'
+        assert f(1023) == '1023 bytes'
+        assert f(Ki) == '1.00 KiB'
+        assert f(Ki+1) == '1.00 KiB'
+        assert f(10*Ki) == '10.0 KiB'
+        assert f(int(999.4*Ki)) == '999. KiB'
+        assert f(int(1023.4*Ki)) == '1023. KiB'
+        assert f(int(1023.5*Ki)) == '1.00 MiB'
+        assert f(Ki*Ki) == '1.00 MiB'
+
+        # 1023.9999 Mib should round to 1 GiB
+        assert f(int(Ki*Ki*Ki*0.9999)) == '1.00 GiB'
+        assert f(Ki*Ki*Ki*Ki*Ki*Ki) == '1.00 EiB'
+        # larger than sys.maxsize, adding larger prefices isn't going to help
+        # anyway.
+        assert f(Ki*Ki*Ki*Ki*Ki*Ki*123456) == '123456. EiB'
+
+    def test__total_size(self):
+        """ Test e._total_size """
+        e = _ArrayMemoryError((1,), np.dtype(np.uint8))
+        assert e._total_size == 1
+
+        e = _ArrayMemoryError((2, 4), np.dtype((np.uint64, 16)))
+        assert e._total_size == 1024

venv/Lib/site-packages/numpy/core/tests/test_abc.py

@@ -0,0 +1,54 @@
+from numpy.testing import assert_
+
+import numbers
+
+import numpy as np
+from numpy.core.numerictypes import sctypes
+
+class TestABC:
+    def test_abstract(self):
+        assert_(issubclass(np.number, numbers.Number))
+
+        assert_(issubclass(np.inexact, numbers.Complex))
+        assert_(issubclass(np.complexfloating, numbers.Complex))
+        assert_(issubclass(np.floating, numbers.Real))
+
+        assert_(issubclass(np.integer, numbers.Integral))
+        assert_(issubclass(np.signedinteger, numbers.Integral))
+        assert_(issubclass(np.unsignedinteger, numbers.Integral))
+
+    def test_floats(self):
+        for t in sctypes['float']:
+            assert_(isinstance(t(), numbers.Real),
+                    "{0} is not instance of Real".format(t.__name__))
+            assert_(issubclass(t, numbers.Real),
+                    "{0} is not subclass of Real".format(t.__name__))
+            assert_(not isinstance(t(), numbers.Rational),
+                    "{0} is instance of Rational".format(t.__name__))
+            assert_(not issubclass(t, numbers.Rational),
+                    "{0} is subclass of Rational".format(t.__name__))
+
+    def test_complex(self):
+        for t in sctypes['complex']:
+            assert_(isinstance(t(), numbers.Complex),
+                    "{0} is not instance of Complex".format(t.__name__))
+            assert_(issubclass(t, numbers.Complex),
+                    "{0} is not subclass of Complex".format(t.__name__))
+            assert_(not isinstance(t(), numbers.Real),
+                    "{0} is instance of Real".format(t.__name__))
+            assert_(not issubclass(t, numbers.Real),
+                    "{0} is subclass of Real".format(t.__name__))
+
+    def test_int(self):
+        for t in sctypes['int']:
+            assert_(isinstance(t(), numbers.Integral),
+                    "{0} is not instance of Integral".format(t.__name__))
+            assert_(issubclass(t, numbers.Integral),
+                    "{0} is not subclass of Integral".format(t.__name__))
+
+    def test_uint(self):
+        for t in sctypes['uint']:
+            assert_(isinstance(t(), numbers.Integral),
+                    "{0} is not instance of Integral".format(t.__name__))
+            assert_(issubclass(t, numbers.Integral),
+                    "{0} is not subclass of Integral".format(t.__name__))

venv/Lib/site-packages/numpy/core/tests/test_api.py

@@ -0,0 +1,567 @@
+import sys
+
+import numpy as np
+from numpy.core._rational_tests import rational
+import pytest
+from numpy.testing import (
+     assert_, assert_equal, assert_array_equal, assert_raises, assert_warns,
+     HAS_REFCOUNT
+    )
+
+# Switch between new behaviour when NPY_RELAXED_STRIDES_CHECKING is set.
+NPY_RELAXED_STRIDES_CHECKING = np.ones((10, 1), order='C').flags.f_contiguous
+
+
+def test_array_array():
+    tobj = type(object)
+    ones11 = np.ones((1, 1), np.float64)
+    tndarray = type(ones11)
+    # Test is_ndarray
+    assert_equal(np.array(ones11, dtype=np.float64), ones11)
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tndarray)
+        np.array(ones11)
+        assert_equal(old_refcount, sys.getrefcount(tndarray))
+
+    # test None
+    assert_equal(np.array(None, dtype=np.float64),
+                 np.array(np.nan, dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tobj)
+        np.array(None, dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(tobj))
+
+    # test scalar
+    assert_equal(np.array(1.0, dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(np.float64)
+        np.array(np.array(1.0, dtype=np.float64), dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(np.float64))
+
+    # test string
+    S2 = np.dtype((bytes, 2))
+    S3 = np.dtype((bytes, 3))
+    S5 = np.dtype((bytes, 5))
+    assert_equal(np.array(b"1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array(b"1.0").dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=bytes).dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=S2), np.array(b"1."))
+    assert_equal(np.array(b"1", dtype=S5), np.ones((), dtype=S5))
+
+    # test string
+    U2 = np.dtype((str, 2))
+    U3 = np.dtype((str, 3))
+    U5 = np.dtype((str, 5))
+    assert_equal(np.array("1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array("1.0").dtype, U3)
+    assert_equal(np.array("1.0", dtype=str).dtype, U3)
+    assert_equal(np.array("1.0", dtype=U2), np.array(str("1.")))
+    assert_equal(np.array("1", dtype=U5), np.ones((), dtype=U5))
+
+    builtins = getattr(__builtins__, '__dict__', __builtins__)
+    assert_(hasattr(builtins, 'get'))
+
+    # test memoryview
+    dat = np.array(memoryview(b'1.0'), dtype=np.float64)
+    assert_equal(dat, [49.0, 46.0, 48.0])
+    assert_(dat.dtype.type is np.float64)
+
+    dat = np.array(memoryview(b'1.0'))
+    assert_equal(dat, [49, 46, 48])
+    assert_(dat.dtype.type is np.uint8)
+
+    # test array interface
+    a = np.array(100.0, dtype=np.float64)
+    o = type("o", (object,),
+             dict(__array_interface__=a.__array_interface__))
+    assert_equal(np.array(o, dtype=np.float64), a)
+
+    # test array_struct interface
+    a = np.array([(1, 4.0, 'Hello'), (2, 6.0, 'World')],
+                 dtype=[('f0', int), ('f1', float), ('f2', str)])
+    o = type("o", (object,),
+             dict(__array_struct__=a.__array_struct__))
+    ## wasn't what I expected... is np.array(o) supposed to equal a ?
+    ## instead we get a array([...], dtype=">V18")
+    assert_equal(bytes(np.array(o).data), bytes(a.data))
+
+    # test array
+    o = type("o", (object,),
+             dict(__array__=lambda *x: np.array(100.0, dtype=np.float64)))()
+    assert_equal(np.array(o, dtype=np.float64), np.array(100.0, np.float64))
+
+    # test recursion
+    nested = 1.5
+    for i in range(np.MAXDIMS):
+        nested = [nested]
+
+    # no error
+    np.array(nested)
+
+    # Exceeds recursion limit
+    assert_raises(ValueError, np.array, [nested], dtype=np.float64)
+
+    # Try with lists...
+    assert_equal(np.array([None] * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None]] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array([1.0] * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([[1.0]] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+    # Try with tuples
+    assert_equal(np.array((None,) * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,)] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array((1.0,) * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([(1.0,)] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+@pytest.mark.parametrize("array", [True, False])
+def test_array_impossible_casts(array):
+    # All builtin types can forst cast as least theoretically
+    # but user dtypes cannot necessarily.
+    rt = rational(1, 2)
+    if array:
+        rt = np.array(rt)
+    with assert_raises(ValueError):
+        np.array(rt, dtype="M8")
+
+
+def test_fastCopyAndTranspose():
+    # 0D array
+    a = np.array(2)
+    b = np.fastCopyAndTranspose(a)
+    assert_equal(b, a.T)
+    assert_(b.flags.owndata)
+
+    # 1D array
+    a = np.array([3, 2, 7, 0])
+    b = np.fastCopyAndTranspose(a)
+    assert_equal(b, a.T)
+    assert_(b.flags.owndata)
+
+    # 2D array
+    a = np.arange(6).reshape(2, 3)
+    b = np.fastCopyAndTranspose(a)
+    assert_equal(b, a.T)
+    assert_(b.flags.owndata)
+
+def test_array_astype():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+    # Default behavior: allows unsafe casts, keeps memory layout,
+    #                   always copies.
+    b = a.astype('i4')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.strides, b.strides)
+    b = a.T.astype('i4')
+    assert_equal(a.T, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.T.strides, b.strides)
+    b = a.astype('f4')
+    assert_equal(a, b)
+    assert_(not (a is b))
+
+    # copy=False parameter can sometimes skip a copy
+    b = a.astype('f4', copy=False)
+    assert_(a is b)
+
+    # order parameter allows overriding of the memory layout,
+    # forcing a copy if the layout is wrong
+    b = a.astype('f4', order='F', copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(b.flags.f_contiguous)
+
+    b = a.astype('f4', order='C', copy=False)
+    assert_equal(a, b)
+    assert_(a is b)
+    assert_(b.flags.c_contiguous)
+
+    # casting parameter allows catching bad casts
+    b = a.astype('c8', casting='safe')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('c8'))
+
+    assert_raises(TypeError, a.astype, 'i4', casting='safe')
+
+    # subok=False passes through a non-subclassed array
+    b = a.astype('f4', subok=0, copy=False)
+    assert_(a is b)
+
+    class MyNDArray(np.ndarray):
+        pass
+
+    a = np.array([[0, 1, 2], [3, 4, 5]], dtype='f4').view(MyNDArray)
+
+    # subok=True passes through a subclass
+    b = a.astype('f4', subok=True, copy=False)
+    assert_(a is b)
+
+    # subok=True is default, and creates a subtype on a cast
+    b = a.astype('i4', copy=False)
+    assert_equal(a, b)
+    assert_equal(type(b), MyNDArray)
+
+    # subok=False never returns a subclass
+    b = a.astype('f4', subok=False, copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(type(b) is not MyNDArray)
+
+    # Make sure converting from string object to fixed length string
+    # does not truncate.
+    a = np.array([b'a'*100], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S100'))
+    a = np.array([u'a'*100], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U100'))
+
+    # Same test as above but for strings shorter than 64 characters
+    a = np.array([b'a'*10], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S10'))
+    a = np.array([u'a'*10], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U10'))
+
+    a = np.array(123456789012345678901234567890, dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='O').astype('U')
+    assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30'))
+
+    a = np.array([123456789012345678901234567890], dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array([123456789012345678901234567890], dtype='O').astype('U')
+    assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30'))
+
+    a = np.array(123456789012345678901234567890, dtype='S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='U')
+    assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30'))
+
+    a = np.array(u'a\u0140', dtype='U')
+    b = np.ndarray(buffer=a, dtype='uint32', shape=2)
+    assert_(b.size == 2)
+
+    a = np.array([1000], dtype='i4')
+    assert_raises(TypeError, a.astype, 'S1', casting='safe')
+
+    a = np.array(1000, dtype='i4')
+    assert_raises(TypeError, a.astype, 'U1', casting='safe')
+
+@pytest.mark.parametrize("t",
+    np.sctypes['uint'] + np.sctypes['int'] + np.sctypes['float']
+)
+def test_array_astype_warning(t):
+    # test ComplexWarning when casting from complex to float or int
+    a = np.array(10, dtype=np.complex_)
+    assert_warns(np.ComplexWarning, a.astype, t)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool_),
+         (np.unicode, np.bool_),
+         (np.dtype("S10,S9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast(dtype, out_dtype):
+    """
+    Currently, for `astype` strings are cast to booleans effectively by
+    calling `bool(int(string)`. This is not consistent (see gh-9875) and
+    will eventually be deprecated.
+    """
+    arr = np.array(["10", "10\0\0\0", "0\0\0", "0"], dtype=dtype)
+    expected = np.array([True, True, False, False], dtype=out_dtype)
+    assert_array_equal(arr.astype(out_dtype), expected)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool_),
+         (np.unicode, np.bool_),
+         (np.dtype("S10,S9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast_errors(dtype, out_dtype):
+    """
+    These currently error out, since cast to integers fails, but should not
+    error out in the future.
+    """
+    for invalid in ["False", "True", "", "\0", "non-empty"]:
+        arr = np.array([invalid], dtype=dtype)
+        with assert_raises(ValueError):
+            arr.astype(out_dtype)
+
+@pytest.mark.parametrize("str_type", [str, bytes, np.str_, np.unicode_])
+@pytest.mark.parametrize("scalar_type",
+        [np.complex64, np.complex128, np.clongdouble])
+def test_string_to_complex_cast(str_type, scalar_type):
+    value = scalar_type(b"1+3j")
+    assert scalar_type(value) == 1+3j
+    assert np.array([value], dtype=object).astype(scalar_type)[()] == 1+3j
+    assert np.array(value).astype(scalar_type)[()] == 1+3j
+    arr = np.zeros(1, dtype=scalar_type)
+    arr[0] = value
+    assert arr[0] == 1+3j
+
+@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"])
+def test_none_to_nan_cast(dtype):
+    # Note that at the time of writing this test, the scalar constructors
+    # reject None
+    arr = np.zeros(1, dtype=dtype)
+    arr[0] = None
+    assert np.isnan(arr)[0]
+    assert np.isnan(np.array(None, dtype=dtype))[()]
+    assert np.isnan(np.array([None], dtype=dtype))[0]
+    assert np.isnan(np.array(None).astype(dtype))[()]
+
+def test_copyto_fromscalar():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, 1.5)
+    assert_equal(a, 1.5)
+    np.copyto(a.T, 2.5)
+    assert_equal(a, 2.5)
+
+    # Where-masked copy
+    mask = np.array([[0, 1, 0], [0, 0, 1]], dtype='?')
+    np.copyto(a, 3.5, where=mask)
+    assert_equal(a, [[2.5, 3.5, 2.5], [2.5, 2.5, 3.5]])
+    mask = np.array([[0, 1], [1, 1], [1, 0]], dtype='?')
+    np.copyto(a.T, 4.5, where=mask)
+    assert_equal(a, [[2.5, 4.5, 4.5], [4.5, 4.5, 3.5]])
+
+def test_copyto():
+    a = np.arange(6, dtype='i4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, [[3, 1, 5], [6, 2, 1]])
+    assert_equal(a, [[3, 1, 5], [6, 2, 1]])
+
+    # Overlapping copy should work
+    np.copyto(a[:, :2], a[::-1, 1::-1])
+    assert_equal(a, [[2, 6, 5], [1, 3, 1]])
+
+    # Defaults to 'same_kind' casting
+    assert_raises(TypeError, np.copyto, a, 1.5)
+
+    # Force a copy with 'unsafe' casting, truncating 1.5 to 1
+    np.copyto(a, 1.5, casting='unsafe')
+    assert_equal(a, 1)
+
+    # Copying with a mask
+    np.copyto(a, 3, where=[True, False, True])
+    assert_equal(a, [[3, 1, 3], [3, 1, 3]])
+
+    # Casting rule still applies with a mask
+    assert_raises(TypeError, np.copyto, a, 3.5, where=[True, False, True])
+
+    # Lists of integer 0's and 1's is ok too
+    np.copyto(a, 4.0, casting='unsafe', where=[[0, 1, 1], [1, 0, 0]])
+    assert_equal(a, [[3, 4, 4], [4, 1, 3]])
+
+    # Overlapping copy with mask should work
+    np.copyto(a[:, :2], a[::-1, 1::-1], where=[[0, 1], [1, 1]])
+    assert_equal(a, [[3, 4, 4], [4, 3, 3]])
+
+    # 'dst' must be an array
+    assert_raises(TypeError, np.copyto, [1, 2, 3], [2, 3, 4])
+
+def test_copyto_permut():
+    # test explicit overflow case
+    pad = 500
+    l = [True] * pad + [True, True, True, True]
+    r = np.zeros(len(l)-pad)
+    d = np.ones(len(l)-pad)
+    mask = np.array(l)[pad:]
+    np.copyto(r, d, where=mask[::-1])
+
+    # test all permutation of possible masks, 9 should be sufficient for
+    # current 4 byte unrolled code
+    power = 9
+    d = np.ones(power)
+    for i in range(2**power):
+        r = np.zeros(power)
+        l = [(i & x) != 0 for x in range(power)]
+        mask = np.array(l)
+        np.copyto(r, d, where=mask)
+        assert_array_equal(r == 1, l)
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r, d, where=mask[::-1])
+        assert_array_equal(r == 1, l[::-1])
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::2])
+        assert_array_equal(r[::2] == 1, l[::2])
+        assert_equal(r[::2].sum(), sum(l[::2]))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::-2])
+        assert_array_equal(r[::2] == 1, l[::-2])
+        assert_equal(r[::2].sum(), sum(l[::-2]))
+
+        for c in [0xFF, 0x7F, 0x02, 0x10]:
+            r = np.zeros(power)
+            mask = np.array(l)
+            imask = np.array(l).view(np.uint8)
+            imask[mask != 0] = c
+            np.copyto(r, d, where=mask)
+            assert_array_equal(r == 1, l)
+            assert_equal(r.sum(), sum(l))
+
+    r = np.zeros(power)
+    np.copyto(r, d, where=True)
+    assert_equal(r.sum(), r.size)
+    r = np.ones(power)
+    d = np.zeros(power)
+    np.copyto(r, d, where=False)
+    assert_equal(r.sum(), r.size)
+
+def test_copy_order():
+    a = np.arange(24).reshape(2, 1, 3, 4)
+    b = a.copy(order='F')
+    c = np.arange(24).reshape(2, 1, 4, 3).swapaxes(2, 3)
+
+    def check_copy_result(x, y, ccontig, fcontig, strides=False):
+        assert_(not (x is y))
+        assert_equal(x, y)
+        assert_equal(res.flags.c_contiguous, ccontig)
+        assert_equal(res.flags.f_contiguous, fcontig)
+        # This check is impossible only because
+        # NPY_RELAXED_STRIDES_CHECKING changes the strides actively
+        if not NPY_RELAXED_STRIDES_CHECKING:
+            if strides:
+                assert_equal(x.strides, y.strides)
+            else:
+                assert_(x.strides != y.strides)
+
+    # Validate the initial state of a, b, and c
+    assert_(a.flags.c_contiguous)
+    assert_(not a.flags.f_contiguous)
+    assert_(not b.flags.c_contiguous)
+    assert_(b.flags.f_contiguous)
+    assert_(not c.flags.c_contiguous)
+    assert_(not c.flags.f_contiguous)
+
+    # Copy with order='C'
+    res = a.copy(order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = c.copy(order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(a, order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(c, order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+
+    # Copy with order='F'
+    res = a.copy(order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = b.copy(order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(a, order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(b, order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+
+    # Copy with order='K'
+    res = a.copy(order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+    res = np.copy(a, order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+
+def test_contiguous_flags():
+    a = np.ones((4, 4, 1))[::2,:,:]
+    if NPY_RELAXED_STRIDES_CHECKING:
+        a.strides = a.strides[:2] + (-123,)
+    b = np.ones((2, 2, 1, 2, 2)).swapaxes(3, 4)
+
+    def check_contig(a, ccontig, fcontig):
+        assert_(a.flags.c_contiguous == ccontig)
+        assert_(a.flags.f_contiguous == fcontig)
+
+    # Check if new arrays are correct:
+    check_contig(a, False, False)
+    check_contig(b, False, False)
+    if NPY_RELAXED_STRIDES_CHECKING:
+        check_contig(np.empty((2, 2, 0, 2, 2)), True, True)
+        check_contig(np.array([[[1], [2]]], order='F'), True, True)
+    else:
+        check_contig(np.empty((2, 2, 0, 2, 2)), True, False)
+        check_contig(np.array([[[1], [2]]], order='F'), False, True)
+    check_contig(np.empty((2, 2)), True, False)
+    check_contig(np.empty((2, 2), order='F'), False, True)
+
+    # Check that np.array creates correct contiguous flags:
+    check_contig(np.array(a, copy=False), False, False)
+    check_contig(np.array(a, copy=False, order='C'), True, False)
+    check_contig(np.array(a, ndmin=4, copy=False, order='F'), False, True)
+
+    if NPY_RELAXED_STRIDES_CHECKING:
+        # Check slicing update of flags and :
+        check_contig(a[0], True, True)
+        check_contig(a[None, ::4, ..., None], True, True)
+        check_contig(b[0, 0, ...], False, True)
+        check_contig(b[:,:, 0:0,:,:], True, True)
+    else:
+        # Check slicing update of flags:
+        check_contig(a[0], True, False)
+        # Would be nice if this was C-Contiguous:
+        check_contig(a[None, 0, ..., None], False, False)
+        check_contig(b[0, 0, 0, ...], False, True)
+
+    # Test ravel and squeeze.
+    check_contig(a.ravel(), True, True)
+    check_contig(np.ones((1, 3, 1)).squeeze(), True, True)
+
+def test_broadcast_arrays():
+    # Test user defined dtypes
+    a = np.array([(1, 2, 3)], dtype='u4,u4,u4')
+    b = np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4')
+    result = np.broadcast_arrays(a, b)
+    assert_equal(result[0], np.array([(1, 2, 3), (1, 2, 3), (1, 2, 3)], dtype='u4,u4,u4'))
+    assert_equal(result[1], np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4'))

venv/Lib/site-packages/numpy/core/tests/test_arrayprint.py

@@ -0,0 +1,886 @@
+# -*- coding: utf-8 -*-
+import sys
+import gc
+from hypothesis import given
+from hypothesis.extra import numpy as hynp
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_warns, HAS_REFCOUNT,
+    assert_raises_regex,
+    )
+import textwrap
+
+class TestArrayRepr:
+    def test_nan_inf(self):
+        x = np.array([np.nan, np.inf])
+        assert_equal(repr(x), 'array([nan, inf])')
+
+    def test_subclass(self):
+        class sub(np.ndarray): pass
+
+        # one dimensional
+        x1d = np.array([1, 2]).view(sub)
+        assert_equal(repr(x1d), 'sub([1, 2])')
+
+        # two dimensional
+        x2d = np.array([[1, 2], [3, 4]]).view(sub)
+        assert_equal(repr(x2d),
+            'sub([[1, 2],\n'
+            '     [3, 4]])')
+
+        # two dimensional with flexible dtype
+        xstruct = np.ones((2,2), dtype=[('a', '<i4')]).view(sub)
+        assert_equal(repr(xstruct),
+            "sub([[(1,), (1,)],\n"
+            "     [(1,), (1,)]], dtype=[('a', '<i4')])"
+        )
+
+    @pytest.mark.xfail(reason="See gh-10544")
+    def test_object_subclass(self):
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super(sub, self).__getitem__(ind)
+                return sub(ret)
+
+        # test that object + subclass is OK:
+        x = sub([None, None])
+        assert_equal(repr(x), 'sub([None, None], dtype=object)')
+        assert_equal(str(x), '[None None]')
+
+        x = sub([None, sub([None, None])])
+        assert_equal(repr(x),
+            'sub([None, sub([None, None], dtype=object)], dtype=object)')
+        assert_equal(str(x), '[None sub([None, None], dtype=object)]')
+
+    def test_0d_object_subclass(self):
+        # make sure that subclasses which return 0ds instead
+        # of scalars don't cause infinite recursion in str
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super(sub, self).__getitem__(ind)
+                return sub(ret)
+
+        x = sub(1)
+        assert_equal(repr(x), 'sub(1)')
+        assert_equal(str(x), '1')
+
+        x = sub([1, 1])
+        assert_equal(repr(x), 'sub([1, 1])')
+        assert_equal(str(x), '[1 1]')
+
+        # check it works properly with object arrays too
+        x = sub(None)
+        assert_equal(repr(x), 'sub(None, dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # plus recursive object arrays (even depth > 1)
+        y = sub(None)
+        x[()] = y
+        y[()] = x
+        assert_equal(repr(x),
+            'sub(sub(sub(..., dtype=object), dtype=object), dtype=object)')
+        assert_equal(str(x), '...')
+        x[()] = 0  # resolve circular references for garbage collector
+
+        # nested 0d-subclass-object
+        x = sub(None)
+        x[()] = sub(None)
+        assert_equal(repr(x), 'sub(sub(None, dtype=object), dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # gh-10663
+        class DuckCounter(np.ndarray):
+            def __getitem__(self, item):
+                result = super(DuckCounter, self).__getitem__(item)
+                if not isinstance(result, DuckCounter):
+                    result = result[...].view(DuckCounter)
+                return result
+
+            def to_string(self):
+                return {0: 'zero', 1: 'one', 2: 'two'}.get(self.item(), 'many')
+
+            def __str__(self):
+                if self.shape == ():
+                    return self.to_string()
+                else:
+                    fmt = {'all': lambda x: x.to_string()}
+                    return np.array2string(self, formatter=fmt)
+
+        dc = np.arange(5).view(DuckCounter)
+        assert_equal(str(dc), "[zero one two many many]")
+        assert_equal(str(dc[0]), "zero")
+
+    def test_self_containing(self):
+        arr0d = np.array(None)
+        arr0d[()] = arr0d
+        assert_equal(repr(arr0d),
+            'array(array(..., dtype=object), dtype=object)')
+        arr0d[()] = 0  # resolve recursion for garbage collector
+
+        arr1d = np.array([None, None])
+        arr1d[1] = arr1d
+        assert_equal(repr(arr1d),
+            'array([None, array(..., dtype=object)], dtype=object)')
+        arr1d[1] = 0  # resolve recursion for garbage collector
+
+        first = np.array(None)
+        second = np.array(None)
+        first[()] = second
+        second[()] = first
+        assert_equal(repr(first),
+            'array(array(array(..., dtype=object), dtype=object), dtype=object)')
+        first[()] = 0  # resolve circular references for garbage collector
+
+    def test_containing_list(self):
+        # printing square brackets directly would be ambiguuous
+        arr1d = np.array([None, None])
+        arr1d[0] = [1, 2]
+        arr1d[1] = [3]
+        assert_equal(repr(arr1d),
+            'array([list([1, 2]), list([3])], dtype=object)')
+
+    def test_void_scalar_recursion(self):
+        # gh-9345
+        repr(np.void(b'test'))  # RecursionError ?
+
+    def test_fieldless_structured(self):
+        # gh-10366
+        no_fields = np.dtype([])
+        arr_no_fields = np.empty(4, dtype=no_fields)
+        assert_equal(repr(arr_no_fields), 'array([(), (), (), ()], dtype=[])')
+
+
+class TestComplexArray:
+    def test_str(self):
+        rvals = [0, 1, -1, np.inf, -np.inf, np.nan]
+        cvals = [complex(rp, ip) for rp in rvals for ip in rvals]
+        dtypes = [np.complex64, np.cdouble, np.clongdouble]
+        actual = [str(np.array([c], dt)) for c in cvals for dt in dtypes]
+        wanted = [
+            '[0.+0.j]',    '[0.+0.j]',    '[0.+0.j]',
+            '[0.+1.j]',    '[0.+1.j]',    '[0.+1.j]',
+            '[0.-1.j]',    '[0.-1.j]',    '[0.-1.j]',
+            '[0.+infj]',   '[0.+infj]',   '[0.+infj]',
+            '[0.-infj]',   '[0.-infj]',   '[0.-infj]',
+            '[0.+nanj]',   '[0.+nanj]',   '[0.+nanj]',
+            '[1.+0.j]',    '[1.+0.j]',    '[1.+0.j]',
+            '[1.+1.j]',    '[1.+1.j]',    '[1.+1.j]',
+            '[1.-1.j]',    '[1.-1.j]',    '[1.-1.j]',
+            '[1.+infj]',   '[1.+infj]',   '[1.+infj]',
+            '[1.-infj]',   '[1.-infj]',   '[1.-infj]',
+            '[1.+nanj]',   '[1.+nanj]',   '[1.+nanj]',
+            '[-1.+0.j]',   '[-1.+0.j]',   '[-1.+0.j]',
+            '[-1.+1.j]',   '[-1.+1.j]',   '[-1.+1.j]',
+            '[-1.-1.j]',   '[-1.-1.j]',   '[-1.-1.j]',
+            '[-1.+infj]',  '[-1.+infj]',  '[-1.+infj]',
+            '[-1.-infj]',  '[-1.-infj]',  '[-1.-infj]',
+            '[-1.+nanj]',  '[-1.+nanj]',  '[-1.+nanj]',
+            '[inf+0.j]',   '[inf+0.j]',   '[inf+0.j]',
+            '[inf+1.j]',   '[inf+1.j]',   '[inf+1.j]',
+            '[inf-1.j]',   '[inf-1.j]',   '[inf-1.j]',
+            '[inf+infj]',  '[inf+infj]',  '[inf+infj]',
+            '[inf-infj]',  '[inf-infj]',  '[inf-infj]',
+            '[inf+nanj]',  '[inf+nanj]',  '[inf+nanj]',
+            '[-inf+0.j]',  '[-inf+0.j]',  '[-inf+0.j]',
+            '[-inf+1.j]',  '[-inf+1.j]',  '[-inf+1.j]',
+            '[-inf-1.j]',  '[-inf-1.j]',  '[-inf-1.j]',
+            '[-inf+infj]', '[-inf+infj]', '[-inf+infj]',
+            '[-inf-infj]', '[-inf-infj]', '[-inf-infj]',
+            '[-inf+nanj]', '[-inf+nanj]', '[-inf+nanj]',
+            '[nan+0.j]',   '[nan+0.j]',   '[nan+0.j]',
+            '[nan+1.j]',   '[nan+1.j]',   '[nan+1.j]',
+            '[nan-1.j]',   '[nan-1.j]',   '[nan-1.j]',
+            '[nan+infj]',  '[nan+infj]',  '[nan+infj]',
+            '[nan-infj]',  '[nan-infj]',  '[nan-infj]',
+            '[nan+nanj]',  '[nan+nanj]',  '[nan+nanj]']
+
+        for res, val in zip(actual, wanted):
+            assert_equal(res, val)
+
+class TestArray2String:
+    def test_basic(self):
+        """Basic test of array2string."""
+        a = np.arange(3)
+        assert_(np.array2string(a) == '[0 1 2]')
+        assert_(np.array2string(a, max_line_width=4, legacy='1.13') == '[0 1\n 2]')
+        assert_(np.array2string(a, max_line_width=4) == '[0\n 1\n 2]')
+
+    def test_unexpected_kwarg(self):
+        # ensure than an appropriate TypeError
+        # is raised when array2string receives
+        # an unexpected kwarg
+
+        with assert_raises_regex(TypeError, 'nonsense'):
+            np.array2string(np.array([1, 2, 3]),
+                            nonsense=None)
+
+    def test_format_function(self):
+        """Test custom format function for each element in array."""
+        def _format_function(x):
+            if np.abs(x) < 1:
+                return '.'
+            elif np.abs(x) < 2:
+                return 'o'
+            else:
+                return 'O'
+
+        x = np.arange(3)
+        x_hex = "[0x0 0x1 0x2]"
+        x_oct = "[0o0 0o1 0o2]"
+        assert_(np.array2string(x, formatter={'all':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'int_kind':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'all':lambda x: "%.4f" % x}) ==
+                "[0.0000 1.0000 2.0000]")
+        assert_equal(np.array2string(x, formatter={'int':lambda x: hex(x)}),
+                x_hex)
+        assert_equal(np.array2string(x, formatter={'int':lambda x: oct(x)}),
+                x_oct)
+
+        x = np.arange(3.)
+        assert_(np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+        assert_(np.array2string(x, formatter={'float':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+
+        s = np.array(['abc', 'def'])
+        assert_(np.array2string(s, formatter={'numpystr':lambda s: s*2}) ==
+                '[abcabc defdef]')
+
+
+    def test_structure_format(self):
+        dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))])
+        x = np.array([('Sarah', (8.0, 7.0)), ('John', (6.0, 7.0))], dtype=dt)
+        assert_equal(np.array2string(x),
+                "[('Sarah', [8., 7.]) ('John', [6., 7.])]")
+
+        np.set_printoptions(legacy='1.13')
+        try:
+            # for issue #5692
+            A = np.zeros(shape=10, dtype=[("A", "M8[s]")])
+            A[5:].fill(np.datetime64('NaT'))
+            assert_equal(
+                np.array2string(A),
+                textwrap.dedent("""\
+                [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+                 ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('NaT',) ('NaT',)
+                 ('NaT',) ('NaT',) ('NaT',)]""")
+            )
+        finally:
+            np.set_printoptions(legacy=False)
+
+        # same again, but with non-legacy behavior
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) (                'NaT',)
+             (                'NaT',) (                'NaT',)
+             (                'NaT',) (                'NaT',)]""")
+        )
+
+        # and again, with timedeltas
+        A = np.full(10, 123456, dtype=[("A", "m8[s]")])
+        A[5:].fill(np.datetime64('NaT'))
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [(123456,) (123456,) (123456,) (123456,) (123456,) ( 'NaT',) ( 'NaT',)
+             ( 'NaT',) ( 'NaT',) ( 'NaT',)]""")
+        )
+
+        # See #8160
+        struct_int = np.array([([1, -1],), ([123, 1],)], dtype=[('B', 'i4', 2)])
+        assert_equal(np.array2string(struct_int),
+                "[([  1,  -1],) ([123,   1],)]")
+        struct_2dint = np.array([([[0, 1], [2, 3]],), ([[12, 0], [0, 0]],)],
+                dtype=[('B', 'i4', (2, 2))])
+        assert_equal(np.array2string(struct_2dint),
+                "[([[ 0,  1], [ 2,  3]],) ([[12,  0], [ 0,  0]],)]")
+
+        # See #8172
+        array_scalar = np.array(
+                (1., 2.1234567890123456789, 3.), dtype=('f8,f8,f8'))
+        assert_equal(np.array2string(array_scalar), "(1., 2.12345679, 3.)")
+
+    def test_unstructured_void_repr(self):
+        a = np.array([27, 91, 50, 75,  7, 65, 10,  8,
+                      27, 91, 51, 49,109, 82,101,100], dtype='u1').view('V8')
+        assert_equal(repr(a[0]), r"void(b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08')")
+        assert_equal(str(a[0]), r"b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'")
+        assert_equal(repr(a),
+            r"array([b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'," "\n"
+            r"       b'\x1B\x5B\x33\x31\x6D\x52\x65\x64'], dtype='|V8')")
+
+        assert_equal(eval(repr(a), vars(np)), a)
+        assert_equal(eval(repr(a[0]), vars(np)), a[0])
+
+    def test_edgeitems_kwarg(self):
+        # previously the global print options would be taken over the kwarg
+        arr = np.zeros(3, int)
+        assert_equal(
+            np.array2string(arr, edgeitems=1, threshold=0),
+            "[0 ... 0]"
+        )
+
+    def test_summarize_1d(self):
+        A = np.arange(1001)
+        strA = '[   0    1    2 ...  998  999 1000]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([   0,    1,    2, ...,  998,  999, 1000])'
+        assert_equal(repr(A), reprA)
+
+    def test_summarize_2d(self):
+        A = np.arange(1002).reshape(2, 501)
+        strA = '[[   0    1    2 ...  498  499  500]\n' \
+               ' [ 501  502  503 ...  999 1000 1001]]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([[   0,    1,    2, ...,  498,  499,  500],\n' \
+                '       [ 501,  502,  503, ...,  999, 1000, 1001]])'
+        assert_equal(repr(A), reprA)
+
+    def test_linewidth(self):
+        a = np.full(6, 1)
+
+        def make_str(a, width, **kw):
+            return np.array2string(a, separator="", max_line_width=width, **kw)
+
+        assert_equal(make_str(a, 8, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 7, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 5, legacy='1.13'), '[1111\n'
+                                                    ' 11]')
+
+        assert_equal(make_str(a, 8), '[111111]')
+        assert_equal(make_str(a, 7), '[11111\n'
+                                     ' 1]')
+        assert_equal(make_str(a, 5), '[111\n'
+                                     ' 111]')
+
+        b = a[None,None,:]
+
+        assert_equal(make_str(b, 12, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  9, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  8, legacy='1.13'), '[[[11111\n'
+                                                     '   1]]]')
+
+        assert_equal(make_str(b, 12), '[[[111111]]]')
+        assert_equal(make_str(b,  9), '[[[111\n'
+                                      '   111]]]')
+        assert_equal(make_str(b,  8), '[[[11\n'
+                                      '   11\n'
+                                      '   11]]]')
+
+    def test_wide_element(self):
+        a = np.array(['xxxxx'])
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            "['xxxxx']"
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5, legacy='1.13'),
+            "[ 'xxxxx']"
+        )
+
+    @given(hynp.from_dtype(np.dtype("U")))
+    def test_any_text(self, text):
+        # This test checks that, given any value that can be represented in an
+        # array of dtype("U") (i.e. unicode string), ...
+        a = np.array([text, text, text])
+        # casting a list of them to an array does not e.g. truncate the value
+        assert_equal(a[0], text)
+        # and that np.array2string puts a newline in the expected location
+        expected_repr = "[{0!r} {0!r}\n {0!r}]".format(text)
+        result = np.array2string(a, max_line_width=len(repr(text)) * 2 + 3)
+        assert_equal(result, expected_repr)
+
+    @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts")
+    def test_refcount(self):
+        # make sure we do not hold references to the array due to a recursive
+        # closure (gh-10620)
+        gc.disable()
+        a = np.arange(2)
+        r1 = sys.getrefcount(a)
+        np.array2string(a)
+        np.array2string(a)
+        r2 = sys.getrefcount(a)
+        gc.collect()
+        gc.enable()
+        assert_(r1 == r2)
+
+class TestPrintOptions:
+    """Test getting and setting global print options."""
+
+    def setup(self):
+        self.oldopts = np.get_printoptions()
+
+    def teardown(self):
+        np.set_printoptions(**self.oldopts)
+
+    def test_basic(self):
+        x = np.array([1.5, 0, 1.234567890])
+        assert_equal(repr(x), "array([1.5       , 0.        , 1.23456789])")
+        np.set_printoptions(precision=4)
+        assert_equal(repr(x), "array([1.5   , 0.    , 1.2346])")
+
+    def test_precision_zero(self):
+        np.set_printoptions(precision=0)
+        for values, string in (
+                ([0.], "0."), ([.3], "0."), ([-.3], "-0."), ([.7], "1."),
+                ([1.5], "2."), ([-1.5], "-2."), ([-15.34], "-15."),
+                ([100.], "100."), ([.2, -1, 122.51], "  0.,  -1., 123."),
+                ([0], "0"), ([-12], "-12"), ([complex(.3, -.7)], "0.-1.j")):
+            x = np.array(values)
+            assert_equal(repr(x), "array([%s])" % string)
+
+    def test_formatter(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+
+    def test_formatter_reset(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'all':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'int':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int_kind':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        x = np.arange(3.)
+        np.set_printoptions(formatter={'float':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1.0, 0.0, 1.0])")
+        np.set_printoptions(formatter={'float_kind':None})
+        assert_equal(repr(x), "array([0., 1., 2.])")
+
+    def test_0d_arrays(self):
+        assert_equal(str(np.array(u'café', '<U4')), u'café')
+
+        assert_equal(repr(np.array('café', '<U4')),
+                     "array('café', dtype='<U4')")
+        assert_equal(str(np.array('test', np.str_)), 'test')
+
+        a = np.zeros(1, dtype=[('a', '<i4', (3,))])
+        assert_equal(str(a[0]), '([0, 0, 0],)')
+
+        assert_equal(repr(np.datetime64('2005-02-25')[...]),
+                     "array('2005-02-25', dtype='datetime64[D]')")
+
+        assert_equal(repr(np.timedelta64('10', 'Y')[...]),
+                     "array(10, dtype='timedelta64[Y]')")
+
+        # repr of 0d arrays is affected by printoptions
+        x = np.array(1)
+        np.set_printoptions(formatter={'all':lambda x: "test"})
+        assert_equal(repr(x), "array(test)")
+        # str is unaffected
+        assert_equal(str(x), "1")
+
+        # check `style` arg raises
+        assert_warns(DeprecationWarning, np.array2string,
+                                         np.array(1.), style=repr)
+        # but not in legacy mode
+        np.array2string(np.array(1.), style=repr, legacy='1.13')
+        # gh-10934 style was broken in legacy mode, check it works
+        np.array2string(np.array(1.), legacy='1.13')
+
+    def test_float_spacing(self):
+        x = np.array([1., 2., 3.])
+        y = np.array([1., 2., -10.])
+        z = np.array([100., 2., -1.])
+        w = np.array([-100., 2., 1.])
+
+        assert_equal(repr(x), 'array([1., 2., 3.])')
+        assert_equal(repr(y), 'array([  1.,   2., -10.])')
+        assert_equal(repr(np.array(y[0])), 'array(1.)')
+        assert_equal(repr(np.array(y[-1])), 'array(-10.)')
+        assert_equal(repr(z), 'array([100.,   2.,  -1.])')
+        assert_equal(repr(w), 'array([-100.,    2.,    1.])')
+
+        assert_equal(repr(np.array([np.nan, np.inf])), 'array([nan, inf])')
+        assert_equal(repr(np.array([np.nan, -np.inf])), 'array([ nan, -inf])')
+
+        x = np.array([np.inf, 100000, 1.1234])
+        y = np.array([np.inf, 100000, -1.1234])
+        z = np.array([np.inf, 1.1234, -1e120])
+        np.set_printoptions(precision=2)
+        assert_equal(repr(x), 'array([     inf, 1.00e+05, 1.12e+00])')
+        assert_equal(repr(y), 'array([      inf,  1.00e+05, -1.12e+00])')
+        assert_equal(repr(z), 'array([       inf,  1.12e+000, -1.00e+120])')
+
+    def test_bool_spacing(self):
+        assert_equal(repr(np.array([True,  True])),
+                     'array([ True,  True])')
+        assert_equal(repr(np.array([True, False])),
+                     'array([ True, False])')
+        assert_equal(repr(np.array([True])),
+                     'array([ True])')
+        assert_equal(repr(np.array(True)),
+                     'array(True)')
+        assert_equal(repr(np.array(False)),
+                     'array(False)')
+
+    def test_sign_spacing(self):
+        a = np.arange(4.)
+        b = np.array([1.234e9])
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        assert_equal(repr(a), 'array([0., 1., 2., 3.])')
+        assert_equal(repr(np.array(1.)), 'array(1.)')
+        assert_equal(repr(b), 'array([1.234e+09])')
+        assert_equal(repr(np.array([0.])), 'array([0.])')
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign=' ')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(np.array(1.)), 'array( 1.)')
+        assert_equal(repr(b), 'array([ 1.234e+09])')
+        assert_equal(repr(c),
+            "array([ 1.        +1.j        ,  1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign='+')
+        assert_equal(repr(a), 'array([+0., +1., +2., +3.])')
+        assert_equal(repr(np.array(1.)), 'array(+1.)')
+        assert_equal(repr(b), 'array([+1.234e+09])')
+        assert_equal(repr(c),
+            "array([+1.        +1.j        , +1.12345679+1.12345679j])")
+
+        np.set_printoptions(legacy='1.13')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(b),  'array([  1.23400000e+09])')
+        assert_equal(repr(-b), 'array([ -1.23400000e+09])')
+        assert_equal(repr(np.array(1.)), 'array(1.0)')
+        assert_equal(repr(np.array([0.])), 'array([ 0.])')
+        assert_equal(repr(c),
+            "array([ 1.00000000+1.j        ,  1.12345679+1.12345679j])")
+        # gh-10383
+        assert_equal(str(np.array([-1., 10])), "[ -1.  10.]")
+
+        assert_raises(TypeError, np.set_printoptions, wrongarg=True)
+
+    def test_float_overflow_nowarn(self):
+        # make sure internal computations in FloatingFormat don't
+        # warn about overflow
+        repr(np.array([1e4, 0.1], dtype='f2'))
+
+    def test_sign_spacing_structured(self):
+        a = np.ones(2, dtype='<f,<f')
+        assert_equal(repr(a),
+            "array([(1., 1.), (1., 1.)], dtype=[('f0', '<f4'), ('f1', '<f4')])")
+        assert_equal(repr(a[0]), "(1., 1.)")
+
+    def test_floatmode(self):
+        x = np.array([0.6104, 0.922, 0.457, 0.0906, 0.3733, 0.007244,
+                      0.5933, 0.947, 0.2383, 0.4226], dtype=np.float16)
+        y = np.array([0.2918820979355541, 0.5064172631089138,
+                      0.2848750619642916, 0.4342965294660567,
+                      0.7326538397312751, 0.3459503329096204,
+                      0.0862072768214508, 0.39112753029631175],
+                      dtype=np.float64)
+        z = np.arange(6, dtype=np.float16)/10
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        # also make sure 1e23 is right (is between two fp numbers)
+        w = np.array(['1e{}'.format(i) for i in range(25)], dtype=np.float64)
+        # note: we construct w from the strings `1eXX` instead of doing
+        # `10.**arange(24)` because it turns out the two are not equivalent in
+        # python. On some architectures `1e23 != 10.**23`.
+        wp = np.array([1.234e1, 1e2, 1e123])
+
+        # unique mode
+        np.set_printoptions(floatmode='unique')
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918820979355541 , 0.5064172631089138 , 0.2848750619642916 ,\n"
+            "       0.4342965294660567 , 0.7326538397312751 , 0.3459503329096204 ,\n"
+            "       0.0862072768214508 , 0.39112753029631175])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w),
+            "array([1.e+00, 1.e+01, 1.e+02, 1.e+03, 1.e+04, 1.e+05, 1.e+06, 1.e+07,\n"
+            "       1.e+08, 1.e+09, 1.e+10, 1.e+11, 1.e+12, 1.e+13, 1.e+14, 1.e+15,\n"
+            "       1.e+16, 1.e+17, 1.e+18, 1.e+19, 1.e+20, 1.e+21, 1.e+22, 1.e+23,\n"
+            "       1.e+24])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.         +1.j         , 1.123456789+1.123456789j])")
+
+        # maxprec mode, precision=8
+        np.set_printoptions(floatmode='maxprec', precision=8)
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918821 , 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+
+        # fixed mode, precision=4
+        np.set_printoptions(floatmode='fixed', precision=4)
+        assert_equal(repr(x),
+            "array([0.6104, 0.9219, 0.4570, 0.0906, 0.3733, 0.0072, 0.5933, 0.9468,\n"
+            "       0.2383, 0.4226], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2919, 0.5064, 0.2849, 0.4343, 0.7327, 0.3460, 0.0862, 0.3911])")
+        assert_equal(repr(z),
+            "array([0.0000, 0.1000, 0.2000, 0.3000, 0.3999, 0.5000], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.0000e+00, 1.0000e+05, 1.0000e+10, 1.0000e+15, 1.0000e+20])")
+        assert_equal(repr(wp), "array([1.2340e+001, 1.0000e+002, 1.0000e+123])")
+        assert_equal(repr(np.zeros(3)), "array([0.0000, 0.0000, 0.0000])")
+        assert_equal(repr(c),
+            "array([1.0000+1.0000j, 1.1235+1.1235j])")
+        # for larger precision, representation error becomes more apparent:
+        np.set_printoptions(floatmode='fixed', precision=8)
+        assert_equal(repr(z),
+            "array([0.00000000, 0.09997559, 0.19995117, 0.30004883, 0.39990234,\n"
+            "       0.50000000], dtype=float16)")
+
+        # maxprec_equal  mode, precision=8
+        np.set_printoptions(floatmode='maxprec_equal', precision=8)
+        assert_equal(repr(x),
+            "array([0.610352, 0.921875, 0.457031, 0.090576, 0.373291, 0.007244,\n"
+            "       0.593262, 0.946777, 0.238281, 0.422607], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.29188210, 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0.0, 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.00000000+1.00000000j, 1.12345679+1.12345679j])")
+
+    def test_legacy_mode_scalars(self):
+        # in legacy mode, str of floats get truncated, and complex scalars
+        # use * for non-finite imaginary part
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.float64(1.123456789123456789)), '1.12345678912')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nan*j)')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.float64(1.123456789123456789)),
+                     '1.1234567891234568')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nanj)')
+
+    def test_legacy_stray_comma(self):
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ..., 9997 9998 9999]')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ... 9997 9998 9999]')
+
+    def test_dtype_linewidth_wrapping(self):
+        np.set_printoptions(linewidth=75)
+        assert_equal(repr(np.arange(10,20., dtype='f4')),
+            "array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19.], dtype=float32)")
+        assert_equal(repr(np.arange(10,23., dtype='f4')), textwrap.dedent("""\
+            array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19., 20., 21., 22.],
+                  dtype=float32)"""))
+
+        styp = '<U4'
+        assert_equal(repr(np.ones(3, dtype=styp)),
+            "array(['1', '1', '1'], dtype='{}')".format(styp))
+        assert_equal(repr(np.ones(12, dtype=styp)), textwrap.dedent("""\
+            array(['1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1'],
+                  dtype='{}')""".format(styp)))
+
+    def test_linewidth_repr(self):
+        a = np.full(7, fill_value=2)
+        np.set_printoptions(linewidth=17)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2])""")
+        )
+        np.set_printoptions(linewidth=17, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+        a = np.full(8, fill_value=2)
+
+        np.set_printoptions(linewidth=18, legacy=False)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2, 2])""")
+        )
+
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+    def test_linewidth_str(self):
+        a = np.full(18, fill_value=2)
+        np.set_printoptions(linewidth=18)
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2
+             2 2]""")
+        )
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2 2]""")
+        )
+
+    def test_edgeitems(self):
+        np.set_printoptions(edgeitems=1, threshold=1)
+        a = np.arange(27).reshape((3, 3, 3))
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ...,
+                    [ 6, ...,  8]],
+
+                   ...,
+
+                   [[18, ..., 20],
+                    ...,
+                    [24, ..., 26]]])""")
+        )
+
+        b = np.zeros((3, 3, 1, 1))
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[0.]],
+
+                    ...,
+
+                    [[0.]]],
+
+
+                   ...,
+
+
+                   [[[0.]],
+
+                    ...,
+
+                    [[0.]]]])""")
+        )
+
+        # 1.13 had extra trailing spaces, and was missing newlines
+        np.set_printoptions(legacy='1.13')
+
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ..., 
+                    [ 6, ...,  8]],
+
+                   ..., 
+                   [[18, ..., 20],
+                    ..., 
+                    [24, ..., 26]]])""")
+        )
+
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[ 0.]],
+
+                    ..., 
+                    [[ 0.]]],
+
+
+                   ..., 
+                   [[[ 0.]],
+
+                    ..., 
+                    [[ 0.]]]])""")
+        )
+
+    def test_bad_args(self):
+        assert_raises(ValueError, np.set_printoptions, threshold=float('nan'))
+        assert_raises(TypeError, np.set_printoptions, threshold='1')
+        assert_raises(TypeError, np.set_printoptions, threshold=b'1')
+
+def test_unicode_object_array():
+    expected = "array(['é'], dtype=object)"
+    x = np.array([u'\xe9'], dtype=object)
+    assert_equal(repr(x), expected)
+
+
+class TestContextManager:
+    def test_ctx_mgr(self):
+        # test that context manager actually works
+        with np.printoptions(precision=2):
+            s = str(np.array([2.0]) / 3)
+        assert_equal(s, '[0.67]')
+
+    def test_ctx_mgr_restores(self):
+        # test that print options are actually restrored
+        opts = np.get_printoptions()
+        with np.printoptions(precision=opts['precision'] - 1,
+                             linewidth=opts['linewidth'] - 4):
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_exceptions(self):
+        # test that print options are restored even if an exception is raised
+        opts = np.get_printoptions()
+        try:
+            with np.printoptions(precision=2, linewidth=11):
+                raise ValueError
+        except ValueError:
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_as_smth(self):
+        opts = {"precision": 2}
+        with np.printoptions(**opts) as ctx:
+            saved_opts = ctx.copy()
+        assert_equal({k: saved_opts[k] for k in opts}, opts)

venv/Lib/site-packages/numpy/core/tests/test_conversion_utils.py

@@ -0,0 +1,156 @@
+"""
+Tests for numpy/core/src/multiarray/conversion_utils.c
+"""
+import re
+
+import pytest
+
+import numpy as np
+import numpy.core._multiarray_tests as mt
+
+
+class StringConverterTestCase:
+    allow_bytes = True
+    case_insensitive = True
+    exact_match = False
+
+    def _check_value_error(self, val):
+        pattern = r'\(got {}\)'.format(re.escape(repr(val)))
+        with pytest.raises(ValueError, match=pattern) as exc:
+            self.conv(val)
+
+    def _check(self, val, expected):
+        assert self.conv(val) == expected
+
+        if self.allow_bytes:
+            assert self.conv(val.encode('ascii')) == expected
+        else:
+            with pytest.raises(TypeError):
+                self.conv(val.encode('ascii'))
+
+        if len(val) != 1:
+            if self.exact_match:
+                self._check_value_error(val[:1])
+                self._check_value_error(val + '\0')
+            else:
+                assert self.conv(val[:1]) == expected
+
+        if self.case_insensitive:
+            if val != val.lower():
+                assert self.conv(val.lower()) == expected
+            if val != val.upper():
+                assert self.conv(val.upper()) == expected
+        else:
+            if val != val.lower():
+                self._check_value_error(val.lower())
+            if val != val.upper():
+                self._check_value_error(val.upper())
+
+    def test_wrong_type(self):
+        # common cases which apply to all the below
+        with pytest.raises(TypeError):
+            self.conv({})
+        with pytest.raises(TypeError):
+            self.conv([])
+
+    def test_wrong_value(self):
+        # nonsense strings
+        self._check_value_error('')
+        self._check_value_error('\N{greek small letter pi}')
+
+        if self.allow_bytes:
+            self._check_value_error(b'')
+            # bytes which can't be converted to strings via utf8
+            self._check_value_error(b"\xFF")
+        if self.exact_match:
+            self._check_value_error("there's no way this is supported")
+
+
+class TestByteorderConverter(StringConverterTestCase):
+    """ Tests of PyArray_ByteorderConverter """
+    conv = mt.run_byteorder_converter
+    def test_valid(self):
+        for s in ['big', '>']:
+            self._check(s, 'NPY_BIG')
+        for s in ['little', '<']:
+            self._check(s, 'NPY_LITTLE')
+        for s in ['native', '=']:
+            self._check(s, 'NPY_NATIVE')
+        for s in ['ignore', '|']:
+            self._check(s, 'NPY_IGNORE')
+        for s in ['swap']:
+            self._check(s, 'NPY_SWAP')
+
+
+class TestSortkindConverter(StringConverterTestCase):
+    """ Tests of PyArray_SortkindConverter """
+    conv = mt.run_sortkind_converter
+    def test_valid(self):
+        self._check('quick', 'NPY_QUICKSORT')
+        self._check('heap', 'NPY_HEAPSORT')
+        self._check('merge', 'NPY_STABLESORT')  # alias
+        self._check('stable', 'NPY_STABLESORT')
+
+
+class TestSelectkindConverter(StringConverterTestCase):
+    """ Tests of PyArray_SelectkindConverter """
+    conv = mt.run_selectkind_converter
+    case_insensitive = False
+    exact_match = True
+
+    def test_valid(self):
+        self._check('introselect', 'NPY_INTROSELECT')
+
+
+class TestSearchsideConverter(StringConverterTestCase):
+    """ Tests of PyArray_SearchsideConverter """
+    conv = mt.run_searchside_converter
+    def test_valid(self):
+        self._check('left', 'NPY_SEARCHLEFT')
+        self._check('right', 'NPY_SEARCHRIGHT')
+
+
+class TestOrderConverter(StringConverterTestCase):
+    """ Tests of PyArray_OrderConverter """
+    conv = mt.run_order_converter
+    def test_valid(self):
+        self._check('c', 'NPY_CORDER')
+        self._check('f', 'NPY_FORTRANORDER')
+        self._check('a', 'NPY_ANYORDER')
+        self._check('k', 'NPY_KEEPORDER')
+
+    def test_flatten_invalid_order(self):
+        # invalid after gh-14596
+        with pytest.raises(ValueError):
+            self.conv('Z')
+        for order in [False, True, 0, 8]:
+            with pytest.raises(TypeError):
+                self.conv(order)
+
+
+class TestClipmodeConverter(StringConverterTestCase):
+    """ Tests of PyArray_ClipmodeConverter """
+    conv = mt.run_clipmode_converter
+    def test_valid(self):
+        self._check('clip', 'NPY_CLIP')
+        self._check('wrap', 'NPY_WRAP')
+        self._check('raise', 'NPY_RAISE')
+
+        # integer values allowed here
+        assert self.conv(np.CLIP) == 'NPY_CLIP'
+        assert self.conv(np.WRAP) == 'NPY_WRAP'
+        assert self.conv(np.RAISE) == 'NPY_RAISE'
+
+
+class TestCastingConverter(StringConverterTestCase):
+    """ Tests of PyArray_CastingConverter """
+    conv = mt.run_casting_converter
+    case_insensitive = False
+    exact_match = True
+
+    def test_valid(self):
+        self._check("no", "NPY_NO_CASTING")
+        self._check("equiv", "NPY_EQUIV_CASTING")
+        self._check("safe", "NPY_SAFE_CASTING")
+        self._check("same_kind", "NPY_SAME_KIND_CASTING")
+        self._check("unsafe", "NPY_UNSAFE_CASTING")

venv/Lib/site-packages/numpy/core/tests/test_cpu_features.py

@@ -0,0 +1,171 @@
+import sys, platform, re, pytest
+from numpy.core._multiarray_umath import __cpu_features__
+
+def assert_features_equal(actual, desired, fname):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    actual, desired = str(actual), str(desired)
+    if actual == desired:
+        return
+    detected = str(__cpu_features__).replace("'", "")
+    try:
+        with open("/proc/cpuinfo", "r") as fd:
+            cpuinfo = fd.read(2048)
+    except Exception as err:
+        cpuinfo = str(err)
+
+    try:
+        import subprocess
+        auxv = subprocess.check_output(['/bin/true'], env=dict(LD_SHOW_AUXV="1"))
+        auxv = auxv.decode()
+    except Exception as err:
+        auxv = str(err)
+
+    import textwrap
+    error_report = textwrap.indent(
+"""
+###########################################
+### Extra debugging information
+###########################################
+-------------------------------------------
+--- NumPy Detections
+-------------------------------------------
+%s
+-------------------------------------------
+--- SYS / CPUINFO
+-------------------------------------------
+%s....
+-------------------------------------------
+--- SYS / AUXV
+-------------------------------------------
+%s
+""" % (detected, cpuinfo, auxv), prefix='\r')
+
+    raise AssertionError((
+        "Failure Detection\n"
+        " NAME: '%s'\n"
+        " ACTUAL: %s\n"
+        " DESIRED: %s\n"
+        "%s"
+    ) % (fname, actual, desired, error_report))
+
+class AbstractTest(object):
+    features = []
+    features_groups = {}
+    features_map = {}
+    features_flags = set()
+
+    def load_flags(self):
+        # a hook
+        pass
+    def test_features(self):
+        self.load_flags()
+        for gname, features in self.features_groups.items():
+            test_features = [self.cpu_have(f) for f in features]
+            assert_features_equal(__cpu_features__.get(gname), all(test_features), gname)
+
+        for feature_name in self.features:
+            cpu_have = self.cpu_have(feature_name)
+            npy_have = __cpu_features__.get(feature_name)
+            assert_features_equal(npy_have, cpu_have, feature_name)
+
+    def cpu_have(self, feature_name):
+        map_names = self.features_map.get(feature_name, feature_name)
+        if isinstance(map_names, str):
+            return map_names in self.features_flags
+        for f in map_names:
+            if f in self.features_flags:
+                return True
+        return False
+
+    def load_flags_cpuinfo(self, magic_key):
+        self.features_flags = self.get_cpuinfo_item(magic_key)
+
+    def get_cpuinfo_item(self, magic_key):
+        values = set()
+        with open('/proc/cpuinfo') as fd:
+            for line in fd:
+                if not line.startswith(magic_key):
+                    continue
+                flags_value = [s.strip() for s in line.split(':', 1)]
+                if len(flags_value) == 2:
+                    values = values.union(flags_value[1].upper().split())
+        return values
+
+    def load_flags_auxv(self):
+        import subprocess
+        auxv = subprocess.check_output(['/bin/true'], env=dict(LD_SHOW_AUXV="1"))
+        for at in auxv.split(b'\n'):
+            if not at.startswith(b"AT_HWCAP"):
+                continue
+            hwcap_value = [s.strip() for s in at.split(b':', 1)]
+            if len(hwcap_value) == 2:
+                self.features_flags = self.features_flags.union(
+                    hwcap_value[1].upper().decode().split()
+                )
+
+is_linux = sys.platform.startswith('linux')
+machine  = platform.machine()
+is_x86   = re.match("^(amd64|x86|i386|i686)", machine, re.IGNORECASE)
+@pytest.mark.skipif(not is_linux or not is_x86, reason="Only for Linux and x86")
+class Test_X86_Features(AbstractTest):
+    features = [
+        "MMX", "SSE", "SSE2", "SSE3", "SSSE3", "SSE41", "POPCNT", "SSE42",
+        "AVX", "F16C", "XOP", "FMA4", "FMA3", "AVX2", "AVX512F", "AVX512CD",
+        "AVX512ER", "AVX512PF", "AVX5124FMAPS", "AVX5124VNNIW", "AVX512VPOPCNTDQ",
+        "AVX512VL", "AVX512BW", "AVX512DQ", "AVX512VNNI", "AVX512IFMA",
+        "AVX512VBMI", "AVX512VBMI2", "AVX512BITALG",
+    ]
+    features_groups = dict(
+        AVX512_KNL = ["AVX512F", "AVX512CD", "AVX512ER", "AVX512PF"],
+        AVX512_KNM = ["AVX512F", "AVX512CD", "AVX512ER", "AVX512PF", "AVX5124FMAPS",
+                      "AVX5124VNNIW", "AVX512VPOPCNTDQ"],
+        AVX512_SKX = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL"],
+        AVX512_CLX = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL", "AVX512VNNI"],
+        AVX512_CNL = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL", "AVX512IFMA",
+                      "AVX512VBMI"],
+        AVX512_ICL = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL", "AVX512IFMA",
+                      "AVX512VBMI", "AVX512VNNI", "AVX512VBMI2", "AVX512BITALG", "AVX512VPOPCNTDQ"],
+    )
+    features_map = dict(
+        SSE3="PNI", SSE41="SSE4_1", SSE42="SSE4_2", FMA3="FMA",
+        AVX512VNNI="AVX512_VNNI", AVX512BITALG="AVX512_BITALG", AVX512VBMI2="AVX512_VBMI2",
+        AVX5124FMAPS="AVX512_4FMAPS", AVX5124VNNIW="AVX512_4VNNIW", AVX512VPOPCNTDQ="AVX512_VPOPCNTDQ",
+    )
+    def load_flags(self):
+        self.load_flags_cpuinfo("flags")
+
+is_power = re.match("^(powerpc|ppc)64", machine, re.IGNORECASE)
+@pytest.mark.skipif(not is_linux or not is_power, reason="Only for Linux and Power")
+class Test_POWER_Features(AbstractTest):
+    features = ["VSX", "VSX2", "VSX3"]
+    features_map = dict(VSX2="ARCH_2_07", VSX3="ARCH_3_00")
+
+    def load_flags(self):
+        self.load_flags_auxv()
+
+is_arm = re.match("^(arm|aarch64)", machine, re.IGNORECASE)
+@pytest.mark.skipif(not is_linux or not is_arm, reason="Only for Linux and ARM")
+class Test_ARM_Features(AbstractTest):
+    features = [
+        "NEON", "ASIMD", "FPHP", "ASIMDHP", "ASIMDDP", "ASIMDFHM"
+    ]
+    features_groups = dict(
+        NEON_FP16  = ["NEON", "HALF"],
+        NEON_VFPV4 = ["NEON", "VFPV4"],
+    )
+    def load_flags(self):
+        self.load_flags_cpuinfo("Features")
+        arch = self.get_cpuinfo_item("CPU architecture")
+        # in case of mounting virtual filesystem of aarch64 kernel
+        is_rootfs_v8 = int('0'+next(iter(arch))) > 7 if arch else 0
+        if  re.match("^(aarch64|AARCH64)", machine) or is_rootfs_v8:
+            self.features_map = dict(
+                NEON="ASIMD", HALF="ASIMD", VFPV4="ASIMD"
+            )
+        else:
+            self.features_map = dict(
+                # ELF auxiliary vector and /proc/cpuinfo on Linux kernel(armv8 aarch32)
+                # doesn't provide information about ASIMD, so we assume that ASIMD is supported
+                # if the kernel reports any one of the following ARM8 features.
+                ASIMD=("AES", "SHA1", "SHA2", "PMULL", "CRC32")
+            )

venv/Lib/site-packages/numpy/core/tests/test_defchararray.py

@@ -0,0 +1,667 @@
+
+import numpy as np
+from numpy.core.multiarray import _vec_string
+from numpy.testing import (
+    assert_, assert_equal, assert_array_equal, assert_raises,
+    assert_raises_regex
+    )
+
+kw_unicode_true = {'unicode': True}  # make 2to3 work properly
+kw_unicode_false = {'unicode': False}
+
+class TestBasic:
+    def test_from_object_array(self):
+        A = np.array([['abc', 2],
+                      ['long   ', '0123456789']], dtype='O')
+        B = np.char.array(A)
+        assert_equal(B.dtype.itemsize, 10)
+        assert_array_equal(B, [[b'abc', b'2'],
+                               [b'long', b'0123456789']])
+
+    def test_from_object_array_unicode(self):
+        A = np.array([['abc', u'Sigma \u03a3'],
+                      ['long   ', '0123456789']], dtype='O')
+        assert_raises(ValueError, np.char.array, (A,))
+        B = np.char.array(A, **kw_unicode_true)
+        assert_equal(B.dtype.itemsize, 10 * np.array('a', 'U').dtype.itemsize)
+        assert_array_equal(B, [['abc', u'Sigma \u03a3'],
+                               ['long', '0123456789']])
+
+    def test_from_string_array(self):
+        A = np.array([[b'abc', b'foo'],
+                      [b'long   ', b'0123456789']])
+        assert_equal(A.dtype.type, np.string_)
+        B = np.char.array(A)
+        assert_array_equal(B, A)
+        assert_equal(B.dtype, A.dtype)
+        assert_equal(B.shape, A.shape)
+        B[0, 0] = 'changed'
+        assert_(B[0, 0] != A[0, 0])
+        C = np.char.asarray(A)
+        assert_array_equal(C, A)
+        assert_equal(C.dtype, A.dtype)
+        C[0, 0] = 'changed again'
+        assert_(C[0, 0] != B[0, 0])
+        assert_(C[0, 0] == A[0, 0])
+
+    def test_from_unicode_array(self):
+        A = np.array([['abc', u'Sigma \u03a3'],
+                      ['long   ', '0123456789']])
+        assert_equal(A.dtype.type, np.unicode_)
+        B = np.char.array(A)
+        assert_array_equal(B, A)
+        assert_equal(B.dtype, A.dtype)
+        assert_equal(B.shape, A.shape)
+        B = np.char.array(A, **kw_unicode_true)
+        assert_array_equal(B, A)
+        assert_equal(B.dtype, A.dtype)
+        assert_equal(B.shape, A.shape)
+
+        def fail():
+            np.char.array(A, **kw_unicode_false)
+
+        assert_raises(UnicodeEncodeError, fail)
+
+    def test_unicode_upconvert(self):
+        A = np.char.array(['abc'])
+        B = np.char.array([u'\u03a3'])
+        assert_(issubclass((A + B).dtype.type, np.unicode_))
+
+    def test_from_string(self):
+        A = np.char.array(b'abc')
+        assert_equal(len(A), 1)
+        assert_equal(len(A[0]), 3)
+        assert_(issubclass(A.dtype.type, np.string_))
+
+    def test_from_unicode(self):
+        A = np.char.array(u'\u03a3')
+        assert_equal(len(A), 1)
+        assert_equal(len(A[0]), 1)
+        assert_equal(A.itemsize, 4)
+        assert_(issubclass(A.dtype.type, np.unicode_))
+
+class TestVecString:
+    def test_non_existent_method(self):
+
+        def fail():
+            _vec_string('a', np.string_, 'bogus')
+
+        assert_raises(AttributeError, fail)
+
+    def test_non_string_array(self):
+
+        def fail():
+            _vec_string(1, np.string_, 'strip')
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_args_tuple(self):
+
+        def fail():
+            _vec_string(['a'], np.string_, 'strip', 1)
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_type_descr(self):
+
+        def fail():
+            _vec_string(['a'], 'BOGUS', 'strip')
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_function_args(self):
+
+        def fail():
+            _vec_string(['a'], np.string_, 'strip', (1,))
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_result_type(self):
+
+        def fail():
+            _vec_string(['a'], np.int_, 'strip')
+
+        assert_raises(TypeError, fail)
+
+    def test_broadcast_error(self):
+
+        def fail():
+            _vec_string([['abc', 'def']], np.int_, 'find', (['a', 'd', 'j'],))
+
+        assert_raises(ValueError, fail)
+
+
+class TestWhitespace:
+    def setup(self):
+        self.A = np.array([['abc ', '123  '],
+                           ['789 ', 'xyz ']]).view(np.chararray)
+        self.B = np.array([['abc', '123'],
+                           ['789', 'xyz']]).view(np.chararray)
+
+    def test1(self):
+        assert_(np.all(self.A == self.B))
+        assert_(np.all(self.A >= self.B))
+        assert_(np.all(self.A <= self.B))
+        assert_(not np.any(self.A > self.B))
+        assert_(not np.any(self.A < self.B))
+        assert_(not np.any(self.A != self.B))
+
+class TestChar:
+    def setup(self):
+        self.A = np.array('abc1', dtype='c').view(np.chararray)
+
+    def test_it(self):
+        assert_equal(self.A.shape, (4,))
+        assert_equal(self.A.upper()[:2].tobytes(), b'AB')
+
+class TestComparisons:
+    def setup(self):
+        self.A = np.array([['abc', '123'],
+                           ['789', 'xyz']]).view(np.chararray)
+        self.B = np.array([['efg', '123  '],
+                           ['051', 'tuv']]).view(np.chararray)
+
+    def test_not_equal(self):
+        assert_array_equal((self.A != self.B), [[True, False], [True, True]])
+
+    def test_equal(self):
+        assert_array_equal((self.A == self.B), [[False, True], [False, False]])
+
+    def test_greater_equal(self):
+        assert_array_equal((self.A >= self.B), [[False, True], [True, True]])
+
+    def test_less_equal(self):
+        assert_array_equal((self.A <= self.B), [[True, True], [False, False]])
+
+    def test_greater(self):
+        assert_array_equal((self.A > self.B), [[False, False], [True, True]])
+
+    def test_less(self):
+        assert_array_equal((self.A < self.B), [[True, False], [False, False]])
+
+class TestComparisonsMixed1(TestComparisons):
+    """Ticket #1276"""
+
+    def setup(self):
+        TestComparisons.setup(self)
+        self.B = np.array([['efg', '123  '],
+                           ['051', 'tuv']], np.unicode_).view(np.chararray)
+
+class TestComparisonsMixed2(TestComparisons):
+    """Ticket #1276"""
+
+    def setup(self):
+        TestComparisons.setup(self)
+        self.A = np.array([['abc', '123'],
+                           ['789', 'xyz']], np.unicode_).view(np.chararray)
+
+class TestInformation:
+    def setup(self):
+        self.A = np.array([[' abc ', ''],
+                           ['12345', 'MixedCase'],
+                           ['123 \t 345 \0 ', 'UPPER']]).view(np.chararray)
+        self.B = np.array([[u' \u03a3 ', u''],
+                           [u'12345', u'MixedCase'],
+                           [u'123 \t 345 \0 ', u'UPPER']]).view(np.chararray)
+
+    def test_len(self):
+        assert_(issubclass(np.char.str_len(self.A).dtype.type, np.integer))
+        assert_array_equal(np.char.str_len(self.A), [[5, 0], [5, 9], [12, 5]])
+        assert_array_equal(np.char.str_len(self.B), [[3, 0], [5, 9], [12, 5]])
+
+    def test_count(self):
+        assert_(issubclass(self.A.count('').dtype.type, np.integer))
+        assert_array_equal(self.A.count('a'), [[1, 0], [0, 1], [0, 0]])
+        assert_array_equal(self.A.count('123'), [[0, 0], [1, 0], [1, 0]])
+        # Python doesn't seem to like counting NULL characters
+        # assert_array_equal(self.A.count('\0'), [[0, 0], [0, 0], [1, 0]])
+        assert_array_equal(self.A.count('a', 0, 2), [[1, 0], [0, 0], [0, 0]])
+        assert_array_equal(self.B.count('a'), [[0, 0], [0, 1], [0, 0]])
+        assert_array_equal(self.B.count('123'), [[0, 0], [1, 0], [1, 0]])
+        # assert_array_equal(self.B.count('\0'), [[0, 0], [0, 0], [1, 0]])
+
+    def test_endswith(self):
+        assert_(issubclass(self.A.endswith('').dtype.type, np.bool_))
+        assert_array_equal(self.A.endswith(' '), [[1, 0], [0, 0], [1, 0]])
+        assert_array_equal(self.A.endswith('3', 0, 3), [[0, 0], [1, 0], [1, 0]])
+
+        def fail():
+            self.A.endswith('3', 'fdjk')
+
+        assert_raises(TypeError, fail)
+
+    def test_find(self):
+        assert_(issubclass(self.A.find('a').dtype.type, np.integer))
+        assert_array_equal(self.A.find('a'), [[1, -1], [-1, 6], [-1, -1]])
+        assert_array_equal(self.A.find('3'), [[-1, -1], [2, -1], [2, -1]])
+        assert_array_equal(self.A.find('a', 0, 2), [[1, -1], [-1, -1], [-1, -1]])
+        assert_array_equal(self.A.find(['1', 'P']), [[-1, -1], [0, -1], [0, 1]])
+
+    def test_index(self):
+
+        def fail():
+            self.A.index('a')
+
+        assert_raises(ValueError, fail)
+        assert_(np.char.index('abcba', 'b') == 1)
+        assert_(issubclass(np.char.index('abcba', 'b').dtype.type, np.integer))
+
+    def test_isalnum(self):
+        assert_(issubclass(self.A.isalnum().dtype.type, np.bool_))
+        assert_array_equal(self.A.isalnum(), [[False, False], [True, True], [False, True]])
+
+    def test_isalpha(self):
+        assert_(issubclass(self.A.isalpha().dtype.type, np.bool_))
+        assert_array_equal(self.A.isalpha(), [[False, False], [False, True], [False, True]])
+
+    def test_isdigit(self):
+        assert_(issubclass(self.A.isdigit().dtype.type, np.bool_))
+        assert_array_equal(self.A.isdigit(), [[False, False], [True, False], [False, False]])
+
+    def test_islower(self):
+        assert_(issubclass(self.A.islower().dtype.type, np.bool_))
+        assert_array_equal(self.A.islower(), [[True, False], [False, False], [False, False]])
+
+    def test_isspace(self):
+        assert_(issubclass(self.A.isspace().dtype.type, np.bool_))
+        assert_array_equal(self.A.isspace(), [[False, False], [False, False], [False, False]])
+
+    def test_istitle(self):
+        assert_(issubclass(self.A.istitle().dtype.type, np.bool_))
+        assert_array_equal(self.A.istitle(), [[False, False], [False, False], [False, False]])
+
+    def test_isupper(self):
+        assert_(issubclass(self.A.isupper().dtype.type, np.bool_))
+        assert_array_equal(self.A.isupper(), [[False, False], [False, False], [False, True]])
+
+    def test_rfind(self):
+        assert_(issubclass(self.A.rfind('a').dtype.type, np.integer))
+        assert_array_equal(self.A.rfind('a'), [[1, -1], [-1, 6], [-1, -1]])
+        assert_array_equal(self.A.rfind('3'), [[-1, -1], [2, -1], [6, -1]])
+        assert_array_equal(self.A.rfind('a', 0, 2), [[1, -1], [-1, -1], [-1, -1]])
+        assert_array_equal(self.A.rfind(['1', 'P']), [[-1, -1], [0, -1], [0, 2]])
+
+    def test_rindex(self):
+
+        def fail():
+            self.A.rindex('a')
+
+        assert_raises(ValueError, fail)
+        assert_(np.char.rindex('abcba', 'b') == 3)
+        assert_(issubclass(np.char.rindex('abcba', 'b').dtype.type, np.integer))
+
+    def test_startswith(self):
+        assert_(issubclass(self.A.startswith('').dtype.type, np.bool_))
+        assert_array_equal(self.A.startswith(' '), [[1, 0], [0, 0], [0, 0]])
+        assert_array_equal(self.A.startswith('1', 0, 3), [[0, 0], [1, 0], [1, 0]])
+
+        def fail():
+            self.A.startswith('3', 'fdjk')
+
+        assert_raises(TypeError, fail)
+
+
+class TestMethods:
+    def setup(self):
+        self.A = np.array([[' abc ', ''],
+                           ['12345', 'MixedCase'],
+                           ['123 \t 345 \0 ', 'UPPER']],
+                          dtype='S').view(np.chararray)
+        self.B = np.array([[u' \u03a3 ', u''],
+                           [u'12345', u'MixedCase'],
+                           [u'123 \t 345 \0 ', u'UPPER']]).view(np.chararray)
+
+    def test_capitalize(self):
+        tgt = [[b' abc ', b''],
+               [b'12345', b'Mixedcase'],
+               [b'123 \t 345 \0 ', b'Upper']]
+        assert_(issubclass(self.A.capitalize().dtype.type, np.string_))
+        assert_array_equal(self.A.capitalize(), tgt)
+
+        tgt = [[u' \u03c3 ', ''],
+               ['12345', 'Mixedcase'],
+               ['123 \t 345 \0 ', 'Upper']]
+        assert_(issubclass(self.B.capitalize().dtype.type, np.unicode_))
+        assert_array_equal(self.B.capitalize(), tgt)
+
+    def test_center(self):
+        assert_(issubclass(self.A.center(10).dtype.type, np.string_))
+        C = self.A.center([10, 20])
+        assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]])
+
+        C = self.A.center(20, b'#')
+        assert_(np.all(C.startswith(b'#')))
+        assert_(np.all(C.endswith(b'#')))
+
+        C = np.char.center(b'FOO', [[10, 20], [15, 8]])
+        tgt = [[b'   FOO    ', b'        FOO         '],
+               [b'      FOO      ', b'  FOO   ']]
+        assert_(issubclass(C.dtype.type, np.string_))
+        assert_array_equal(C, tgt)
+
+    def test_decode(self):
+        A = np.char.array([b'\\u03a3'])
+        assert_(A.decode('unicode-escape')[0] == '\u03a3')
+
+    def test_encode(self):
+        B = self.B.encode('unicode_escape')
+        assert_(B[0][0] == str(' \\u03a3 ').encode('latin1'))
+
+    def test_expandtabs(self):
+        T = self.A.expandtabs()
+        assert_(T[2, 0] == b'123      345 \0')
+
+    def test_join(self):
+        # NOTE: list(b'123') == [49, 50, 51]
+        #       so that b','.join(b'123') results to an error on Py3
+        A0 = self.A.decode('ascii')
+
+        A = np.char.join([',', '#'], A0)
+        assert_(issubclass(A.dtype.type, np.unicode_))
+        tgt = np.array([[' ,a,b,c, ', ''],
+                        ['1,2,3,4,5', 'M#i#x#e#d#C#a#s#e'],
+                        ['1,2,3, ,\t, ,3,4,5, ,\x00, ', 'U#P#P#E#R']])
+        assert_array_equal(np.char.join([',', '#'], A0), tgt)
+
+    def test_ljust(self):
+        assert_(issubclass(self.A.ljust(10).dtype.type, np.string_))
+
+        C = self.A.ljust([10, 20])
+        assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]])
+
+        C = self.A.ljust(20, b'#')
+        assert_array_equal(C.startswith(b'#'), [
+                [False, True], [False, False], [False, False]])
+        assert_(np.all(C.endswith(b'#')))
+
+        C = np.char.ljust(b'FOO', [[10, 20], [15, 8]])
+        tgt = [[b'FOO       ', b'FOO                 '],
+               [b'FOO            ', b'FOO     ']]
+        assert_(issubclass(C.dtype.type, np.string_))
+        assert_array_equal(C, tgt)
+
+    def test_lower(self):
+        tgt = [[b' abc ', b''],
+               [b'12345', b'mixedcase'],
+               [b'123 \t 345 \0 ', b'upper']]
+        assert_(issubclass(self.A.lower().dtype.type, np.string_))
+        assert_array_equal(self.A.lower(), tgt)
+
+        tgt = [[u' \u03c3 ', u''],
+               [u'12345', u'mixedcase'],
+               [u'123 \t 345 \0 ', u'upper']]
+        assert_(issubclass(self.B.lower().dtype.type, np.unicode_))
+        assert_array_equal(self.B.lower(), tgt)
+
+    def test_lstrip(self):
+        tgt = [[b'abc ', b''],
+               [b'12345', b'MixedCase'],
+               [b'123 \t 345 \0 ', b'UPPER']]
+        assert_(issubclass(self.A.lstrip().dtype.type, np.string_))
+        assert_array_equal(self.A.lstrip(), tgt)
+
+        tgt = [[b' abc', b''],
+               [b'2345', b'ixedCase'],
+               [b'23 \t 345 \x00', b'UPPER']]
+        assert_array_equal(self.A.lstrip([b'1', b'M']), tgt)
+
+        tgt = [[u'\u03a3 ', ''],
+               ['12345', 'MixedCase'],
+               ['123 \t 345 \0 ', 'UPPER']]
+        assert_(issubclass(self.B.lstrip().dtype.type, np.unicode_))
+        assert_array_equal(self.B.lstrip(), tgt)
+
+    def test_partition(self):
+        P = self.A.partition([b'3', b'M'])
+        tgt = [[(b' abc ', b'', b''), (b'', b'', b'')],
+               [(b'12', b'3', b'45'), (b'', b'M', b'ixedCase')],
+               [(b'12', b'3', b' \t 345 \0 '), (b'UPPER', b'', b'')]]
+        assert_(issubclass(P.dtype.type, np.string_))
+        assert_array_equal(P, tgt)
+
+    def test_replace(self):
+        R = self.A.replace([b'3', b'a'],
+                           [b'##########', b'@'])
+        tgt = [[b' abc ', b''],
+               [b'12##########45', b'MixedC@se'],
+               [b'12########## \t ##########45 \x00', b'UPPER']]
+        assert_(issubclass(R.dtype.type, np.string_))
+        assert_array_equal(R, tgt)
+
+    def test_rjust(self):
+        assert_(issubclass(self.A.rjust(10).dtype.type, np.string_))
+
+        C = self.A.rjust([10, 20])
+        assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]])
+
+        C = self.A.rjust(20, b'#')
+        assert_(np.all(C.startswith(b'#')))
+        assert_array_equal(C.endswith(b'#'),
+                           [[False, True], [False, False], [False, False]])
+
+        C = np.char.rjust(b'FOO', [[10, 20], [15, 8]])
+        tgt = [[b'       FOO', b'                 FOO'],
+               [b'            FOO', b'     FOO']]
+        assert_(issubclass(C.dtype.type, np.string_))
+        assert_array_equal(C, tgt)
+
+    def test_rpartition(self):
+        P = self.A.rpartition([b'3', b'M'])
+        tgt = [[(b'', b'', b' abc '), (b'', b'', b'')],
+               [(b'12', b'3', b'45'), (b'', b'M', b'ixedCase')],
+               [(b'123 \t ', b'3', b'45 \0 '), (b'', b'', b'UPPER')]]
+        assert_(issubclass(P.dtype.type, np.string_))
+        assert_array_equal(P, tgt)
+
+    def test_rsplit(self):
+        A = self.A.rsplit(b'3')
+        tgt = [[[b' abc '], [b'']],
+               [[b'12', b'45'], [b'MixedCase']],
+               [[b'12', b' \t ', b'45 \x00 '], [b'UPPER']]]
+        assert_(issubclass(A.dtype.type, np.object_))
+        assert_equal(A.tolist(), tgt)
+
+    def test_rstrip(self):
+        assert_(issubclass(self.A.rstrip().dtype.type, np.string_))
+
+        tgt = [[b' abc', b''],
+               [b'12345', b'MixedCase'],
+               [b'123 \t 345', b'UPPER']]
+        assert_array_equal(self.A.rstrip(), tgt)
+
+        tgt = [[b' abc ', b''],
+               [b'1234', b'MixedCase'],
+               [b'123 \t 345 \x00', b'UPP']
+               ]
+        assert_array_equal(self.A.rstrip([b'5', b'ER']), tgt)
+
+        tgt = [[u' \u03a3', ''],
+               ['12345', 'MixedCase'],
+               ['123 \t 345', 'UPPER']]
+        assert_(issubclass(self.B.rstrip().dtype.type, np.unicode_))
+        assert_array_equal(self.B.rstrip(), tgt)
+
+    def test_strip(self):
+        tgt = [[b'abc', b''],
+               [b'12345', b'MixedCase'],
+               [b'123 \t 345', b'UPPER']]
+        assert_(issubclass(self.A.strip().dtype.type, np.string_))
+        assert_array_equal(self.A.strip(), tgt)
+
+        tgt = [[b' abc ', b''],
+               [b'234', b'ixedCas'],
+               [b'23 \t 345 \x00', b'UPP']]
+        assert_array_equal(self.A.strip([b'15', b'EReM']), tgt)
+
+        tgt = [[u'\u03a3', ''],
+               ['12345', 'MixedCase'],
+               ['123 \t 345', 'UPPER']]
+        assert_(issubclass(self.B.strip().dtype.type, np.unicode_))
+        assert_array_equal(self.B.strip(), tgt)
+
+    def test_split(self):
+        A = self.A.split(b'3')
+        tgt = [
+               [[b' abc '], [b'']],
+               [[b'12', b'45'], [b'MixedCase']],
+               [[b'12', b' \t ', b'45 \x00 '], [b'UPPER']]]
+        assert_(issubclass(A.dtype.type, np.object_))
+        assert_equal(A.tolist(), tgt)
+
+    def test_splitlines(self):
+        A = np.char.array(['abc\nfds\nwer']).splitlines()
+        assert_(issubclass(A.dtype.type, np.object_))
+        assert_(A.shape == (1,))
+        assert_(len(A[0]) == 3)
+
+    def test_swapcase(self):
+        tgt = [[b' ABC ', b''],
+               [b'12345', b'mIXEDcASE'],
+               [b'123 \t 345 \0 ', b'upper']]
+        assert_(issubclass(self.A.swapcase().dtype.type, np.string_))
+        assert_array_equal(self.A.swapcase(), tgt)
+
+        tgt = [[u' \u03c3 ', u''],
+               [u'12345', u'mIXEDcASE'],
+               [u'123 \t 345 \0 ', u'upper']]
+        assert_(issubclass(self.B.swapcase().dtype.type, np.unicode_))
+        assert_array_equal(self.B.swapcase(), tgt)
+
+    def test_title(self):
+        tgt = [[b' Abc ', b''],
+               [b'12345', b'Mixedcase'],
+               [b'123 \t 345 \0 ', b'Upper']]
+        assert_(issubclass(self.A.title().dtype.type, np.string_))
+        assert_array_equal(self.A.title(), tgt)
+
+        tgt = [[u' \u03a3 ', u''],
+               [u'12345', u'Mixedcase'],
+               [u'123 \t 345 \0 ', u'Upper']]
+        assert_(issubclass(self.B.title().dtype.type, np.unicode_))
+        assert_array_equal(self.B.title(), tgt)
+
+    def test_upper(self):
+        tgt = [[b' ABC ', b''],
+               [b'12345', b'MIXEDCASE'],
+               [b'123 \t 345 \0 ', b'UPPER']]
+        assert_(issubclass(self.A.upper().dtype.type, np.string_))
+        assert_array_equal(self.A.upper(), tgt)
+
+        tgt = [[u' \u03a3 ', u''],
+               [u'12345', u'MIXEDCASE'],
+               [u'123 \t 345 \0 ', u'UPPER']]
+        assert_(issubclass(self.B.upper().dtype.type, np.unicode_))
+        assert_array_equal(self.B.upper(), tgt)
+
+    def test_isnumeric(self):
+
+        def fail():
+            self.A.isnumeric()
+
+        assert_raises(TypeError, fail)
+        assert_(issubclass(self.B.isnumeric().dtype.type, np.bool_))
+        assert_array_equal(self.B.isnumeric(), [
+                [False, False], [True, False], [False, False]])
+
+    def test_isdecimal(self):
+
+        def fail():
+            self.A.isdecimal()
+
+        assert_raises(TypeError, fail)
+        assert_(issubclass(self.B.isdecimal().dtype.type, np.bool_))
+        assert_array_equal(self.B.isdecimal(), [
+                [False, False], [True, False], [False, False]])
+
+
+class TestOperations:
+    def setup(self):
+        self.A = np.array([['abc', '123'],
+                           ['789', 'xyz']]).view(np.chararray)
+        self.B = np.array([['efg', '456'],
+                           ['051', 'tuv']]).view(np.chararray)
+
+    def test_add(self):
+        AB = np.array([['abcefg', '123456'],
+                       ['789051', 'xyztuv']]).view(np.chararray)
+        assert_array_equal(AB, (self.A + self.B))
+        assert_(len((self.A + self.B)[0][0]) == 6)
+
+    def test_radd(self):
+        QA = np.array([['qabc', 'q123'],
+                       ['q789', 'qxyz']]).view(np.chararray)
+        assert_array_equal(QA, ('q' + self.A))
+
+    def test_mul(self):
+        A = self.A
+        for r in (2, 3, 5, 7, 197):
+            Ar = np.array([[A[0, 0]*r, A[0, 1]*r],
+                           [A[1, 0]*r, A[1, 1]*r]]).view(np.chararray)
+
+            assert_array_equal(Ar, (self.A * r))
+
+        for ob in [object(), 'qrs']:
+            with assert_raises_regex(ValueError,
+                                     'Can only multiply by integers'):
+                A*ob
+
+    def test_rmul(self):
+        A = self.A
+        for r in (2, 3, 5, 7, 197):
+            Ar = np.array([[A[0, 0]*r, A[0, 1]*r],
+                           [A[1, 0]*r, A[1, 1]*r]]).view(np.chararray)
+            assert_array_equal(Ar, (r * self.A))
+
+        for ob in [object(), 'qrs']:
+            with assert_raises_regex(ValueError,
+                                     'Can only multiply by integers'):
+                ob * A
+
+    def test_mod(self):
+        """Ticket #856"""
+        F = np.array([['%d', '%f'], ['%s', '%r']]).view(np.chararray)
+        C = np.array([[3, 7], [19, 1]])
+        FC = np.array([['3', '7.000000'],
+                       ['19', '1']]).view(np.chararray)
+        assert_array_equal(FC, F % C)
+
+        A = np.array([['%.3f', '%d'], ['%s', '%r']]).view(np.chararray)
+        A1 = np.array([['1.000', '1'], ['1', '1']]).view(np.chararray)
+        assert_array_equal(A1, (A % 1))
+
+        A2 = np.array([['1.000', '2'], ['3', '4']]).view(np.chararray)
+        assert_array_equal(A2, (A % [[1, 2], [3, 4]]))
+
+    def test_rmod(self):
+        assert_(("%s" % self.A) == str(self.A))
+        assert_(("%r" % self.A) == repr(self.A))
+
+        for ob in [42, object()]:
+            with assert_raises_regex(
+                    TypeError, "unsupported operand type.* and 'chararray'"):
+                ob % self.A
+
+    def test_slice(self):
+        """Regression test for https://github.com/numpy/numpy/issues/5982"""
+
+        arr = np.array([['abc ', 'def '], ['geh ', 'ijk ']],
+                       dtype='S4').view(np.chararray)
+        sl1 = arr[:]
+        assert_array_equal(sl1, arr)
+        assert_(sl1.base is arr)
+        assert_(sl1.base.base is arr.base)
+
+        sl2 = arr[:, :]
+        assert_array_equal(sl2, arr)
+        assert_(sl2.base is arr)
+        assert_(sl2.base.base is arr.base)
+
+        assert_(arr[0, 0] == b'abc')
+
+
+def test_empty_indexing():
+    """Regression test for ticket 1948."""
+    # Check that indexing a chararray with an empty list/array returns an
+    # empty chararray instead of a chararray with a single empty string in it.
+    s = np.chararray((4,))
+    assert_(s[[]].size == 0)

venv/Lib/site-packages/numpy/core/tests/test_deprecations.py

@@ -0,0 +1,620 @@
+"""
+Tests related to deprecation warnings. Also a convenient place
+to document how deprecations should eventually be turned into errors.
+
+"""
+import datetime
+import operator
+import warnings
+import pytest
+import tempfile
+import re
+
+import numpy as np
+from numpy.testing import (
+    assert_raises, assert_warns, assert_, assert_array_equal
+    )
+
+from numpy.core._multiarray_tests import fromstring_null_term_c_api
+
+try:
+    import pytz
+    _has_pytz = True
+except ImportError:
+    _has_pytz = False
+
+
+class _DeprecationTestCase:
+    # Just as warning: warnings uses re.match, so the start of this message
+    # must match.
+    message = ''
+    warning_cls = DeprecationWarning
+
+    def setup(self):
+        self.warn_ctx = warnings.catch_warnings(record=True)
+        self.log = self.warn_ctx.__enter__()
+
+        # Do *not* ignore other DeprecationWarnings. Ignoring warnings
+        # can give very confusing results because of
+        # https://bugs.python.org/issue4180 and it is probably simplest to
+        # try to keep the tests cleanly giving only the right warning type.
+        # (While checking them set to "error" those are ignored anyway)
+        # We still have them show up, because otherwise they would be raised
+        warnings.filterwarnings("always", category=self.warning_cls)
+        warnings.filterwarnings("always", message=self.message,
+                                category=self.warning_cls)
+
+    def teardown(self):
+        self.warn_ctx.__exit__()
+
+    def assert_deprecated(self, function, num=1, ignore_others=False,
+                          function_fails=False,
+                          exceptions=np._NoValue,
+                          args=(), kwargs={}):
+        """Test if DeprecationWarnings are given and raised.
+
+        This first checks if the function when called gives `num`
+        DeprecationWarnings, after that it tries to raise these
+        DeprecationWarnings and compares them with `exceptions`.
+        The exceptions can be different for cases where this code path
+        is simply not anticipated and the exception is replaced.
+
+        Parameters
+        ----------
+        function : callable
+            The function to test
+        num : int
+            Number of DeprecationWarnings to expect. This should normally be 1.
+        ignore_others : bool
+            Whether warnings of the wrong type should be ignored (note that
+            the message is not checked)
+        function_fails : bool
+            If the function would normally fail, setting this will check for
+            warnings inside a try/except block.
+        exceptions : Exception or tuple of Exceptions
+            Exception to expect when turning the warnings into an error.
+            The default checks for DeprecationWarnings. If exceptions is
+            empty the function is expected to run successfully.
+        args : tuple
+            Arguments for `function`
+        kwargs : dict
+            Keyword arguments for `function`
+        """
+        # reset the log
+        self.log[:] = []
+
+        if exceptions is np._NoValue:
+            exceptions = (self.warning_cls,)
+
+        try:
+            function(*args, **kwargs)
+        except (Exception if function_fails else tuple()):
+            pass
+
+        # just in case, clear the registry
+        num_found = 0
+        for warning in self.log:
+            if warning.category is self.warning_cls:
+                num_found += 1
+            elif not ignore_others:
+                raise AssertionError(
+                        "expected %s but got: %s" %
+                        (self.warning_cls.__name__, warning.category))
+        if num is not None and num_found != num:
+            msg = "%i warnings found but %i expected." % (len(self.log), num)
+            lst = [str(w) for w in self.log]
+            raise AssertionError("\n".join([msg] + lst))
+
+        with warnings.catch_warnings():
+            warnings.filterwarnings("error", message=self.message,
+                                    category=self.warning_cls)
+            try:
+                function(*args, **kwargs)
+                if exceptions != tuple():
+                    raise AssertionError(
+                            "No error raised during function call")
+            except exceptions:
+                if exceptions == tuple():
+                    raise AssertionError(
+                            "Error raised during function call")
+
+    def assert_not_deprecated(self, function, args=(), kwargs={}):
+        """Test that warnings are not raised.
+
+        This is just a shorthand for:
+
+        self.assert_deprecated(function, num=0, ignore_others=True,
+                        exceptions=tuple(), args=args, kwargs=kwargs)
+        """
+        self.assert_deprecated(function, num=0, ignore_others=True,
+                        exceptions=tuple(), args=args, kwargs=kwargs)
+
+
+class _VisibleDeprecationTestCase(_DeprecationTestCase):
+    warning_cls = np.VisibleDeprecationWarning
+
+
+class TestNonTupleNDIndexDeprecation:
+    def test_basic(self):
+        a = np.zeros((5, 5))
+        with warnings.catch_warnings():
+            warnings.filterwarnings('always')
+            assert_warns(FutureWarning, a.__getitem__, [[0, 1], [0, 1]])
+            assert_warns(FutureWarning, a.__getitem__, [slice(None)])
+
+            warnings.filterwarnings('error')
+            assert_raises(FutureWarning, a.__getitem__, [[0, 1], [0, 1]])
+            assert_raises(FutureWarning, a.__getitem__, [slice(None)])
+
+            # a a[[0, 1]] always was advanced indexing, so no error/warning
+            a[[0, 1]]
+
+
+class TestComparisonDeprecations(_DeprecationTestCase):
+    """This tests the deprecation, for non-element-wise comparison logic.
+    This used to mean that when an error occurred during element-wise comparison
+    (i.e. broadcasting) NotImplemented was returned, but also in the comparison
+    itself, False was given instead of the error.
+
+    Also test FutureWarning for the None comparison.
+    """
+
+    message = "elementwise.* comparison failed; .*"
+
+    def test_normal_types(self):
+        for op in (operator.eq, operator.ne):
+            # Broadcasting errors:
+            self.assert_deprecated(op, args=(np.zeros(3), []))
+            a = np.zeros(3, dtype='i,i')
+            # (warning is issued a couple of times here)
+            self.assert_deprecated(op, args=(a, a[:-1]), num=None)
+
+            # ragged array comparison returns True/False
+            a = np.array([1, np.array([1,2,3])], dtype=object)
+            b = np.array([1, np.array([1,2,3])], dtype=object)
+            self.assert_deprecated(op, args=(a, b), num=None)
+
+    def test_string(self):
+        # For two string arrays, strings always raised the broadcasting error:
+        a = np.array(['a', 'b'])
+        b = np.array(['a', 'b', 'c'])
+        assert_raises(ValueError, lambda x, y: x == y, a, b)
+
+        # The empty list is not cast to string, and this used to pass due
+        # to dtype mismatch; now (2018-06-21) it correctly leads to a
+        # FutureWarning.
+        assert_warns(FutureWarning, lambda: a == [])
+
+    def test_void_dtype_equality_failures(self):
+        class NotArray:
+            def __array__(self):
+                raise TypeError
+
+            # Needed so Python 3 does not raise DeprecationWarning twice.
+            def __ne__(self, other):
+                return NotImplemented
+
+        self.assert_deprecated(lambda: np.arange(2) == NotArray())
+        self.assert_deprecated(lambda: np.arange(2) != NotArray())
+
+        struct1 = np.zeros(2, dtype="i4,i4")
+        struct2 = np.zeros(2, dtype="i4,i4,i4")
+
+        assert_warns(FutureWarning, lambda: struct1 == 1)
+        assert_warns(FutureWarning, lambda: struct1 == struct2)
+        assert_warns(FutureWarning, lambda: struct1 != 1)
+        assert_warns(FutureWarning, lambda: struct1 != struct2)
+
+    def test_array_richcompare_legacy_weirdness(self):
+        # It doesn't really work to use assert_deprecated here, b/c part of
+        # the point of assert_deprecated is to check that when warnings are
+        # set to "error" mode then the error is propagated -- which is good!
+        # But here we are testing a bunch of code that is deprecated *because*
+        # it has the habit of swallowing up errors and converting them into
+        # different warnings. So assert_warns will have to be sufficient.
+        assert_warns(FutureWarning, lambda: np.arange(2) == "a")
+        assert_warns(FutureWarning, lambda: np.arange(2) != "a")
+        # No warning for scalar comparisons
+        with warnings.catch_warnings():
+            warnings.filterwarnings("error")
+            assert_(not (np.array(0) == "a"))
+            assert_(np.array(0) != "a")
+            assert_(not (np.int16(0) == "a"))
+            assert_(np.int16(0) != "a")
+
+        for arg1 in [np.asarray(0), np.int16(0)]:
+            struct = np.zeros(2, dtype="i4,i4")
+            for arg2 in [struct, "a"]:
+                for f in [operator.lt, operator.le, operator.gt, operator.ge]:
+                    with warnings.catch_warnings() as l:
+                        warnings.filterwarnings("always")
+                        assert_raises(TypeError, f, arg1, arg2)
+                        assert_(not l)
+
+
+class TestDatetime64Timezone(_DeprecationTestCase):
+    """Parsing of datetime64 with timezones deprecated in 1.11.0, because
+    datetime64 is now timezone naive rather than UTC only.
+
+    It will be quite a while before we can remove this, because, at the very
+    least, a lot of existing code uses the 'Z' modifier to avoid conversion
+    from local time to UTC, even if otherwise it handles time in a timezone
+    naive fashion.
+    """
+    def test_string(self):
+        self.assert_deprecated(np.datetime64, args=('2000-01-01T00+01',))
+        self.assert_deprecated(np.datetime64, args=('2000-01-01T00Z',))
+
+    @pytest.mark.skipif(not _has_pytz,
+                        reason="The pytz module is not available.")
+    def test_datetime(self):
+        tz = pytz.timezone('US/Eastern')
+        dt = datetime.datetime(2000, 1, 1, 0, 0, tzinfo=tz)
+        self.assert_deprecated(np.datetime64, args=(dt,))
+
+
+class TestNonCContiguousViewDeprecation(_DeprecationTestCase):
+    """View of non-C-contiguous arrays deprecated in 1.11.0.
+
+    The deprecation will not be raised for arrays that are both C and F
+    contiguous, as C contiguous is dominant. There are more such arrays
+    with relaxed stride checking than without so the deprecation is not
+    as visible with relaxed stride checking in force.
+    """
+
+    def test_fortran_contiguous(self):
+        self.assert_deprecated(np.ones((2,2)).T.view, args=(complex,))
+        self.assert_deprecated(np.ones((2,2)).T.view, args=(np.int8,))
+
+
+class TestArrayDataAttributeAssignmentDeprecation(_DeprecationTestCase):
+    """Assigning the 'data' attribute of an ndarray is unsafe as pointed
+     out in gh-7093. Eventually, such assignment should NOT be allowed, but
+     in the interests of maintaining backwards compatibility, only a Deprecation-
+     Warning will be raised instead for the time being to give developers time to
+     refactor relevant code.
+    """
+
+    def test_data_attr_assignment(self):
+        a = np.arange(10)
+        b = np.linspace(0, 1, 10)
+
+        self.message = ("Assigning the 'data' attribute is an "
+                        "inherently unsafe operation and will "
+                        "be removed in the future.")
+        self.assert_deprecated(a.__setattr__, args=('data', b.data))
+
+
+class TestBinaryReprInsufficientWidthParameterForRepresentation(_DeprecationTestCase):
+    """
+    If a 'width' parameter is passed into ``binary_repr`` that is insufficient to
+    represent the number in base 2 (positive) or 2's complement (negative) form,
+    the function used to silently ignore the parameter and return a representation
+    using the minimal number of bits needed for the form in question. Such behavior
+    is now considered unsafe from a user perspective and will raise an error in the future.
+    """
+
+    def test_insufficient_width_positive(self):
+        args = (10,)
+        kwargs = {'width': 2}
+
+        self.message = ("Insufficient bit width provided. This behavior "
+                        "will raise an error in the future.")
+        self.assert_deprecated(np.binary_repr, args=args, kwargs=kwargs)
+
+    def test_insufficient_width_negative(self):
+        args = (-5,)
+        kwargs = {'width': 2}
+
+        self.message = ("Insufficient bit width provided. This behavior "
+                        "will raise an error in the future.")
+        self.assert_deprecated(np.binary_repr, args=args, kwargs=kwargs)
+
+
+class TestNumericStyleTypecodes(_DeprecationTestCase):
+    """
+    Deprecate the old numeric-style dtypes, which are especially
+    confusing for complex types, e.g. Complex32 -> complex64. When the
+    deprecation cycle is complete, the check for the strings should be
+    removed from PyArray_DescrConverter in descriptor.c, and the
+    deprecated keys should not be added as capitalized aliases in
+    _add_aliases in numerictypes.py.
+    """
+    def test_all_dtypes(self):
+        deprecated_types = [
+            'Bool', 'Complex32', 'Complex64', 'Float16', 'Float32', 'Float64',
+            'Int8', 'Int16', 'Int32', 'Int64', 'Object0', 'Timedelta64',
+            'UInt8', 'UInt16', 'UInt32', 'UInt64', 'Void0'
+            ]
+        for dt in deprecated_types:
+            self.assert_deprecated(np.dtype, exceptions=(TypeError,),
+                                   args=(dt,))
+
+
+class TestTestDeprecated:
+    def test_assert_deprecated(self):
+        test_case_instance = _DeprecationTestCase()
+        test_case_instance.setup()
+        assert_raises(AssertionError,
+                      test_case_instance.assert_deprecated,
+                      lambda: None)
+
+        def foo():
+            warnings.warn("foo", category=DeprecationWarning, stacklevel=2)
+
+        test_case_instance.assert_deprecated(foo)
+        test_case_instance.teardown()
+
+
+class TestNonNumericConjugate(_DeprecationTestCase):
+    """
+    Deprecate no-op behavior of ndarray.conjugate on non-numeric dtypes,
+    which conflicts with the error behavior of np.conjugate.
+    """
+    def test_conjugate(self):
+        for a in np.array(5), np.array(5j):
+            self.assert_not_deprecated(a.conjugate)
+        for a in (np.array('s'), np.array('2016', 'M'),
+                np.array((1, 2), [('a', int), ('b', int)])):
+            self.assert_deprecated(a.conjugate)
+
+
+class TestNPY_CHAR(_DeprecationTestCase):
+    # 2017-05-03, 1.13.0
+    def test_npy_char_deprecation(self):
+        from numpy.core._multiarray_tests import npy_char_deprecation
+        self.assert_deprecated(npy_char_deprecation)
+        assert_(npy_char_deprecation() == 'S1')
+
+
+class TestPyArray_AS1D(_DeprecationTestCase):
+    def test_npy_pyarrayas1d_deprecation(self):
+        from numpy.core._multiarray_tests import npy_pyarrayas1d_deprecation
+        assert_raises(NotImplementedError, npy_pyarrayas1d_deprecation)
+
+
+class TestPyArray_AS2D(_DeprecationTestCase):
+    def test_npy_pyarrayas2d_deprecation(self):
+        from numpy.core._multiarray_tests import npy_pyarrayas2d_deprecation
+        assert_raises(NotImplementedError, npy_pyarrayas2d_deprecation)
+
+
+class Test_UPDATEIFCOPY(_DeprecationTestCase):
+    """
+    v1.14 deprecates creating an array with the UPDATEIFCOPY flag, use
+    WRITEBACKIFCOPY instead
+    """
+    def test_npy_updateifcopy_deprecation(self):
+        from numpy.core._multiarray_tests import npy_updateifcopy_deprecation
+        arr = np.arange(9).reshape(3, 3)
+        v = arr.T
+        self.assert_deprecated(npy_updateifcopy_deprecation, args=(v,))
+
+
+class TestDatetimeEvent(_DeprecationTestCase):
+    # 2017-08-11, 1.14.0
+    def test_3_tuple(self):
+        for cls in (np.datetime64, np.timedelta64):
+            # two valid uses - (unit, num) and (unit, num, den, None)
+            self.assert_not_deprecated(cls, args=(1, ('ms', 2)))
+            self.assert_not_deprecated(cls, args=(1, ('ms', 2, 1, None)))
+
+            # trying to use the event argument, removed in 1.7.0, is deprecated
+            # it used to be a uint8
+            self.assert_deprecated(cls, args=(1, ('ms', 2, 'event')))
+            self.assert_deprecated(cls, args=(1, ('ms', 2, 63)))
+            self.assert_deprecated(cls, args=(1, ('ms', 2, 1, 'event')))
+            self.assert_deprecated(cls, args=(1, ('ms', 2, 1, 63)))
+
+
+class TestTruthTestingEmptyArrays(_DeprecationTestCase):
+    # 2017-09-25, 1.14.0
+    message = '.*truth value of an empty array is ambiguous.*'
+
+    def test_1d(self):
+        self.assert_deprecated(bool, args=(np.array([]),))
+
+    def test_2d(self):
+        self.assert_deprecated(bool, args=(np.zeros((1, 0)),))
+        self.assert_deprecated(bool, args=(np.zeros((0, 1)),))
+        self.assert_deprecated(bool, args=(np.zeros((0, 0)),))
+
+
+class TestBincount(_DeprecationTestCase):
+    # 2017-06-01, 1.14.0
+    def test_bincount_minlength(self):
+        self.assert_deprecated(lambda: np.bincount([1, 2, 3], minlength=None))
+
+
+class TestAlen(_DeprecationTestCase):
+    # 2019-08-02, 1.18.0
+    def test_alen(self):
+        self.assert_deprecated(lambda: np.alen(np.array([1, 2, 3])))
+
+
+class TestGeneratorSum(_DeprecationTestCase):
+    # 2018-02-25, 1.15.0
+    def test_generator_sum(self):
+        self.assert_deprecated(np.sum, args=((i for i in range(5)),))
+
+
+class TestSctypeNA(_VisibleDeprecationTestCase):
+    # 2018-06-24, 1.16
+    def test_sctypeNA(self):
+        self.assert_deprecated(lambda: np.sctypeNA['?'])
+        self.assert_deprecated(lambda: np.typeNA['?'])
+        self.assert_deprecated(lambda: np.typeNA.get('?'))
+
+
+class TestPositiveOnNonNumerical(_DeprecationTestCase):
+    # 2018-06-28, 1.16.0
+    def test_positive_on_non_number(self):
+        self.assert_deprecated(operator.pos, args=(np.array('foo'),))
+
+
+class TestFromstring(_DeprecationTestCase):
+    # 2017-10-19, 1.14
+    def test_fromstring(self):
+        self.assert_deprecated(np.fromstring, args=('\x00'*80,))
+
+
+class TestFromStringAndFileInvalidData(_DeprecationTestCase):
+    # 2019-06-08, 1.17.0
+    # Tests should be moved to real tests when deprecation is done.
+    message = "string or file could not be read to its end"
+
+    @pytest.mark.parametrize("invalid_str", [",invalid_data", "invalid_sep"])
+    def test_deprecate_unparsable_data_file(self, invalid_str):
+        x = np.array([1.51, 2, 3.51, 4], dtype=float)
+
+        with tempfile.TemporaryFile(mode="w") as f:
+            x.tofile(f, sep=',', format='%.2f')
+            f.write(invalid_str)
+
+            f.seek(0)
+            self.assert_deprecated(lambda: np.fromfile(f, sep=","))
+            f.seek(0)
+            self.assert_deprecated(lambda: np.fromfile(f, sep=",", count=5))
+            # Should not raise:
+            with warnings.catch_warnings():
+                warnings.simplefilter("error", DeprecationWarning)
+                f.seek(0)
+                res = np.fromfile(f, sep=",", count=4)
+                assert_array_equal(res, x)
+
+    @pytest.mark.parametrize("invalid_str", [",invalid_data", "invalid_sep"])
+    def test_deprecate_unparsable_string(self, invalid_str):
+        x = np.array([1.51, 2, 3.51, 4], dtype=float)
+        x_str = "1.51,2,3.51,4{}".format(invalid_str)
+
+        self.assert_deprecated(lambda: np.fromstring(x_str, sep=","))
+        self.assert_deprecated(lambda: np.fromstring(x_str, sep=",", count=5))
+
+        # The C-level API can use not fixed size, but 0 terminated strings,
+        # so test that as well:
+        bytestr = x_str.encode("ascii")
+        self.assert_deprecated(lambda: fromstring_null_term_c_api(bytestr))
+
+        with assert_warns(DeprecationWarning):
+            # this is slightly strange, in that fromstring leaves data
+            # potentially uninitialized (would be good to error when all is
+            # read, but count is larger then actual data maybe).
+            res = np.fromstring(x_str, sep=",", count=5)
+            assert_array_equal(res[:-1], x)
+
+        with warnings.catch_warnings():
+            warnings.simplefilter("error", DeprecationWarning)
+
+            # Should not raise:
+            res = np.fromstring(x_str, sep=",", count=4)
+            assert_array_equal(res, x)
+
+
+class Test_GetSet_NumericOps(_DeprecationTestCase):
+    # 2018-09-20, 1.16.0
+    def test_get_numeric_ops(self):
+        from numpy.core._multiarray_tests import getset_numericops
+        self.assert_deprecated(getset_numericops, num=2)
+
+        # empty kwargs prevents any state actually changing which would break
+        # other tests.
+        self.assert_deprecated(np.set_numeric_ops, kwargs={})
+        assert_raises(ValueError, np.set_numeric_ops, add='abc')
+
+
+class TestShape1Fields(_DeprecationTestCase):
+    warning_cls = FutureWarning
+
+    # 2019-05-20, 1.17.0
+    def test_shape_1_fields(self):
+        self.assert_deprecated(np.dtype, args=([('a', int, 1)],))
+
+
+class TestNonZero(_DeprecationTestCase):
+    # 2019-05-26, 1.17.0
+    def test_zerod(self):
+        self.assert_deprecated(lambda: np.nonzero(np.array(0)))
+        self.assert_deprecated(lambda: np.nonzero(np.array(1)))
+
+
+def test_deprecate_ragged_arrays():
+    # 2019-11-29 1.19.0
+    #
+    # NEP 34 deprecated automatic object dtype when creating ragged
+    # arrays. Also see the "ragged" tests in `test_multiarray`
+    #
+    # emits a VisibleDeprecationWarning
+    arg = [1, [2, 3]]
+    with assert_warns(np.VisibleDeprecationWarning):
+        np.array(arg)
+
+
+class TestToString(_DeprecationTestCase):
+    # 2020-03-06 1.19.0
+    message = re.escape("tostring() is deprecated. Use tobytes() instead.")
+
+    def test_tostring(self):
+        arr = np.array(list(b"test\xFF"), dtype=np.uint8)
+        self.assert_deprecated(arr.tostring)
+
+    def test_tostring_matches_tobytes(self):
+        arr = np.array(list(b"test\xFF"), dtype=np.uint8)
+        b = arr.tobytes()
+        with assert_warns(DeprecationWarning):
+            s = arr.tostring()
+        assert s == b
+
+
+class TestDTypeCoercion(_DeprecationTestCase):
+    # 2020-02-06 1.19.0
+    message = "Converting .* to a dtype .*is deprecated"
+    deprecated_types = [
+        # The builtin scalar super types:
+        np.generic, np.flexible, np.number,
+        np.inexact, np.floating, np.complexfloating,
+        np.integer, np.unsignedinteger, np.signedinteger,
+        # character is a deprecated S1 special case:
+        np.character,
+    ]
+
+    def test_dtype_coercion(self):
+        for scalar_type in self.deprecated_types:
+            self.assert_deprecated(np.dtype, args=(scalar_type,))
+
+    def test_array_construction(self):
+        for scalar_type in self.deprecated_types:
+            self.assert_deprecated(np.array, args=([], scalar_type,))
+
+    def test_not_deprecated(self):
+        # All specific types are not deprecated:
+        for group in np.sctypes.values():
+            for scalar_type in group:
+                self.assert_not_deprecated(np.dtype, args=(scalar_type,))
+
+        for scalar_type in [type, dict, list, tuple]:
+            # Typical python types are coerced to object currently:
+            self.assert_not_deprecated(np.dtype, args=(scalar_type,))
+
+
+class BuiltInRoundComplexDType(_DeprecationTestCase):
+    # 2020-03-31 1.19.0
+    deprecated_types = [np.csingle, np.cdouble, np.clongdouble]
+    not_deprecated_types = [
+        np.int8, np.int16, np.int32, np.int64,
+        np.uint8, np.uint16, np.uint32, np.uint64,
+        np.float16, np.float32, np.float64,
+    ]
+
+    def test_deprecated(self):
+        for scalar_type in self.deprecated_types:
+            scalar = scalar_type(0)
+            self.assert_deprecated(round, args=(scalar,))
+            self.assert_deprecated(round, args=(scalar, 0))
+            self.assert_deprecated(round, args=(scalar,), kwargs={'ndigits': 0})
+    
+    def test_not_deprecated(self):
+        for scalar_type in self.not_deprecated_types:
+            scalar = scalar_type(0)
+            self.assert_not_deprecated(round, args=(scalar,))
+            self.assert_not_deprecated(round, args=(scalar, 0))
+            self.assert_not_deprecated(round, args=(scalar,), kwargs={'ndigits': 0})

venv/Lib/site-packages/numpy/core/tests/test_errstate.py

@@ -0,0 +1,59 @@
+import pytest
+import sysconfig
+
+import numpy as np
+from numpy.testing import assert_, assert_raises
+
+# The floating point emulation on ARM EABI systems lacking a hardware FPU is
+# known to be buggy. This is an attempt to identify these hosts. It may not
+# catch all possible cases, but it catches the known cases of gh-413 and
+# gh-15562.
+hosttype = sysconfig.get_config_var('HOST_GNU_TYPE')
+arm_softfloat = False if hosttype is None else hosttype.endswith('gnueabi')
+
+class TestErrstate:
+    @pytest.mark.skipif(arm_softfloat,
+                        reason='platform/cpu issue with FPU (gh-413,-15562)')
+    def test_invalid(self):
+        with np.errstate(all='raise', under='ignore'):
+            a = -np.arange(3)
+            # This should work
+            with np.errstate(invalid='ignore'):
+                np.sqrt(a)
+            # While this should fail!
+            with assert_raises(FloatingPointError):
+                np.sqrt(a)
+
+    @pytest.mark.skipif(arm_softfloat,
+                        reason='platform/cpu issue with FPU (gh-15562)')
+    def test_divide(self):
+        with np.errstate(all='raise', under='ignore'):
+            a = -np.arange(3)
+            # This should work
+            with np.errstate(divide='ignore'):
+                a // 0
+            # While this should fail!
+            with assert_raises(FloatingPointError):
+                a // 0
+            # As should this, see gh-15562
+            with assert_raises(FloatingPointError):
+                a // a
+
+    def test_errcall(self):
+        def foo(*args):
+            print(args)
+
+        olderrcall = np.geterrcall()
+        with np.errstate(call=foo):
+            assert_(np.geterrcall() is foo, 'call is not foo')
+            with np.errstate(call=None):
+                assert_(np.geterrcall() is None, 'call is not None')
+        assert_(np.geterrcall() is olderrcall, 'call is not olderrcall')
+
+    def test_errstate_decorator(self):
+        @np.errstate(all='ignore')
+        def foo():
+            a = -np.arange(3)
+            a // 0
+            
+        foo()

venv/Lib/site-packages/numpy/core/tests/test_extint128.py

@@ -0,0 +1,219 @@
+import itertools
+import contextlib
+import operator
+import pytest
+
+import numpy as np
+import numpy.core._multiarray_tests as mt
+
+from numpy.testing import assert_raises, assert_equal
+
+
+INT64_MAX = np.iinfo(np.int64).max
+INT64_MIN = np.iinfo(np.int64).min
+INT64_MID = 2**32
+
+# int128 is not two's complement, the sign bit is separate
+INT128_MAX = 2**128 - 1
+INT128_MIN = -INT128_MAX
+INT128_MID = 2**64
+
+INT64_VALUES = (
+    [INT64_MIN + j for j in range(20)] +
+    [INT64_MAX - j for j in range(20)] +
+    [INT64_MID + j for j in range(-20, 20)] +
+    [2*INT64_MID + j for j in range(-20, 20)] +
+    [INT64_MID//2 + j for j in range(-20, 20)] +
+    list(range(-70, 70))
+)
+
+INT128_VALUES = (
+    [INT128_MIN + j for j in range(20)] +
+    [INT128_MAX - j for j in range(20)] +
+    [INT128_MID + j for j in range(-20, 20)] +
+    [2*INT128_MID + j for j in range(-20, 20)] +
+    [INT128_MID//2 + j for j in range(-20, 20)] +
+    list(range(-70, 70)) +
+    [False]  # negative zero
+)
+
+INT64_POS_VALUES = [x for x in INT64_VALUES if x > 0]
+
+
+@contextlib.contextmanager
+def exc_iter(*args):
+    """
+    Iterate over Cartesian product of *args, and if an exception is raised,
+    add information of the current iterate.
+    """
+
+    value = [None]
+
+    def iterate():
+        for v in itertools.product(*args):
+            value[0] = v
+            yield v
+
+    try:
+        yield iterate()
+    except Exception:
+        import traceback
+        msg = "At: %r\n%s" % (repr(value[0]),
+                              traceback.format_exc())
+        raise AssertionError(msg)
+
+
+def test_safe_binop():
+    # Test checked arithmetic routines
+
+    ops = [
+        (operator.add, 1),
+        (operator.sub, 2),
+        (operator.mul, 3)
+    ]
+
+    with exc_iter(ops, INT64_VALUES, INT64_VALUES) as it:
+        for xop, a, b in it:
+            pyop, op = xop
+            c = pyop(a, b)
+
+            if not (INT64_MIN <= c <= INT64_MAX):
+                assert_raises(OverflowError, mt.extint_safe_binop, a, b, op)
+            else:
+                d = mt.extint_safe_binop(a, b, op)
+                if c != d:
+                    # assert_equal is slow
+                    assert_equal(d, c)
+
+
+def test_to_128():
+    with exc_iter(INT64_VALUES) as it:
+        for a, in it:
+            b = mt.extint_to_128(a)
+            if a != b:
+                assert_equal(b, a)
+
+
+def test_to_64():
+    with exc_iter(INT128_VALUES) as it:
+        for a, in it:
+            if not (INT64_MIN <= a <= INT64_MAX):
+                assert_raises(OverflowError, mt.extint_to_64, a)
+            else:
+                b = mt.extint_to_64(a)
+                if a != b:
+                    assert_equal(b, a)
+
+
+def test_mul_64_64():
+    with exc_iter(INT64_VALUES, INT64_VALUES) as it:
+        for a, b in it:
+            c = a * b
+            d = mt.extint_mul_64_64(a, b)
+            if c != d:
+                assert_equal(d, c)
+
+
+def test_add_128():
+    with exc_iter(INT128_VALUES, INT128_VALUES) as it:
+        for a, b in it:
+            c = a + b
+            if not (INT128_MIN <= c <= INT128_MAX):
+                assert_raises(OverflowError, mt.extint_add_128, a, b)
+            else:
+                d = mt.extint_add_128(a, b)
+                if c != d:
+                    assert_equal(d, c)
+
+
+def test_sub_128():
+    with exc_iter(INT128_VALUES, INT128_VALUES) as it:
+        for a, b in it:
+            c = a - b
+            if not (INT128_MIN <= c <= INT128_MAX):
+                assert_raises(OverflowError, mt.extint_sub_128, a, b)
+            else:
+                d = mt.extint_sub_128(a, b)
+                if c != d:
+                    assert_equal(d, c)
+
+
+def test_neg_128():
+    with exc_iter(INT128_VALUES) as it:
+        for a, in it:
+            b = -a
+            c = mt.extint_neg_128(a)
+            if b != c:
+                assert_equal(c, b)
+
+
+def test_shl_128():
+    with exc_iter(INT128_VALUES) as it:
+        for a, in it:
+            if a < 0:
+                b = -(((-a) << 1) & (2**128-1))
+            else:
+                b = (a << 1) & (2**128-1)
+            c = mt.extint_shl_128(a)
+            if b != c:
+                assert_equal(c, b)
+
+
+def test_shr_128():
+    with exc_iter(INT128_VALUES) as it:
+        for a, in it:
+            if a < 0:
+                b = -((-a) >> 1)
+            else:
+                b = a >> 1
+            c = mt.extint_shr_128(a)
+            if b != c:
+                assert_equal(c, b)
+
+
+def test_gt_128():
+    with exc_iter(INT128_VALUES, INT128_VALUES) as it:
+        for a, b in it:
+            c = a > b
+            d = mt.extint_gt_128(a, b)
+            if c != d:
+                assert_equal(d, c)
+
+
+@pytest.mark.slow
+def test_divmod_128_64():
+    with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it:
+        for a, b in it:
+            if a >= 0:
+                c, cr = divmod(a, b)
+            else:
+                c, cr = divmod(-a, b)
+                c = -c
+                cr = -cr
+
+            d, dr = mt.extint_divmod_128_64(a, b)
+
+            if c != d or d != dr or b*d + dr != a:
+                assert_equal(d, c)
+                assert_equal(dr, cr)
+                assert_equal(b*d + dr, a)
+
+
+def test_floordiv_128_64():
+    with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it:
+        for a, b in it:
+            c = a // b
+            d = mt.extint_floordiv_128_64(a, b)
+
+            if c != d:
+                assert_equal(d, c)
+
+
+def test_ceildiv_128_64():
+    with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it:
+        for a, b in it:
+            c = (a + b - 1) // b
+            d = mt.extint_ceildiv_128_64(a, b)
+
+            if c != d:
+                assert_equal(d, c)

venv/Lib/site-packages/numpy/core/tests/test_function_base.py

@@ -0,0 +1,370 @@
+from numpy import (
+    logspace, linspace, geomspace, dtype, array, sctypes, arange, isnan,
+    ndarray, sqrt, nextafter, stack
+    )
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_array_equal, assert_allclose,
+    )
+
+
+class PhysicalQuantity(float):
+    def __new__(cls, value):
+        return float.__new__(cls, value)
+
+    def __add__(self, x):
+        assert_(isinstance(x, PhysicalQuantity))
+        return PhysicalQuantity(float(x) + float(self))
+    __radd__ = __add__
+
+    def __sub__(self, x):
+        assert_(isinstance(x, PhysicalQuantity))
+        return PhysicalQuantity(float(self) - float(x))
+
+    def __rsub__(self, x):
+        assert_(isinstance(x, PhysicalQuantity))
+        return PhysicalQuantity(float(x) - float(self))
+
+    def __mul__(self, x):
+        return PhysicalQuantity(float(x) * float(self))
+    __rmul__ = __mul__
+
+    def __div__(self, x):
+        return PhysicalQuantity(float(self) / float(x))
+
+    def __rdiv__(self, x):
+        return PhysicalQuantity(float(x) / float(self))
+
+
+class PhysicalQuantity2(ndarray):
+    __array_priority__ = 10
+
+
+class TestLogspace:
+
+    def test_basic(self):
+        y = logspace(0, 6)
+        assert_(len(y) == 50)
+        y = logspace(0, 6, num=100)
+        assert_(y[-1] == 10 ** 6)
+        y = logspace(0, 6, endpoint=False)
+        assert_(y[-1] < 10 ** 6)
+        y = logspace(0, 6, num=7)
+        assert_array_equal(y, [1, 10, 100, 1e3, 1e4, 1e5, 1e6])
+
+    def test_start_stop_array(self):
+        start = array([0., 1.])
+        stop = array([6., 7.])
+        t1 = logspace(start, stop, 6)
+        t2 = stack([logspace(_start, _stop, 6)
+                    for _start, _stop in zip(start, stop)], axis=1)
+        assert_equal(t1, t2)
+        t3 = logspace(start, stop[0], 6)
+        t4 = stack([logspace(_start, stop[0], 6)
+                    for _start in start], axis=1)
+        assert_equal(t3, t4)
+        t5 = logspace(start, stop, 6, axis=-1)
+        assert_equal(t5, t2.T)
+
+    def test_dtype(self):
+        y = logspace(0, 6, dtype='float32')
+        assert_equal(y.dtype, dtype('float32'))
+        y = logspace(0, 6, dtype='float64')
+        assert_equal(y.dtype, dtype('float64'))
+        y = logspace(0, 6, dtype='int32')
+        assert_equal(y.dtype, dtype('int32'))
+
+    def test_physical_quantities(self):
+        a = PhysicalQuantity(1.0)
+        b = PhysicalQuantity(5.0)
+        assert_equal(logspace(a, b), logspace(1.0, 5.0))
+
+    def test_subclass(self):
+        a = array(1).view(PhysicalQuantity2)
+        b = array(7).view(PhysicalQuantity2)
+        ls = logspace(a, b)
+        assert type(ls) is PhysicalQuantity2
+        assert_equal(ls, logspace(1.0, 7.0))
+        ls = logspace(a, b, 1)
+        assert type(ls) is PhysicalQuantity2
+        assert_equal(ls, logspace(1.0, 7.0, 1))
+
+
+class TestGeomspace:
+
+    def test_basic(self):
+        y = geomspace(1, 1e6)
+        assert_(len(y) == 50)
+        y = geomspace(1, 1e6, num=100)
+        assert_(y[-1] == 10 ** 6)
+        y = geomspace(1, 1e6, endpoint=False)
+        assert_(y[-1] < 10 ** 6)
+        y = geomspace(1, 1e6, num=7)
+        assert_array_equal(y, [1, 10, 100, 1e3, 1e4, 1e5, 1e6])
+
+        y = geomspace(8, 2, num=3)
+        assert_allclose(y, [8, 4, 2])
+        assert_array_equal(y.imag, 0)
+
+        y = geomspace(-1, -100, num=3)
+        assert_array_equal(y, [-1, -10, -100])
+        assert_array_equal(y.imag, 0)
+
+        y = geomspace(-100, -1, num=3)
+        assert_array_equal(y, [-100, -10, -1])
+        assert_array_equal(y.imag, 0)
+
+    def test_complex(self):
+        # Purely imaginary
+        y = geomspace(1j, 16j, num=5)
+        assert_allclose(y, [1j, 2j, 4j, 8j, 16j])
+        assert_array_equal(y.real, 0)
+
+        y = geomspace(-4j, -324j, num=5)
+        assert_allclose(y, [-4j, -12j, -36j, -108j, -324j])
+        assert_array_equal(y.real, 0)
+
+        y = geomspace(1+1j, 1000+1000j, num=4)
+        assert_allclose(y, [1+1j, 10+10j, 100+100j, 1000+1000j])
+
+        y = geomspace(-1+1j, -1000+1000j, num=4)
+        assert_allclose(y, [-1+1j, -10+10j, -100+100j, -1000+1000j])
+
+        # Logarithmic spirals
+        y = geomspace(-1, 1, num=3, dtype=complex)
+        assert_allclose(y, [-1, 1j, +1])
+
+        y = geomspace(0+3j, -3+0j, 3)
+        assert_allclose(y, [0+3j, -3/sqrt(2)+3j/sqrt(2), -3+0j])
+        y = geomspace(0+3j, 3+0j, 3)
+        assert_allclose(y, [0+3j, 3/sqrt(2)+3j/sqrt(2), 3+0j])
+        y = geomspace(-3+0j, 0-3j, 3)
+        assert_allclose(y, [-3+0j, -3/sqrt(2)-3j/sqrt(2), 0-3j])
+        y = geomspace(0+3j, -3+0j, 3)
+        assert_allclose(y, [0+3j, -3/sqrt(2)+3j/sqrt(2), -3+0j])
+        y = geomspace(-2-3j, 5+7j, 7)
+        assert_allclose(y, [-2-3j, -0.29058977-4.15771027j,
+                            2.08885354-4.34146838j, 4.58345529-3.16355218j,
+                            6.41401745-0.55233457j, 6.75707386+3.11795092j,
+                            5+7j])
+
+        # Type promotion should prevent the -5 from becoming a NaN
+        y = geomspace(3j, -5, 2)
+        assert_allclose(y, [3j, -5])
+        y = geomspace(-5, 3j, 2)
+        assert_allclose(y, [-5, 3j])
+
+    def test_dtype(self):
+        y = geomspace(1, 1e6, dtype='float32')
+        assert_equal(y.dtype, dtype('float32'))
+        y = geomspace(1, 1e6, dtype='float64')
+        assert_equal(y.dtype, dtype('float64'))
+        y = geomspace(1, 1e6, dtype='int32')
+        assert_equal(y.dtype, dtype('int32'))
+
+        # Native types
+        y = geomspace(1, 1e6, dtype=float)
+        assert_equal(y.dtype, dtype('float_'))
+        y = geomspace(1, 1e6, dtype=complex)
+        assert_equal(y.dtype, dtype('complex'))
+
+    def test_start_stop_array_scalar(self):
+        lim1 = array([120, 100], dtype="int8")
+        lim2 = array([-120, -100], dtype="int8")
+        lim3 = array([1200, 1000], dtype="uint16")
+        t1 = geomspace(lim1[0], lim1[1], 5)
+        t2 = geomspace(lim2[0], lim2[1], 5)
+        t3 = geomspace(lim3[0], lim3[1], 5)
+        t4 = geomspace(120.0, 100.0, 5)
+        t5 = geomspace(-120.0, -100.0, 5)
+        t6 = geomspace(1200.0, 1000.0, 5)
+
+        # t3 uses float32, t6 uses float64
+        assert_allclose(t1, t4, rtol=1e-2)
+        assert_allclose(t2, t5, rtol=1e-2)
+        assert_allclose(t3, t6, rtol=1e-5)
+
+    def test_start_stop_array(self):
+        # Try to use all special cases.
+        start = array([1.e0, 32., 1j, -4j, 1+1j, -1])
+        stop = array([1.e4, 2., 16j, -324j, 10000+10000j, 1])
+        t1 = geomspace(start, stop, 5)
+        t2 = stack([geomspace(_start, _stop, 5)
+                    for _start, _stop in zip(start, stop)], axis=1)
+        assert_equal(t1, t2)
+        t3 = geomspace(start, stop[0], 5)
+        t4 = stack([geomspace(_start, stop[0], 5)
+                    for _start in start], axis=1)
+        assert_equal(t3, t4)
+        t5 = geomspace(start, stop, 5, axis=-1)
+        assert_equal(t5, t2.T)
+
+    def test_physical_quantities(self):
+        a = PhysicalQuantity(1.0)
+        b = PhysicalQuantity(5.0)
+        assert_equal(geomspace(a, b), geomspace(1.0, 5.0))
+
+    def test_subclass(self):
+        a = array(1).view(PhysicalQuantity2)
+        b = array(7).view(PhysicalQuantity2)
+        gs = geomspace(a, b)
+        assert type(gs) is PhysicalQuantity2
+        assert_equal(gs, geomspace(1.0, 7.0))
+        gs = geomspace(a, b, 1)
+        assert type(gs) is PhysicalQuantity2
+        assert_equal(gs, geomspace(1.0, 7.0, 1))
+
+    def test_bounds(self):
+        assert_raises(ValueError, geomspace, 0, 10)
+        assert_raises(ValueError, geomspace, 10, 0)
+        assert_raises(ValueError, geomspace, 0, 0)
+
+
+class TestLinspace:
+
+    def test_basic(self):
+        y = linspace(0, 10)
+        assert_(len(y) == 50)
+        y = linspace(2, 10, num=100)
+        assert_(y[-1] == 10)
+        y = linspace(2, 10, endpoint=False)
+        assert_(y[-1] < 10)
+        assert_raises(ValueError, linspace, 0, 10, num=-1)
+
+    def test_corner(self):
+        y = list(linspace(0, 1, 1))
+        assert_(y == [0.0], y)
+        assert_raises(TypeError, linspace, 0, 1, num=2.5)
+
+    def test_type(self):
+        t1 = linspace(0, 1, 0).dtype
+        t2 = linspace(0, 1, 1).dtype
+        t3 = linspace(0, 1, 2).dtype
+        assert_equal(t1, t2)
+        assert_equal(t2, t3)
+
+    def test_dtype(self):
+        y = linspace(0, 6, dtype='float32')
+        assert_equal(y.dtype, dtype('float32'))
+        y = linspace(0, 6, dtype='float64')
+        assert_equal(y.dtype, dtype('float64'))
+        y = linspace(0, 6, dtype='int32')
+        assert_equal(y.dtype, dtype('int32'))
+
+    def test_start_stop_array_scalar(self):
+        lim1 = array([-120, 100], dtype="int8")
+        lim2 = array([120, -100], dtype="int8")
+        lim3 = array([1200, 1000], dtype="uint16")
+        t1 = linspace(lim1[0], lim1[1], 5)
+        t2 = linspace(lim2[0], lim2[1], 5)
+        t3 = linspace(lim3[0], lim3[1], 5)
+        t4 = linspace(-120.0, 100.0, 5)
+        t5 = linspace(120.0, -100.0, 5)
+        t6 = linspace(1200.0, 1000.0, 5)
+        assert_equal(t1, t4)
+        assert_equal(t2, t5)
+        assert_equal(t3, t6)
+
+    def test_start_stop_array(self):
+        start = array([-120, 120], dtype="int8")
+        stop = array([100, -100], dtype="int8")
+        t1 = linspace(start, stop, 5)
+        t2 = stack([linspace(_start, _stop, 5)
+                    for _start, _stop in zip(start, stop)], axis=1)
+        assert_equal(t1, t2)
+        t3 = linspace(start, stop[0], 5)
+        t4 = stack([linspace(_start, stop[0], 5)
+                    for _start in start], axis=1)
+        assert_equal(t3, t4)
+        t5 = linspace(start, stop, 5, axis=-1)
+        assert_equal(t5, t2.T)
+
+    def test_complex(self):
+        lim1 = linspace(1 + 2j, 3 + 4j, 5)
+        t1 = array([1.0+2.j, 1.5+2.5j,  2.0+3j, 2.5+3.5j, 3.0+4j])
+        lim2 = linspace(1j, 10, 5)
+        t2 = array([0.0+1.j, 2.5+0.75j, 5.0+0.5j, 7.5+0.25j, 10.0+0j])
+        assert_equal(lim1, t1)
+        assert_equal(lim2, t2)
+
+    def test_physical_quantities(self):
+        a = PhysicalQuantity(0.0)
+        b = PhysicalQuantity(1.0)
+        assert_equal(linspace(a, b), linspace(0.0, 1.0))
+
+    def test_subclass(self):
+        a = array(0).view(PhysicalQuantity2)
+        b = array(1).view(PhysicalQuantity2)
+        ls = linspace(a, b)
+        assert type(ls) is PhysicalQuantity2
+        assert_equal(ls, linspace(0.0, 1.0))
+        ls = linspace(a, b, 1)
+        assert type(ls) is PhysicalQuantity2
+        assert_equal(ls, linspace(0.0, 1.0, 1))
+
+    def test_array_interface(self):
+        # Regression test for https://github.com/numpy/numpy/pull/6659
+        # Ensure that start/stop can be objects that implement
+        # __array_interface__ and are convertible to numeric scalars
+
+        class Arrayish:
+            """
+            A generic object that supports the __array_interface__ and hence
+            can in principle be converted to a numeric scalar, but is not
+            otherwise recognized as numeric, but also happens to support
+            multiplication by floats.
+
+            Data should be an object that implements the buffer interface,
+            and contains at least 4 bytes.
+            """
+
+            def __init__(self, data):
+                self._data = data
+
+            @property
+            def __array_interface__(self):
+                return {'shape': (), 'typestr': '<i4', 'data': self._data,
+                        'version': 3}
+
+            def __mul__(self, other):
+                # For the purposes of this test any multiplication is an
+                # identity operation :)
+                return self
+
+        one = Arrayish(array(1, dtype='<i4'))
+        five = Arrayish(array(5, dtype='<i4'))
+
+        assert_equal(linspace(one, five), linspace(1, 5))
+
+    def test_denormal_numbers(self):
+        # Regression test for gh-5437. Will probably fail when compiled
+        # with ICC, which flushes denormals to zero
+        for ftype in sctypes['float']:
+            stop = nextafter(ftype(0), ftype(1)) * 5  # A denormal number
+            assert_(any(linspace(0, stop, 10, endpoint=False, dtype=ftype)))
+
+    def test_equivalent_to_arange(self):
+        for j in range(1000):
+            assert_equal(linspace(0, j, j+1, dtype=int),
+                         arange(j+1, dtype=int))
+
+    def test_retstep(self):
+        for num in [0, 1, 2]:
+            for ept in [False, True]:
+                y = linspace(0, 1, num, endpoint=ept, retstep=True)
+                assert isinstance(y, tuple) and len(y) == 2
+                if num == 2:
+                    y0_expect = [0.0, 1.0] if ept else [0.0, 0.5]
+                    assert_array_equal(y[0], y0_expect)
+                    assert_equal(y[1], y0_expect[1])
+                elif num == 1 and not ept:
+                    assert_array_equal(y[0], [0.0])
+                    assert_equal(y[1], 1.0)
+                else:
+                    assert_array_equal(y[0], [0.0][:num])
+                    assert isnan(y[1])
+
+    def test_object(self):
+        start = array(1, dtype='O')
+        stop = array(2, dtype='O')
+        y = linspace(start, stop, 3)
+        assert_array_equal(y, array([1., 1.5, 2.]))

venv/Lib/site-packages/numpy/core/tests/test_getlimits.py

@@ -0,0 +1,121 @@
+""" Test functions for limits module.
+
+"""
+import numpy as np
+from numpy.core import finfo, iinfo
+from numpy import half, single, double, longdouble
+from numpy.testing import assert_equal, assert_, assert_raises
+from numpy.core.getlimits import _discovered_machar, _float_ma
+
+##################################################
+
+class TestPythonFloat:
+    def test_singleton(self):
+        ftype = finfo(float)
+        ftype2 = finfo(float)
+        assert_equal(id(ftype), id(ftype2))
+
+class TestHalf:
+    def test_singleton(self):
+        ftype = finfo(half)
+        ftype2 = finfo(half)
+        assert_equal(id(ftype), id(ftype2))
+
+class TestSingle:
+    def test_singleton(self):
+        ftype = finfo(single)
+        ftype2 = finfo(single)
+        assert_equal(id(ftype), id(ftype2))
+
+class TestDouble:
+    def test_singleton(self):
+        ftype = finfo(double)
+        ftype2 = finfo(double)
+        assert_equal(id(ftype), id(ftype2))
+
+class TestLongdouble:
+    def test_singleton(self):
+        ftype = finfo(longdouble)
+        ftype2 = finfo(longdouble)
+        assert_equal(id(ftype), id(ftype2))
+
+class TestFinfo:
+    def test_basic(self):
+        dts = list(zip(['f2', 'f4', 'f8', 'c8', 'c16'],
+                       [np.float16, np.float32, np.float64, np.complex64,
+                        np.complex128]))
+        for dt1, dt2 in dts:
+            for attr in ('bits', 'eps', 'epsneg', 'iexp', 'machar', 'machep',
+                         'max', 'maxexp', 'min', 'minexp', 'negep', 'nexp',
+                         'nmant', 'precision', 'resolution', 'tiny'):
+                assert_equal(getattr(finfo(dt1), attr),
+                             getattr(finfo(dt2), attr), attr)
+        assert_raises(ValueError, finfo, 'i4')
+
+class TestIinfo:
+    def test_basic(self):
+        dts = list(zip(['i1', 'i2', 'i4', 'i8',
+                   'u1', 'u2', 'u4', 'u8'],
+                  [np.int8, np.int16, np.int32, np.int64,
+                   np.uint8, np.uint16, np.uint32, np.uint64]))
+        for dt1, dt2 in dts:
+            for attr in ('bits', 'min', 'max'):
+                assert_equal(getattr(iinfo(dt1), attr),
+                             getattr(iinfo(dt2), attr), attr)
+        assert_raises(ValueError, iinfo, 'f4')
+
+    def test_unsigned_max(self):
+        types = np.sctypes['uint']
+        for T in types:
+            assert_equal(iinfo(T).max, T(-1))
+
+class TestRepr:
+    def test_iinfo_repr(self):
+        expected = "iinfo(min=-32768, max=32767, dtype=int16)"
+        assert_equal(repr(np.iinfo(np.int16)), expected)
+
+    def test_finfo_repr(self):
+        expected = "finfo(resolution=1e-06, min=-3.4028235e+38," + \
+                   " max=3.4028235e+38, dtype=float32)"
+        assert_equal(repr(np.finfo(np.float32)), expected)
+
+
+def test_instances():
+    iinfo(10)
+    finfo(3.0)
+
+
+def assert_ma_equal(discovered, ma_like):
+    # Check MachAr-like objects same as calculated MachAr instances
+    for key, value in discovered.__dict__.items():
+        assert_equal(value, getattr(ma_like, key))
+        if hasattr(value, 'shape'):
+            assert_equal(value.shape, getattr(ma_like, key).shape)
+            assert_equal(value.dtype, getattr(ma_like, key).dtype)
+
+
+def test_known_types():
+    # Test we are correctly compiling parameters for known types
+    for ftype, ma_like in ((np.float16, _float_ma[16]),
+                           (np.float32, _float_ma[32]),
+                           (np.float64, _float_ma[64])):
+        assert_ma_equal(_discovered_machar(ftype), ma_like)
+    # Suppress warning for broken discovery of double double on PPC
+    with np.errstate(all='ignore'):
+        ld_ma = _discovered_machar(np.longdouble)
+    bytes = np.dtype(np.longdouble).itemsize
+    if (ld_ma.it, ld_ma.maxexp) == (63, 16384) and bytes in (12, 16):
+        # 80-bit extended precision
+        assert_ma_equal(ld_ma, _float_ma[80])
+    elif (ld_ma.it, ld_ma.maxexp) == (112, 16384) and bytes == 16:
+        # IEE 754 128-bit
+        assert_ma_equal(ld_ma, _float_ma[128])
+
+
+def test_plausible_finfo():
+    # Assert that finfo returns reasonable results for all types
+    for ftype in np.sctypes['float'] + np.sctypes['complex']:
+        info = np.finfo(ftype)
+        assert_(info.nmant > 1)
+        assert_(info.minexp < -1)
+        assert_(info.maxexp > 1)

venv/Lib/site-packages/numpy/core/tests/test_half.py

@@ -0,0 +1,539 @@
+import platform
+import pytest
+
+import numpy as np
+from numpy import uint16, float16, float32, float64
+from numpy.testing import assert_, assert_equal
+
+
+def assert_raises_fpe(strmatch, callable, *args, **kwargs):
+    try:
+        callable(*args, **kwargs)
+    except FloatingPointError as exc:
+        assert_(str(exc).find(strmatch) >= 0,
+                "Did not raise floating point %s error" % strmatch)
+    else:
+        assert_(False,
+                "Did not raise floating point %s error" % strmatch)
+
+class TestHalf:
+    def setup(self):
+        # An array of all possible float16 values
+        self.all_f16 = np.arange(0x10000, dtype=uint16)
+        self.all_f16.dtype = float16
+        self.all_f32 = np.array(self.all_f16, dtype=float32)
+        self.all_f64 = np.array(self.all_f16, dtype=float64)
+
+        # An array of all non-NaN float16 values, in sorted order
+        self.nonan_f16 = np.concatenate(
+                                (np.arange(0xfc00, 0x7fff, -1, dtype=uint16),
+                                 np.arange(0x0000, 0x7c01, 1, dtype=uint16)))
+        self.nonan_f16.dtype = float16
+        self.nonan_f32 = np.array(self.nonan_f16, dtype=float32)
+        self.nonan_f64 = np.array(self.nonan_f16, dtype=float64)
+
+        # An array of all finite float16 values, in sorted order
+        self.finite_f16 = self.nonan_f16[1:-1]
+        self.finite_f32 = self.nonan_f32[1:-1]
+        self.finite_f64 = self.nonan_f64[1:-1]
+
+    def test_half_conversions(self):
+        """Checks that all 16-bit values survive conversion
+           to/from 32-bit and 64-bit float"""
+        # Because the underlying routines preserve the NaN bits, every
+        # value is preserved when converting to/from other floats.
+
+        # Convert from float32 back to float16
+        b = np.array(self.all_f32, dtype=float16)
+        assert_equal(self.all_f16.view(dtype=uint16),
+                     b.view(dtype=uint16))
+
+        # Convert from float64 back to float16
+        b = np.array(self.all_f64, dtype=float16)
+        assert_equal(self.all_f16.view(dtype=uint16),
+                     b.view(dtype=uint16))
+
+        # Convert float16 to longdouble and back
+        # This doesn't necessarily preserve the extra NaN bits,
+        # so exclude NaNs.
+        a_ld = np.array(self.nonan_f16, dtype=np.longdouble)
+        b = np.array(a_ld, dtype=float16)
+        assert_equal(self.nonan_f16.view(dtype=uint16),
+                     b.view(dtype=uint16))
+
+        # Check the range for which all integers can be represented
+        i_int = np.arange(-2048, 2049)
+        i_f16 = np.array(i_int, dtype=float16)
+        j = np.array(i_f16, dtype=int)
+        assert_equal(i_int, j)
+
+    @pytest.mark.parametrize("offset", [None, "up", "down"])
+    @pytest.mark.parametrize("shift", [None, "up", "down"])
+    @pytest.mark.parametrize("float_t", [np.float32, np.float64])
+    def test_half_conversion_rounding(self, float_t, shift, offset):
+        # Assumes that round to even is used during casting.
+        max_pattern = np.float16(np.finfo(np.float16).max).view(np.uint16)
+
+        # Test all (positive) finite numbers, denormals are most interesting
+        # however:
+        f16s_patterns = np.arange(0, max_pattern+1, dtype=np.uint16)
+        f16s_float = f16s_patterns.view(np.float16).astype(float_t)
+
+        # Shift the values by half a bit up or a down (or do not shift),
+        if shift == "up":
+            f16s_float = 0.5 * (f16s_float[:-1] + f16s_float[1:])[1:]
+        elif shift == "down":
+            f16s_float = 0.5 * (f16s_float[:-1] + f16s_float[1:])[:-1]
+        else:
+            f16s_float = f16s_float[1:-1]
+
+        # Increase the float by a minimal value:
+        if offset == "up":
+            f16s_float = np.nextafter(f16s_float, float_t(1e50))
+        elif offset == "down":
+            f16s_float = np.nextafter(f16s_float, float_t(-1e50))
+
+        # Convert back to float16 and its bit pattern:
+        res_patterns = f16s_float.astype(np.float16).view(np.uint16)
+
+        # The above calculations tries the original values, or the exact
+        # mid points between the float16 values. It then further offsets them
+        # by as little as possible. If no offset occurs, "round to even"
+        # logic will be necessary, an arbitrarily small offset should cause
+        # normal up/down rounding always.
+
+        # Calculate the expected pattern:
+        cmp_patterns = f16s_patterns[1:-1].copy()
+
+        if shift == "down" and offset != "up":
+            shift_pattern = -1
+        elif shift == "up" and offset != "down":
+            shift_pattern = 1
+        else:
+            # There cannot be a shift, either shift is None, so all rounding
+            # will go back to original, or shift is reduced by offset too much.
+            shift_pattern = 0
+
+        # If rounding occurs, is it normal rounding or round to even?
+        if offset is None:
+            # Round to even occurs, modify only non-even, cast to allow + (-1)
+            cmp_patterns[0::2].view(np.int16)[...] += shift_pattern
+        else:
+            cmp_patterns.view(np.int16)[...] += shift_pattern
+
+        assert_equal(res_patterns, cmp_patterns)
+
+    @pytest.mark.parametrize(["float_t", "uint_t", "bits"],
+                             [(np.float32, np.uint32, 23),
+                              (np.float64, np.uint64, 52)])
+    def test_half_conversion_denormal_round_even(self, float_t, uint_t, bits):
+        # Test specifically that all bits are considered when deciding
+        # whether round to even should occur (i.e. no bits are lost at the
+        # end. Compare also gh-12721. The most bits can get lost for the
+        # smallest denormal:
+        smallest_value = np.uint16(1).view(np.float16).astype(float_t)
+        assert smallest_value == 2**-24
+
+        # Will be rounded to zero based on round to even rule:
+        rounded_to_zero = smallest_value / float_t(2)
+        assert rounded_to_zero.astype(np.float16) == 0
+
+        # The significand will be all 0 for the float_t, test that we do not
+        # lose the lower ones of these:
+        for i in range(bits):
+            # slightly increasing the value should make it round up:
+            larger_pattern = rounded_to_zero.view(uint_t) | uint_t(1 << i)
+            larger_value = larger_pattern.view(float_t)
+            assert larger_value.astype(np.float16) == smallest_value
+
+    def test_nans_infs(self):
+        with np.errstate(all='ignore'):
+            # Check some of the ufuncs
+            assert_equal(np.isnan(self.all_f16), np.isnan(self.all_f32))
+            assert_equal(np.isinf(self.all_f16), np.isinf(self.all_f32))
+            assert_equal(np.isfinite(self.all_f16), np.isfinite(self.all_f32))
+            assert_equal(np.signbit(self.all_f16), np.signbit(self.all_f32))
+            assert_equal(np.spacing(float16(65504)), np.inf)
+
+            # Check comparisons of all values with NaN
+            nan = float16(np.nan)
+
+            assert_(not (self.all_f16 == nan).any())
+            assert_(not (nan == self.all_f16).any())
+
+            assert_((self.all_f16 != nan).all())
+            assert_((nan != self.all_f16).all())
+
+            assert_(not (self.all_f16 < nan).any())
+            assert_(not (nan < self.all_f16).any())
+
+            assert_(not (self.all_f16 <= nan).any())
+            assert_(not (nan <= self.all_f16).any())
+
+            assert_(not (self.all_f16 > nan).any())
+            assert_(not (nan > self.all_f16).any())
+
+            assert_(not (self.all_f16 >= nan).any())
+            assert_(not (nan >= self.all_f16).any())
+
+    def test_half_values(self):
+        """Confirms a small number of known half values"""
+        a = np.array([1.0, -1.0,
+                      2.0, -2.0,
+                      0.0999755859375, 0.333251953125,  # 1/10, 1/3
+                      65504, -65504,           # Maximum magnitude
+                      2.0**(-14), -2.0**(-14),  # Minimum normal
+                      2.0**(-24), -2.0**(-24),  # Minimum subnormal
+                      0, -1/1e1000,            # Signed zeros
+                      np.inf, -np.inf])
+        b = np.array([0x3c00, 0xbc00,
+                      0x4000, 0xc000,
+                      0x2e66, 0x3555,
+                      0x7bff, 0xfbff,
+                      0x0400, 0x8400,
+                      0x0001, 0x8001,
+                      0x0000, 0x8000,
+                      0x7c00, 0xfc00], dtype=uint16)
+        b.dtype = float16
+        assert_equal(a, b)
+
+    def test_half_rounding(self):
+        """Checks that rounding when converting to half is correct"""
+        a = np.array([2.0**-25 + 2.0**-35,  # Rounds to minimum subnormal
+                      2.0**-25,       # Underflows to zero (nearest even mode)
+                      2.0**-26,       # Underflows to zero
+                      1.0+2.0**-11 + 2.0**-16,  # rounds to 1.0+2**(-10)
+                      1.0+2.0**-11,   # rounds to 1.0 (nearest even mode)
+                      1.0+2.0**-12,   # rounds to 1.0
+                      65519,          # rounds to 65504
+                      65520],         # rounds to inf
+                      dtype=float64)
+        rounded = [2.0**-24,
+                   0.0,
+                   0.0,
+                   1.0+2.0**(-10),
+                   1.0,
+                   1.0,
+                   65504,
+                   np.inf]
+
+        # Check float64->float16 rounding
+        b = np.array(a, dtype=float16)
+        assert_equal(b, rounded)
+
+        # Check float32->float16 rounding
+        a = np.array(a, dtype=float32)
+        b = np.array(a, dtype=float16)
+        assert_equal(b, rounded)
+
+    def test_half_correctness(self):
+        """Take every finite float16, and check the casting functions with
+           a manual conversion."""
+
+        # Create an array of all finite float16s
+        a_bits = self.finite_f16.view(dtype=uint16)
+
+        # Convert to 64-bit float manually
+        a_sgn = (-1.0)**((a_bits & 0x8000) >> 15)
+        a_exp = np.array((a_bits & 0x7c00) >> 10, dtype=np.int32) - 15
+        a_man = (a_bits & 0x03ff) * 2.0**(-10)
+        # Implicit bit of normalized floats
+        a_man[a_exp != -15] += 1
+        # Denormalized exponent is -14
+        a_exp[a_exp == -15] = -14
+
+        a_manual = a_sgn * a_man * 2.0**a_exp
+
+        a32_fail = np.nonzero(self.finite_f32 != a_manual)[0]
+        if len(a32_fail) != 0:
+            bad_index = a32_fail[0]
+            assert_equal(self.finite_f32, a_manual,
+                 "First non-equal is half value %x -> %g != %g" %
+                            (self.finite_f16[bad_index],
+                             self.finite_f32[bad_index],
+                             a_manual[bad_index]))
+
+        a64_fail = np.nonzero(self.finite_f64 != a_manual)[0]
+        if len(a64_fail) != 0:
+            bad_index = a64_fail[0]
+            assert_equal(self.finite_f64, a_manual,
+                 "First non-equal is half value %x -> %g != %g" %
+                            (self.finite_f16[bad_index],
+                             self.finite_f64[bad_index],
+                             a_manual[bad_index]))
+
+    def test_half_ordering(self):
+        """Make sure comparisons are working right"""
+
+        # All non-NaN float16 values in reverse order
+        a = self.nonan_f16[::-1].copy()
+
+        # 32-bit float copy
+        b = np.array(a, dtype=float32)
+
+        # Should sort the same
+        a.sort()
+        b.sort()
+        assert_equal(a, b)
+
+        # Comparisons should work
+        assert_((a[:-1] <= a[1:]).all())
+        assert_(not (a[:-1] > a[1:]).any())
+        assert_((a[1:] >= a[:-1]).all())
+        assert_(not (a[1:] < a[:-1]).any())
+        # All != except for +/-0
+        assert_equal(np.nonzero(a[:-1] < a[1:])[0].size, a.size-2)
+        assert_equal(np.nonzero(a[1:] > a[:-1])[0].size, a.size-2)
+
+    def test_half_funcs(self):
+        """Test the various ArrFuncs"""
+
+        # fill
+        assert_equal(np.arange(10, dtype=float16),
+                     np.arange(10, dtype=float32))
+
+        # fillwithscalar
+        a = np.zeros((5,), dtype=float16)
+        a.fill(1)
+        assert_equal(a, np.ones((5,), dtype=float16))
+
+        # nonzero and copyswap
+        a = np.array([0, 0, -1, -1/1e20, 0, 2.0**-24, 7.629e-6], dtype=float16)
+        assert_equal(a.nonzero()[0],
+                     [2, 5, 6])
+        a = a.byteswap().newbyteorder()
+        assert_equal(a.nonzero()[0],
+                     [2, 5, 6])
+
+        # dot
+        a = np.arange(0, 10, 0.5, dtype=float16)
+        b = np.ones((20,), dtype=float16)
+        assert_equal(np.dot(a, b),
+                     95)
+
+        # argmax
+        a = np.array([0, -np.inf, -2, 0.5, 12.55, 7.3, 2.1, 12.4], dtype=float16)
+        assert_equal(a.argmax(),
+                     4)
+        a = np.array([0, -np.inf, -2, np.inf, 12.55, np.nan, 2.1, 12.4], dtype=float16)
+        assert_equal(a.argmax(),
+                     5)
+
+        # getitem
+        a = np.arange(10, dtype=float16)
+        for i in range(10):
+            assert_equal(a.item(i), i)
+
+    def test_spacing_nextafter(self):
+        """Test np.spacing and np.nextafter"""
+        # All non-negative finite #'s
+        a = np.arange(0x7c00, dtype=uint16)
+        hinf = np.array((np.inf,), dtype=float16)
+        hnan = np.array((np.nan,), dtype=float16)
+        a_f16 = a.view(dtype=float16)
+
+        assert_equal(np.spacing(a_f16[:-1]), a_f16[1:]-a_f16[:-1])
+
+        assert_equal(np.nextafter(a_f16[:-1], hinf), a_f16[1:])
+        assert_equal(np.nextafter(a_f16[0], -hinf), -a_f16[1])
+        assert_equal(np.nextafter(a_f16[1:], -hinf), a_f16[:-1])
+
+        assert_equal(np.nextafter(hinf, a_f16), a_f16[-1])
+        assert_equal(np.nextafter(-hinf, a_f16), -a_f16[-1])
+
+        assert_equal(np.nextafter(hinf, hinf), hinf)
+        assert_equal(np.nextafter(hinf, -hinf), a_f16[-1])
+        assert_equal(np.nextafter(-hinf, hinf), -a_f16[-1])
+        assert_equal(np.nextafter(-hinf, -hinf), -hinf)
+
+        assert_equal(np.nextafter(a_f16, hnan), hnan[0])
+        assert_equal(np.nextafter(hnan, a_f16), hnan[0])
+
+        assert_equal(np.nextafter(hnan, hnan), hnan)
+        assert_equal(np.nextafter(hinf, hnan), hnan)
+        assert_equal(np.nextafter(hnan, hinf), hnan)
+
+        # switch to negatives
+        a |= 0x8000
+
+        assert_equal(np.spacing(a_f16[0]), np.spacing(a_f16[1]))
+        assert_equal(np.spacing(a_f16[1:]), a_f16[:-1]-a_f16[1:])
+
+        assert_equal(np.nextafter(a_f16[0], hinf), -a_f16[1])
+        assert_equal(np.nextafter(a_f16[1:], hinf), a_f16[:-1])
+        assert_equal(np.nextafter(a_f16[:-1], -hinf), a_f16[1:])
+
+        assert_equal(np.nextafter(hinf, a_f16), -a_f16[-1])
+        assert_equal(np.nextafter(-hinf, a_f16), a_f16[-1])
+
+        assert_equal(np.nextafter(a_f16, hnan), hnan[0])
+        assert_equal(np.nextafter(hnan, a_f16), hnan[0])
+
+    def test_half_ufuncs(self):
+        """Test the various ufuncs"""
+
+        a = np.array([0, 1, 2, 4, 2], dtype=float16)
+        b = np.array([-2, 5, 1, 4, 3], dtype=float16)
+        c = np.array([0, -1, -np.inf, np.nan, 6], dtype=float16)
+
+        assert_equal(np.add(a, b), [-2, 6, 3, 8, 5])
+        assert_equal(np.subtract(a, b), [2, -4, 1, 0, -1])
+        assert_equal(np.multiply(a, b), [0, 5, 2, 16, 6])
+        assert_equal(np.divide(a, b), [0, 0.199951171875, 2, 1, 0.66650390625])
+
+        assert_equal(np.equal(a, b), [False, False, False, True, False])
+        assert_equal(np.not_equal(a, b), [True, True, True, False, True])
+        assert_equal(np.less(a, b), [False, True, False, False, True])
+        assert_equal(np.less_equal(a, b), [False, True, False, True, True])
+        assert_equal(np.greater(a, b), [True, False, True, False, False])
+        assert_equal(np.greater_equal(a, b), [True, False, True, True, False])
+        assert_equal(np.logical_and(a, b), [False, True, True, True, True])
+        assert_equal(np.logical_or(a, b), [True, True, True, True, True])
+        assert_equal(np.logical_xor(a, b), [True, False, False, False, False])
+        assert_equal(np.logical_not(a), [True, False, False, False, False])
+
+        assert_equal(np.isnan(c), [False, False, False, True, False])
+        assert_equal(np.isinf(c), [False, False, True, False, False])
+        assert_equal(np.isfinite(c), [True, True, False, False, True])
+        assert_equal(np.signbit(b), [True, False, False, False, False])
+
+        assert_equal(np.copysign(b, a), [2, 5, 1, 4, 3])
+
+        assert_equal(np.maximum(a, b), [0, 5, 2, 4, 3])
+
+        x = np.maximum(b, c)
+        assert_(np.isnan(x[3]))
+        x[3] = 0
+        assert_equal(x, [0, 5, 1, 0, 6])
+
+        assert_equal(np.minimum(a, b), [-2, 1, 1, 4, 2])
+
+        x = np.minimum(b, c)
+        assert_(np.isnan(x[3]))
+        x[3] = 0
+        assert_equal(x, [-2, -1, -np.inf, 0, 3])
+
+        assert_equal(np.fmax(a, b), [0, 5, 2, 4, 3])
+        assert_equal(np.fmax(b, c), [0, 5, 1, 4, 6])
+        assert_equal(np.fmin(a, b), [-2, 1, 1, 4, 2])
+        assert_equal(np.fmin(b, c), [-2, -1, -np.inf, 4, 3])
+
+        assert_equal(np.floor_divide(a, b), [0, 0, 2, 1, 0])
+        assert_equal(np.remainder(a, b), [0, 1, 0, 0, 2])
+        assert_equal(np.divmod(a, b), ([0, 0, 2, 1, 0], [0, 1, 0, 0, 2]))
+        assert_equal(np.square(b), [4, 25, 1, 16, 9])
+        assert_equal(np.reciprocal(b), [-0.5, 0.199951171875, 1, 0.25, 0.333251953125])
+        assert_equal(np.ones_like(b), [1, 1, 1, 1, 1])
+        assert_equal(np.conjugate(b), b)
+        assert_equal(np.absolute(b), [2, 5, 1, 4, 3])
+        assert_equal(np.negative(b), [2, -5, -1, -4, -3])
+        assert_equal(np.positive(b), b)
+        assert_equal(np.sign(b), [-1, 1, 1, 1, 1])
+        assert_equal(np.modf(b), ([0, 0, 0, 0, 0], b))
+        assert_equal(np.frexp(b), ([-0.5, 0.625, 0.5, 0.5, 0.75], [2, 3, 1, 3, 2]))
+        assert_equal(np.ldexp(b, [0, 1, 2, 4, 2]), [-2, 10, 4, 64, 12])
+
+    def test_half_coercion(self):
+        """Test that half gets coerced properly with the other types"""
+        a16 = np.array((1,), dtype=float16)
+        a32 = np.array((1,), dtype=float32)
+        b16 = float16(1)
+        b32 = float32(1)
+
+        assert_equal(np.power(a16, 2).dtype, float16)
+        assert_equal(np.power(a16, 2.0).dtype, float16)
+        assert_equal(np.power(a16, b16).dtype, float16)
+        assert_equal(np.power(a16, b32).dtype, float16)
+        assert_equal(np.power(a16, a16).dtype, float16)
+        assert_equal(np.power(a16, a32).dtype, float32)
+
+        assert_equal(np.power(b16, 2).dtype, float64)
+        assert_equal(np.power(b16, 2.0).dtype, float64)
+        assert_equal(np.power(b16, b16).dtype, float16)
+        assert_equal(np.power(b16, b32).dtype, float32)
+        assert_equal(np.power(b16, a16).dtype, float16)
+        assert_equal(np.power(b16, a32).dtype, float32)
+
+        assert_equal(np.power(a32, a16).dtype, float32)
+        assert_equal(np.power(a32, b16).dtype, float32)
+        assert_equal(np.power(b32, a16).dtype, float16)
+        assert_equal(np.power(b32, b16).dtype, float32)
+
+    @pytest.mark.skipif(platform.machine() == "armv5tel",
+                        reason="See gh-413.")
+    def test_half_fpe(self):
+        with np.errstate(all='raise'):
+            sx16 = np.array((1e-4,), dtype=float16)
+            bx16 = np.array((1e4,), dtype=float16)
+            sy16 = float16(1e-4)
+            by16 = float16(1e4)
+
+            # Underflow errors
+            assert_raises_fpe('underflow', lambda a, b:a*b, sx16, sx16)
+            assert_raises_fpe('underflow', lambda a, b:a*b, sx16, sy16)
+            assert_raises_fpe('underflow', lambda a, b:a*b, sy16, sx16)
+            assert_raises_fpe('underflow', lambda a, b:a*b, sy16, sy16)
+            assert_raises_fpe('underflow', lambda a, b:a/b, sx16, bx16)
+            assert_raises_fpe('underflow', lambda a, b:a/b, sx16, by16)
+            assert_raises_fpe('underflow', lambda a, b:a/b, sy16, bx16)
+            assert_raises_fpe('underflow', lambda a, b:a/b, sy16, by16)
+            assert_raises_fpe('underflow', lambda a, b:a/b,
+                                             float16(2.**-14), float16(2**11))
+            assert_raises_fpe('underflow', lambda a, b:a/b,
+                                             float16(-2.**-14), float16(2**11))
+            assert_raises_fpe('underflow', lambda a, b:a/b,
+                                             float16(2.**-14+2**-24), float16(2))
+            assert_raises_fpe('underflow', lambda a, b:a/b,
+                                             float16(-2.**-14-2**-24), float16(2))
+            assert_raises_fpe('underflow', lambda a, b:a/b,
+                                             float16(2.**-14+2**-23), float16(4))
+
+            # Overflow errors
+            assert_raises_fpe('overflow', lambda a, b:a*b, bx16, bx16)
+            assert_raises_fpe('overflow', lambda a, b:a*b, bx16, by16)
+            assert_raises_fpe('overflow', lambda a, b:a*b, by16, bx16)
+            assert_raises_fpe('overflow', lambda a, b:a*b, by16, by16)
+            assert_raises_fpe('overflow', lambda a, b:a/b, bx16, sx16)
+            assert_raises_fpe('overflow', lambda a, b:a/b, bx16, sy16)
+            assert_raises_fpe('overflow', lambda a, b:a/b, by16, sx16)
+            assert_raises_fpe('overflow', lambda a, b:a/b, by16, sy16)
+            assert_raises_fpe('overflow', lambda a, b:a+b,
+                                             float16(65504), float16(17))
+            assert_raises_fpe('overflow', lambda a, b:a-b,
+                                             float16(-65504), float16(17))
+            assert_raises_fpe('overflow', np.nextafter, float16(65504), float16(np.inf))
+            assert_raises_fpe('overflow', np.nextafter, float16(-65504), float16(-np.inf))
+            assert_raises_fpe('overflow', np.spacing, float16(65504))
+
+            # Invalid value errors
+            assert_raises_fpe('invalid', np.divide, float16(np.inf), float16(np.inf))
+            assert_raises_fpe('invalid', np.spacing, float16(np.inf))
+            assert_raises_fpe('invalid', np.spacing, float16(np.nan))
+
+            # These should not raise
+            float16(65472)+float16(32)
+            float16(2**-13)/float16(2)
+            float16(2**-14)/float16(2**10)
+            np.spacing(float16(-65504))
+            np.nextafter(float16(65504), float16(-np.inf))
+            np.nextafter(float16(-65504), float16(np.inf))
+            np.nextafter(float16(np.inf), float16(0))
+            np.nextafter(float16(-np.inf), float16(0))
+            np.nextafter(float16(0), float16(np.nan))
+            np.nextafter(float16(np.nan), float16(0))
+            float16(2**-14)/float16(2**10)
+            float16(-2**-14)/float16(2**10)
+            float16(2**-14+2**-23)/float16(2)
+            float16(-2**-14-2**-23)/float16(2)
+
+    def test_half_array_interface(self):
+        """Test that half is compatible with __array_interface__"""
+        class Dummy:
+            pass
+
+        a = np.ones((1,), dtype=float16)
+        b = Dummy()
+        b.__array_interface__ = a.__array_interface__
+        c = np.array(b)
+        assert_(c.dtype == float16)
+        assert_equal(a, c)

venv/Lib/site-packages/numpy/core/tests/test_indexerrors.py

@@ -0,0 +1,133 @@
+import numpy as np
+from numpy.testing import (
+        assert_raises, assert_raises_regex,
+        )
+
+
+class TestIndexErrors:
+    '''Tests to exercise indexerrors not covered by other tests.'''
+
+    def test_arraytypes_fasttake(self):
+        'take from a 0-length dimension'
+        x = np.empty((2, 3, 0, 4))
+        assert_raises(IndexError, x.take, [0], axis=2)
+        assert_raises(IndexError, x.take, [1], axis=2)
+        assert_raises(IndexError, x.take, [0], axis=2, mode='wrap')
+        assert_raises(IndexError, x.take, [0], axis=2, mode='clip')
+
+    def test_take_from_object(self):
+        # Check exception taking from object array
+        d = np.zeros(5, dtype=object)
+        assert_raises(IndexError, d.take, [6])
+
+        # Check exception taking from 0-d array
+        d = np.zeros((5, 0), dtype=object)
+        assert_raises(IndexError, d.take, [1], axis=1)
+        assert_raises(IndexError, d.take, [0], axis=1)
+        assert_raises(IndexError, d.take, [0])
+        assert_raises(IndexError, d.take, [0], mode='wrap')
+        assert_raises(IndexError, d.take, [0], mode='clip')
+
+    def test_multiindex_exceptions(self):
+        a = np.empty(5, dtype=object)
+        assert_raises(IndexError, a.item, 20)
+        a = np.empty((5, 0), dtype=object)
+        assert_raises(IndexError, a.item, (0, 0))
+
+        a = np.empty(5, dtype=object)
+        assert_raises(IndexError, a.itemset, 20, 0)
+        a = np.empty((5, 0), dtype=object)
+        assert_raises(IndexError, a.itemset, (0, 0), 0)
+
+    def test_put_exceptions(self):
+        a = np.zeros((5, 5))
+        assert_raises(IndexError, a.put, 100, 0)
+        a = np.zeros((5, 5), dtype=object)
+        assert_raises(IndexError, a.put, 100, 0)
+        a = np.zeros((5, 5, 0))
+        assert_raises(IndexError, a.put, 100, 0)
+        a = np.zeros((5, 5, 0), dtype=object)
+        assert_raises(IndexError, a.put, 100, 0)
+
+    def test_iterators_exceptions(self):
+        "cases in iterators.c"
+        def assign(obj, ind, val):
+            obj[ind] = val
+
+        a = np.zeros([1, 2, 3])
+        assert_raises(IndexError, lambda: a[0, 5, None, 2])
+        assert_raises(IndexError, lambda: a[0, 5, 0, 2])
+        assert_raises(IndexError, lambda: assign(a, (0, 5, None, 2), 1))
+        assert_raises(IndexError, lambda: assign(a, (0, 5, 0, 2),  1))
+
+        a = np.zeros([1, 0, 3])
+        assert_raises(IndexError, lambda: a[0, 0, None, 2])
+        assert_raises(IndexError, lambda: assign(a, (0, 0, None, 2), 1))
+
+        a = np.zeros([1, 2, 3])
+        assert_raises(IndexError, lambda: a.flat[10])
+        assert_raises(IndexError, lambda: assign(a.flat, 10, 5))
+        a = np.zeros([1, 0, 3])
+        assert_raises(IndexError, lambda: a.flat[10])
+        assert_raises(IndexError, lambda: assign(a.flat, 10, 5))
+
+        a = np.zeros([1, 2, 3])
+        assert_raises(IndexError, lambda: a.flat[np.array(10)])
+        assert_raises(IndexError, lambda: assign(a.flat, np.array(10), 5))
+        a = np.zeros([1, 0, 3])
+        assert_raises(IndexError, lambda: a.flat[np.array(10)])
+        assert_raises(IndexError, lambda: assign(a.flat, np.array(10), 5))
+
+        a = np.zeros([1, 2, 3])
+        assert_raises(IndexError, lambda: a.flat[np.array([10])])
+        assert_raises(IndexError, lambda: assign(a.flat, np.array([10]), 5))
+        a = np.zeros([1, 0, 3])
+        assert_raises(IndexError, lambda: a.flat[np.array([10])])
+        assert_raises(IndexError, lambda: assign(a.flat, np.array([10]), 5))
+
+    def test_mapping(self):
+        "cases from mapping.c"
+
+        def assign(obj, ind, val):
+            obj[ind] = val
+
+        a = np.zeros((0, 10))
+        assert_raises(IndexError, lambda: a[12])
+
+        a = np.zeros((3, 5))
+        assert_raises(IndexError, lambda: a[(10, 20)])
+        assert_raises(IndexError, lambda: assign(a, (10, 20), 1))
+        a = np.zeros((3, 0))
+        assert_raises(IndexError, lambda: a[(1, 0)])
+        assert_raises(IndexError, lambda: assign(a, (1, 0), 1))
+
+        a = np.zeros((10,))
+        assert_raises(IndexError, lambda: assign(a, 10, 1))
+        a = np.zeros((0,))
+        assert_raises(IndexError, lambda: assign(a, 10, 1))
+
+        a = np.zeros((3, 5))
+        assert_raises(IndexError, lambda: a[(1, [1, 20])])
+        assert_raises(IndexError, lambda: assign(a, (1, [1, 20]), 1))
+        a = np.zeros((3, 0))
+        assert_raises(IndexError, lambda: a[(1, [0, 1])])
+        assert_raises(IndexError, lambda: assign(a, (1, [0, 1]), 1))
+
+    def test_mapping_error_message(self):
+        a = np.zeros((3, 5))
+        index = (1, 2, 3, 4, 5)
+        assert_raises_regex(
+                IndexError,
+                "too many indices for array: "
+                "array is 2-dimensional, but 5 were indexed",
+                lambda: a[index])
+
+    def test_methods(self):
+        "cases from methods.c"
+
+        a = np.zeros((3, 3))
+        assert_raises(IndexError, lambda: a.item(100))
+        assert_raises(IndexError, lambda: a.itemset(100, 1))
+        a = np.zeros((0, 3))
+        assert_raises(IndexError, lambda: a.item(100))
+        assert_raises(IndexError, lambda: a.itemset(100, 1))

venv/Lib/site-packages/numpy/core/tests/test_item_selection.py

@@ -0,0 +1,86 @@
+import sys
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_raises, assert_array_equal, HAS_REFCOUNT
+    )
+
+
+class TestTake:
+    def test_simple(self):
+        a = [[1, 2], [3, 4]]
+        a_str = [[b'1', b'2'], [b'3', b'4']]
+        modes = ['raise', 'wrap', 'clip']
+        indices = [-1, 4]
+        index_arrays = [np.empty(0, dtype=np.intp),
+                        np.empty(tuple(), dtype=np.intp),
+                        np.empty((1, 1), dtype=np.intp)]
+        real_indices = {'raise': {-1: 1, 4: IndexError},
+                        'wrap': {-1: 1, 4: 0},
+                        'clip': {-1: 0, 4: 1}}
+        # Currently all types but object, use the same function generation.
+        # So it should not be necessary to test all. However test also a non
+        # refcounted struct on top of object, which has a size that hits the
+        # default (non-specialized) path.
+        types = int, object, np.dtype([('', 'i2', 3)])
+        for t in types:
+            # ta works, even if the array may be odd if buffer interface is used
+            ta = np.array(a if np.issubdtype(t, np.number) else a_str, dtype=t)
+            tresult = list(ta.T.copy())
+            for index_array in index_arrays:
+                if index_array.size != 0:
+                    tresult[0].shape = (2,) + index_array.shape
+                    tresult[1].shape = (2,) + index_array.shape
+                for mode in modes:
+                    for index in indices:
+                        real_index = real_indices[mode][index]
+                        if real_index is IndexError and index_array.size != 0:
+                            index_array.put(0, index)
+                            assert_raises(IndexError, ta.take, index_array,
+                                          mode=mode, axis=1)
+                        elif index_array.size != 0:
+                            index_array.put(0, index)
+                            res = ta.take(index_array, mode=mode, axis=1)
+                            assert_array_equal(res, tresult[real_index])
+                        else:
+                            res = ta.take(index_array, mode=mode, axis=1)
+                            assert_(res.shape == (2,) + index_array.shape)
+
+    def test_refcounting(self):
+        objects = [object() for i in range(10)]
+        for mode in ('raise', 'clip', 'wrap'):
+            a = np.array(objects)
+            b = np.array([2, 2, 4, 5, 3, 5])
+            a.take(b, out=a[:6], mode=mode)
+            del a
+            if HAS_REFCOUNT:
+                assert_(all(sys.getrefcount(o) == 3 for o in objects))
+            # not contiguous, example:
+            a = np.array(objects * 2)[::2]
+            a.take(b, out=a[:6], mode=mode)
+            del a
+            if HAS_REFCOUNT:
+                assert_(all(sys.getrefcount(o) == 3 for o in objects))
+
+    def test_unicode_mode(self):
+        d = np.arange(10)
+        k = b'\xc3\xa4'.decode("UTF8")
+        assert_raises(ValueError, d.take, 5, mode=k)
+
+    def test_empty_partition(self):
+        # In reference to github issue #6530
+        a_original = np.array([0, 2, 4, 6, 8, 10])
+        a = a_original.copy()
+
+        # An empty partition should be a successful no-op
+        a.partition(np.array([], dtype=np.int16))
+
+        assert_array_equal(a, a_original)
+
+    def test_empty_argpartition(self):
+        # In reference to github issue #6530
+        a = np.array([0, 2, 4, 6, 8, 10])
+        a = a.argpartition(np.array([], dtype=np.int16))
+
+        b = np.array([0, 1, 2, 3, 4, 5])
+        assert_array_equal(a, b)

venv/Lib/site-packages/numpy/core/tests/test_longdouble.py

@@ -0,0 +1,369 @@
+import warnings
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_warns, assert_array_equal,
+    temppath,
+    )
+from numpy.core.tests._locales import CommaDecimalPointLocale
+
+LD_INFO = np.finfo(np.longdouble)
+longdouble_longer_than_double = (LD_INFO.eps < np.finfo(np.double).eps)
+
+
+_o = 1 + LD_INFO.eps
+string_to_longdouble_inaccurate = (_o != np.longdouble(repr(_o)))
+del _o
+
+
+def test_scalar_extraction():
+    """Confirm that extracting a value doesn't convert to python float"""
+    o = 1 + LD_INFO.eps
+    a = np.array([o, o, o])
+    assert_equal(a[1], o)
+
+
+# Conversions string -> long double
+
+# 0.1 not exactly representable in base 2 floating point.
+repr_precision = len(repr(np.longdouble(0.1)))
+# +2 from macro block starting around line 842 in scalartypes.c.src.
+@pytest.mark.skipif(LD_INFO.precision + 2 >= repr_precision,
+                    reason="repr precision not enough to show eps")
+def test_repr_roundtrip():
+    # We will only see eps in repr if within printing precision.
+    o = 1 + LD_INFO.eps
+    assert_equal(np.longdouble(repr(o)), o, "repr was %s" % repr(o))
+
+
+@pytest.mark.skipif(string_to_longdouble_inaccurate, reason="Need strtold_l")
+def test_repr_roundtrip_bytes():
+    o = 1 + LD_INFO.eps
+    assert_equal(np.longdouble(repr(o).encode("ascii")), o)
+
+
+@pytest.mark.skipif(string_to_longdouble_inaccurate, reason="Need strtold_l")
+@pytest.mark.parametrize("strtype", (np.str_, np.bytes_, str, bytes))
+def test_array_and_stringlike_roundtrip(strtype):
+    """
+    Test that string representations of long-double roundtrip both
+    for array casting and scalar coercion, see also gh-15608.
+    """
+    o = 1 + LD_INFO.eps
+
+    if strtype in (np.bytes_, bytes):
+        o_str = strtype(repr(o).encode("ascii"))
+    else:
+        o_str = strtype(repr(o))
+
+    # Test that `o` is correctly coerced from the string-like
+    assert o == np.longdouble(o_str)
+
+    # Test that arrays also roundtrip correctly:
+    o_strarr = np.asarray([o] * 3, dtype=strtype)
+    assert (o == o_strarr.astype(np.longdouble)).all()
+
+    # And array coercion and casting to string give the same as scalar repr:
+    assert (o_strarr == o_str).all()
+    assert (np.asarray([o] * 3).astype(strtype) == o_str).all()
+
+
+def test_bogus_string():
+    assert_raises(ValueError, np.longdouble, "spam")
+    assert_raises(ValueError, np.longdouble, "1.0 flub")
+
+
+@pytest.mark.skipif(string_to_longdouble_inaccurate, reason="Need strtold_l")
+def test_fromstring():
+    o = 1 + LD_INFO.eps
+    s = (" " + repr(o))*5
+    a = np.array([o]*5)
+    assert_equal(np.fromstring(s, sep=" ", dtype=np.longdouble), a,
+                 err_msg="reading '%s'" % s)
+
+
+def test_fromstring_complex():
+    for ctype in ["complex", "cdouble", "cfloat"]:
+        # Check spacing between separator
+        assert_equal(np.fromstring("1, 2 ,  3  ,4", sep=",", dtype=ctype),
+                     np.array([1., 2., 3., 4.]))
+        # Real component not specified
+        assert_equal(np.fromstring("1j, -2j,  3j, 4e1j", sep=",", dtype=ctype),
+                     np.array([1.j, -2.j, 3.j, 40.j]))
+        # Both components specified
+        assert_equal(np.fromstring("1+1j,2-2j, -3+3j,  -4e1+4j", sep=",", dtype=ctype),
+                     np.array([1. + 1.j, 2. - 2.j, - 3. + 3.j, - 40. + 4j]))
+        # Spaces at wrong places
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1+2 j,3", dtype=ctype, sep=","),
+                         np.array([1.]))
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1+ 2j,3", dtype=ctype, sep=","),
+                         np.array([1.]))
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1 +2j,3", dtype=ctype, sep=","),
+                         np.array([1.]))
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1+j", dtype=ctype, sep=","),
+                         np.array([1.]))
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1+", dtype=ctype, sep=","),
+                         np.array([1.]))
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1j+1", dtype=ctype, sep=","),
+                         np.array([1j]))
+
+
+def test_fromstring_bogus():
+    with assert_warns(DeprecationWarning):
+        assert_equal(np.fromstring("1. 2. 3. flop 4.", dtype=float, sep=" "),
+                     np.array([1., 2., 3.]))
+
+
+def test_fromstring_empty():
+    with assert_warns(DeprecationWarning):
+        assert_equal(np.fromstring("xxxxx", sep="x"),
+                     np.array([]))
+
+
+def test_fromstring_missing():
+    with assert_warns(DeprecationWarning):
+        assert_equal(np.fromstring("1xx3x4x5x6", sep="x"),
+                     np.array([1]))
+
+
+class TestFileBased:
+
+    ldbl = 1 + LD_INFO.eps
+    tgt = np.array([ldbl]*5)
+    out = ''.join([repr(t) + '\n' for t in tgt])
+
+    def test_fromfile_bogus(self):
+        with temppath() as path:
+            with open(path, 'wt') as f:
+                f.write("1. 2. 3. flop 4.\n")
+
+            with assert_warns(DeprecationWarning):
+                res = np.fromfile(path, dtype=float, sep=" ")
+        assert_equal(res, np.array([1., 2., 3.]))
+
+    def test_fromfile_complex(self):
+        for ctype in ["complex", "cdouble", "cfloat"]:
+            # Check spacing between separator and only real component specified
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1, 2 ,  3  ,4\n")
+
+                res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1., 2., 3., 4.]))
+
+            # Real component not specified
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1j, -2j,  3j, 4e1j\n")
+
+                res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.j, -2.j, 3.j, 40.j]))
+
+            # Both components specified
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1+1j,2-2j, -3+3j,  -4e1+4j\n")
+
+                res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1. + 1.j, 2. - 2.j, - 3. + 3.j, - 40. + 4j]))
+
+            # Spaces at wrong places
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1+2 j,3\n")
+
+                with assert_warns(DeprecationWarning):
+                    res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.]))
+
+            # Spaces at wrong places
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1+ 2j,3\n")
+
+                with assert_warns(DeprecationWarning):
+                    res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.]))
+
+            # Spaces at wrong places
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1 +2j,3\n")
+
+                with assert_warns(DeprecationWarning):
+                    res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.]))
+
+            # Spaces at wrong places
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1+j\n")
+
+                with assert_warns(DeprecationWarning):
+                    res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.]))
+
+            # Spaces at wrong places
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1+\n")
+
+                with assert_warns(DeprecationWarning):
+                    res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.]))
+
+            # Spaces at wrong places
+            with temppath() as path:
+                with open(path, 'wt') as f:
+                    f.write("1j+1\n")
+
+                with assert_warns(DeprecationWarning):
+                    res = np.fromfile(path, dtype=ctype, sep=",")
+            assert_equal(res, np.array([1.j]))
+
+
+
+    @pytest.mark.skipif(string_to_longdouble_inaccurate,
+                        reason="Need strtold_l")
+    def test_fromfile(self):
+        with temppath() as path:
+            with open(path, 'wt') as f:
+                f.write(self.out)
+            res = np.fromfile(path, dtype=np.longdouble, sep="\n")
+        assert_equal(res, self.tgt)
+
+    @pytest.mark.skipif(string_to_longdouble_inaccurate,
+                        reason="Need strtold_l")
+    def test_genfromtxt(self):
+        with temppath() as path:
+            with open(path, 'wt') as f:
+                f.write(self.out)
+            res = np.genfromtxt(path, dtype=np.longdouble)
+        assert_equal(res, self.tgt)
+
+    @pytest.mark.skipif(string_to_longdouble_inaccurate,
+                        reason="Need strtold_l")
+    def test_loadtxt(self):
+        with temppath() as path:
+            with open(path, 'wt') as f:
+                f.write(self.out)
+            res = np.loadtxt(path, dtype=np.longdouble)
+        assert_equal(res, self.tgt)
+
+    @pytest.mark.skipif(string_to_longdouble_inaccurate,
+                        reason="Need strtold_l")
+    def test_tofile_roundtrip(self):
+        with temppath() as path:
+            self.tgt.tofile(path, sep=" ")
+            res = np.fromfile(path, dtype=np.longdouble, sep=" ")
+        assert_equal(res, self.tgt)
+
+
+# Conversions long double -> string
+
+
+def test_repr_exact():
+    o = 1 + LD_INFO.eps
+    assert_(repr(o) != '1')
+
+
+@pytest.mark.skipif(longdouble_longer_than_double, reason="BUG #2376")
+@pytest.mark.skipif(string_to_longdouble_inaccurate,
+                    reason="Need strtold_l")
+def test_format():
+    o = 1 + LD_INFO.eps
+    assert_("{0:.40g}".format(o) != '1')
+
+
+@pytest.mark.skipif(longdouble_longer_than_double, reason="BUG #2376")
+@pytest.mark.skipif(string_to_longdouble_inaccurate,
+                    reason="Need strtold_l")
+def test_percent():
+    o = 1 + LD_INFO.eps
+    assert_("%.40g" % o != '1')
+
+
+@pytest.mark.skipif(longdouble_longer_than_double,
+                    reason="array repr problem")
+@pytest.mark.skipif(string_to_longdouble_inaccurate,
+                    reason="Need strtold_l")
+def test_array_repr():
+    o = 1 + LD_INFO.eps
+    a = np.array([o])
+    b = np.array([1], dtype=np.longdouble)
+    if not np.all(a != b):
+        raise ValueError("precision loss creating arrays")
+    assert_(repr(a) != repr(b))
+
+#
+# Locale tests: scalar types formatting should be independent of the locale
+#
+
+class TestCommaDecimalPointLocale(CommaDecimalPointLocale):
+
+    def test_repr_roundtrip_foreign(self):
+        o = 1.5
+        assert_equal(o, np.longdouble(repr(o)))
+
+    def test_fromstring_foreign_repr(self):
+        f = 1.234
+        a = np.fromstring(repr(f), dtype=float, sep=" ")
+        assert_equal(a[0], f)
+
+    def test_fromstring_best_effort_float(self):
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1,234", dtype=float, sep=" "),
+                         np.array([1.]))
+
+    def test_fromstring_best_effort(self):
+        with assert_warns(DeprecationWarning):
+            assert_equal(np.fromstring("1,234", dtype=np.longdouble, sep=" "),
+                         np.array([1.]))
+
+    def test_fromstring_foreign(self):
+        s = "1.234"
+        a = np.fromstring(s, dtype=np.longdouble, sep=" ")
+        assert_equal(a[0], np.longdouble(s))
+
+    def test_fromstring_foreign_sep(self):
+        a = np.array([1, 2, 3, 4])
+        b = np.fromstring("1,2,3,4,", dtype=np.longdouble, sep=",")
+        assert_array_equal(a, b)
+
+    def test_fromstring_foreign_value(self):
+        with assert_warns(DeprecationWarning):
+            b = np.fromstring("1,234", dtype=np.longdouble, sep=" ")
+            assert_array_equal(b[0], 1)
+
+
+@pytest.mark.parametrize("int_val", [
+    # cases discussed in gh-10723
+    # and gh-9968
+    2 ** 1024, 0])
+def test_longdouble_from_int(int_val):
+    # for issue gh-9968
+    str_val = str(int_val)
+    # we'll expect a RuntimeWarning on platforms
+    # with np.longdouble equivalent to np.double
+    # for large integer input
+    with warnings.catch_warnings(record=True) as w:
+        warnings.filterwarnings('always', '', RuntimeWarning)
+        # can be inf==inf on some platforms
+        assert np.longdouble(int_val) == np.longdouble(str_val)
+        # we can't directly compare the int and
+        # max longdouble value on all platforms
+        if np.allclose(np.finfo(np.longdouble).max,
+                       np.finfo(np.double).max) and w:
+            assert w[0].category is RuntimeWarning
+
+@pytest.mark.parametrize("bool_val", [
+    True, False])
+def test_longdouble_from_bool(bool_val):
+    assert np.longdouble(bool_val) == np.longdouble(int(bool_val))

venv/Lib/site-packages/numpy/core/tests/test_machar.py

@@ -0,0 +1,30 @@
+"""
+Test machar. Given recent changes to hardcode type data, we might want to get
+rid of both MachAr and this test at some point.
+
+"""
+from numpy.core.machar import MachAr
+import numpy.core.numerictypes as ntypes
+from numpy import errstate, array
+
+
+class TestMachAr:
+    def _run_machar_highprec(self):
+        # Instantiate MachAr instance with high enough precision to cause
+        # underflow
+        try:
+            hiprec = ntypes.float96
+            MachAr(lambda v: array(v, hiprec))
+        except AttributeError:
+            # Fixme, this needs to raise a 'skip' exception.
+            "Skipping test: no ntypes.float96 available on this platform."
+
+    def test_underlow(self):
+        # Regression test for #759:
+        # instantiating MachAr for dtype = np.float96 raises spurious warning.
+        with errstate(all='raise'):
+            try:
+                self._run_machar_highprec()
+            except FloatingPointError as e:
+                msg = "Caught %s exception, should not have been raised." % e
+                raise AssertionError(msg)

venv/Lib/site-packages/numpy/core/tests/test_mem_overlap.py

@@ -0,0 +1,926 @@
+import itertools
+import pytest
+
+import numpy as np
+from numpy.core._multiarray_tests import solve_diophantine, internal_overlap
+from numpy.core import _umath_tests
+from numpy.lib.stride_tricks import as_strided
+from numpy.testing import (
+    assert_, assert_raises, assert_equal, assert_array_equal
+    )
+
+
+ndims = 2
+size = 10
+shape = tuple([size] * ndims)
+
+MAY_SHARE_BOUNDS = 0
+MAY_SHARE_EXACT = -1
+
+
+def _indices_for_nelems(nelems):
+    """Returns slices of length nelems, from start onwards, in direction sign."""
+
+    if nelems == 0:
+        return [size // 2]  # int index
+
+    res = []
+    for step in (1, 2):
+        for sign in (-1, 1):
+            start = size // 2 - nelems * step * sign // 2
+            stop = start + nelems * step * sign
+            res.append(slice(start, stop, step * sign))
+
+    return res
+
+
+def _indices_for_axis():
+    """Returns (src, dst) pairs of indices."""
+
+    res = []
+    for nelems in (0, 2, 3):
+        ind = _indices_for_nelems(nelems)
+        res.extend(itertools.product(ind, ind))  # all assignments of size "nelems"
+
+    return res
+
+
+def _indices(ndims):
+    """Returns ((axis0_src, axis0_dst), (axis1_src, axis1_dst), ... ) index pairs."""
+
+    ind = _indices_for_axis()
+    return itertools.product(ind, repeat=ndims)
+
+
+def _check_assignment(srcidx, dstidx):
+    """Check assignment arr[dstidx] = arr[srcidx] works."""
+
+    arr = np.arange(np.product(shape)).reshape(shape)
+
+    cpy = arr.copy()
+
+    cpy[dstidx] = arr[srcidx]
+    arr[dstidx] = arr[srcidx]
+
+    assert_(np.all(arr == cpy),
+            'assigning arr[%s] = arr[%s]' % (dstidx, srcidx))
+
+
+def test_overlapping_assignments():
+    # Test automatically generated assignments which overlap in memory.
+
+    inds = _indices(ndims)
+
+    for ind in inds:
+        srcidx = tuple([a[0] for a in ind])
+        dstidx = tuple([a[1] for a in ind])
+
+        _check_assignment(srcidx, dstidx)
+
+
+@pytest.mark.slow
+def test_diophantine_fuzz():
+    # Fuzz test the diophantine solver
+    rng = np.random.RandomState(1234)
+
+    max_int = np.iinfo(np.intp).max
+
+    for ndim in range(10):
+        feasible_count = 0
+        infeasible_count = 0
+
+        min_count = 500//(ndim + 1)
+
+        while min(feasible_count, infeasible_count) < min_count:
+            # Ensure big and small integer problems
+            A_max = 1 + rng.randint(0, 11, dtype=np.intp)**6
+            U_max = rng.randint(0, 11, dtype=np.intp)**6
+
+            A_max = min(max_int, A_max)
+            U_max = min(max_int-1, U_max)
+
+            A = tuple(int(rng.randint(1, A_max+1, dtype=np.intp))
+                      for j in range(ndim))
+            U = tuple(int(rng.randint(0, U_max+2, dtype=np.intp))
+                      for j in range(ndim))
+
+            b_ub = min(max_int-2, sum(a*ub for a, ub in zip(A, U)))
+            b = rng.randint(-1, b_ub+2, dtype=np.intp)
+
+            if ndim == 0 and feasible_count < min_count:
+                b = 0
+
+            X = solve_diophantine(A, U, b)
+
+            if X is None:
+                # Check the simplified decision problem agrees
+                X_simplified = solve_diophantine(A, U, b, simplify=1)
+                assert_(X_simplified is None, (A, U, b, X_simplified))
+
+                # Check no solution exists (provided the problem is
+                # small enough so that brute force checking doesn't
+                # take too long)
+                ranges = tuple(range(0, a*ub+1, a) for a, ub in zip(A, U))
+
+                size = 1
+                for r in ranges:
+                    size *= len(r)
+                if size < 100000:
+                    assert_(not any(sum(w) == b for w in itertools.product(*ranges)))
+                    infeasible_count += 1
+            else:
+                # Check the simplified decision problem agrees
+                X_simplified = solve_diophantine(A, U, b, simplify=1)
+                assert_(X_simplified is not None, (A, U, b, X_simplified))
+
+                # Check validity
+                assert_(sum(a*x for a, x in zip(A, X)) == b)
+                assert_(all(0 <= x <= ub for x, ub in zip(X, U)))
+                feasible_count += 1
+
+
+def test_diophantine_overflow():
+    # Smoke test integer overflow detection
+    max_intp = np.iinfo(np.intp).max
+    max_int64 = np.iinfo(np.int64).max
+
+    if max_int64 <= max_intp:
+        # Check that the algorithm works internally in 128-bit;
+        # solving this problem requires large intermediate numbers
+        A = (max_int64//2, max_int64//2 - 10)
+        U = (max_int64//2, max_int64//2 - 10)
+        b = 2*(max_int64//2) - 10
+
+        assert_equal(solve_diophantine(A, U, b), (1, 1))
+
+
+def check_may_share_memory_exact(a, b):
+    got = np.may_share_memory(a, b, max_work=MAY_SHARE_EXACT)
+
+    assert_equal(np.may_share_memory(a, b),
+                 np.may_share_memory(a, b, max_work=MAY_SHARE_BOUNDS))
+
+    a.fill(0)
+    b.fill(0)
+    a.fill(1)
+    exact = b.any()
+
+    err_msg = ""
+    if got != exact:
+        err_msg = "    " + "\n    ".join([
+            "base_a - base_b = %r" % (a.__array_interface__['data'][0] - b.__array_interface__['data'][0],),
+            "shape_a = %r" % (a.shape,),
+            "shape_b = %r" % (b.shape,),
+            "strides_a = %r" % (a.strides,),
+            "strides_b = %r" % (b.strides,),
+            "size_a = %r" % (a.size,),
+            "size_b = %r" % (b.size,)
+        ])
+
+    assert_equal(got, exact, err_msg=err_msg)
+
+
+def test_may_share_memory_manual():
+    # Manual test cases for may_share_memory
+
+    # Base arrays
+    xs0 = [
+        np.zeros([13, 21, 23, 22], dtype=np.int8),
+        np.zeros([13, 21, 23*2, 22], dtype=np.int8)[:,:,::2,:]
+    ]
+
+    # Generate all negative stride combinations
+    xs = []
+    for x in xs0:
+        for ss in itertools.product(*(([slice(None), slice(None, None, -1)],)*4)):
+            xp = x[ss]
+            xs.append(xp)
+
+    for x in xs:
+        # The default is a simple extent check
+        assert_(np.may_share_memory(x[:,0,:], x[:,1,:]))
+        assert_(np.may_share_memory(x[:,0,:], x[:,1,:], max_work=None))
+
+        # Exact checks
+        check_may_share_memory_exact(x[:,0,:], x[:,1,:])
+        check_may_share_memory_exact(x[:,::7], x[:,3::3])
+
+        try:
+            xp = x.ravel()
+            if xp.flags.owndata:
+                continue
+            xp = xp.view(np.int16)
+        except ValueError:
+            continue
+
+        # 0-size arrays cannot overlap
+        check_may_share_memory_exact(x.ravel()[6:6],
+                                     xp.reshape(13, 21, 23, 11)[:,::7])
+
+        # Test itemsize is dealt with
+        check_may_share_memory_exact(x[:,::7],
+                                     xp.reshape(13, 21, 23, 11))
+        check_may_share_memory_exact(x[:,::7],
+                                     xp.reshape(13, 21, 23, 11)[:,3::3])
+        check_may_share_memory_exact(x.ravel()[6:7],
+                                     xp.reshape(13, 21, 23, 11)[:,::7])
+
+    # Check unit size
+    x = np.zeros([1], dtype=np.int8)
+    check_may_share_memory_exact(x, x)
+    check_may_share_memory_exact(x, x.copy())
+
+
+def iter_random_view_pairs(x, same_steps=True, equal_size=False):
+    rng = np.random.RandomState(1234)
+
+    if equal_size and same_steps:
+        raise ValueError()
+
+    def random_slice(n, step):
+        start = rng.randint(0, n+1, dtype=np.intp)
+        stop = rng.randint(start, n+1, dtype=np.intp)
+        if rng.randint(0, 2, dtype=np.intp) == 0:
+            stop, start = start, stop
+            step *= -1
+        return slice(start, stop, step)
+
+    def random_slice_fixed_size(n, step, size):
+        start = rng.randint(0, n+1 - size*step)
+        stop = start + (size-1)*step + 1
+        if rng.randint(0, 2) == 0:
+            stop, start = start-1, stop-1
+            if stop < 0:
+                stop = None
+            step *= -1
+        return slice(start, stop, step)
+
+    # First a few regular views
+    yield x, x
+    for j in range(1, 7, 3):
+        yield x[j:], x[:-j]
+        yield x[...,j:], x[...,:-j]
+
+    # An array with zero stride internal overlap
+    strides = list(x.strides)
+    strides[0] = 0
+    xp = as_strided(x, shape=x.shape, strides=strides)
+    yield x, xp
+    yield xp, xp
+
+    # An array with non-zero stride internal overlap
+    strides = list(x.strides)
+    if strides[0] > 1:
+        strides[0] = 1
+    xp = as_strided(x, shape=x.shape, strides=strides)
+    yield x, xp
+    yield xp, xp
+
+    # Then discontiguous views
+    while True:
+        steps = tuple(rng.randint(1, 11, dtype=np.intp)
+                      if rng.randint(0, 5, dtype=np.intp) == 0 else 1
+                      for j in range(x.ndim))
+        s1 = tuple(random_slice(p, s) for p, s in zip(x.shape, steps))
+
+        t1 = np.arange(x.ndim)
+        rng.shuffle(t1)
+
+        if equal_size:
+            t2 = t1
+        else:
+            t2 = np.arange(x.ndim)
+            rng.shuffle(t2)
+
+        a = x[s1]
+
+        if equal_size:
+            if a.size == 0:
+                continue
+
+            steps2 = tuple(rng.randint(1, max(2, p//(1+pa)))
+                           if rng.randint(0, 5) == 0 else 1
+                           for p, s, pa in zip(x.shape, s1, a.shape))
+            s2 = tuple(random_slice_fixed_size(p, s, pa)
+                       for p, s, pa in zip(x.shape, steps2, a.shape))
+        elif same_steps:
+            steps2 = steps
+        else:
+            steps2 = tuple(rng.randint(1, 11, dtype=np.intp)
+                           if rng.randint(0, 5, dtype=np.intp) == 0 else 1
+                           for j in range(x.ndim))
+
+        if not equal_size:
+            s2 = tuple(random_slice(p, s) for p, s in zip(x.shape, steps2))
+
+        a = a.transpose(t1)
+        b = x[s2].transpose(t2)
+
+        yield a, b
+
+
+def check_may_share_memory_easy_fuzz(get_max_work, same_steps, min_count):
+    # Check that overlap problems with common strides are solved with
+    # little work.
+    x = np.zeros([17,34,71,97], dtype=np.int16)
+
+    feasible = 0
+    infeasible = 0
+
+    pair_iter = iter_random_view_pairs(x, same_steps)
+
+    while min(feasible, infeasible) < min_count:
+        a, b = next(pair_iter)
+
+        bounds_overlap = np.may_share_memory(a, b)
+        may_share_answer = np.may_share_memory(a, b)
+        easy_answer = np.may_share_memory(a, b, max_work=get_max_work(a, b))
+        exact_answer = np.may_share_memory(a, b, max_work=MAY_SHARE_EXACT)
+
+        if easy_answer != exact_answer:
+            # assert_equal is slow...
+            assert_equal(easy_answer, exact_answer)
+
+        if may_share_answer != bounds_overlap:
+            assert_equal(may_share_answer, bounds_overlap)
+
+        if bounds_overlap:
+            if exact_answer:
+                feasible += 1
+            else:
+                infeasible += 1
+
+
+@pytest.mark.slow
+def test_may_share_memory_easy_fuzz():
+    # Check that overlap problems with common strides are always
+    # solved with little work.
+
+    check_may_share_memory_easy_fuzz(get_max_work=lambda a, b: 1,
+                                     same_steps=True,
+                                     min_count=2000)
+
+
+@pytest.mark.slow
+def test_may_share_memory_harder_fuzz():
+    # Overlap problems with not necessarily common strides take more
+    # work.
+    #
+    # The work bound below can't be reduced much. Harder problems can
+    # also exist but not be detected here, as the set of problems
+    # comes from RNG.
+
+    check_may_share_memory_easy_fuzz(get_max_work=lambda a, b: max(a.size, b.size)//2,
+                                     same_steps=False,
+                                     min_count=2000)
+
+
+def test_shares_memory_api():
+    x = np.zeros([4, 5, 6], dtype=np.int8)
+
+    assert_equal(np.shares_memory(x, x), True)
+    assert_equal(np.shares_memory(x, x.copy()), False)
+
+    a = x[:,::2,::3]
+    b = x[:,::3,::2]
+    assert_equal(np.shares_memory(a, b), True)
+    assert_equal(np.shares_memory(a, b, max_work=None), True)
+    assert_raises(np.TooHardError, np.shares_memory, a, b, max_work=1)
+
+
+def test_may_share_memory_bad_max_work():
+    x = np.zeros([1])
+    assert_raises(OverflowError, np.may_share_memory, x, x, max_work=10**100)
+    assert_raises(OverflowError, np.shares_memory, x, x, max_work=10**100)
+
+
+def test_internal_overlap_diophantine():
+    def check(A, U, exists=None):
+        X = solve_diophantine(A, U, 0, require_ub_nontrivial=1)
+
+        if exists is None:
+            exists = (X is not None)
+
+        if X is not None:
+            assert_(sum(a*x for a, x in zip(A, X)) == sum(a*u//2 for a, u in zip(A, U)))
+            assert_(all(0 <= x <= u for x, u in zip(X, U)))
+            assert_(any(x != u//2 for x, u in zip(X, U)))
+
+        if exists:
+            assert_(X is not None, repr(X))
+        else:
+            assert_(X is None, repr(X))
+
+    # Smoke tests
+    check((3, 2), (2*2, 3*2), exists=True)
+    check((3*2, 2), (15*2, (3-1)*2), exists=False)
+
+
+def test_internal_overlap_slices():
+    # Slicing an array never generates internal overlap
+
+    x = np.zeros([17,34,71,97], dtype=np.int16)
+
+    rng = np.random.RandomState(1234)
+
+    def random_slice(n, step):
+        start = rng.randint(0, n+1, dtype=np.intp)
+        stop = rng.randint(start, n+1, dtype=np.intp)
+        if rng.randint(0, 2, dtype=np.intp) == 0:
+            stop, start = start, stop
+            step *= -1
+        return slice(start, stop, step)
+
+    cases = 0
+    min_count = 5000
+
+    while cases < min_count:
+        steps = tuple(rng.randint(1, 11, dtype=np.intp)
+                      if rng.randint(0, 5, dtype=np.intp) == 0 else 1
+                      for j in range(x.ndim))
+        t1 = np.arange(x.ndim)
+        rng.shuffle(t1)
+        s1 = tuple(random_slice(p, s) for p, s in zip(x.shape, steps))
+        a = x[s1].transpose(t1)
+
+        assert_(not internal_overlap(a))
+        cases += 1
+
+
+def check_internal_overlap(a, manual_expected=None):
+    got = internal_overlap(a)
+
+    # Brute-force check
+    m = set()
+    ranges = tuple(range(n) for n in a.shape)
+    for v in itertools.product(*ranges):
+        offset = sum(s*w for s, w in zip(a.strides, v))
+        if offset in m:
+            expected = True
+            break
+        else:
+            m.add(offset)
+    else:
+        expected = False
+
+    # Compare
+    if got != expected:
+        assert_equal(got, expected, err_msg=repr((a.strides, a.shape)))
+    if manual_expected is not None and expected != manual_expected:
+        assert_equal(expected, manual_expected)
+    return got
+
+
+def test_internal_overlap_manual():
+    # Stride tricks can construct arrays with internal overlap
+
+    # We don't care about memory bounds, the array is not
+    # read/write accessed
+    x = np.arange(1).astype(np.int8)
+
+    # Check low-dimensional special cases
+
+    check_internal_overlap(x, False) # 1-dim
+    check_internal_overlap(x.reshape([]), False) # 0-dim
+
+    a = as_strided(x, strides=(3, 4), shape=(4, 4))
+    check_internal_overlap(a, False)
+
+    a = as_strided(x, strides=(3, 4), shape=(5, 4))
+    check_internal_overlap(a, True)
+
+    a = as_strided(x, strides=(0,), shape=(0,))
+    check_internal_overlap(a, False)
+
+    a = as_strided(x, strides=(0,), shape=(1,))
+    check_internal_overlap(a, False)
+
+    a = as_strided(x, strides=(0,), shape=(2,))
+    check_internal_overlap(a, True)
+
+    a = as_strided(x, strides=(0, -9993), shape=(87, 22))
+    check_internal_overlap(a, True)
+
+    a = as_strided(x, strides=(0, -9993), shape=(1, 22))
+    check_internal_overlap(a, False)
+
+    a = as_strided(x, strides=(0, -9993), shape=(0, 22))
+    check_internal_overlap(a, False)
+
+
+def test_internal_overlap_fuzz():
+    # Fuzz check; the brute-force check is fairly slow
+
+    x = np.arange(1).astype(np.int8)
+
+    overlap = 0
+    no_overlap = 0
+    min_count = 100
+
+    rng = np.random.RandomState(1234)
+
+    while min(overlap, no_overlap) < min_count:
+        ndim = rng.randint(1, 4, dtype=np.intp)
+
+        strides = tuple(rng.randint(-1000, 1000, dtype=np.intp)
+                        for j in range(ndim))
+        shape = tuple(rng.randint(1, 30, dtype=np.intp)
+                      for j in range(ndim))
+
+        a = as_strided(x, strides=strides, shape=shape)
+        result = check_internal_overlap(a)
+
+        if result:
+            overlap += 1
+        else:
+            no_overlap += 1
+
+
+def test_non_ndarray_inputs():
+    # Regression check for gh-5604
+
+    class MyArray:
+        def __init__(self, data):
+            self.data = data
+
+        @property
+        def __array_interface__(self):
+            return self.data.__array_interface__
+
+    class MyArray2:
+        def __init__(self, data):
+            self.data = data
+
+        def __array__(self):
+            return self.data
+
+    for cls in [MyArray, MyArray2]:
+        x = np.arange(5)
+
+        assert_(np.may_share_memory(cls(x[::2]), x[1::2]))
+        assert_(not np.shares_memory(cls(x[::2]), x[1::2]))
+
+        assert_(np.shares_memory(cls(x[1::3]), x[::2]))
+        assert_(np.may_share_memory(cls(x[1::3]), x[::2]))
+
+
+def view_element_first_byte(x):
+    """Construct an array viewing the first byte of each element of `x`"""
+    from numpy.lib.stride_tricks import DummyArray
+    interface = dict(x.__array_interface__)
+    interface['typestr'] = '|b1'
+    interface['descr'] = [('', '|b1')]
+    return np.asarray(DummyArray(interface, x))
+
+
+def assert_copy_equivalent(operation, args, out, **kwargs):
+    """
+    Check that operation(*args, out=out) produces results
+    equivalent to out[...] = operation(*args, out=out.copy())
+    """
+
+    kwargs['out'] = out
+    kwargs2 = dict(kwargs)
+    kwargs2['out'] = out.copy()
+
+    out_orig = out.copy()
+    out[...] = operation(*args, **kwargs2)
+    expected = out.copy()
+    out[...] = out_orig
+
+    got = operation(*args, **kwargs).copy()
+
+    if (got != expected).any():
+        assert_equal(got, expected)
+
+
+class TestUFunc:
+    """
+    Test ufunc call memory overlap handling
+    """
+
+    def check_unary_fuzz(self, operation, get_out_axis_size, dtype=np.int16,
+                             count=5000):
+        shapes = [7, 13, 8, 21, 29, 32]
+
+        rng = np.random.RandomState(1234)
+
+        for ndim in range(1, 6):
+            x = rng.randint(0, 2**16, size=shapes[:ndim]).astype(dtype)
+
+            it = iter_random_view_pairs(x, same_steps=False, equal_size=True)
+
+            min_count = count // (ndim + 1)**2
+
+            overlapping = 0
+            while overlapping < min_count:
+                a, b = next(it)
+
+                a_orig = a.copy()
+                b_orig = b.copy()
+
+                if get_out_axis_size is None:
+                    assert_copy_equivalent(operation, [a], out=b)
+
+                    if np.shares_memory(a, b):
+                        overlapping += 1
+                else:
+                    for axis in itertools.chain(range(ndim), [None]):
+                        a[...] = a_orig
+                        b[...] = b_orig
+
+                        # Determine size for reduction axis (None if scalar)
+                        outsize, scalarize = get_out_axis_size(a, b, axis)
+                        if outsize == 'skip':
+                            continue
+
+                        # Slice b to get an output array of the correct size
+                        sl = [slice(None)] * ndim
+                        if axis is None:
+                            if outsize is None:
+                                sl = [slice(0, 1)] + [0]*(ndim - 1)
+                            else:
+                                sl = [slice(0, outsize)] + [0]*(ndim - 1)
+                        else:
+                            if outsize is None:
+                                k = b.shape[axis]//2
+                                if ndim == 1:
+                                    sl[axis] = slice(k, k + 1)
+                                else:
+                                    sl[axis] = k
+                            else:
+                                assert b.shape[axis] >= outsize
+                                sl[axis] = slice(0, outsize)
+                        b_out = b[tuple(sl)]
+
+                        if scalarize:
+                            b_out = b_out.reshape([])
+
+                        if np.shares_memory(a, b_out):
+                            overlapping += 1
+
+                        # Check result
+                        assert_copy_equivalent(operation, [a], out=b_out, axis=axis)
+
+    @pytest.mark.slow
+    def test_unary_ufunc_call_fuzz(self):
+        self.check_unary_fuzz(np.invert, None, np.int16)
+
+    def test_binary_ufunc_accumulate_fuzz(self):
+        def get_out_axis_size(a, b, axis):
+            if axis is None:
+                if a.ndim == 1:
+                    return a.size, False
+                else:
+                    return 'skip', False  # accumulate doesn't support this
+            else:
+                return a.shape[axis], False
+
+        self.check_unary_fuzz(np.add.accumulate, get_out_axis_size,
+                              dtype=np.int16, count=500)
+
+    def test_binary_ufunc_reduce_fuzz(self):
+        def get_out_axis_size(a, b, axis):
+            return None, (axis is None or a.ndim == 1)
+
+        self.check_unary_fuzz(np.add.reduce, get_out_axis_size,
+                              dtype=np.int16, count=500)
+
+    def test_binary_ufunc_reduceat_fuzz(self):
+        def get_out_axis_size(a, b, axis):
+            if axis is None:
+                if a.ndim == 1:
+                    return a.size, False
+                else:
+                    return 'skip', False  # reduceat doesn't support this
+            else:
+                return a.shape[axis], False
+
+        def do_reduceat(a, out, axis):
+            if axis is None:
+                size = len(a)
+                step = size//len(out)
+            else:
+                size = a.shape[axis]
+                step = a.shape[axis] // out.shape[axis]
+            idx = np.arange(0, size, step)
+            return np.add.reduceat(a, idx, out=out, axis=axis)
+
+        self.check_unary_fuzz(do_reduceat, get_out_axis_size,
+                              dtype=np.int16, count=500)
+
+    def test_binary_ufunc_reduceat_manual(self):
+        def check(ufunc, a, ind, out):
+            c1 = ufunc.reduceat(a.copy(), ind.copy(), out=out.copy())
+            c2 = ufunc.reduceat(a, ind, out=out)
+            assert_array_equal(c1, c2)
+
+        # Exactly same input/output arrays
+        a = np.arange(10000, dtype=np.int16)
+        check(np.add, a, a[::-1].copy(), a)
+
+        # Overlap with index
+        a = np.arange(10000, dtype=np.int16)
+        check(np.add, a, a[::-1], a)
+
+    @pytest.mark.slow
+    def test_unary_gufunc_fuzz(self):
+        shapes = [7, 13, 8, 21, 29, 32]
+        gufunc = _umath_tests.euclidean_pdist
+
+        rng = np.random.RandomState(1234)
+
+        for ndim in range(2, 6):
+            x = rng.rand(*shapes[:ndim])
+
+            it = iter_random_view_pairs(x, same_steps=False, equal_size=True)
+
+            min_count = 500 // (ndim + 1)**2
+
+            overlapping = 0
+            while overlapping < min_count:
+                a, b = next(it)
+
+                if min(a.shape[-2:]) < 2 or min(b.shape[-2:]) < 2 or a.shape[-1] < 2:
+                    continue
+
+                # Ensure the shapes are so that euclidean_pdist is happy
+                if b.shape[-1] > b.shape[-2]:
+                    b = b[...,0,:]
+                else:
+                    b = b[...,:,0]
+
+                n = a.shape[-2]
+                p = n * (n - 1) // 2
+                if p <= b.shape[-1] and p > 0:
+                    b = b[...,:p]
+                else:
+                    n = max(2, int(np.sqrt(b.shape[-1]))//2)
+                    p = n * (n - 1) // 2
+                    a = a[...,:n,:]
+                    b = b[...,:p]
+
+                # Call
+                if np.shares_memory(a, b):
+                    overlapping += 1
+
+                with np.errstate(over='ignore', invalid='ignore'):
+                    assert_copy_equivalent(gufunc, [a], out=b)
+
+    def test_ufunc_at_manual(self):
+        def check(ufunc, a, ind, b=None):
+            a0 = a.copy()
+            if b is None:
+                ufunc.at(a0, ind.copy())
+                c1 = a0.copy()
+                ufunc.at(a, ind)
+                c2 = a.copy()
+            else:
+                ufunc.at(a0, ind.copy(), b.copy())
+                c1 = a0.copy()
+                ufunc.at(a, ind, b)
+                c2 = a.copy()
+            assert_array_equal(c1, c2)
+
+        # Overlap with index
+        a = np.arange(10000, dtype=np.int16)
+        check(np.invert, a[::-1], a)
+
+        # Overlap with second data array
+        a = np.arange(100, dtype=np.int16)
+        ind = np.arange(0, 100, 2, dtype=np.int16)
+        check(np.add, a, ind, a[25:75])
+
+    def test_unary_ufunc_1d_manual(self):
+        # Exercise branches in PyArray_EQUIVALENTLY_ITERABLE
+
+        def check(a, b):
+            a_orig = a.copy()
+            b_orig = b.copy()
+
+            b0 = b.copy()
+            c1 = ufunc(a, out=b0)
+            c2 = ufunc(a, out=b)
+            assert_array_equal(c1, c2)
+
+            # Trigger "fancy ufunc loop" code path
+            mask = view_element_first_byte(b).view(np.bool_)
+
+            a[...] = a_orig
+            b[...] = b_orig
+            c1 = ufunc(a, out=b.copy(), where=mask.copy()).copy()
+
+            a[...] = a_orig
+            b[...] = b_orig
+            c2 = ufunc(a, out=b, where=mask.copy()).copy()
+
+            # Also, mask overlapping with output
+            a[...] = a_orig
+            b[...] = b_orig
+            c3 = ufunc(a, out=b, where=mask).copy()
+
+            assert_array_equal(c1, c2)
+            assert_array_equal(c1, c3)
+
+        dtypes = [np.int8, np.int16, np.int32, np.int64, np.float32,
+                  np.float64, np.complex64, np.complex128]
+        dtypes = [np.dtype(x) for x in dtypes]
+
+        for dtype in dtypes:
+            if np.issubdtype(dtype, np.integer):
+                ufunc = np.invert
+            else:
+                ufunc = np.reciprocal
+
+            n = 1000
+            k = 10
+            indices = [
+                np.index_exp[:n],
+                np.index_exp[k:k+n],
+                np.index_exp[n-1::-1],
+                np.index_exp[k+n-1:k-1:-1],
+                np.index_exp[:2*n:2],
+                np.index_exp[k:k+2*n:2],
+                np.index_exp[2*n-1::-2],
+                np.index_exp[k+2*n-1:k-1:-2],
+            ]
+
+            for xi, yi in itertools.product(indices, indices):
+                v = np.arange(1, 1 + n*2 + k, dtype=dtype)
+                x = v[xi]
+                y = v[yi]
+
+                with np.errstate(all='ignore'):
+                    check(x, y)
+
+                    # Scalar cases
+                    check(x[:1], y)
+                    check(x[-1:], y)
+                    check(x[:1].reshape([]), y)
+                    check(x[-1:].reshape([]), y)
+
+    def test_unary_ufunc_where_same(self):
+        # Check behavior at wheremask overlap
+        ufunc = np.invert
+
+        def check(a, out, mask):
+            c1 = ufunc(a, out=out.copy(), where=mask.copy())
+            c2 = ufunc(a, out=out, where=mask)
+            assert_array_equal(c1, c2)
+
+        # Check behavior with same input and output arrays
+        x = np.arange(100).astype(np.bool_)
+        check(x, x, x)
+        check(x, x.copy(), x)
+        check(x, x, x.copy())
+
+    @pytest.mark.slow
+    def test_binary_ufunc_1d_manual(self):
+        ufunc = np.add
+
+        def check(a, b, c):
+            c0 = c.copy()
+            c1 = ufunc(a, b, out=c0)
+            c2 = ufunc(a, b, out=c)
+            assert_array_equal(c1, c2)
+
+        for dtype in [np.int8, np.int16, np.int32, np.int64,
+                      np.float32, np.float64, np.complex64, np.complex128]:
+            # Check different data dependency orders
+
+            n = 1000
+            k = 10
+
+            indices = []
+            for p in [1, 2]:
+                indices.extend([
+                    np.index_exp[:p*n:p],
+                    np.index_exp[k:k+p*n:p],
+                    np.index_exp[p*n-1::-p],
+                    np.index_exp[k+p*n-1:k-1:-p],
+                ])
+
+            for x, y, z in itertools.product(indices, indices, indices):
+                v = np.arange(6*n).astype(dtype)
+                x = v[x]
+                y = v[y]
+                z = v[z]
+
+                check(x, y, z)
+
+                # Scalar cases
+                check(x[:1], y, z)
+                check(x[-1:], y, z)
+                check(x[:1].reshape([]), y, z)
+                check(x[-1:].reshape([]), y, z)
+                check(x, y[:1], z)
+                check(x, y[-1:], z)
+                check(x, y[:1].reshape([]), z)
+                check(x, y[-1:].reshape([]), z)
+
+    def test_inplace_op_simple_manual(self):
+        rng = np.random.RandomState(1234)
+        x = rng.rand(200, 200)  # bigger than bufsize
+
+        x += x.T
+        assert_array_equal(x - x.T, 0)

venv/Lib/site-packages/numpy/core/tests/test_memmap.py

@@ -0,0 +1,213 @@
+import sys
+import os
+import shutil
+import mmap
+import pytest
+from pathlib import Path
+from tempfile import NamedTemporaryFile, TemporaryFile, mktemp, mkdtemp
+
+from numpy import (
+    memmap, sum, average, product, ndarray, isscalar, add, subtract, multiply)
+
+from numpy import arange, allclose, asarray
+from numpy.testing import (
+    assert_, assert_equal, assert_array_equal, suppress_warnings
+    )
+
+class TestMemmap:
+    def setup(self):
+        self.tmpfp = NamedTemporaryFile(prefix='mmap')
+        self.tempdir = mkdtemp()
+        self.shape = (3, 4)
+        self.dtype = 'float32'
+        self.data = arange(12, dtype=self.dtype)
+        self.data.resize(self.shape)
+
+    def teardown(self):
+        self.tmpfp.close()
+        shutil.rmtree(self.tempdir)
+
+    def test_roundtrip(self):
+        # Write data to file
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+',
+                    shape=self.shape)
+        fp[:] = self.data[:]
+        del fp  # Test __del__ machinery, which handles cleanup
+
+        # Read data back from file
+        newfp = memmap(self.tmpfp, dtype=self.dtype, mode='r',
+                       shape=self.shape)
+        assert_(allclose(self.data, newfp))
+        assert_array_equal(self.data, newfp)
+        assert_equal(newfp.flags.writeable, False)
+
+    def test_open_with_filename(self):
+        tmpname = mktemp('', 'mmap', dir=self.tempdir)
+        fp = memmap(tmpname, dtype=self.dtype, mode='w+',
+                       shape=self.shape)
+        fp[:] = self.data[:]
+        del fp
+
+    def test_unnamed_file(self):
+        with TemporaryFile() as f:
+            fp = memmap(f, dtype=self.dtype, shape=self.shape)
+            del fp
+
+    def test_attributes(self):
+        offset = 1
+        mode = "w+"
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode=mode,
+                    shape=self.shape, offset=offset)
+        assert_equal(offset, fp.offset)
+        assert_equal(mode, fp.mode)
+        del fp
+
+    def test_filename(self):
+        tmpname = mktemp('', 'mmap', dir=self.tempdir)
+        fp = memmap(tmpname, dtype=self.dtype, mode='w+',
+                       shape=self.shape)
+        abspath = os.path.abspath(tmpname)
+        fp[:] = self.data[:]
+        assert_equal(abspath, fp.filename)
+        b = fp[:1]
+        assert_equal(abspath, b.filename)
+        del b
+        del fp
+
+    def test_path(self):
+        tmpname = mktemp('', 'mmap', dir=self.tempdir)
+        fp = memmap(Path(tmpname), dtype=self.dtype, mode='w+',
+                       shape=self.shape)
+        # os.path.realpath does not resolve symlinks on Windows
+        # see: https://bugs.python.org/issue9949
+        # use Path.resolve, just as memmap class does internally
+        abspath = str(Path(tmpname).resolve())
+        fp[:] = self.data[:]
+        assert_equal(abspath, str(fp.filename.resolve()))
+        b = fp[:1]
+        assert_equal(abspath, str(b.filename.resolve()))
+        del b
+        del fp
+
+    def test_filename_fileobj(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode="w+",
+                    shape=self.shape)
+        assert_equal(fp.filename, self.tmpfp.name)
+
+    @pytest.mark.skipif(sys.platform == 'gnu0',
+                        reason="Known to fail on hurd")
+    def test_flush(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+',
+                    shape=self.shape)
+        fp[:] = self.data[:]
+        assert_equal(fp[0], self.data[0])
+        fp.flush()
+
+    def test_del(self):
+        # Make sure a view does not delete the underlying mmap
+        fp_base = memmap(self.tmpfp, dtype=self.dtype, mode='w+',
+                    shape=self.shape)
+        fp_base[0] = 5
+        fp_view = fp_base[0:1]
+        assert_equal(fp_view[0], 5)
+        del fp_view
+        # Should still be able to access and assign values after
+        # deleting the view
+        assert_equal(fp_base[0], 5)
+        fp_base[0] = 6
+        assert_equal(fp_base[0], 6)
+
+    def test_arithmetic_drops_references(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+',
+                    shape=self.shape)
+        tmp = (fp + 10)
+        if isinstance(tmp, memmap):
+            assert_(tmp._mmap is not fp._mmap)
+
+    def test_indexing_drops_references(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+',
+                    shape=self.shape)
+        tmp = fp[(1, 2), (2, 3)]
+        if isinstance(tmp, memmap):
+            assert_(tmp._mmap is not fp._mmap)
+
+    def test_slicing_keeps_references(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+',
+                    shape=self.shape)
+        assert_(fp[:2, :2]._mmap is fp._mmap)
+
+    def test_view(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape)
+        new1 = fp.view()
+        new2 = new1.view()
+        assert_(new1.base is fp)
+        assert_(new2.base is fp)
+        new_array = asarray(fp)
+        assert_(new_array.base is fp)
+
+    def test_ufunc_return_ndarray(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape)
+        fp[:] = self.data
+
+        with suppress_warnings() as sup:
+            sup.filter(FutureWarning, "np.average currently does not preserve")
+            for unary_op in [sum, average, product]:
+                result = unary_op(fp)
+                assert_(isscalar(result))
+                assert_(result.__class__ is self.data[0, 0].__class__)
+
+                assert_(unary_op(fp, axis=0).__class__ is ndarray)
+                assert_(unary_op(fp, axis=1).__class__ is ndarray)
+
+        for binary_op in [add, subtract, multiply]:
+            assert_(binary_op(fp, self.data).__class__ is ndarray)
+            assert_(binary_op(self.data, fp).__class__ is ndarray)
+            assert_(binary_op(fp, fp).__class__ is ndarray)
+
+        fp += 1
+        assert(fp.__class__ is memmap)
+        add(fp, 1, out=fp)
+        assert(fp.__class__ is memmap)
+
+    def test_getitem(self):
+        fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape)
+        fp[:] = self.data
+
+        assert_(fp[1:, :-1].__class__ is memmap)
+        # Fancy indexing returns a copy that is not memmapped
+        assert_(fp[[0, 1]].__class__ is ndarray)
+
+    def test_memmap_subclass(self):
+        class MemmapSubClass(memmap):
+            pass
+
+        fp = MemmapSubClass(self.tmpfp, dtype=self.dtype, shape=self.shape)
+        fp[:] = self.data
+
+        # We keep previous behavior for subclasses of memmap, i.e. the
+        # ufunc and __getitem__ output is never turned into a ndarray
+        assert_(sum(fp, axis=0).__class__ is MemmapSubClass)
+        assert_(sum(fp).__class__ is MemmapSubClass)
+        assert_(fp[1:, :-1].__class__ is MemmapSubClass)
+        assert(fp[[0, 1]].__class__ is MemmapSubClass)
+
+    def test_mmap_offset_greater_than_allocation_granularity(self):
+        size = 5 * mmap.ALLOCATIONGRANULARITY
+        offset = mmap.ALLOCATIONGRANULARITY + 1
+        fp = memmap(self.tmpfp, shape=size, mode='w+', offset=offset)
+        assert_(fp.offset == offset)
+
+    def test_no_shape(self):
+        self.tmpfp.write(b'a'*16)
+        mm = memmap(self.tmpfp, dtype='float64')
+        assert_equal(mm.shape, (2,))
+
+    def test_empty_array(self):
+        # gh-12653
+        with pytest.raises(ValueError, match='empty file'):
+            memmap(self.tmpfp, shape=(0,4), mode='w+')
+
+        self.tmpfp.write(b'\0')
+
+        # ok now the file is not empty
+        memmap(self.tmpfp, shape=(0,4), mode='w+')

venv/Lib/site-packages/numpy/core/tests/test_numerictypes.py

@@ -0,0 +1,554 @@
+import sys
+import itertools
+
+import pytest
+import numpy as np
+from numpy.testing import assert_, assert_equal, assert_raises, IS_PYPY
+
+# This is the structure of the table used for plain objects:
+#
+# +-+-+-+
+# |x|y|z|
+# +-+-+-+
+
+# Structure of a plain array description:
+Pdescr = [
+    ('x', 'i4', (2,)),
+    ('y', 'f8', (2, 2)),
+    ('z', 'u1')]
+
+# A plain list of tuples with values for testing:
+PbufferT = [
+    # x     y                  z
+    ([3, 2], [[6., 4.], [6., 4.]], 8),
+    ([4, 3], [[7., 5.], [7., 5.]], 9),
+    ]
+
+
+# This is the structure of the table used for nested objects (DON'T PANIC!):
+#
+# +-+---------------------------------+-----+----------+-+-+
+# |x|Info                             |color|info      |y|z|
+# | +-----+--+----------------+----+--+     +----+-----+ | |
+# | |value|y2|Info2           |name|z2|     |Name|Value| | |
+# | |     |  +----+-----+--+--+    |  |     |    |     | | |
+# | |     |  |name|value|y3|z3|    |  |     |    |     | | |
+# +-+-----+--+----+-----+--+--+----+--+-----+----+-----+-+-+
+#
+
+# The corresponding nested array description:
+Ndescr = [
+    ('x', 'i4', (2,)),
+    ('Info', [
+        ('value', 'c16'),
+        ('y2', 'f8'),
+        ('Info2', [
+            ('name', 'S2'),
+            ('value', 'c16', (2,)),
+            ('y3', 'f8', (2,)),
+            ('z3', 'u4', (2,))]),
+        ('name', 'S2'),
+        ('z2', 'b1')]),
+    ('color', 'S2'),
+    ('info', [
+        ('Name', 'U8'),
+        ('Value', 'c16')]),
+    ('y', 'f8', (2, 2)),
+    ('z', 'u1')]
+
+NbufferT = [
+    # x     Info                                                color info        y                  z
+    #       value y2 Info2                            name z2         Name Value
+    #                name   value    y3       z3
+    ([3, 2], (6j, 6., (b'nn', [6j, 4j], [6., 4.], [1, 2]), b'NN', True), b'cc', (u'NN', 6j), [[6., 4.], [6., 4.]], 8),
+    ([4, 3], (7j, 7., (b'oo', [7j, 5j], [7., 5.], [2, 1]), b'OO', False), b'dd', (u'OO', 7j), [[7., 5.], [7., 5.]], 9),
+    ]
+
+
+byteorder = {'little':'<', 'big':'>'}[sys.byteorder]
+
+def normalize_descr(descr):
+    "Normalize a description adding the platform byteorder."
+
+    out = []
+    for item in descr:
+        dtype = item[1]
+        if isinstance(dtype, str):
+            if dtype[0] not in ['|', '<', '>']:
+                onebyte = dtype[1:] == "1"
+                if onebyte or dtype[0] in ['S', 'V', 'b']:
+                    dtype = "|" + dtype
+                else:
+                    dtype = byteorder + dtype
+            if len(item) > 2 and np.prod(item[2]) > 1:
+                nitem = (item[0], dtype, item[2])
+            else:
+                nitem = (item[0], dtype)
+            out.append(nitem)
+        elif isinstance(dtype, list):
+            l = normalize_descr(dtype)
+            out.append((item[0], l))
+        else:
+            raise ValueError("Expected a str or list and got %s" %
+                             (type(item)))
+    return out
+
+
+############################################################
+#    Creation tests
+############################################################
+
+class CreateZeros:
+    """Check the creation of heterogeneous arrays zero-valued"""
+
+    def test_zeros0D(self):
+        """Check creation of 0-dimensional objects"""
+        h = np.zeros((), dtype=self._descr)
+        assert_(normalize_descr(self._descr) == h.dtype.descr)
+        assert_(h.dtype.fields['x'][0].name[:4] == 'void')
+        assert_(h.dtype.fields['x'][0].char == 'V')
+        assert_(h.dtype.fields['x'][0].type == np.void)
+        # A small check that data is ok
+        assert_equal(h['z'], np.zeros((), dtype='u1'))
+
+    def test_zerosSD(self):
+        """Check creation of single-dimensional objects"""
+        h = np.zeros((2,), dtype=self._descr)
+        assert_(normalize_descr(self._descr) == h.dtype.descr)
+        assert_(h.dtype['y'].name[:4] == 'void')
+        assert_(h.dtype['y'].char == 'V')
+        assert_(h.dtype['y'].type == np.void)
+        # A small check that data is ok
+        assert_equal(h['z'], np.zeros((2,), dtype='u1'))
+
+    def test_zerosMD(self):
+        """Check creation of multi-dimensional objects"""
+        h = np.zeros((2, 3), dtype=self._descr)
+        assert_(normalize_descr(self._descr) == h.dtype.descr)
+        assert_(h.dtype['z'].name == 'uint8')
+        assert_(h.dtype['z'].char == 'B')
+        assert_(h.dtype['z'].type == np.uint8)
+        # A small check that data is ok
+        assert_equal(h['z'], np.zeros((2, 3), dtype='u1'))
+
+
+class TestCreateZerosPlain(CreateZeros):
+    """Check the creation of heterogeneous arrays zero-valued (plain)"""
+    _descr = Pdescr
+
+class TestCreateZerosNested(CreateZeros):
+    """Check the creation of heterogeneous arrays zero-valued (nested)"""
+    _descr = Ndescr
+
+
+class CreateValues:
+    """Check the creation of heterogeneous arrays with values"""
+
+    def test_tuple(self):
+        """Check creation from tuples"""
+        h = np.array(self._buffer, dtype=self._descr)
+        assert_(normalize_descr(self._descr) == h.dtype.descr)
+        if self.multiple_rows:
+            assert_(h.shape == (2,))
+        else:
+            assert_(h.shape == ())
+
+    def test_list_of_tuple(self):
+        """Check creation from list of tuples"""
+        h = np.array([self._buffer], dtype=self._descr)
+        assert_(normalize_descr(self._descr) == h.dtype.descr)
+        if self.multiple_rows:
+            assert_(h.shape == (1, 2))
+        else:
+            assert_(h.shape == (1,))
+
+    def test_list_of_list_of_tuple(self):
+        """Check creation from list of list of tuples"""
+        h = np.array([[self._buffer]], dtype=self._descr)
+        assert_(normalize_descr(self._descr) == h.dtype.descr)
+        if self.multiple_rows:
+            assert_(h.shape == (1, 1, 2))
+        else:
+            assert_(h.shape == (1, 1))
+
+
+class TestCreateValuesPlainSingle(CreateValues):
+    """Check the creation of heterogeneous arrays (plain, single row)"""
+    _descr = Pdescr
+    multiple_rows = 0
+    _buffer = PbufferT[0]
+
+class TestCreateValuesPlainMultiple(CreateValues):
+    """Check the creation of heterogeneous arrays (plain, multiple rows)"""
+    _descr = Pdescr
+    multiple_rows = 1
+    _buffer = PbufferT
+
+class TestCreateValuesNestedSingle(CreateValues):
+    """Check the creation of heterogeneous arrays (nested, single row)"""
+    _descr = Ndescr
+    multiple_rows = 0
+    _buffer = NbufferT[0]
+
+class TestCreateValuesNestedMultiple(CreateValues):
+    """Check the creation of heterogeneous arrays (nested, multiple rows)"""
+    _descr = Ndescr
+    multiple_rows = 1
+    _buffer = NbufferT
+
+
+############################################################
+#    Reading tests
+############################################################
+
+class ReadValuesPlain:
+    """Check the reading of values in heterogeneous arrays (plain)"""
+
+    def test_access_fields(self):
+        h = np.array(self._buffer, dtype=self._descr)
+        if not self.multiple_rows:
+            assert_(h.shape == ())
+            assert_equal(h['x'], np.array(self._buffer[0], dtype='i4'))
+            assert_equal(h['y'], np.array(self._buffer[1], dtype='f8'))
+            assert_equal(h['z'], np.array(self._buffer[2], dtype='u1'))
+        else:
+            assert_(len(h) == 2)
+            assert_equal(h['x'], np.array([self._buffer[0][0],
+                                             self._buffer[1][0]], dtype='i4'))
+            assert_equal(h['y'], np.array([self._buffer[0][1],
+                                             self._buffer[1][1]], dtype='f8'))
+            assert_equal(h['z'], np.array([self._buffer[0][2],
+                                             self._buffer[1][2]], dtype='u1'))
+
+
+class TestReadValuesPlainSingle(ReadValuesPlain):
+    """Check the creation of heterogeneous arrays (plain, single row)"""
+    _descr = Pdescr
+    multiple_rows = 0
+    _buffer = PbufferT[0]
+
+class TestReadValuesPlainMultiple(ReadValuesPlain):
+    """Check the values of heterogeneous arrays (plain, multiple rows)"""
+    _descr = Pdescr
+    multiple_rows = 1
+    _buffer = PbufferT
+
+class ReadValuesNested:
+    """Check the reading of values in heterogeneous arrays (nested)"""
+
+    def test_access_top_fields(self):
+        """Check reading the top fields of a nested array"""
+        h = np.array(self._buffer, dtype=self._descr)
+        if not self.multiple_rows:
+            assert_(h.shape == ())
+            assert_equal(h['x'], np.array(self._buffer[0], dtype='i4'))
+            assert_equal(h['y'], np.array(self._buffer[4], dtype='f8'))
+            assert_equal(h['z'], np.array(self._buffer[5], dtype='u1'))
+        else:
+            assert_(len(h) == 2)
+            assert_equal(h['x'], np.array([self._buffer[0][0],
+                                           self._buffer[1][0]], dtype='i4'))
+            assert_equal(h['y'], np.array([self._buffer[0][4],
+                                           self._buffer[1][4]], dtype='f8'))
+            assert_equal(h['z'], np.array([self._buffer[0][5],
+                                           self._buffer[1][5]], dtype='u1'))
+
+    def test_nested1_acessors(self):
+        """Check reading the nested fields of a nested array (1st level)"""
+        h = np.array(self._buffer, dtype=self._descr)
+        if not self.multiple_rows:
+            assert_equal(h['Info']['value'],
+                         np.array(self._buffer[1][0], dtype='c16'))
+            assert_equal(h['Info']['y2'],
+                         np.array(self._buffer[1][1], dtype='f8'))
+            assert_equal(h['info']['Name'],
+                         np.array(self._buffer[3][0], dtype='U2'))
+            assert_equal(h['info']['Value'],
+                         np.array(self._buffer[3][1], dtype='c16'))
+        else:
+            assert_equal(h['Info']['value'],
+                         np.array([self._buffer[0][1][0],
+                                self._buffer[1][1][0]],
+                                dtype='c16'))
+            assert_equal(h['Info']['y2'],
+                         np.array([self._buffer[0][1][1],
+                                self._buffer[1][1][1]],
+                                dtype='f8'))
+            assert_equal(h['info']['Name'],
+                         np.array([self._buffer[0][3][0],
+                                self._buffer[1][3][0]],
+                               dtype='U2'))
+            assert_equal(h['info']['Value'],
+                         np.array([self._buffer[0][3][1],
+                                self._buffer[1][3][1]],
+                               dtype='c16'))
+
+    def test_nested2_acessors(self):
+        """Check reading the nested fields of a nested array (2nd level)"""
+        h = np.array(self._buffer, dtype=self._descr)
+        if not self.multiple_rows:
+            assert_equal(h['Info']['Info2']['value'],
+                         np.array(self._buffer[1][2][1], dtype='c16'))
+            assert_equal(h['Info']['Info2']['z3'],
+                         np.array(self._buffer[1][2][3], dtype='u4'))
+        else:
+            assert_equal(h['Info']['Info2']['value'],
+                         np.array([self._buffer[0][1][2][1],
+                                self._buffer[1][1][2][1]],
+                               dtype='c16'))
+            assert_equal(h['Info']['Info2']['z3'],
+                         np.array([self._buffer[0][1][2][3],
+                                self._buffer[1][1][2][3]],
+                               dtype='u4'))
+
+    def test_nested1_descriptor(self):
+        """Check access nested descriptors of a nested array (1st level)"""
+        h = np.array(self._buffer, dtype=self._descr)
+        assert_(h.dtype['Info']['value'].name == 'complex128')
+        assert_(h.dtype['Info']['y2'].name == 'float64')
+        assert_(h.dtype['info']['Name'].name == 'str256')
+        assert_(h.dtype['info']['Value'].name == 'complex128')
+
+    def test_nested2_descriptor(self):
+        """Check access nested descriptors of a nested array (2nd level)"""
+        h = np.array(self._buffer, dtype=self._descr)
+        assert_(h.dtype['Info']['Info2']['value'].name == 'void256')
+        assert_(h.dtype['Info']['Info2']['z3'].name == 'void64')
+
+
+class TestReadValuesNestedSingle(ReadValuesNested):
+    """Check the values of heterogeneous arrays (nested, single row)"""
+    _descr = Ndescr
+    multiple_rows = False
+    _buffer = NbufferT[0]
+
+class TestReadValuesNestedMultiple(ReadValuesNested):
+    """Check the values of heterogeneous arrays (nested, multiple rows)"""
+    _descr = Ndescr
+    multiple_rows = True
+    _buffer = NbufferT
+
+class TestEmptyField:
+    def test_assign(self):
+        a = np.arange(10, dtype=np.float32)
+        a.dtype = [("int",   "<0i4"), ("float", "<2f4")]
+        assert_(a['int'].shape == (5, 0))
+        assert_(a['float'].shape == (5, 2))
+
+class TestCommonType:
+    def test_scalar_loses1(self):
+        res = np.find_common_type(['f4', 'f4', 'i2'], ['f8'])
+        assert_(res == 'f4')
+
+    def test_scalar_loses2(self):
+        res = np.find_common_type(['f4', 'f4'], ['i8'])
+        assert_(res == 'f4')
+
+    def test_scalar_wins(self):
+        res = np.find_common_type(['f4', 'f4', 'i2'], ['c8'])
+        assert_(res == 'c8')
+
+    def test_scalar_wins2(self):
+        res = np.find_common_type(['u4', 'i4', 'i4'], ['f4'])
+        assert_(res == 'f8')
+
+    def test_scalar_wins3(self):  # doesn't go up to 'f16' on purpose
+        res = np.find_common_type(['u8', 'i8', 'i8'], ['f8'])
+        assert_(res == 'f8')
+
+class TestMultipleFields:
+    def setup(self):
+        self.ary = np.array([(1, 2, 3, 4), (5, 6, 7, 8)], dtype='i4,f4,i2,c8')
+
+    def _bad_call(self):
+        return self.ary['f0', 'f1']
+
+    def test_no_tuple(self):
+        assert_raises(IndexError, self._bad_call)
+
+    def test_return(self):
+        res = self.ary[['f0', 'f2']].tolist()
+        assert_(res == [(1, 3), (5, 7)])
+
+
+class TestIsSubDType:
+    # scalar types can be promoted into dtypes
+    wrappers = [np.dtype, lambda x: x]
+
+    def test_both_abstract(self):
+        assert_(np.issubdtype(np.floating, np.inexact))
+        assert_(not np.issubdtype(np.inexact, np.floating))
+
+    def test_same(self):
+        for cls in (np.float32, np.int32):
+            for w1, w2 in itertools.product(self.wrappers, repeat=2):
+                assert_(np.issubdtype(w1(cls), w2(cls)))
+
+    def test_subclass(self):
+        # note we cannot promote floating to a dtype, as it would turn into a
+        # concrete type
+        for w in self.wrappers:
+            assert_(np.issubdtype(w(np.float32), np.floating))
+            assert_(np.issubdtype(w(np.float64), np.floating))
+
+    def test_subclass_backwards(self):
+        for w in self.wrappers:
+            assert_(not np.issubdtype(np.floating, w(np.float32)))
+            assert_(not np.issubdtype(np.floating, w(np.float64)))
+
+    def test_sibling_class(self):
+        for w1, w2 in itertools.product(self.wrappers, repeat=2):
+            assert_(not np.issubdtype(w1(np.float32), w2(np.float64)))
+            assert_(not np.issubdtype(w1(np.float64), w2(np.float32)))
+
+    def test_nondtype_nonscalartype(self):
+        # See gh-14619 and gh-9505 which introduced the deprecation to fix
+        # this. These tests are directly taken from gh-9505
+        assert not np.issubdtype(np.float32, 'float64')
+        assert not np.issubdtype(np.float32, 'f8')
+        assert not np.issubdtype(np.int32, str)
+        assert not np.issubdtype(np.int32, 'int64')
+        assert not np.issubdtype(np.str_, 'void')
+        # for the following the correct spellings are
+        # np.integer, np.floating, or np.complexfloating respectively:
+        assert not np.issubdtype(np.int8, int)  # np.int8 is never np.int_
+        assert not np.issubdtype(np.float32, float)
+        assert not np.issubdtype(np.complex64, complex)
+        assert not np.issubdtype(np.float32, "float")
+        assert not np.issubdtype(np.float64, "f")
+
+        # Test the same for the correct first datatype and abstract one
+        # in the case of int, float, complex:
+        assert np.issubdtype(np.float64, 'float64')
+        assert np.issubdtype(np.float64, 'f8')
+        assert np.issubdtype(np.str_, str)
+        assert np.issubdtype(np.int64, 'int64')
+        assert np.issubdtype(np.void, 'void')
+        assert np.issubdtype(np.int8, np.integer)
+        assert np.issubdtype(np.float32, np.floating)
+        assert np.issubdtype(np.complex64, np.complexfloating)
+        assert np.issubdtype(np.float64, "float")
+        assert np.issubdtype(np.float32, "f")
+
+
+class TestSctypeDict:
+    def test_longdouble(self):
+        assert_(np.sctypeDict['f8'] is not np.longdouble)
+        assert_(np.sctypeDict['c16'] is not np.clongdouble)
+
+
+class TestBitName:
+    def test_abstract(self):
+        assert_raises(ValueError, np.core.numerictypes.bitname, np.floating)
+
+
+class TestMaximumSctype:
+
+    # note that parametrizing with sctype['int'] and similar would skip types
+    # with the same size (gh-11923)
+
+    @pytest.mark.parametrize('t', [np.byte, np.short, np.intc, np.int_, np.longlong])
+    def test_int(self, t):
+        assert_equal(np.maximum_sctype(t), np.sctypes['int'][-1])
+
+    @pytest.mark.parametrize('t', [np.ubyte, np.ushort, np.uintc, np.uint, np.ulonglong])
+    def test_uint(self, t):
+        assert_equal(np.maximum_sctype(t), np.sctypes['uint'][-1])
+
+    @pytest.mark.parametrize('t', [np.half, np.single, np.double, np.longdouble])
+    def test_float(self, t):
+        assert_equal(np.maximum_sctype(t), np.sctypes['float'][-1])
+
+    @pytest.mark.parametrize('t', [np.csingle, np.cdouble, np.clongdouble])
+    def test_complex(self, t):
+        assert_equal(np.maximum_sctype(t), np.sctypes['complex'][-1])
+
+    @pytest.mark.parametrize('t', [np.bool_, np.object_, np.unicode_, np.bytes_, np.void])
+    def test_other(self, t):
+        assert_equal(np.maximum_sctype(t), t)
+
+
+class Test_sctype2char:
+    # This function is old enough that we're really just documenting the quirks
+    # at this point.
+
+    def test_scalar_type(self):
+        assert_equal(np.sctype2char(np.double), 'd')
+        assert_equal(np.sctype2char(np.int_), 'l')
+        assert_equal(np.sctype2char(np.unicode_), 'U')
+        assert_equal(np.sctype2char(np.bytes_), 'S')
+
+    def test_other_type(self):
+        assert_equal(np.sctype2char(float), 'd')
+        assert_equal(np.sctype2char(list), 'O')
+        assert_equal(np.sctype2char(np.ndarray), 'O')
+
+    def test_third_party_scalar_type(self):
+        from numpy.core._rational_tests import rational
+        assert_raises(KeyError, np.sctype2char, rational)
+        assert_raises(KeyError, np.sctype2char, rational(1))
+
+    def test_array_instance(self):
+        assert_equal(np.sctype2char(np.array([1.0, 2.0])), 'd')
+
+    def test_abstract_type(self):
+        assert_raises(KeyError, np.sctype2char, np.floating)
+
+    def test_non_type(self):
+        assert_raises(ValueError, np.sctype2char, 1)
+
+@pytest.mark.parametrize("rep, expected", [
+    (np.int32, True),
+    (list, False),
+    (1.1, False),
+    (str, True),
+    (np.dtype(np.float64), True),
+    (np.dtype((np.int16, (3, 4))), True),
+    (np.dtype([('a', np.int8)]), True),
+    ])
+def test_issctype(rep, expected):
+    # ensure proper identification of scalar
+    # data-types by issctype()
+    actual = np.issctype(rep)
+    assert_equal(actual, expected)
+
+
+@pytest.mark.skipif(sys.flags.optimize > 1,
+                    reason="no docstrings present to inspect when PYTHONOPTIMIZE/Py_OptimizeFlag > 1")
+@pytest.mark.xfail(IS_PYPY,
+                   reason="PyPy cannot modify tp_doc after PyType_Ready")
+class TestDocStrings:
+    def test_platform_dependent_aliases(self):
+        if np.int64 is np.int_:
+            assert_('int64' in np.int_.__doc__)
+        elif np.int64 is np.longlong:
+            assert_('int64' in np.longlong.__doc__)
+
+
+class TestScalarTypeNames:
+    # gh-9799
+
+    numeric_types = [
+        np.byte, np.short, np.intc, np.int_, np.longlong,
+        np.ubyte, np.ushort, np.uintc, np.uint, np.ulonglong,
+        np.half, np.single, np.double, np.longdouble,
+        np.csingle, np.cdouble, np.clongdouble,
+    ]
+
+    def test_names_are_unique(self):
+        # none of the above may be aliases for each other
+        assert len(set(self.numeric_types)) == len(self.numeric_types)
+
+        # names must be unique
+        names = [t.__name__ for t in self.numeric_types]
+        assert len(set(names)) == len(names)
+
+    @pytest.mark.parametrize('t', numeric_types)
+    def test_names_reflect_attributes(self, t):
+        """ Test that names correspond to where the type is under ``np.`` """
+        assert getattr(np, t.__name__) is t
+
+    @pytest.mark.parametrize('t', numeric_types)
+    def test_names_are_undersood_by_dtype(self, t):
+        """ Test the dtype constructor maps names back to the type """
+        assert np.dtype(t.__name__).type is t

venv/Lib/site-packages/numpy/core/tests/test_overrides.py

@@ -0,0 +1,427 @@
+import inspect
+import sys
+from unittest import mock
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_raises_regex)
+from numpy.core.overrides import (
+    _get_implementing_args, array_function_dispatch,
+    verify_matching_signatures, ARRAY_FUNCTION_ENABLED)
+from numpy.compat import pickle
+import pytest
+
+
+requires_array_function = pytest.mark.skipif(
+    not ARRAY_FUNCTION_ENABLED,
+    reason="__array_function__ dispatch not enabled.")
+
+
+def _return_not_implemented(self, *args, **kwargs):
+    return NotImplemented
+
+
+# need to define this at the top level to test pickling
+@array_function_dispatch(lambda array: (array,))
+def dispatched_one_arg(array):
+    """Docstring."""
+    return 'original'
+
+
+@array_function_dispatch(lambda array1, array2: (array1, array2))
+def dispatched_two_arg(array1, array2):
+    """Docstring."""
+    return 'original'
+
+
+class TestGetImplementingArgs:
+
+    def test_ndarray(self):
+        array = np.array(1)
+
+        args = _get_implementing_args([array])
+        assert_equal(list(args), [array])
+
+        args = _get_implementing_args([array, array])
+        assert_equal(list(args), [array])
+
+        args = _get_implementing_args([array, 1])
+        assert_equal(list(args), [array])
+
+        args = _get_implementing_args([1, array])
+        assert_equal(list(args), [array])
+
+    def test_ndarray_subclasses(self):
+
+        class OverrideSub(np.ndarray):
+            __array_function__ = _return_not_implemented
+
+        class NoOverrideSub(np.ndarray):
+            pass
+
+        array = np.array(1).view(np.ndarray)
+        override_sub = np.array(1).view(OverrideSub)
+        no_override_sub = np.array(1).view(NoOverrideSub)
+
+        args = _get_implementing_args([array, override_sub])
+        assert_equal(list(args), [override_sub, array])
+
+        args = _get_implementing_args([array, no_override_sub])
+        assert_equal(list(args), [no_override_sub, array])
+
+        args = _get_implementing_args(
+            [override_sub, no_override_sub])
+        assert_equal(list(args), [override_sub, no_override_sub])
+
+    def test_ndarray_and_duck_array(self):
+
+        class Other:
+            __array_function__ = _return_not_implemented
+
+        array = np.array(1)
+        other = Other()
+
+        args = _get_implementing_args([other, array])
+        assert_equal(list(args), [other, array])
+
+        args = _get_implementing_args([array, other])
+        assert_equal(list(args), [array, other])
+
+    def test_ndarray_subclass_and_duck_array(self):
+
+        class OverrideSub(np.ndarray):
+            __array_function__ = _return_not_implemented
+
+        class Other:
+            __array_function__ = _return_not_implemented
+
+        array = np.array(1)
+        subarray = np.array(1).view(OverrideSub)
+        other = Other()
+
+        assert_equal(_get_implementing_args([array, subarray, other]),
+                     [subarray, array, other])
+        assert_equal(_get_implementing_args([array, other, subarray]),
+                     [subarray, array, other])
+
+    def test_many_duck_arrays(self):
+
+        class A:
+            __array_function__ = _return_not_implemented
+
+        class B(A):
+            __array_function__ = _return_not_implemented
+
+        class C(A):
+            __array_function__ = _return_not_implemented
+
+        class D:
+            __array_function__ = _return_not_implemented
+
+        a = A()
+        b = B()
+        c = C()
+        d = D()
+
+        assert_equal(_get_implementing_args([1]), [])
+        assert_equal(_get_implementing_args([a]), [a])
+        assert_equal(_get_implementing_args([a, 1]), [a])
+        assert_equal(_get_implementing_args([a, a, a]), [a])
+        assert_equal(_get_implementing_args([a, d, a]), [a, d])
+        assert_equal(_get_implementing_args([a, b]), [b, a])
+        assert_equal(_get_implementing_args([b, a]), [b, a])
+        assert_equal(_get_implementing_args([a, b, c]), [b, c, a])
+        assert_equal(_get_implementing_args([a, c, b]), [c, b, a])
+
+    def test_too_many_duck_arrays(self):
+        namespace = dict(__array_function__=_return_not_implemented)
+        types = [type('A' + str(i), (object,), namespace) for i in range(33)]
+        relevant_args = [t() for t in types]
+
+        actual = _get_implementing_args(relevant_args[:32])
+        assert_equal(actual, relevant_args[:32])
+
+        with assert_raises_regex(TypeError, 'distinct argument types'):
+            _get_implementing_args(relevant_args)
+
+
+class TestNDArrayArrayFunction:
+
+    @requires_array_function
+    def test_method(self):
+
+        class Other:
+            __array_function__ = _return_not_implemented
+
+        class NoOverrideSub(np.ndarray):
+            pass
+
+        class OverrideSub(np.ndarray):
+            __array_function__ = _return_not_implemented
+
+        array = np.array([1])
+        other = Other()
+        no_override_sub = array.view(NoOverrideSub)
+        override_sub = array.view(OverrideSub)
+
+        result = array.__array_function__(func=dispatched_two_arg,
+                                          types=(np.ndarray,),
+                                          args=(array, 1.), kwargs={})
+        assert_equal(result, 'original')
+
+        result = array.__array_function__(func=dispatched_two_arg,
+                                          types=(np.ndarray, Other),
+                                          args=(array, other), kwargs={})
+        assert_(result is NotImplemented)
+
+        result = array.__array_function__(func=dispatched_two_arg,
+                                          types=(np.ndarray, NoOverrideSub),
+                                          args=(array, no_override_sub),
+                                          kwargs={})
+        assert_equal(result, 'original')
+
+        result = array.__array_function__(func=dispatched_two_arg,
+                                          types=(np.ndarray, OverrideSub),
+                                          args=(array, override_sub),
+                                          kwargs={})
+        assert_equal(result, 'original')
+
+        with assert_raises_regex(TypeError, 'no implementation found'):
+            np.concatenate((array, other))
+
+        expected = np.concatenate((array, array))
+        result = np.concatenate((array, no_override_sub))
+        assert_equal(result, expected.view(NoOverrideSub))
+        result = np.concatenate((array, override_sub))
+        assert_equal(result, expected.view(OverrideSub))
+
+    def test_no_wrapper(self):
+        # This shouldn't happen unless a user intentionally calls
+        # __array_function__ with invalid arguments, but check that we raise
+        # an appropriate error all the same.
+        array = np.array(1)
+        func = lambda x: x
+        with assert_raises_regex(AttributeError, '_implementation'):
+            array.__array_function__(func=func, types=(np.ndarray,),
+                                     args=(array,), kwargs={})
+
+
+@requires_array_function
+class TestArrayFunctionDispatch:
+
+    def test_pickle(self):
+        for proto in range(2, pickle.HIGHEST_PROTOCOL + 1):
+            roundtripped = pickle.loads(
+                    pickle.dumps(dispatched_one_arg, protocol=proto))
+            assert_(roundtripped is dispatched_one_arg)
+
+    def test_name_and_docstring(self):
+        assert_equal(dispatched_one_arg.__name__, 'dispatched_one_arg')
+        if sys.flags.optimize < 2:
+            assert_equal(dispatched_one_arg.__doc__, 'Docstring.')
+
+    def test_interface(self):
+
+        class MyArray:
+            def __array_function__(self, func, types, args, kwargs):
+                return (self, func, types, args, kwargs)
+
+        original = MyArray()
+        (obj, func, types, args, kwargs) = dispatched_one_arg(original)
+        assert_(obj is original)
+        assert_(func is dispatched_one_arg)
+        assert_equal(set(types), {MyArray})
+        # assert_equal uses the overloaded np.iscomplexobj() internally
+        assert_(args == (original,))
+        assert_equal(kwargs, {})
+
+    def test_not_implemented(self):
+
+        class MyArray:
+            def __array_function__(self, func, types, args, kwargs):
+                return NotImplemented
+
+        array = MyArray()
+        with assert_raises_regex(TypeError, 'no implementation found'):
+            dispatched_one_arg(array)
+
+
+@requires_array_function
+class TestVerifyMatchingSignatures:
+
+    def test_verify_matching_signatures(self):
+
+        verify_matching_signatures(lambda x: 0, lambda x: 0)
+        verify_matching_signatures(lambda x=None: 0, lambda x=None: 0)
+        verify_matching_signatures(lambda x=1: 0, lambda x=None: 0)
+
+        with assert_raises(RuntimeError):
+            verify_matching_signatures(lambda a: 0, lambda b: 0)
+        with assert_raises(RuntimeError):
+            verify_matching_signatures(lambda x: 0, lambda x=None: 0)
+        with assert_raises(RuntimeError):
+            verify_matching_signatures(lambda x=None: 0, lambda y=None: 0)
+        with assert_raises(RuntimeError):
+            verify_matching_signatures(lambda x=1: 0, lambda y=1: 0)
+
+    def test_array_function_dispatch(self):
+
+        with assert_raises(RuntimeError):
+            @array_function_dispatch(lambda x: (x,))
+            def f(y):
+                pass
+
+        # should not raise
+        @array_function_dispatch(lambda x: (x,), verify=False)
+        def f(y):
+            pass
+
+
+def _new_duck_type_and_implements():
+    """Create a duck array type and implements functions."""
+    HANDLED_FUNCTIONS = {}
+
+    class MyArray:
+        def __array_function__(self, func, types, args, kwargs):
+            if func not in HANDLED_FUNCTIONS:
+                return NotImplemented
+            if not all(issubclass(t, MyArray) for t in types):
+                return NotImplemented
+            return HANDLED_FUNCTIONS[func](*args, **kwargs)
+
+    def implements(numpy_function):
+        """Register an __array_function__ implementations."""
+        def decorator(func):
+            HANDLED_FUNCTIONS[numpy_function] = func
+            return func
+        return decorator
+
+    return (MyArray, implements)
+
+
+@requires_array_function
+class TestArrayFunctionImplementation:
+
+    def test_one_arg(self):
+        MyArray, implements = _new_duck_type_and_implements()
+
+        @implements(dispatched_one_arg)
+        def _(array):
+            return 'myarray'
+
+        assert_equal(dispatched_one_arg(1), 'original')
+        assert_equal(dispatched_one_arg(MyArray()), 'myarray')
+
+    def test_optional_args(self):
+        MyArray, implements = _new_duck_type_and_implements()
+
+        @array_function_dispatch(lambda array, option=None: (array,))
+        def func_with_option(array, option='default'):
+            return option
+
+        @implements(func_with_option)
+        def my_array_func_with_option(array, new_option='myarray'):
+            return new_option
+
+        # we don't need to implement every option on __array_function__
+        # implementations
+        assert_equal(func_with_option(1), 'default')
+        assert_equal(func_with_option(1, option='extra'), 'extra')
+        assert_equal(func_with_option(MyArray()), 'myarray')
+        with assert_raises(TypeError):
+            func_with_option(MyArray(), option='extra')
+
+        # but new options on implementations can't be used
+        result = my_array_func_with_option(MyArray(), new_option='yes')
+        assert_equal(result, 'yes')
+        with assert_raises(TypeError):
+            func_with_option(MyArray(), new_option='no')
+
+    def test_not_implemented(self):
+        MyArray, implements = _new_duck_type_and_implements()
+
+        @array_function_dispatch(lambda array: (array,), module='my')
+        def func(array):
+            return array
+
+        array = np.array(1)
+        assert_(func(array) is array)
+        assert_equal(func.__module__, 'my')
+
+        with assert_raises_regex(
+                TypeError, "no implementation found for 'my.func'"):
+            func(MyArray())
+
+
+class TestNDArrayMethods:
+
+    def test_repr(self):
+        # gh-12162: should still be defined even if __array_function__ doesn't
+        # implement np.array_repr()
+
+        class MyArray(np.ndarray):
+            def __array_function__(*args, **kwargs):
+                return NotImplemented
+
+        array = np.array(1).view(MyArray)
+        assert_equal(repr(array), 'MyArray(1)')
+        assert_equal(str(array), '1')
+
+
+class TestNumPyFunctions:
+
+    def test_set_module(self):
+        assert_equal(np.sum.__module__, 'numpy')
+        assert_equal(np.char.equal.__module__, 'numpy.char')
+        assert_equal(np.fft.fft.__module__, 'numpy.fft')
+        assert_equal(np.linalg.solve.__module__, 'numpy.linalg')
+
+    def test_inspect_sum(self):
+        signature = inspect.signature(np.sum)
+        assert_('axis' in signature.parameters)
+
+    @requires_array_function
+    def test_override_sum(self):
+        MyArray, implements = _new_duck_type_and_implements()
+
+        @implements(np.sum)
+        def _(array):
+            return 'yes'
+
+        assert_equal(np.sum(MyArray()), 'yes')
+
+    @requires_array_function
+    def test_sum_on_mock_array(self):
+
+        # We need a proxy for mocks because __array_function__ is only looked
+        # up in the class dict
+        class ArrayProxy:
+            def __init__(self, value):
+                self.value = value
+            def __array_function__(self, *args, **kwargs):
+                return self.value.__array_function__(*args, **kwargs)
+            def __array__(self, *args, **kwargs):
+                return self.value.__array__(*args, **kwargs)
+
+        proxy = ArrayProxy(mock.Mock(spec=ArrayProxy))
+        proxy.value.__array_function__.return_value = 1
+        result = np.sum(proxy)
+        assert_equal(result, 1)
+        proxy.value.__array_function__.assert_called_once_with(
+            np.sum, (ArrayProxy,), (proxy,), {})
+        proxy.value.__array__.assert_not_called()
+
+    @requires_array_function
+    def test_sum_forwarding_implementation(self):
+
+        class MyArray(np.ndarray):
+
+            def sum(self, axis, out):
+                return 'summed'
+
+            def __array_function__(self, func, types, args, kwargs):
+                return super().__array_function__(func, types, args, kwargs)
+
+        # note: the internal implementation of np.sum() calls the .sum() method
+        array = np.array(1).view(MyArray)
+        assert_equal(np.sum(array), 'summed')

venv/Lib/site-packages/numpy/core/tests/test_print.py

@@ -0,0 +1,200 @@
+import sys
+
+import pytest
+
+import numpy as np
+from numpy.testing import assert_, assert_equal
+from numpy.core.tests._locales import CommaDecimalPointLocale
+
+
+from io import StringIO
+
+_REF = {np.inf: 'inf', -np.inf: '-inf', np.nan: 'nan'}
+
+
+@pytest.mark.parametrize('tp', [np.float32, np.double, np.longdouble])
+def test_float_types(tp):
+    """ Check formatting.
+
+        This is only for the str function, and only for simple types.
+        The precision of np.float32 and np.longdouble aren't the same as the
+        python float precision.
+
+    """
+    for x in [0, 1, -1, 1e20]:
+        assert_equal(str(tp(x)), str(float(x)),
+                     err_msg='Failed str formatting for type %s' % tp)
+
+    if tp(1e16).itemsize > 4:
+        assert_equal(str(tp(1e16)), str(float('1e16')),
+                     err_msg='Failed str formatting for type %s' % tp)
+    else:
+        ref = '1e+16'
+        assert_equal(str(tp(1e16)), ref,
+                     err_msg='Failed str formatting for type %s' % tp)
+
+
+@pytest.mark.parametrize('tp', [np.float32, np.double, np.longdouble])
+def test_nan_inf_float(tp):
+    """ Check formatting of nan & inf.
+
+        This is only for the str function, and only for simple types.
+        The precision of np.float32 and np.longdouble aren't the same as the
+        python float precision.
+
+    """
+    for x in [np.inf, -np.inf, np.nan]:
+        assert_equal(str(tp(x)), _REF[x],
+                     err_msg='Failed str formatting for type %s' % tp)
+
+
+@pytest.mark.parametrize('tp', [np.complex64, np.cdouble, np.clongdouble])
+def test_complex_types(tp):
+    """Check formatting of complex types.
+
+        This is only for the str function, and only for simple types.
+        The precision of np.float32 and np.longdouble aren't the same as the
+        python float precision.
+
+    """
+    for x in [0, 1, -1, 1e20]:
+        assert_equal(str(tp(x)), str(complex(x)),
+                     err_msg='Failed str formatting for type %s' % tp)
+        assert_equal(str(tp(x*1j)), str(complex(x*1j)),
+                     err_msg='Failed str formatting for type %s' % tp)
+        assert_equal(str(tp(x + x*1j)), str(complex(x + x*1j)),
+                     err_msg='Failed str formatting for type %s' % tp)
+
+    if tp(1e16).itemsize > 8:
+        assert_equal(str(tp(1e16)), str(complex(1e16)),
+                     err_msg='Failed str formatting for type %s' % tp)
+    else:
+        ref = '(1e+16+0j)'
+        assert_equal(str(tp(1e16)), ref,
+                     err_msg='Failed str formatting for type %s' % tp)
+
+
+@pytest.mark.parametrize('dtype', [np.complex64, np.cdouble, np.clongdouble])
+def test_complex_inf_nan(dtype):
+    """Check inf/nan formatting of complex types."""
+    TESTS = {
+        complex(np.inf, 0): "(inf+0j)",
+        complex(0, np.inf): "infj",
+        complex(-np.inf, 0): "(-inf+0j)",
+        complex(0, -np.inf): "-infj",
+        complex(np.inf, 1): "(inf+1j)",
+        complex(1, np.inf): "(1+infj)",
+        complex(-np.inf, 1): "(-inf+1j)",
+        complex(1, -np.inf): "(1-infj)",
+        complex(np.nan, 0): "(nan+0j)",
+        complex(0, np.nan): "nanj",
+        complex(-np.nan, 0): "(nan+0j)",
+        complex(0, -np.nan): "nanj",
+        complex(np.nan, 1): "(nan+1j)",
+        complex(1, np.nan): "(1+nanj)",
+        complex(-np.nan, 1): "(nan+1j)",
+        complex(1, -np.nan): "(1+nanj)",
+    }
+    for c, s in TESTS.items():
+        assert_equal(str(dtype(c)), s)
+
+
+# print tests
+def _test_redirected_print(x, tp, ref=None):
+    file = StringIO()
+    file_tp = StringIO()
+    stdout = sys.stdout
+    try:
+        sys.stdout = file_tp
+        print(tp(x))
+        sys.stdout = file
+        if ref:
+            print(ref)
+        else:
+            print(x)
+    finally:
+        sys.stdout = stdout
+
+    assert_equal(file.getvalue(), file_tp.getvalue(),
+                 err_msg='print failed for type%s' % tp)
+
+
+@pytest.mark.parametrize('tp', [np.float32, np.double, np.longdouble])
+def test_float_type_print(tp):
+    """Check formatting when using print """
+    for x in [0, 1, -1, 1e20]:
+        _test_redirected_print(float(x), tp)
+
+    for x in [np.inf, -np.inf, np.nan]:
+        _test_redirected_print(float(x), tp, _REF[x])
+
+    if tp(1e16).itemsize > 4:
+        _test_redirected_print(float(1e16), tp)
+    else:
+        ref = '1e+16'
+        _test_redirected_print(float(1e16), tp, ref)
+
+
+@pytest.mark.parametrize('tp', [np.complex64, np.cdouble, np.clongdouble])
+def test_complex_type_print(tp):
+    """Check formatting when using print """
+    # We do not create complex with inf/nan directly because the feature is
+    # missing in python < 2.6
+    for x in [0, 1, -1, 1e20]:
+        _test_redirected_print(complex(x), tp)
+
+    if tp(1e16).itemsize > 8:
+        _test_redirected_print(complex(1e16), tp)
+    else:
+        ref = '(1e+16+0j)'
+        _test_redirected_print(complex(1e16), tp, ref)
+
+    _test_redirected_print(complex(np.inf, 1), tp, '(inf+1j)')
+    _test_redirected_print(complex(-np.inf, 1), tp, '(-inf+1j)')
+    _test_redirected_print(complex(-np.nan, 1), tp, '(nan+1j)')
+
+
+def test_scalar_format():
+    """Test the str.format method with NumPy scalar types"""
+    tests = [('{0}', True, np.bool_),
+            ('{0}', False, np.bool_),
+            ('{0:d}', 130, np.uint8),
+            ('{0:d}', 50000, np.uint16),
+            ('{0:d}', 3000000000, np.uint32),
+            ('{0:d}', 15000000000000000000, np.uint64),
+            ('{0:d}', -120, np.int8),
+            ('{0:d}', -30000, np.int16),
+            ('{0:d}', -2000000000, np.int32),
+            ('{0:d}', -7000000000000000000, np.int64),
+            ('{0:g}', 1.5, np.float16),
+            ('{0:g}', 1.5, np.float32),
+            ('{0:g}', 1.5, np.float64),
+            ('{0:g}', 1.5, np.longdouble),
+            ('{0:g}', 1.5+0.5j, np.complex64),
+            ('{0:g}', 1.5+0.5j, np.complex128),
+            ('{0:g}', 1.5+0.5j, np.clongdouble)]
+
+    for (fmat, val, valtype) in tests:
+        try:
+            assert_equal(fmat.format(val), fmat.format(valtype(val)),
+                    "failed with val %s, type %s" % (val, valtype))
+        except ValueError as e:
+            assert_(False,
+               "format raised exception (fmt='%s', val=%s, type=%s, exc='%s')" %
+                            (fmat, repr(val), repr(valtype), str(e)))
+
+
+#
+# Locale tests: scalar types formatting should be independent of the locale
+#
+
+class TestCommaDecimalPointLocale(CommaDecimalPointLocale):
+
+    def test_locale_single(self):
+        assert_equal(str(np.float32(1.2)), str(float(1.2)))
+
+    def test_locale_double(self):
+        assert_equal(str(np.double(1.2)), str(float(1.2)))
+
+    def test_locale_longdouble(self):
+        assert_equal(str(np.longdouble('1.2')), str(float(1.2)))

venv/Lib/site-packages/numpy/core/tests/test_protocols.py

@@ -0,0 +1,44 @@
+import pytest
+import warnings
+import numpy as np
+
+
+@pytest.mark.filterwarnings("error")
+def test_getattr_warning():
+    # issue gh-14735: make sure we clear only getattr errors, and let warnings
+    # through
+    class Wrapper:
+        def __init__(self, array):
+            self.array = array
+
+        def __len__(self):
+            return len(self.array)
+
+        def __getitem__(self, item):
+            return type(self)(self.array[item])
+
+        def __getattr__(self, name):
+            if name.startswith("__array_"):
+                warnings.warn("object got converted", UserWarning, stacklevel=1)
+
+            return getattr(self.array, name)
+
+        def __repr__(self):
+            return "<Wrapper({self.array})>".format(self=self)
+
+    array = Wrapper(np.arange(10))
+    with pytest.raises(UserWarning, match="object got converted"):
+        np.asarray(array)
+
+
+def test_array_called():
+    class Wrapper:
+        val = '0' * 100
+        def __array__(self, result=None):
+            return np.array([self.val], dtype=object)
+
+
+    wrapped = Wrapper()
+    arr = np.array(wrapped, dtype=str)
+    assert arr.dtype == 'U100'
+    assert arr[0] == Wrapper.val

venv/Lib/site-packages/numpy/core/tests/test_records.py

@@ -0,0 +1,504 @@
+import collections.abc
+import textwrap
+from os import path
+from pathlib import Path
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_array_equal, assert_array_almost_equal,
+    assert_raises, temppath,
+    )
+from numpy.compat import pickle
+
+
+class TestFromrecords:
+    def test_fromrecords(self):
+        r = np.rec.fromrecords([[456, 'dbe', 1.2], [2, 'de', 1.3]],
+                            names='col1,col2,col3')
+        assert_equal(r[0].item(), (456, 'dbe', 1.2))
+        assert_equal(r['col1'].dtype.kind, 'i')
+        assert_equal(r['col2'].dtype.kind, 'U')
+        assert_equal(r['col2'].dtype.itemsize, 12)
+        assert_equal(r['col3'].dtype.kind, 'f')
+
+    def test_fromrecords_0len(self):
+        """ Verify fromrecords works with a 0-length input """
+        dtype = [('a', float), ('b', float)]
+        r = np.rec.fromrecords([], dtype=dtype)
+        assert_equal(r.shape, (0,))
+
+    def test_fromrecords_2d(self):
+        data = [
+            [(1, 2), (3, 4), (5, 6)],
+            [(6, 5), (4, 3), (2, 1)]
+        ]
+        expected_a = [[1, 3, 5], [6, 4, 2]]
+        expected_b = [[2, 4, 6], [5, 3, 1]]
+
+        # try with dtype
+        r1 = np.rec.fromrecords(data, dtype=[('a', int), ('b', int)])
+        assert_equal(r1['a'], expected_a)
+        assert_equal(r1['b'], expected_b)
+
+        # try with names
+        r2 = np.rec.fromrecords(data, names=['a', 'b'])
+        assert_equal(r2['a'], expected_a)
+        assert_equal(r2['b'], expected_b)
+
+        assert_equal(r1, r2)
+
+    def test_method_array(self):
+        r = np.rec.array(b'abcdefg' * 100, formats='i2,a3,i4', shape=3, byteorder='big')
+        assert_equal(r[1].item(), (25444, b'efg', 1633837924))
+
+    def test_method_array2(self):
+        r = np.rec.array([(1, 11, 'a'), (2, 22, 'b'), (3, 33, 'c'), (4, 44, 'd'), (5, 55, 'ex'),
+                     (6, 66, 'f'), (7, 77, 'g')], formats='u1,f4,a1')
+        assert_equal(r[1].item(), (2, 22.0, b'b'))
+
+    def test_recarray_slices(self):
+        r = np.rec.array([(1, 11, 'a'), (2, 22, 'b'), (3, 33, 'c'), (4, 44, 'd'), (5, 55, 'ex'),
+                     (6, 66, 'f'), (7, 77, 'g')], formats='u1,f4,a1')
+        assert_equal(r[1::2][1].item(), (4, 44.0, b'd'))
+
+    def test_recarray_fromarrays(self):
+        x1 = np.array([1, 2, 3, 4])
+        x2 = np.array(['a', 'dd', 'xyz', '12'])
+        x3 = np.array([1.1, 2, 3, 4])
+        r = np.rec.fromarrays([x1, x2, x3], names='a,b,c')
+        assert_equal(r[1].item(), (2, 'dd', 2.0))
+        x1[1] = 34
+        assert_equal(r.a, np.array([1, 2, 3, 4]))
+
+    def test_recarray_fromfile(self):
+        data_dir = path.join(path.dirname(__file__), 'data')
+        filename = path.join(data_dir, 'recarray_from_file.fits')
+        fd = open(filename, 'rb')
+        fd.seek(2880 * 2)
+        r1 = np.rec.fromfile(fd, formats='f8,i4,a5', shape=3, byteorder='big')
+        fd.seek(2880 * 2)
+        r2 = np.rec.array(fd, formats='f8,i4,a5', shape=3, byteorder='big')
+        fd.close()
+        assert_equal(r1, r2)
+
+    def test_recarray_from_obj(self):
+        count = 10
+        a = np.zeros(count, dtype='O')
+        b = np.zeros(count, dtype='f8')
+        c = np.zeros(count, dtype='f8')
+        for i in range(len(a)):
+            a[i] = list(range(1, 10))
+
+        mine = np.rec.fromarrays([a, b, c], names='date,data1,data2')
+        for i in range(len(a)):
+            assert_((mine.date[i] == list(range(1, 10))))
+            assert_((mine.data1[i] == 0.0))
+            assert_((mine.data2[i] == 0.0))
+
+    def test_recarray_repr(self):
+        a = np.array([(1, 0.1), (2, 0.2)],
+                     dtype=[('foo', '<i4'), ('bar', '<f8')])
+        a = np.rec.array(a)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            rec.array([(1, 0.1), (2, 0.2)],
+                      dtype=[('foo', '<i4'), ('bar', '<f8')])""")
+        )
+
+        # make sure non-structured dtypes also show up as rec.array
+        a = np.array(np.ones(4, dtype='f8'))
+        assert_(repr(np.rec.array(a)).startswith('rec.array'))
+
+        # check that the 'np.record' part of the dtype isn't shown
+        a = np.rec.array(np.ones(3, dtype='i4,i4'))
+        assert_equal(repr(a).find('numpy.record'), -1)
+        a = np.rec.array(np.ones(3, dtype='i4'))
+        assert_(repr(a).find('dtype=int32') != -1)
+
+    def test_0d_recarray_repr(self):
+        arr_0d = np.rec.array((1, 2.0, '2003'), dtype='<i4,<f8,<M8[Y]')
+        assert_equal(repr(arr_0d), textwrap.dedent("""\
+            rec.array((1, 2., '2003'),
+                      dtype=[('f0', '<i4'), ('f1', '<f8'), ('f2', '<M8[Y]')])"""))
+
+        record = arr_0d[()]
+        assert_equal(repr(record), "(1, 2., '2003')")
+        # 1.13 converted to python scalars before the repr
+        try:
+            np.set_printoptions(legacy='1.13')
+            assert_equal(repr(record), '(1, 2.0, datetime.date(2003, 1, 1))')
+        finally:
+            np.set_printoptions(legacy=False)
+
+    def test_recarray_from_repr(self):
+        a = np.array([(1,'ABC'), (2, "DEF")],
+                     dtype=[('foo', int), ('bar', 'S4')])
+        recordarr = np.rec.array(a)
+        recarr = a.view(np.recarray)
+        recordview = a.view(np.dtype((np.record, a.dtype)))
+
+        recordarr_r = eval("numpy." + repr(recordarr), {'numpy': np})
+        recarr_r = eval("numpy." + repr(recarr), {'numpy': np})
+        recordview_r = eval("numpy." + repr(recordview), {'numpy': np})
+
+        assert_equal(type(recordarr_r), np.recarray)
+        assert_equal(recordarr_r.dtype.type, np.record)
+        assert_equal(recordarr, recordarr_r)
+
+        assert_equal(type(recarr_r), np.recarray)
+        assert_equal(recarr_r.dtype.type, np.record)
+        assert_equal(recarr, recarr_r)
+
+        assert_equal(type(recordview_r), np.ndarray)
+        assert_equal(recordview.dtype.type, np.record)
+        assert_equal(recordview, recordview_r)
+
+    def test_recarray_views(self):
+        a = np.array([(1,'ABC'), (2, "DEF")],
+                     dtype=[('foo', int), ('bar', 'S4')])
+        b = np.array([1,2,3,4,5], dtype=np.int64)
+
+        #check that np.rec.array gives right dtypes
+        assert_equal(np.rec.array(a).dtype.type, np.record)
+        assert_equal(type(np.rec.array(a)), np.recarray)
+        assert_equal(np.rec.array(b).dtype.type, np.int64)
+        assert_equal(type(np.rec.array(b)), np.recarray)
+
+        #check that viewing as recarray does the same
+        assert_equal(a.view(np.recarray).dtype.type, np.record)
+        assert_equal(type(a.view(np.recarray)), np.recarray)
+        assert_equal(b.view(np.recarray).dtype.type, np.int64)
+        assert_equal(type(b.view(np.recarray)), np.recarray)
+
+        #check that view to non-structured dtype preserves type=np.recarray
+        r = np.rec.array(np.ones(4, dtype="f4,i4"))
+        rv = r.view('f8').view('f4,i4')
+        assert_equal(type(rv), np.recarray)
+        assert_equal(rv.dtype.type, np.record)
+
+        #check that getitem also preserves np.recarray and np.record
+        r = np.rec.array(np.ones(4, dtype=[('a', 'i4'), ('b', 'i4'),
+                                           ('c', 'i4,i4')]))
+        assert_equal(r['c'].dtype.type, np.record)
+        assert_equal(type(r['c']), np.recarray)
+
+        #and that it preserves subclasses (gh-6949)
+        class C(np.recarray):
+            pass
+
+        c = r.view(C)
+        assert_equal(type(c['c']), C)
+
+        # check that accessing nested structures keep record type, but
+        # not for subarrays, non-void structures, non-structured voids
+        test_dtype = [('a', 'f4,f4'), ('b', 'V8'), ('c', ('f4',2)),
+                      ('d', ('i8', 'i4,i4'))]
+        r = np.rec.array([((1,1), b'11111111', [1,1], 1),
+                          ((1,1), b'11111111', [1,1], 1)], dtype=test_dtype)
+        assert_equal(r.a.dtype.type, np.record)
+        assert_equal(r.b.dtype.type, np.void)
+        assert_equal(r.c.dtype.type, np.float32)
+        assert_equal(r.d.dtype.type, np.int64)
+        # check the same, but for views
+        r = np.rec.array(np.ones(4, dtype='i4,i4'))
+        assert_equal(r.view('f4,f4').dtype.type, np.record)
+        assert_equal(r.view(('i4',2)).dtype.type, np.int32)
+        assert_equal(r.view('V8').dtype.type, np.void)
+        assert_equal(r.view(('i8', 'i4,i4')).dtype.type, np.int64)
+
+        #check that we can undo the view
+        arrs = [np.ones(4, dtype='f4,i4'), np.ones(4, dtype='f8')]
+        for arr in arrs:
+            rec = np.rec.array(arr)
+            # recommended way to view as an ndarray:
+            arr2 = rec.view(rec.dtype.fields or rec.dtype, np.ndarray)
+            assert_equal(arr2.dtype.type, arr.dtype.type)
+            assert_equal(type(arr2), type(arr))
+
+    def test_recarray_from_names(self):
+        ra = np.rec.array([
+            (1, 'abc', 3.7000002861022949, 0),
+            (2, 'xy', 6.6999998092651367, 1),
+            (0, ' ', 0.40000000596046448, 0)],
+                       names='c1, c2, c3, c4')
+        pa = np.rec.fromrecords([
+            (1, 'abc', 3.7000002861022949, 0),
+            (2, 'xy', 6.6999998092651367, 1),
+            (0, ' ', 0.40000000596046448, 0)],
+                       names='c1, c2, c3, c4')
+        assert_(ra.dtype == pa.dtype)
+        assert_(ra.shape == pa.shape)
+        for k in range(len(ra)):
+            assert_(ra[k].item() == pa[k].item())
+
+    def test_recarray_conflict_fields(self):
+        ra = np.rec.array([(1, 'abc', 2.3), (2, 'xyz', 4.2),
+                        (3, 'wrs', 1.3)],
+                       names='field, shape, mean')
+        ra.mean = [1.1, 2.2, 3.3]
+        assert_array_almost_equal(ra['mean'], [1.1, 2.2, 3.3])
+        assert_(type(ra.mean) is type(ra.var))
+        ra.shape = (1, 3)
+        assert_(ra.shape == (1, 3))
+        ra.shape = ['A', 'B', 'C']
+        assert_array_equal(ra['shape'], [['A', 'B', 'C']])
+        ra.field = 5
+        assert_array_equal(ra['field'], [[5, 5, 5]])
+        assert_(isinstance(ra.field, collections.abc.Callable))
+
+    def test_fromrecords_with_explicit_dtype(self):
+        a = np.rec.fromrecords([(1, 'a'), (2, 'bbb')],
+                                dtype=[('a', int), ('b', object)])
+        assert_equal(a.a, [1, 2])
+        assert_equal(a[0].a, 1)
+        assert_equal(a.b, ['a', 'bbb'])
+        assert_equal(a[-1].b, 'bbb')
+        #
+        ndtype = np.dtype([('a', int), ('b', object)])
+        a = np.rec.fromrecords([(1, 'a'), (2, 'bbb')], dtype=ndtype)
+        assert_equal(a.a, [1, 2])
+        assert_equal(a[0].a, 1)
+        assert_equal(a.b, ['a', 'bbb'])
+        assert_equal(a[-1].b, 'bbb')
+
+    def test_recarray_stringtypes(self):
+        # Issue #3993
+        a = np.array([('abc ', 1), ('abc', 2)],
+                     dtype=[('foo', 'S4'), ('bar', int)])
+        a = a.view(np.recarray)
+        assert_equal(a.foo[0] == a.foo[1], False)
+
+    def test_recarray_returntypes(self):
+        qux_fields = {'C': (np.dtype('S5'), 0), 'D': (np.dtype('S5'), 6)}
+        a = np.rec.array([('abc ', (1,1), 1, ('abcde', 'fgehi')),
+                          ('abc', (2,3), 1, ('abcde', 'jklmn'))],
+                         dtype=[('foo', 'S4'),
+                                ('bar', [('A', int), ('B', int)]),
+                                ('baz', int), ('qux', qux_fields)])
+        assert_equal(type(a.foo), np.ndarray)
+        assert_equal(type(a['foo']), np.ndarray)
+        assert_equal(type(a.bar), np.recarray)
+        assert_equal(type(a['bar']), np.recarray)
+        assert_equal(a.bar.dtype.type, np.record)
+        assert_equal(type(a['qux']), np.recarray)
+        assert_equal(a.qux.dtype.type, np.record)
+        assert_equal(dict(a.qux.dtype.fields), qux_fields)
+        assert_equal(type(a.baz), np.ndarray)
+        assert_equal(type(a['baz']), np.ndarray)
+        assert_equal(type(a[0].bar), np.record)
+        assert_equal(type(a[0]['bar']), np.record)
+        assert_equal(a[0].bar.A, 1)
+        assert_equal(a[0].bar['A'], 1)
+        assert_equal(a[0]['bar'].A, 1)
+        assert_equal(a[0]['bar']['A'], 1)
+        assert_equal(a[0].qux.D, b'fgehi')
+        assert_equal(a[0].qux['D'], b'fgehi')
+        assert_equal(a[0]['qux'].D, b'fgehi')
+        assert_equal(a[0]['qux']['D'], b'fgehi')
+
+    def test_zero_width_strings(self):
+        # Test for #6430, based on the test case from #1901
+
+        cols = [['test'] * 3, [''] * 3]
+        rec = np.rec.fromarrays(cols)
+        assert_equal(rec['f0'], ['test', 'test', 'test'])
+        assert_equal(rec['f1'], ['', '', ''])
+
+        dt = np.dtype([('f0', '|S4'), ('f1', '|S')])
+        rec = np.rec.fromarrays(cols, dtype=dt)
+        assert_equal(rec.itemsize, 4)
+        assert_equal(rec['f0'], [b'test', b'test', b'test'])
+        assert_equal(rec['f1'], [b'', b'', b''])
+
+
+class TestPathUsage:
+    # Test that pathlib.Path can be used
+    def test_tofile_fromfile(self):
+        with temppath(suffix='.bin') as path:
+            path = Path(path)
+            np.random.seed(123)
+            a = np.random.rand(10).astype('f8,i4,a5')
+            a[5] = (0.5,10,'abcde')
+            with path.open("wb") as fd:
+                a.tofile(fd)
+            x = np.core.records.fromfile(path,
+                                         formats='f8,i4,a5',
+                                         shape=10)
+            assert_array_equal(x, a)
+
+
+class TestRecord:
+    def setup(self):
+        self.data = np.rec.fromrecords([(1, 2, 3), (4, 5, 6)],
+                            dtype=[("col1", "<i4"),
+                                   ("col2", "<i4"),
+                                   ("col3", "<i4")])
+
+    def test_assignment1(self):
+        a = self.data
+        assert_equal(a.col1[0], 1)
+        a[0].col1 = 0
+        assert_equal(a.col1[0], 0)
+
+    def test_assignment2(self):
+        a = self.data
+        assert_equal(a.col1[0], 1)
+        a.col1[0] = 0
+        assert_equal(a.col1[0], 0)
+
+    def test_invalid_assignment(self):
+        a = self.data
+
+        def assign_invalid_column(x):
+            x[0].col5 = 1
+
+        assert_raises(AttributeError, assign_invalid_column, a)
+
+    def test_nonwriteable_setfield(self):
+        # gh-8171
+        r = np.rec.array([(0,), (1,)], dtype=[('f', 'i4')])
+        r.flags.writeable = False
+        with assert_raises(ValueError):
+            r.f = [2, 3]
+        with assert_raises(ValueError):
+            r.setfield([2,3], *r.dtype.fields['f'])
+
+    def test_out_of_order_fields(self):
+        # names in the same order, padding added to descr
+        x = self.data[['col1', 'col2']]
+        assert_equal(x.dtype.names, ('col1', 'col2'))
+        assert_equal(x.dtype.descr,
+                     [('col1', '<i4'), ('col2', '<i4'), ('', '|V4')])
+
+        # names change order to match indexing, as of 1.14 - descr can't
+        # represent that
+        y = self.data[['col2', 'col1']]
+        assert_equal(y.dtype.names, ('col2', 'col1'))
+        assert_raises(ValueError, lambda: y.dtype.descr)
+
+    def test_pickle_1(self):
+        # Issue #1529
+        a = np.array([(1, [])], dtype=[('a', np.int32), ('b', np.int32, 0)])
+        for proto in range(2, pickle.HIGHEST_PROTOCOL + 1):
+            assert_equal(a, pickle.loads(pickle.dumps(a, protocol=proto)))
+            assert_equal(a[0], pickle.loads(pickle.dumps(a[0],
+                                                         protocol=proto)))
+
+    def test_pickle_2(self):
+        a = self.data
+        for proto in range(2, pickle.HIGHEST_PROTOCOL + 1):
+            assert_equal(a, pickle.loads(pickle.dumps(a, protocol=proto)))
+            assert_equal(a[0], pickle.loads(pickle.dumps(a[0],
+                                                         protocol=proto)))
+
+    def test_pickle_3(self):
+        # Issue #7140
+        a = self.data
+        for proto in range(2, pickle.HIGHEST_PROTOCOL + 1):
+            pa = pickle.loads(pickle.dumps(a[0], protocol=proto))
+            assert_(pa.flags.c_contiguous)
+            assert_(pa.flags.f_contiguous)
+            assert_(pa.flags.writeable)
+            assert_(pa.flags.aligned)
+
+    def test_pickle_void(self):
+        # issue gh-13593
+        dt = np.dtype([('obj', 'O'), ('int', 'i')])
+        a = np.empty(1, dtype=dt)
+        data = (bytearray(b'eman'),)
+        a['obj'] = data
+        a['int'] = 42
+        ctor, args = a[0].__reduce__()
+        # check the constructor is what we expect before interpreting the arguments
+        assert ctor is np.core.multiarray.scalar
+        dtype, obj = args
+        # make sure we did not pickle the address
+        assert not isinstance(obj, bytes)
+
+        assert_raises(TypeError, ctor, dtype, 13)
+
+    def test_objview_record(self):
+        # https://github.com/numpy/numpy/issues/2599
+        dt = np.dtype([('foo', 'i8'), ('bar', 'O')])
+        r = np.zeros((1,3), dtype=dt).view(np.recarray)
+        r.foo = np.array([1, 2, 3])  # TypeError?
+
+        # https://github.com/numpy/numpy/issues/3256
+        ra = np.recarray((2,), dtype=[('x', object), ('y', float), ('z', int)])
+        ra[['x','y']]  # TypeError?
+
+    def test_record_scalar_setitem(self):
+        # https://github.com/numpy/numpy/issues/3561
+        rec = np.recarray(1, dtype=[('x', float, 5)])
+        rec[0].x = 1
+        assert_equal(rec[0].x, np.ones(5))
+
+    def test_missing_field(self):
+        # https://github.com/numpy/numpy/issues/4806
+        arr = np.zeros((3,), dtype=[('x', int), ('y', int)])
+        assert_raises(KeyError, lambda: arr[['nofield']])
+
+    def test_fromarrays_nested_structured_arrays(self):
+        arrays = [
+            np.arange(10),
+            np.ones(10, dtype=[('a', '<u2'), ('b', '<f4')]),
+        ]
+        arr = np.rec.fromarrays(arrays)  # ValueError?
+
+    @pytest.mark.parametrize('nfields', [0, 1, 2])
+    def test_assign_dtype_attribute(self, nfields):
+        dt = np.dtype([('a', np.uint8), ('b', np.uint8), ('c', np.uint8)][:nfields])
+        data = np.zeros(3, dt).view(np.recarray)
+
+        # the original and resulting dtypes differ on whether they are records
+        assert data.dtype.type == np.record
+        assert dt.type != np.record
+
+        # ensure that the dtype remains a record even when assigned
+        data.dtype = dt
+        assert data.dtype.type == np.record
+
+    @pytest.mark.parametrize('nfields', [0, 1, 2])
+    def test_nested_fields_are_records(self, nfields):
+        """ Test that nested structured types are treated as records too """
+        dt = np.dtype([('a', np.uint8), ('b', np.uint8), ('c', np.uint8)][:nfields])
+        dt_outer = np.dtype([('inner', dt)])
+
+        data = np.zeros(3, dt_outer).view(np.recarray)
+        assert isinstance(data, np.recarray)
+        assert isinstance(data['inner'], np.recarray)
+
+        data0 = data[0]
+        assert isinstance(data0, np.record)
+        assert isinstance(data0['inner'], np.record)
+
+    def test_nested_dtype_padding(self):
+        """ test that trailing padding is preserved """
+        # construct a dtype with padding at the end
+        dt = np.dtype([('a', np.uint8), ('b', np.uint8), ('c', np.uint8)])
+        dt_padded_end = dt[['a', 'b']]
+        assert dt_padded_end.itemsize == dt.itemsize
+
+        dt_outer = np.dtype([('inner', dt_padded_end)])
+
+        data = np.zeros(3, dt_outer).view(np.recarray)
+        assert_equal(data['inner'].dtype, dt_padded_end)
+
+        data0 = data[0]
+        assert_equal(data0['inner'].dtype, dt_padded_end)
+
+
+def test_find_duplicate():
+    l1 = [1, 2, 3, 4, 5, 6]
+    assert_(np.rec.find_duplicate(l1) == [])
+
+    l2 = [1, 2, 1, 4, 5, 6]
+    assert_(np.rec.find_duplicate(l2) == [1])
+
+    l3 = [1, 2, 1, 4, 1, 6, 2, 3]
+    assert_(np.rec.find_duplicate(l3) == [1, 2])
+
+    l3 = [2, 2, 1, 4, 1, 6, 2, 3]
+    assert_(np.rec.find_duplicate(l3) == [2, 1])

venv/Lib/site-packages/numpy/core/tests/test_scalar_ctors.py

@@ -0,0 +1,81 @@
+"""
+Test the scalar constructors, which also do type-coercion
+"""
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_equal, assert_almost_equal, assert_warns,
+    )
+
+class TestFromString:
+    def test_floating(self):
+        # Ticket #640, floats from string
+        fsingle = np.single('1.234')
+        fdouble = np.double('1.234')
+        flongdouble = np.longdouble('1.234')
+        assert_almost_equal(fsingle, 1.234)
+        assert_almost_equal(fdouble, 1.234)
+        assert_almost_equal(flongdouble, 1.234)
+
+    def test_floating_overflow(self):
+        """ Strings containing an unrepresentable float overflow """
+        fhalf = np.half('1e10000')
+        assert_equal(fhalf, np.inf)
+        fsingle = np.single('1e10000')
+        assert_equal(fsingle, np.inf)
+        fdouble = np.double('1e10000')
+        assert_equal(fdouble, np.inf)
+        flongdouble = assert_warns(RuntimeWarning, np.longdouble, '1e10000')
+        assert_equal(flongdouble, np.inf)
+
+        fhalf = np.half('-1e10000')
+        assert_equal(fhalf, -np.inf)
+        fsingle = np.single('-1e10000')
+        assert_equal(fsingle, -np.inf)
+        fdouble = np.double('-1e10000')
+        assert_equal(fdouble, -np.inf)
+        flongdouble = assert_warns(RuntimeWarning, np.longdouble, '-1e10000')
+        assert_equal(flongdouble, -np.inf)
+
+
+class TestExtraArgs:
+    def test_superclass(self):
+        # try both positional and keyword arguments
+        s = np.str_(b'\\x61', encoding='unicode-escape')
+        assert s == 'a'
+        s = np.str_(b'\\x61', 'unicode-escape')
+        assert s == 'a'
+
+        # previously this would return '\\xx'
+        with pytest.raises(UnicodeDecodeError):
+            np.str_(b'\\xx', encoding='unicode-escape')
+        with pytest.raises(UnicodeDecodeError):
+            np.str_(b'\\xx', 'unicode-escape')
+
+        # superclass fails, but numpy succeeds
+        assert np.bytes_(-2) == b'-2'
+
+    def test_datetime(self):
+        dt = np.datetime64('2000-01', ('M', 2))
+        assert np.datetime_data(dt) == ('M', 2)
+
+        with pytest.raises(TypeError):
+            np.datetime64('2000', garbage=True)
+
+    def test_bool(self):
+        with pytest.raises(TypeError):
+            np.bool(False, garbage=True)
+
+    def test_void(self):
+        with pytest.raises(TypeError):
+            np.void(b'test', garbage=True)
+
+
+class TestFromInt:
+    def test_intp(self):
+        # Ticket #99
+        assert_equal(1024, np.intp(1024))
+
+    def test_uint64_from_negative(self):
+        assert_equal(np.uint64(-2), np.uint64(18446744073709551614))

venv/Lib/site-packages/numpy/core/tests/test_scalar_methods.py

@@ -0,0 +1,103 @@
+"""
+Test the scalar constructors, which also do type-coercion
+"""
+import fractions
+import platform
+
+import pytest
+import numpy as np
+
+from numpy.testing import assert_equal, assert_raises
+
+
+class TestAsIntegerRatio:
+    # derived in part from the cpython test "test_floatasratio"
+
+    @pytest.mark.parametrize("ftype", [
+        np.half, np.single, np.double, np.longdouble])
+    @pytest.mark.parametrize("f, ratio", [
+        (0.875, (7, 8)),
+        (-0.875, (-7, 8)),
+        (0.0, (0, 1)),
+        (11.5, (23, 2)),
+        ])
+    def test_small(self, ftype, f, ratio):
+        assert_equal(ftype(f).as_integer_ratio(), ratio)
+
+    @pytest.mark.parametrize("ftype", [
+        np.half, np.single, np.double, np.longdouble])
+    def test_simple_fractions(self, ftype):
+        R = fractions.Fraction
+        assert_equal(R(0, 1),
+                     R(*ftype(0.0).as_integer_ratio()))
+        assert_equal(R(5, 2),
+                     R(*ftype(2.5).as_integer_ratio()))
+        assert_equal(R(1, 2),
+                     R(*ftype(0.5).as_integer_ratio()))
+        assert_equal(R(-2100, 1),
+                     R(*ftype(-2100.0).as_integer_ratio()))
+
+    @pytest.mark.parametrize("ftype", [
+        np.half, np.single, np.double, np.longdouble])
+    def test_errors(self, ftype):
+        assert_raises(OverflowError, ftype('inf').as_integer_ratio)
+        assert_raises(OverflowError, ftype('-inf').as_integer_ratio)
+        assert_raises(ValueError, ftype('nan').as_integer_ratio)
+
+    def test_against_known_values(self):
+        R = fractions.Fraction
+        assert_equal(R(1075, 512),
+                     R(*np.half(2.1).as_integer_ratio()))
+        assert_equal(R(-1075, 512),
+                     R(*np.half(-2.1).as_integer_ratio()))
+        assert_equal(R(4404019, 2097152),
+                     R(*np.single(2.1).as_integer_ratio()))
+        assert_equal(R(-4404019, 2097152),
+                     R(*np.single(-2.1).as_integer_ratio()))
+        assert_equal(R(4728779608739021, 2251799813685248),
+                     R(*np.double(2.1).as_integer_ratio()))
+        assert_equal(R(-4728779608739021, 2251799813685248),
+                     R(*np.double(-2.1).as_integer_ratio()))
+        # longdouble is platform dependent
+
+    @pytest.mark.parametrize("ftype, frac_vals, exp_vals", [
+        # dtype test cases generated using hypothesis
+        # first five generated cases per dtype
+        (np.half, [0.0, 0.01154830649280303, 0.31082276347447274,
+                   0.527350517124794, 0.8308562335072596],
+                  [0, 1, 0, -8, 12]),
+        (np.single, [0.0, 0.09248576989263226, 0.8160498218131407,
+                     0.17389442853722373, 0.7956044195067877],
+                    [0, 12, 10, 17, -26]),
+        (np.double, [0.0, 0.031066908499895136, 0.5214135908877832,
+                     0.45780736035689296, 0.5906586745934036],
+                    [0, -801, 51, 194, -653]),
+        pytest.param(
+            np.longdouble,
+            [0.0, 0.20492557202724854, 0.4277180662199366, 0.9888085019891495,
+             0.9620175814461964],
+            [0, -7400, 14266, -7822, -8721],
+            marks=[
+                pytest.mark.skipif(
+                    np.finfo(np.double) == np.finfo(np.longdouble),
+                    reason="long double is same as double"),
+                pytest.mark.skipif(
+                    platform.machine().startswith("ppc"),
+                    reason="IBM double double"),
+            ]
+        )
+    ])
+    def test_roundtrip(self, ftype, frac_vals, exp_vals):
+        for frac, exp in zip(frac_vals, exp_vals):
+            f = np.ldexp(frac, exp, dtype=ftype)
+            n, d = f.as_integer_ratio()
+
+            try:
+                # workaround for gh-9968
+                nf = np.longdouble(str(n))
+                df = np.longdouble(str(d))
+            except (OverflowError, RuntimeWarning):
+                # the values may not fit in any float type
+                pytest.skip("longdouble too small on this platform")
+
+            assert_equal(nf / df, f, "{}/{}".format(n, d))

venv/Lib/site-packages/numpy/core/tests/test_scalarbuffer.py

@@ -0,0 +1,119 @@
+"""
+Test scalar buffer interface adheres to PEP 3118
+"""
+import numpy as np
+import pytest
+
+from numpy.testing import assert_, assert_equal, assert_raises
+
+# PEP3118 format strings for native (standard alignment and byteorder) types
+scalars_and_codes = [
+    (np.bool_, '?'),
+    (np.byte, 'b'),
+    (np.short, 'h'),
+    (np.intc, 'i'),
+    (np.int_, 'l'),
+    (np.longlong, 'q'),
+    (np.ubyte, 'B'),
+    (np.ushort, 'H'),
+    (np.uintc, 'I'),
+    (np.uint, 'L'),
+    (np.ulonglong, 'Q'),
+    (np.half, 'e'),
+    (np.single, 'f'),
+    (np.double, 'd'),
+    (np.longdouble, 'g'),
+    (np.csingle, 'Zf'),
+    (np.cdouble, 'Zd'),
+    (np.clongdouble, 'Zg'),
+]
+scalars_only, codes_only = zip(*scalars_and_codes)
+
+
+class TestScalarPEP3118:
+
+    @pytest.mark.parametrize('scalar', scalars_only, ids=codes_only)
+    def test_scalar_match_array(self, scalar):
+        x = scalar()
+        a = np.array([], dtype=np.dtype(scalar))
+        mv_x = memoryview(x)
+        mv_a = memoryview(a)
+        assert_equal(mv_x.format, mv_a.format)
+
+    @pytest.mark.parametrize('scalar', scalars_only, ids=codes_only)
+    def test_scalar_dim(self, scalar):
+        x = scalar()
+        mv_x = memoryview(x)
+        assert_equal(mv_x.itemsize, np.dtype(scalar).itemsize)
+        assert_equal(mv_x.ndim, 0)
+        assert_equal(mv_x.shape, ())
+        assert_equal(mv_x.strides, ())
+        assert_equal(mv_x.suboffsets, ())
+
+    @pytest.mark.parametrize('scalar, code', scalars_and_codes, ids=codes_only)
+    def test_scalar_known_code(self, scalar, code):
+        x = scalar()
+        mv_x = memoryview(x)
+        assert_equal(mv_x.format, code)
+
+    def test_void_scalar_structured_data(self):
+        dt = np.dtype([('name', np.unicode_, 16), ('grades', np.float64, (2,))])
+        x = np.array(('ndarray_scalar', (1.2, 3.0)), dtype=dt)[()]
+        assert_(isinstance(x, np.void))
+        mv_x = memoryview(x)
+        expected_size = 16 * np.dtype((np.unicode_, 1)).itemsize
+        expected_size += 2 * np.dtype(np.float64).itemsize
+        assert_equal(mv_x.itemsize, expected_size)
+        assert_equal(mv_x.ndim, 0)
+        assert_equal(mv_x.shape, ())
+        assert_equal(mv_x.strides, ())
+        assert_equal(mv_x.suboffsets, ())
+
+        # check scalar format string against ndarray format string
+        a = np.array([('Sarah', (8.0, 7.0)), ('John', (6.0, 7.0))], dtype=dt)
+        assert_(isinstance(a, np.ndarray))
+        mv_a = memoryview(a)
+        assert_equal(mv_x.itemsize, mv_a.itemsize)
+        assert_equal(mv_x.format, mv_a.format)
+
+    def _as_dict(self, m):
+        return dict(strides=m.strides, shape=m.shape, itemsize=m.itemsize,
+                    ndim=m.ndim, format=m.format)
+
+    def test_datetime_memoryview(self):
+        # gh-11656
+        # Values verified with v1.13.3, shape is not () as in test_scalar_dim
+
+        dt1 = np.datetime64('2016-01-01')
+        dt2 = np.datetime64('2017-01-01')
+        expected = dict(strides=(1,), itemsize=1, ndim=1, shape=(8,),
+                        format='B')
+        v = memoryview(dt1)
+        assert self._as_dict(v) == expected
+
+        v = memoryview(dt2 - dt1)
+        assert self._as_dict(v) == expected
+
+        dt = np.dtype([('a', 'uint16'), ('b', 'M8[s]')])
+        a = np.empty(1, dt)
+        # Fails to create a PEP 3118 valid buffer
+        assert_raises((ValueError, BufferError), memoryview, a[0])
+
+    @pytest.mark.parametrize('s', [
+        pytest.param("\x32\x32", id="ascii"),
+        pytest.param("\uFE0F\uFE0F", id="basic multilingual"),
+        pytest.param("\U0001f4bb\U0001f4bb", id="non-BMP"),
+    ])
+    def test_str_ucs4(self, s):
+        s = np.str_(s)  # only our subclass implements the buffer protocol
+
+        # all the same, characters always encode as ucs4
+        expected = dict(strides=(), itemsize=8, ndim=0, shape=(), format='2w')
+
+        v = memoryview(s)
+        assert self._as_dict(v) == expected
+
+        # integers of the paltform-appropriate endianness
+        code_points = np.frombuffer(v, dtype='i4')
+
+        assert_equal(code_points, [ord(c) for c in s])

venv/Lib/site-packages/numpy/core/tests/test_scalarinherit.py

@@ -0,0 +1,91 @@
+# -*- coding: utf-8 -*-
+""" Test printing of scalar types.
+
+"""
+import pytest
+
+import numpy as np
+from numpy.testing import assert_
+
+
+class A:
+    pass
+class B(A, np.float64):
+    pass
+
+class C(B):
+    pass
+class D(C, B):
+    pass
+
+class B0(np.float64, A):
+    pass
+class C0(B0):
+    pass
+
+class HasNew:
+    def __new__(cls, *args, **kwargs):
+        return cls, args, kwargs
+
+class B1(np.float64, HasNew):
+    pass
+
+
+class TestInherit:
+    def test_init(self):
+        x = B(1.0)
+        assert_(str(x) == '1.0')
+        y = C(2.0)
+        assert_(str(y) == '2.0')
+        z = D(3.0)
+        assert_(str(z) == '3.0')
+
+    def test_init2(self):
+        x = B0(1.0)
+        assert_(str(x) == '1.0')
+        y = C0(2.0)
+        assert_(str(y) == '2.0')
+
+    def test_gh_15395(self):
+        # HasNew is the second base, so `np.float64` should have priority
+        x = B1(1.0)
+        assert_(str(x) == '1.0')
+
+        # previously caused RecursionError!?
+        with pytest.raises(TypeError):
+            B1(1.0, 2.0)
+
+
+class TestCharacter:
+    def test_char_radd(self):
+        # GH issue 9620, reached gentype_add and raise TypeError
+        np_s = np.string_('abc')
+        np_u = np.unicode_('abc')
+        s = b'def'
+        u = u'def'
+        assert_(np_s.__radd__(np_s) is NotImplemented)
+        assert_(np_s.__radd__(np_u) is NotImplemented)
+        assert_(np_s.__radd__(s) is NotImplemented)
+        assert_(np_s.__radd__(u) is NotImplemented)
+        assert_(np_u.__radd__(np_s) is NotImplemented)
+        assert_(np_u.__radd__(np_u) is NotImplemented)
+        assert_(np_u.__radd__(s) is NotImplemented)
+        assert_(np_u.__radd__(u) is NotImplemented)
+        assert_(s + np_s == b'defabc')
+        assert_(u + np_u == u'defabc')
+
+
+        class Mystr(str, np.generic):
+            # would segfault
+            pass
+
+        ret = s + Mystr('abc')
+        assert_(type(ret) is type(s))
+
+    def test_char_repeat(self):
+        np_s = np.string_('abc')
+        np_u = np.unicode_('abc')
+        res_s = b'abc' * 5
+        res_u = u'abc' * 5
+        assert_(np_s * 5 == res_s)
+        assert_(np_u * 5 == res_u)

venv/Lib/site-packages/numpy/core/tests/test_scalarmath.py

@@ -0,0 +1,702 @@
+import sys
+import warnings
+import itertools
+import operator
+import platform
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_almost_equal,
+    assert_array_equal, IS_PYPY, suppress_warnings, _gen_alignment_data,
+    assert_warns, assert_raises_regex,
+    )
+
+types = [np.bool_, np.byte, np.ubyte, np.short, np.ushort, np.intc, np.uintc,
+         np.int_, np.uint, np.longlong, np.ulonglong,
+         np.single, np.double, np.longdouble, np.csingle,
+         np.cdouble, np.clongdouble]
+
+floating_types = np.floating.__subclasses__()
+complex_floating_types = np.complexfloating.__subclasses__()
+
+
+# This compares scalarmath against ufuncs.
+
+class TestTypes:
+    def test_types(self):
+        for atype in types:
+            a = atype(1)
+            assert_(a == 1, "error with %r: got %r" % (atype, a))
+
+    def test_type_add(self):
+        # list of types
+        for k, atype in enumerate(types):
+            a_scalar = atype(3)
+            a_array = np.array([3], dtype=atype)
+            for l, btype in enumerate(types):
+                b_scalar = btype(1)
+                b_array = np.array([1], dtype=btype)
+                c_scalar = a_scalar + b_scalar
+                c_array = a_array + b_array
+                # It was comparing the type numbers, but the new ufunc
+                # function-finding mechanism finds the lowest function
+                # to which both inputs can be cast - which produces 'l'
+                # when you do 'q' + 'b'.  The old function finding mechanism
+                # skipped ahead based on the first argument, but that
+                # does not produce properly symmetric results...
+                assert_equal(c_scalar.dtype, c_array.dtype,
+                           "error with types (%d/'%c' + %d/'%c')" %
+                            (k, np.dtype(atype).char, l, np.dtype(btype).char))
+
+    def test_type_create(self):
+        for k, atype in enumerate(types):
+            a = np.array([1, 2, 3], atype)
+            b = atype([1, 2, 3])
+            assert_equal(a, b)
+
+    def test_leak(self):
+        # test leak of scalar objects
+        # a leak would show up in valgrind as still-reachable of ~2.6MB
+        for i in range(200000):
+            np.add(1, 1)
+
+
+class TestBaseMath:
+    def test_blocked(self):
+        # test alignments offsets for simd instructions
+        # alignments for vz + 2 * (vs - 1) + 1
+        for dt, sz in [(np.float32, 11), (np.float64, 7), (np.int32, 11)]:
+            for out, inp1, inp2, msg in _gen_alignment_data(dtype=dt,
+                                                            type='binary',
+                                                            max_size=sz):
+                exp1 = np.ones_like(inp1)
+                inp1[...] = np.ones_like(inp1)
+                inp2[...] = np.zeros_like(inp2)
+                assert_almost_equal(np.add(inp1, inp2), exp1, err_msg=msg)
+                assert_almost_equal(np.add(inp1, 2), exp1 + 2, err_msg=msg)
+                assert_almost_equal(np.add(1, inp2), exp1, err_msg=msg)
+
+                np.add(inp1, inp2, out=out)
+                assert_almost_equal(out, exp1, err_msg=msg)
+
+                inp2[...] += np.arange(inp2.size, dtype=dt) + 1
+                assert_almost_equal(np.square(inp2),
+                                    np.multiply(inp2, inp2),  err_msg=msg)
+                # skip true divide for ints
+                if dt != np.int32:
+                    assert_almost_equal(np.reciprocal(inp2),
+                                        np.divide(1, inp2),  err_msg=msg)
+
+                inp1[...] = np.ones_like(inp1)
+                np.add(inp1, 2, out=out)
+                assert_almost_equal(out, exp1 + 2, err_msg=msg)
+                inp2[...] = np.ones_like(inp2)
+                np.add(2, inp2, out=out)
+                assert_almost_equal(out, exp1 + 2, err_msg=msg)
+
+    def test_lower_align(self):
+        # check data that is not aligned to element size
+        # i.e doubles are aligned to 4 bytes on i386
+        d = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64)
+        o = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64)
+        assert_almost_equal(d + d, d * 2)
+        np.add(d, d, out=o)
+        np.add(np.ones_like(d), d, out=o)
+        np.add(d, np.ones_like(d), out=o)
+        np.add(np.ones_like(d), d)
+        np.add(d, np.ones_like(d))
+
+
+class TestPower:
+    def test_small_types(self):
+        for t in [np.int8, np.int16, np.float16]:
+            a = t(3)
+            b = a ** 4
+            assert_(b == 81, "error with %r: got %r" % (t, b))
+
+    def test_large_types(self):
+        for t in [np.int32, np.int64, np.float32, np.float64, np.longdouble]:
+            a = t(51)
+            b = a ** 4
+            msg = "error with %r: got %r" % (t, b)
+            if np.issubdtype(t, np.integer):
+                assert_(b == 6765201, msg)
+            else:
+                assert_almost_equal(b, 6765201, err_msg=msg)
+
+    def test_integers_to_negative_integer_power(self):
+        # Note that the combination of uint64 with a signed integer
+        # has common type np.float64. The other combinations should all
+        # raise a ValueError for integer ** negative integer.
+        exp = [np.array(-1, dt)[()] for dt in 'bhilq']
+
+        # 1 ** -1 possible special case
+        base = [np.array(1, dt)[()] for dt in 'bhilqBHILQ']
+        for i1, i2 in itertools.product(base, exp):
+            if i1.dtype != np.uint64:
+                assert_raises(ValueError, operator.pow, i1, i2)
+            else:
+                res = operator.pow(i1, i2)
+                assert_(res.dtype.type is np.float64)
+                assert_almost_equal(res, 1.)
+
+        # -1 ** -1 possible special case
+        base = [np.array(-1, dt)[()] for dt in 'bhilq']
+        for i1, i2 in itertools.product(base, exp):
+            if i1.dtype != np.uint64:
+                assert_raises(ValueError, operator.pow, i1, i2)
+            else:
+                res = operator.pow(i1, i2)
+                assert_(res.dtype.type is np.float64)
+                assert_almost_equal(res, -1.)
+
+        # 2 ** -1 perhaps generic
+        base = [np.array(2, dt)[()] for dt in 'bhilqBHILQ']
+        for i1, i2 in itertools.product(base, exp):
+            if i1.dtype != np.uint64:
+                assert_raises(ValueError, operator.pow, i1, i2)
+            else:
+                res = operator.pow(i1, i2)
+                assert_(res.dtype.type is np.float64)
+                assert_almost_equal(res, .5)
+
+    def test_mixed_types(self):
+        typelist = [np.int8, np.int16, np.float16,
+                    np.float32, np.float64, np.int8,
+                    np.int16, np.int32, np.int64]
+        for t1 in typelist:
+            for t2 in typelist:
+                a = t1(3)
+                b = t2(2)
+                result = a**b
+                msg = ("error with %r and %r:"
+                       "got %r, expected %r") % (t1, t2, result, 9)
+                if np.issubdtype(np.dtype(result), np.integer):
+                    assert_(result == 9, msg)
+                else:
+                    assert_almost_equal(result, 9, err_msg=msg)
+
+    def test_modular_power(self):
+        # modular power is not implemented, so ensure it errors
+        a = 5
+        b = 4
+        c = 10
+        expected = pow(a, b, c)  # noqa: F841
+        for t in (np.int32, np.float32, np.complex64):
+            # note that 3-operand power only dispatches on the first argument
+            assert_raises(TypeError, operator.pow, t(a), b, c)
+            assert_raises(TypeError, operator.pow, np.array(t(a)), b, c)
+
+
+def floordiv_and_mod(x, y):
+    return (x // y, x % y)
+
+
+def _signs(dt):
+    if dt in np.typecodes['UnsignedInteger']:
+        return (+1,)
+    else:
+        return (+1, -1)
+
+
+class TestModulus:
+
+    def test_modulus_basic(self):
+        dt = np.typecodes['AllInteger'] + np.typecodes['Float']
+        for op in [floordiv_and_mod, divmod]:
+            for dt1, dt2 in itertools.product(dt, dt):
+                for sg1, sg2 in itertools.product(_signs(dt1), _signs(dt2)):
+                    fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s'
+                    msg = fmt % (op.__name__, dt1, dt2, sg1, sg2)
+                    a = np.array(sg1*71, dtype=dt1)[()]
+                    b = np.array(sg2*19, dtype=dt2)[()]
+                    div, rem = op(a, b)
+                    assert_equal(div*b + rem, a, err_msg=msg)
+                    if sg2 == -1:
+                        assert_(b < rem <= 0, msg)
+                    else:
+                        assert_(b > rem >= 0, msg)
+
+    def test_float_modulus_exact(self):
+        # test that float results are exact for small integers. This also
+        # holds for the same integers scaled by powers of two.
+        nlst = list(range(-127, 0))
+        plst = list(range(1, 128))
+        dividend = nlst + [0] + plst
+        divisor = nlst + plst
+        arg = list(itertools.product(dividend, divisor))
+        tgt = list(divmod(*t) for t in arg)
+
+        a, b = np.array(arg, dtype=int).T
+        # convert exact integer results from Python to float so that
+        # signed zero can be used, it is checked.
+        tgtdiv, tgtrem = np.array(tgt, dtype=float).T
+        tgtdiv = np.where((tgtdiv == 0.0) & ((b < 0) ^ (a < 0)), -0.0, tgtdiv)
+        tgtrem = np.where((tgtrem == 0.0) & (b < 0), -0.0, tgtrem)
+
+        for op in [floordiv_and_mod, divmod]:
+            for dt in np.typecodes['Float']:
+                msg = 'op: %s, dtype: %s' % (op.__name__, dt)
+                fa = a.astype(dt)
+                fb = b.astype(dt)
+                # use list comprehension so a_ and b_ are scalars
+                div, rem = zip(*[op(a_, b_) for  a_, b_ in zip(fa, fb)])
+                assert_equal(div, tgtdiv, err_msg=msg)
+                assert_equal(rem, tgtrem, err_msg=msg)
+
+    def test_float_modulus_roundoff(self):
+        # gh-6127
+        dt = np.typecodes['Float']
+        for op in [floordiv_and_mod, divmod]:
+            for dt1, dt2 in itertools.product(dt, dt):
+                for sg1, sg2 in itertools.product((+1, -1), (+1, -1)):
+                    fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s'
+                    msg = fmt % (op.__name__, dt1, dt2, sg1, sg2)
+                    a = np.array(sg1*78*6e-8, dtype=dt1)[()]
+                    b = np.array(sg2*6e-8, dtype=dt2)[()]
+                    div, rem = op(a, b)
+                    # Equal assertion should hold when fmod is used
+                    assert_equal(div*b + rem, a, err_msg=msg)
+                    if sg2 == -1:
+                        assert_(b < rem <= 0, msg)
+                    else:
+                        assert_(b > rem >= 0, msg)
+
+    def test_float_modulus_corner_cases(self):
+        # Check remainder magnitude.
+        for dt in np.typecodes['Float']:
+            b = np.array(1.0, dtype=dt)
+            a = np.nextafter(np.array(0.0, dtype=dt), -b)
+            rem = operator.mod(a, b)
+            assert_(rem <= b, 'dt: %s' % dt)
+            rem = operator.mod(-a, -b)
+            assert_(rem >= -b, 'dt: %s' % dt)
+
+        # Check nans, inf
+        with suppress_warnings() as sup:
+            sup.filter(RuntimeWarning, "invalid value encountered in remainder")
+            for dt in np.typecodes['Float']:
+                fone = np.array(1.0, dtype=dt)
+                fzer = np.array(0.0, dtype=dt)
+                finf = np.array(np.inf, dtype=dt)
+                fnan = np.array(np.nan, dtype=dt)
+                rem = operator.mod(fone, fzer)
+                assert_(np.isnan(rem), 'dt: %s' % dt)
+                # MSVC 2008 returns NaN here, so disable the check.
+                #rem = operator.mod(fone, finf)
+                #assert_(rem == fone, 'dt: %s' % dt)
+                rem = operator.mod(fone, fnan)
+                assert_(np.isnan(rem), 'dt: %s' % dt)
+                rem = operator.mod(finf, fone)
+                assert_(np.isnan(rem), 'dt: %s' % dt)
+
+    def test_inplace_floordiv_handling(self):
+        # issue gh-12927
+        # this only applies to in-place floordiv //=, because the output type
+        # promotes to float which does not fit
+        a = np.array([1, 2], np.int64)
+        b = np.array([1, 2], np.uint64)
+        pattern = 'could not be coerced to provided output parameter'
+        with assert_raises_regex(TypeError, pattern):
+            a //= b
+
+
+class TestComplexDivision:
+    def test_zero_division(self):
+        with np.errstate(all="ignore"):
+            for t in [np.complex64, np.complex128]:
+                a = t(0.0)
+                b = t(1.0)
+                assert_(np.isinf(b/a))
+                b = t(complex(np.inf, np.inf))
+                assert_(np.isinf(b/a))
+                b = t(complex(np.inf, np.nan))
+                assert_(np.isinf(b/a))
+                b = t(complex(np.nan, np.inf))
+                assert_(np.isinf(b/a))
+                b = t(complex(np.nan, np.nan))
+                assert_(np.isnan(b/a))
+                b = t(0.)
+                assert_(np.isnan(b/a))
+
+    def test_signed_zeros(self):
+        with np.errstate(all="ignore"):
+            for t in [np.complex64, np.complex128]:
+                # tupled (numerator, denominator, expected)
+                # for testing as expected == numerator/denominator
+                data = (
+                    (( 0.0,-1.0), ( 0.0, 1.0), (-1.0,-0.0)),
+                    (( 0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)),
+                    (( 0.0,-1.0), (-0.0,-1.0), ( 1.0, 0.0)),
+                    (( 0.0,-1.0), (-0.0, 1.0), (-1.0, 0.0)),
+                    (( 0.0, 1.0), ( 0.0,-1.0), (-1.0, 0.0)),
+                    (( 0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)),
+                    ((-0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)),
+                    ((-0.0, 1.0), ( 0.0,-1.0), (-1.0,-0.0))
+                )
+                for cases in data:
+                    n = cases[0]
+                    d = cases[1]
+                    ex = cases[2]
+                    result = t(complex(n[0], n[1])) / t(complex(d[0], d[1]))
+                    # check real and imag parts separately to avoid comparison
+                    # in array context, which does not account for signed zeros
+                    assert_equal(result.real, ex[0])
+                    assert_equal(result.imag, ex[1])
+
+    def test_branches(self):
+        with np.errstate(all="ignore"):
+            for t in [np.complex64, np.complex128]:
+                # tupled (numerator, denominator, expected)
+                # for testing as expected == numerator/denominator
+                data = list()
+
+                # trigger branch: real(fabs(denom)) > imag(fabs(denom))
+                # followed by else condition as neither are == 0
+                data.append((( 2.0, 1.0), ( 2.0, 1.0), (1.0, 0.0)))
+
+                # trigger branch: real(fabs(denom)) > imag(fabs(denom))
+                # followed by if condition as both are == 0
+                # is performed in test_zero_division(), so this is skipped
+
+                # trigger else if branch: real(fabs(denom)) < imag(fabs(denom))
+                data.append((( 1.0, 2.0), ( 1.0, 2.0), (1.0, 0.0)))
+
+                for cases in data:
+                    n = cases[0]
+                    d = cases[1]
+                    ex = cases[2]
+                    result = t(complex(n[0], n[1])) / t(complex(d[0], d[1]))
+                    # check real and imag parts separately to avoid comparison
+                    # in array context, which does not account for signed zeros
+                    assert_equal(result.real, ex[0])
+                    assert_equal(result.imag, ex[1])
+
+
+class TestConversion:
+    def test_int_from_long(self):
+        l = [1e6, 1e12, 1e18, -1e6, -1e12, -1e18]
+        li = [10**6, 10**12, 10**18, -10**6, -10**12, -10**18]
+        for T in [None, np.float64, np.int64]:
+            a = np.array(l, dtype=T)
+            assert_equal([int(_m) for _m in a], li)
+
+        a = np.array(l[:3], dtype=np.uint64)
+        assert_equal([int(_m) for _m in a], li[:3])
+
+    def test_iinfo_long_values(self):
+        for code in 'bBhH':
+            res = np.array(np.iinfo(code).max + 1, dtype=code)
+            tgt = np.iinfo(code).min
+            assert_(res == tgt)
+
+        for code in np.typecodes['AllInteger']:
+            res = np.array(np.iinfo(code).max, dtype=code)
+            tgt = np.iinfo(code).max
+            assert_(res == tgt)
+
+        for code in np.typecodes['AllInteger']:
+            res = np.typeDict[code](np.iinfo(code).max)
+            tgt = np.iinfo(code).max
+            assert_(res == tgt)
+
+    def test_int_raise_behaviour(self):
+        def overflow_error_func(dtype):
+            np.typeDict[dtype](np.iinfo(dtype).max + 1)
+
+        for code in 'lLqQ':
+            assert_raises(OverflowError, overflow_error_func, code)
+
+    def test_int_from_infinite_longdouble(self):
+        # gh-627
+        x = np.longdouble(np.inf)
+        assert_raises(OverflowError, int, x)
+        with suppress_warnings() as sup:
+            sup.record(np.ComplexWarning)
+            x = np.clongdouble(np.inf)
+            assert_raises(OverflowError, int, x)
+            assert_equal(len(sup.log), 1)
+
+    @pytest.mark.skipif(not IS_PYPY, reason="Test is PyPy only (gh-9972)")
+    def test_int_from_infinite_longdouble___int__(self):
+        x = np.longdouble(np.inf)
+        assert_raises(OverflowError, x.__int__)
+        with suppress_warnings() as sup:
+            sup.record(np.ComplexWarning)
+            x = np.clongdouble(np.inf)
+            assert_raises(OverflowError, x.__int__)
+            assert_equal(len(sup.log), 1)
+
+    @pytest.mark.skipif(np.finfo(np.double) == np.finfo(np.longdouble),
+                        reason="long double is same as double")
+    @pytest.mark.skipif(platform.machine().startswith("ppc"),
+                        reason="IBM double double")
+    def test_int_from_huge_longdouble(self):
+        # Produce a longdouble that would overflow a double,
+        # use exponent that avoids bug in Darwin pow function.
+        exp = np.finfo(np.double).maxexp - 1
+        huge_ld = 2 * 1234 * np.longdouble(2) ** exp
+        huge_i = 2 * 1234 * 2 ** exp
+        assert_(huge_ld != np.inf)
+        assert_equal(int(huge_ld), huge_i)
+
+    def test_int_from_longdouble(self):
+        x = np.longdouble(1.5)
+        assert_equal(int(x), 1)
+        x = np.longdouble(-10.5)
+        assert_equal(int(x), -10)
+
+    def test_numpy_scalar_relational_operators(self):
+        # All integer
+        for dt1 in np.typecodes['AllInteger']:
+            assert_(1 > np.array(0, dtype=dt1)[()], "type %s failed" % (dt1,))
+            assert_(not 1 < np.array(0, dtype=dt1)[()], "type %s failed" % (dt1,))
+
+            for dt2 in np.typecodes['AllInteger']:
+                assert_(np.array(1, dtype=dt1)[()] > np.array(0, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+                assert_(not np.array(1, dtype=dt1)[()] < np.array(0, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+
+        #Unsigned integers
+        for dt1 in 'BHILQP':
+            assert_(-1 < np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,))
+            assert_(not -1 > np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,))
+            assert_(-1 != np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,))
+
+            #unsigned vs signed
+            for dt2 in 'bhilqp':
+                assert_(np.array(1, dtype=dt1)[()] > np.array(-1, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+                assert_(not np.array(1, dtype=dt1)[()] < np.array(-1, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+                assert_(np.array(1, dtype=dt1)[()] != np.array(-1, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+
+        #Signed integers and floats
+        for dt1 in 'bhlqp' + np.typecodes['Float']:
+            assert_(1 > np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,))
+            assert_(not 1 < np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,))
+            assert_(-1 == np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,))
+
+            for dt2 in 'bhlqp' + np.typecodes['Float']:
+                assert_(np.array(1, dtype=dt1)[()] > np.array(-1, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+                assert_(not np.array(1, dtype=dt1)[()] < np.array(-1, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+                assert_(np.array(-1, dtype=dt1)[()] == np.array(-1, dtype=dt2)[()],
+                        "type %s and %s failed" % (dt1, dt2))
+
+    def test_scalar_comparison_to_none(self):
+        # Scalars should just return False and not give a warnings.
+        # The comparisons are flagged by pep8, ignore that.
+        with warnings.catch_warnings(record=True) as w:
+            warnings.filterwarnings('always', '', FutureWarning)
+            assert_(not np.float32(1) == None)
+            assert_(not np.str_('test') == None)
+            # This is dubious (see below):
+            assert_(not np.datetime64('NaT') == None)
+
+            assert_(np.float32(1) != None)
+            assert_(np.str_('test') != None)
+            # This is dubious (see below):
+            assert_(np.datetime64('NaT') != None)
+        assert_(len(w) == 0)
+
+        # For documentation purposes, this is why the datetime is dubious.
+        # At the time of deprecation this was no behaviour change, but
+        # it has to be considered when the deprecations are done.
+        assert_(np.equal(np.datetime64('NaT'), None))
+
+
+#class TestRepr:
+#    def test_repr(self):
+#        for t in types:
+#            val = t(1197346475.0137341)
+#            val_repr = repr(val)
+#            val2 = eval(val_repr)
+#            assert_equal( val, val2 )
+
+
+class TestRepr:
+    def _test_type_repr(self, t):
+        finfo = np.finfo(t)
+        last_fraction_bit_idx = finfo.nexp + finfo.nmant
+        last_exponent_bit_idx = finfo.nexp
+        storage_bytes = np.dtype(t).itemsize*8
+        # could add some more types to the list below
+        for which in ['small denorm', 'small norm']:
+            # Values from https://en.wikipedia.org/wiki/IEEE_754
+            constr = np.array([0x00]*storage_bytes, dtype=np.uint8)
+            if which == 'small denorm':
+                byte = last_fraction_bit_idx // 8
+                bytebit = 7-(last_fraction_bit_idx % 8)
+                constr[byte] = 1 << bytebit
+            elif which == 'small norm':
+                byte = last_exponent_bit_idx // 8
+                bytebit = 7-(last_exponent_bit_idx % 8)
+                constr[byte] = 1 << bytebit
+            else:
+                raise ValueError('hmm')
+            val = constr.view(t)[0]
+            val_repr = repr(val)
+            val2 = t(eval(val_repr))
+            if not (val2 == 0 and val < 1e-100):
+                assert_equal(val, val2)
+
+    def test_float_repr(self):
+        # long double test cannot work, because eval goes through a python
+        # float
+        for t in [np.float32, np.float64]:
+            self._test_type_repr(t)
+
+
+if not IS_PYPY:
+    # sys.getsizeof() is not valid on PyPy
+    class TestSizeOf:
+
+        def test_equal_nbytes(self):
+            for type in types:
+                x = type(0)
+                assert_(sys.getsizeof(x) > x.nbytes)
+
+        def test_error(self):
+            d = np.float32()
+            assert_raises(TypeError, d.__sizeof__, "a")
+
+
+class TestMultiply:
+    def test_seq_repeat(self):
+        # Test that basic sequences get repeated when multiplied with
+        # numpy integers. And errors are raised when multiplied with others.
+        # Some of this behaviour may be controversial and could be open for
+        # change.
+        accepted_types = set(np.typecodes["AllInteger"])
+        deprecated_types = {'?'}
+        forbidden_types = (
+            set(np.typecodes["All"]) - accepted_types - deprecated_types)
+        forbidden_types -= {'V'}  # can't default-construct void scalars
+
+        for seq_type in (list, tuple):
+            seq = seq_type([1, 2, 3])
+            for numpy_type in accepted_types:
+                i = np.dtype(numpy_type).type(2)
+                assert_equal(seq * i, seq * int(i))
+                assert_equal(i * seq, int(i) * seq)
+
+            for numpy_type in deprecated_types:
+                i = np.dtype(numpy_type).type()
+                assert_equal(
+                    assert_warns(DeprecationWarning, operator.mul, seq, i),
+                    seq * int(i))
+                assert_equal(
+                    assert_warns(DeprecationWarning, operator.mul, i, seq),
+                    int(i) * seq)
+
+            for numpy_type in forbidden_types:
+                i = np.dtype(numpy_type).type()
+                assert_raises(TypeError, operator.mul, seq, i)
+                assert_raises(TypeError, operator.mul, i, seq)
+
+    def test_no_seq_repeat_basic_array_like(self):
+        # Test that an array-like which does not know how to be multiplied
+        # does not attempt sequence repeat (raise TypeError).
+        # See also gh-7428.
+        class ArrayLike:
+            def __init__(self, arr):
+                self.arr = arr
+            def __array__(self):
+                return self.arr
+
+        # Test for simple ArrayLike above and memoryviews (original report)
+        for arr_like in (ArrayLike(np.ones(3)), memoryview(np.ones(3))):
+            assert_array_equal(arr_like * np.float32(3.), np.full(3, 3.))
+            assert_array_equal(np.float32(3.) * arr_like, np.full(3, 3.))
+            assert_array_equal(arr_like * np.int_(3), np.full(3, 3))
+            assert_array_equal(np.int_(3) * arr_like, np.full(3, 3))
+
+
+class TestNegative:
+    def test_exceptions(self):
+        a = np.ones((), dtype=np.bool_)[()]
+        assert_raises(TypeError, operator.neg, a)
+
+    def test_result(self):
+        types = np.typecodes['AllInteger'] + np.typecodes['AllFloat']
+        with suppress_warnings() as sup:
+            sup.filter(RuntimeWarning)
+            for dt in types:
+                a = np.ones((), dtype=dt)[()]
+                assert_equal(operator.neg(a) + a, 0)
+
+
+class TestSubtract:
+    def test_exceptions(self):
+        a = np.ones((), dtype=np.bool_)[()]
+        assert_raises(TypeError, operator.sub, a, a)
+
+    def test_result(self):
+        types = np.typecodes['AllInteger'] + np.typecodes['AllFloat']
+        with suppress_warnings() as sup:
+            sup.filter(RuntimeWarning)
+            for dt in types:
+                a = np.ones((), dtype=dt)[()]
+                assert_equal(operator.sub(a, a), 0)
+
+
+class TestAbs:
+    def _test_abs_func(self, absfunc):
+        for tp in floating_types + complex_floating_types:
+            x = tp(-1.5)
+            assert_equal(absfunc(x), 1.5)
+            x = tp(0.0)
+            res = absfunc(x)
+            # assert_equal() checks zero signedness
+            assert_equal(res, 0.0)
+            x = tp(-0.0)
+            res = absfunc(x)
+            assert_equal(res, 0.0)
+
+            x = tp(np.finfo(tp).max)
+            assert_equal(absfunc(x), x.real)
+
+            x = tp(np.finfo(tp).tiny)
+            assert_equal(absfunc(x), x.real)
+
+            x = tp(np.finfo(tp).min)
+            assert_equal(absfunc(x), -x.real)
+
+    def test_builtin_abs(self):
+        self._test_abs_func(abs)
+
+    def test_numpy_abs(self):
+        self._test_abs_func(np.abs)
+
+
+class TestBitShifts:
+
+    @pytest.mark.parametrize('type_code', np.typecodes['AllInteger'])
+    @pytest.mark.parametrize('op',
+        [operator.rshift, operator.lshift], ids=['>>', '<<'])
+    def test_shift_all_bits(self, type_code, op):
+        """ Shifts where the shift amount is the width of the type or wider """
+        # gh-2449
+        dt = np.dtype(type_code)
+        nbits = dt.itemsize * 8
+        for val in [5, -5]:
+            for shift in [nbits, nbits + 4]:
+                val_scl = dt.type(val)
+                shift_scl = dt.type(shift)
+                res_scl = op(val_scl, shift_scl)
+                if val_scl < 0 and op is operator.rshift:
+                    # sign bit is preserved
+                    assert_equal(res_scl, -1)
+                else:
+                    assert_equal(res_scl, 0)
+
+                # Result on scalars should be the same as on arrays
+                val_arr = np.array([val]*32, dtype=dt)
+                shift_arr = np.array([shift]*32, dtype=dt)
+                res_arr = op(val_arr, shift_arr)
+                assert_equal(res_arr, res_scl)

venv/Lib/site-packages/numpy/core/tests/test_scalarprint.py

@@ -0,0 +1,322 @@
+# -*- coding: utf-8 -*-
+""" Test printing of scalar types.
+
+"""
+import code
+import platform
+import pytest
+import sys
+
+from tempfile import TemporaryFile
+import numpy as np
+from numpy.testing import assert_, assert_equal
+
+class TestRealScalars:
+    def test_str(self):
+        svals = [0.0, -0.0, 1, -1, np.inf, -np.inf, np.nan]
+        styps = [np.float16, np.float32, np.float64, np.longdouble]
+        wanted = [
+             ['0.0',  '0.0',  '0.0',  '0.0' ],
+             ['-0.0', '-0.0', '-0.0', '-0.0'],
+             ['1.0',  '1.0',  '1.0',  '1.0' ],
+             ['-1.0', '-1.0', '-1.0', '-1.0'],
+             ['inf',  'inf',  'inf',  'inf' ],
+             ['-inf', '-inf', '-inf', '-inf'],
+             ['nan',  'nan',  'nan',  'nan']]
+
+        for wants, val in zip(wanted, svals):
+            for want, styp in zip(wants, styps):
+                msg = 'for str({}({}))'.format(np.dtype(styp).name, repr(val))
+                assert_equal(str(styp(val)), want, err_msg=msg)
+
+    def test_scalar_cutoffs(self):
+        # test that both the str and repr of np.float64 behaves
+        # like python floats in python3.
+        def check(v):
+            assert_equal(str(np.float64(v)), str(v))
+            assert_equal(str(np.float64(v)), repr(v))
+            assert_equal(repr(np.float64(v)), repr(v))
+            assert_equal(repr(np.float64(v)), str(v))
+
+        # check we use the same number of significant digits
+        check(1.12345678901234567890)
+        check(0.0112345678901234567890)
+
+        # check switch from scientific output to positional and back
+        check(1e-5)
+        check(1e-4)
+        check(1e15)
+        check(1e16)
+
+    def test_py2_float_print(self):
+        # gh-10753
+        # In python2, the python float type implements an obsolete method
+        # tp_print, which overrides tp_repr and tp_str when using "print" to
+        # output to a "real file" (ie, not a StringIO). Make sure we don't
+        # inherit it.
+        x = np.double(0.1999999999999)
+        with TemporaryFile('r+t') as f:
+            print(x, file=f)
+            f.seek(0)
+            output = f.read()
+        assert_equal(output, str(x) + '\n')
+        # In python2 the value float('0.1999999999999') prints with reduced
+        # precision as '0.2', but we want numpy's np.double('0.1999999999999')
+        # to print the unique value, '0.1999999999999'.
+
+        # gh-11031
+        # Only in the python2 interactive shell and when stdout is a "real"
+        # file, the output of the last command is printed to stdout without
+        # Py_PRINT_RAW (unlike the print statement) so `>>> x` and `>>> print
+        # x` are potentially different. Make sure they are the same. The only
+        # way I found to get prompt-like output is using an actual prompt from
+        # the 'code' module. Again, must use tempfile to get a "real" file.
+
+        # dummy user-input which enters one line and then ctrl-Ds.
+        def userinput():
+            yield 'np.sqrt(2)'
+            raise EOFError
+        gen = userinput()
+        input_func = lambda prompt="": next(gen)
+
+        with TemporaryFile('r+t') as fo, TemporaryFile('r+t') as fe:
+            orig_stdout, orig_stderr = sys.stdout, sys.stderr
+            sys.stdout, sys.stderr = fo, fe
+
+            code.interact(local={'np': np}, readfunc=input_func, banner='')
+
+            sys.stdout, sys.stderr = orig_stdout, orig_stderr
+
+            fo.seek(0)
+            capture = fo.read().strip()
+
+        assert_equal(capture, repr(np.sqrt(2)))
+
+    def test_dragon4(self):
+        # these tests are adapted from Ryan Juckett's dragon4 implementation,
+        # see dragon4.c for details.
+
+        fpos32 = lambda x, **k: np.format_float_positional(np.float32(x), **k)
+        fsci32 = lambda x, **k: np.format_float_scientific(np.float32(x), **k)
+        fpos64 = lambda x, **k: np.format_float_positional(np.float64(x), **k)
+        fsci64 = lambda x, **k: np.format_float_scientific(np.float64(x), **k)
+
+        preckwd = lambda prec: {'unique': False, 'precision': prec}
+
+        assert_equal(fpos32('1.0'), "1.")
+        assert_equal(fsci32('1.0'), "1.e+00")
+        assert_equal(fpos32('10.234'), "10.234")
+        assert_equal(fpos32('-10.234'), "-10.234")
+        assert_equal(fsci32('10.234'), "1.0234e+01")
+        assert_equal(fsci32('-10.234'), "-1.0234e+01")
+        assert_equal(fpos32('1000.0'), "1000.")
+        assert_equal(fpos32('1.0', precision=0), "1.")
+        assert_equal(fsci32('1.0', precision=0), "1.e+00")
+        assert_equal(fpos32('10.234', precision=0), "10.")
+        assert_equal(fpos32('-10.234', precision=0), "-10.")
+        assert_equal(fsci32('10.234', precision=0), "1.e+01")
+        assert_equal(fsci32('-10.234', precision=0), "-1.e+01")
+        assert_equal(fpos32('10.234', precision=2), "10.23")
+        assert_equal(fsci32('-10.234', precision=2), "-1.02e+01")
+        assert_equal(fsci64('9.9999999999999995e-08', **preckwd(16)),
+                            '9.9999999999999995e-08')
+        assert_equal(fsci64('9.8813129168249309e-324', **preckwd(16)),
+                            '9.8813129168249309e-324')
+        assert_equal(fsci64('9.9999999999999694e-311', **preckwd(16)),
+                            '9.9999999999999694e-311')
+
+
+        # test rounding
+        # 3.1415927410 is closest float32 to np.pi
+        assert_equal(fpos32('3.14159265358979323846', **preckwd(10)),
+                            "3.1415927410")
+        assert_equal(fsci32('3.14159265358979323846', **preckwd(10)),
+                            "3.1415927410e+00")
+        assert_equal(fpos64('3.14159265358979323846', **preckwd(10)),
+                            "3.1415926536")
+        assert_equal(fsci64('3.14159265358979323846', **preckwd(10)),
+                            "3.1415926536e+00")
+        # 299792448 is closest float32 to 299792458
+        assert_equal(fpos32('299792458.0', **preckwd(5)), "299792448.00000")
+        assert_equal(fsci32('299792458.0', **preckwd(5)), "2.99792e+08")
+        assert_equal(fpos64('299792458.0', **preckwd(5)), "299792458.00000")
+        assert_equal(fsci64('299792458.0', **preckwd(5)), "2.99792e+08")
+
+        assert_equal(fpos32('3.14159265358979323846', **preckwd(25)),
+                            "3.1415927410125732421875000")
+        assert_equal(fpos64('3.14159265358979323846', **preckwd(50)),
+                         "3.14159265358979311599796346854418516159057617187500")
+        assert_equal(fpos64('3.14159265358979323846'), "3.141592653589793")
+
+
+        # smallest numbers
+        assert_equal(fpos32(0.5**(126 + 23), unique=False, precision=149),
+                    "0.00000000000000000000000000000000000000000000140129846432"
+                    "4817070923729583289916131280261941876515771757068283889791"
+                    "08268586060148663818836212158203125")
+        assert_equal(fpos64(0.5**(1022 + 52), unique=False, precision=1074),
+                    "0.00000000000000000000000000000000000000000000000000000000"
+                    "0000000000000000000000000000000000000000000000000000000000"
+                    "0000000000000000000000000000000000000000000000000000000000"
+                    "0000000000000000000000000000000000000000000000000000000000"
+                    "0000000000000000000000000000000000000000000000000000000000"
+                    "0000000000000000000000000000000000049406564584124654417656"
+                    "8792868221372365059802614324764425585682500675507270208751"
+                    "8652998363616359923797965646954457177309266567103559397963"
+                    "9877479601078187812630071319031140452784581716784898210368"
+                    "8718636056998730723050006387409153564984387312473397273169"
+                    "6151400317153853980741262385655911710266585566867681870395"
+                    "6031062493194527159149245532930545654440112748012970999954"
+                    "1931989409080416563324524757147869014726780159355238611550"
+                    "1348035264934720193790268107107491703332226844753335720832"
+                    "4319360923828934583680601060115061698097530783422773183292"
+                    "4790498252473077637592724787465608477820373446969953364701"
+                    "7972677717585125660551199131504891101451037862738167250955"
+                    "8373897335989936648099411642057026370902792427675445652290"
+                    "87538682506419718265533447265625")
+
+        # largest numbers
+        assert_equal(fpos32(np.finfo(np.float32).max, **preckwd(0)),
+                    "340282346638528859811704183484516925440.")
+        assert_equal(fpos64(np.finfo(np.float64).max, **preckwd(0)),
+                    "1797693134862315708145274237317043567980705675258449965989"
+                    "1747680315726078002853876058955863276687817154045895351438"
+                    "2464234321326889464182768467546703537516986049910576551282"
+                    "0762454900903893289440758685084551339423045832369032229481"
+                    "6580855933212334827479782620414472316873817718091929988125"
+                    "0404026184124858368.")
+        # Warning: In unique mode only the integer digits necessary for
+        # uniqueness are computed, the rest are 0. Should we change this?
+        assert_equal(fpos32(np.finfo(np.float32).max, precision=0),
+                    "340282350000000000000000000000000000000.")
+
+        # test trailing zeros
+        assert_equal(fpos32('1.0', unique=False, precision=3), "1.000")
+        assert_equal(fpos64('1.0', unique=False, precision=3), "1.000")
+        assert_equal(fsci32('1.0', unique=False, precision=3), "1.000e+00")
+        assert_equal(fsci64('1.0', unique=False, precision=3), "1.000e+00")
+        assert_equal(fpos32('1.5', unique=False, precision=3), "1.500")
+        assert_equal(fpos64('1.5', unique=False, precision=3), "1.500")
+        assert_equal(fsci32('1.5', unique=False, precision=3), "1.500e+00")
+        assert_equal(fsci64('1.5', unique=False, precision=3), "1.500e+00")
+        # gh-10713
+        assert_equal(fpos64('324', unique=False, precision=5, fractional=False), "324.00")
+
+    def test_dragon4_interface(self):
+        tps = [np.float16, np.float32, np.float64]
+        if hasattr(np, 'float128'):
+            tps.append(np.float128)
+
+        fpos = np.format_float_positional
+        fsci = np.format_float_scientific
+
+        for tp in tps:
+            # test padding
+            assert_equal(fpos(tp('1.0'), pad_left=4, pad_right=4), "   1.    ")
+            assert_equal(fpos(tp('-1.0'), pad_left=4, pad_right=4), "  -1.    ")
+            assert_equal(fpos(tp('-10.2'),
+                         pad_left=4, pad_right=4), " -10.2   ")
+
+            # test exp_digits
+            assert_equal(fsci(tp('1.23e1'), exp_digits=5), "1.23e+00001")
+
+            # test fixed (non-unique) mode
+            assert_equal(fpos(tp('1.0'), unique=False, precision=4), "1.0000")
+            assert_equal(fsci(tp('1.0'), unique=False, precision=4),
+                         "1.0000e+00")
+
+            # test trimming
+            # trim of 'k' or '.' only affects non-unique mode, since unique
+            # mode will not output trailing 0s.
+            assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='k'),
+                         "1.0000")
+
+            assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='.'),
+                         "1.")
+            assert_equal(fpos(tp('1.2'), unique=False, precision=4, trim='.'),
+                         "1.2" if tp != np.float16 else "1.2002")
+
+            assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='0'),
+                         "1.0")
+            assert_equal(fpos(tp('1.2'), unique=False, precision=4, trim='0'),
+                         "1.2" if tp != np.float16 else "1.2002")
+            assert_equal(fpos(tp('1.'), trim='0'), "1.0")
+
+            assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='-'),
+                         "1")
+            assert_equal(fpos(tp('1.2'), unique=False, precision=4, trim='-'),
+                         "1.2" if tp != np.float16 else "1.2002")
+            assert_equal(fpos(tp('1.'), trim='-'), "1")
+
+    @pytest.mark.skipif(not platform.machine().startswith("ppc64"),
+                        reason="only applies to ppc float128 values")
+    def test_ppc64_ibm_double_double128(self):
+        # check that the precision decreases once we get into the subnormal
+        # range. Unlike float64, this starts around 1e-292 instead of 1e-308,
+        # which happens when the first double is normal and the second is
+        # subnormal.
+        x = np.float128('2.123123123123123123123123123123123e-286')
+        got = [str(x/np.float128('2e' + str(i))) for i in range(0,40)]
+        expected = [
+            "1.06156156156156156156156156156157e-286",
+            "1.06156156156156156156156156156158e-287",
+            "1.06156156156156156156156156156159e-288",
+            "1.0615615615615615615615615615616e-289",
+            "1.06156156156156156156156156156157e-290",
+            "1.06156156156156156156156156156156e-291",
+            "1.0615615615615615615615615615616e-292",
+            "1.0615615615615615615615615615615e-293",
+            "1.061561561561561561561561561562e-294",
+            "1.06156156156156156156156156155e-295",
+            "1.0615615615615615615615615616e-296",
+            "1.06156156156156156156156156e-297",
+            "1.06156156156156156156156157e-298",
+            "1.0615615615615615615615616e-299",
+            "1.06156156156156156156156e-300",
+            "1.06156156156156156156155e-301",
+            "1.0615615615615615615616e-302",
+            "1.061561561561561561562e-303",
+            "1.06156156156156156156e-304",
+            "1.0615615615615615618e-305",
+            "1.06156156156156156e-306",
+            "1.06156156156156157e-307",
+            "1.0615615615615616e-308",
+            "1.06156156156156e-309",
+            "1.06156156156157e-310",
+            "1.0615615615616e-311",
+            "1.06156156156e-312",
+            "1.06156156154e-313",
+            "1.0615615616e-314",
+            "1.06156156e-315",
+            "1.06156155e-316",
+            "1.061562e-317",
+            "1.06156e-318",
+            "1.06155e-319",
+            "1.0617e-320",
+            "1.06e-321",
+            "1.04e-322",
+            "1e-323",
+            "0.0",
+            "0.0"]
+        assert_equal(got, expected)
+
+        # Note: we follow glibc behavior, but it (or gcc) might not be right.
+        # In particular we can get two values that print the same but are not
+        # equal:
+        a = np.float128('2')/np.float128('3')
+        b = np.float128(str(a))
+        assert_equal(str(a), str(b))
+        assert_(a != b)
+
+    def float32_roundtrip(self):
+        # gh-9360
+        x = np.float32(1024 - 2**-14)
+        y = np.float32(1024 - 2**-13)
+        assert_(repr(x) != repr(y))
+        assert_equal(np.float32(repr(x)), x)
+        assert_equal(np.float32(repr(y)), y)
+
+    def float64_vs_python(self):
+        # gh-2643, gh-6136, gh-6908
+        assert_equal(repr(np.float64(0.1)), repr(0.1))
+        assert_(repr(np.float64(0.20000000000000004)) != repr(0.2))

venv/Lib/site-packages/numpy/core/tests/test_shape_base.py

@@ -0,0 +1,713 @@
+import pytest
+import numpy as np
+from numpy.core import (
+    array, arange, atleast_1d, atleast_2d, atleast_3d, block, vstack, hstack,
+    newaxis, concatenate, stack
+    )
+from numpy.core.shape_base import (_block_dispatcher, _block_setup,
+                                   _block_concatenate, _block_slicing)
+from numpy.testing import (
+    assert_, assert_raises, assert_array_equal, assert_equal,
+    assert_raises_regex, assert_warns
+    )
+
+
+class TestAtleast1d:
+    def test_0D_array(self):
+        a = array(1)
+        b = array(2)
+        res = [atleast_1d(a), atleast_1d(b)]
+        desired = [array([1]), array([2])]
+        assert_array_equal(res, desired)
+
+    def test_1D_array(self):
+        a = array([1, 2])
+        b = array([2, 3])
+        res = [atleast_1d(a), atleast_1d(b)]
+        desired = [array([1, 2]), array([2, 3])]
+        assert_array_equal(res, desired)
+
+    def test_2D_array(self):
+        a = array([[1, 2], [1, 2]])
+        b = array([[2, 3], [2, 3]])
+        res = [atleast_1d(a), atleast_1d(b)]
+        desired = [a, b]
+        assert_array_equal(res, desired)
+
+    def test_3D_array(self):
+        a = array([[1, 2], [1, 2]])
+        b = array([[2, 3], [2, 3]])
+        a = array([a, a])
+        b = array([b, b])
+        res = [atleast_1d(a), atleast_1d(b)]
+        desired = [a, b]
+        assert_array_equal(res, desired)
+
+    def test_r1array(self):
+        """ Test to make sure equivalent Travis O's r1array function
+        """
+        assert_(atleast_1d(3).shape == (1,))
+        assert_(atleast_1d(3j).shape == (1,))
+        assert_(atleast_1d(3.0).shape == (1,))
+        assert_(atleast_1d([[2, 3], [4, 5]]).shape == (2, 2))
+
+
+class TestAtleast2d:
+    def test_0D_array(self):
+        a = array(1)
+        b = array(2)
+        res = [atleast_2d(a), atleast_2d(b)]
+        desired = [array([[1]]), array([[2]])]
+        assert_array_equal(res, desired)
+
+    def test_1D_array(self):
+        a = array([1, 2])
+        b = array([2, 3])
+        res = [atleast_2d(a), atleast_2d(b)]
+        desired = [array([[1, 2]]), array([[2, 3]])]
+        assert_array_equal(res, desired)
+
+    def test_2D_array(self):
+        a = array([[1, 2], [1, 2]])
+        b = array([[2, 3], [2, 3]])
+        res = [atleast_2d(a), atleast_2d(b)]
+        desired = [a, b]
+        assert_array_equal(res, desired)
+
+    def test_3D_array(self):
+        a = array([[1, 2], [1, 2]])
+        b = array([[2, 3], [2, 3]])
+        a = array([a, a])
+        b = array([b, b])
+        res = [atleast_2d(a), atleast_2d(b)]
+        desired = [a, b]
+        assert_array_equal(res, desired)
+
+    def test_r2array(self):
+        """ Test to make sure equivalent Travis O's r2array function
+        """
+        assert_(atleast_2d(3).shape == (1, 1))
+        assert_(atleast_2d([3j, 1]).shape == (1, 2))
+        assert_(atleast_2d([[[3, 1], [4, 5]], [[3, 5], [1, 2]]]).shape == (2, 2, 2))
+
+
+class TestAtleast3d:
+    def test_0D_array(self):
+        a = array(1)
+        b = array(2)
+        res = [atleast_3d(a), atleast_3d(b)]
+        desired = [array([[[1]]]), array([[[2]]])]
+        assert_array_equal(res, desired)
+
+    def test_1D_array(self):
+        a = array([1, 2])
+        b = array([2, 3])
+        res = [atleast_3d(a), atleast_3d(b)]
+        desired = [array([[[1], [2]]]), array([[[2], [3]]])]
+        assert_array_equal(res, desired)
+
+    def test_2D_array(self):
+        a = array([[1, 2], [1, 2]])
+        b = array([[2, 3], [2, 3]])
+        res = [atleast_3d(a), atleast_3d(b)]
+        desired = [a[:,:, newaxis], b[:,:, newaxis]]
+        assert_array_equal(res, desired)
+
+    def test_3D_array(self):
+        a = array([[1, 2], [1, 2]])
+        b = array([[2, 3], [2, 3]])
+        a = array([a, a])
+        b = array([b, b])
+        res = [atleast_3d(a), atleast_3d(b)]
+        desired = [a, b]
+        assert_array_equal(res, desired)
+
+
+class TestHstack:
+    def test_non_iterable(self):
+        assert_raises(TypeError, hstack, 1)
+
+    def test_empty_input(self):
+        assert_raises(ValueError, hstack, ())
+
+    def test_0D_array(self):
+        a = array(1)
+        b = array(2)
+        res = hstack([a, b])
+        desired = array([1, 2])
+        assert_array_equal(res, desired)
+
+    def test_1D_array(self):
+        a = array([1])
+        b = array([2])
+        res = hstack([a, b])
+        desired = array([1, 2])
+        assert_array_equal(res, desired)
+
+    def test_2D_array(self):
+        a = array([[1], [2]])
+        b = array([[1], [2]])
+        res = hstack([a, b])
+        desired = array([[1, 1], [2, 2]])
+        assert_array_equal(res, desired)
+
+    def test_generator(self):
+        with assert_warns(FutureWarning):
+            hstack((np.arange(3) for _ in range(2)))
+        with assert_warns(FutureWarning):
+            hstack(map(lambda x: x, np.ones((3, 2))))
+
+
+class TestVstack:
+    def test_non_iterable(self):
+        assert_raises(TypeError, vstack, 1)
+
+    def test_empty_input(self):
+        assert_raises(ValueError, vstack, ())
+
+    def test_0D_array(self):
+        a = array(1)
+        b = array(2)
+        res = vstack([a, b])
+        desired = array([[1], [2]])
+        assert_array_equal(res, desired)
+
+    def test_1D_array(self):
+        a = array([1])
+        b = array([2])
+        res = vstack([a, b])
+        desired = array([[1], [2]])
+        assert_array_equal(res, desired)
+
+    def test_2D_array(self):
+        a = array([[1], [2]])
+        b = array([[1], [2]])
+        res = vstack([a, b])
+        desired = array([[1], [2], [1], [2]])
+        assert_array_equal(res, desired)
+
+    def test_2D_array2(self):
+        a = array([1, 2])
+        b = array([1, 2])
+        res = vstack([a, b])
+        desired = array([[1, 2], [1, 2]])
+        assert_array_equal(res, desired)
+
+    def test_generator(self):
+        with assert_warns(FutureWarning):
+            vstack((np.arange(3) for _ in range(2)))
+
+
+class TestConcatenate:
+    def test_returns_copy(self):
+        a = np.eye(3)
+        b = np.concatenate([a])
+        b[0, 0] = 2
+        assert b[0, 0] != a[0, 0]
+
+    def test_exceptions(self):
+        # test axis must be in bounds
+        for ndim in [1, 2, 3]:
+            a = np.ones((1,)*ndim)
+            np.concatenate((a, a), axis=0)  # OK
+            assert_raises(np.AxisError, np.concatenate, (a, a), axis=ndim)
+            assert_raises(np.AxisError, np.concatenate, (a, a), axis=-(ndim + 1))
+
+        # Scalars cannot be concatenated
+        assert_raises(ValueError, concatenate, (0,))
+        assert_raises(ValueError, concatenate, (np.array(0),))
+
+        # dimensionality must match
+        assert_raises_regex(
+            ValueError,
+            r"all the input arrays must have same number of dimensions, but "
+            r"the array at index 0 has 1 dimension\(s\) and the array at "
+            r"index 1 has 2 dimension\(s\)",
+            np.concatenate, (np.zeros(1), np.zeros((1, 1))))
+
+        # test shapes must match except for concatenation axis
+        a = np.ones((1, 2, 3))
+        b = np.ones((2, 2, 3))
+        axis = list(range(3))
+        for i in range(3):
+            np.concatenate((a, b), axis=axis[0])  # OK
+            assert_raises_regex(
+                ValueError,
+                "all the input array dimensions for the concatenation axis "
+                "must match exactly, but along dimension {}, the array at "
+                "index 0 has size 1 and the array at index 1 has size 2"
+                .format(i),
+                np.concatenate, (a, b), axis=axis[1])
+            assert_raises(ValueError, np.concatenate, (a, b), axis=axis[2])
+            a = np.moveaxis(a, -1, 0)
+            b = np.moveaxis(b, -1, 0)
+            axis.append(axis.pop(0))
+
+        # No arrays to concatenate raises ValueError
+        assert_raises(ValueError, concatenate, ())
+
+    def test_concatenate_axis_None(self):
+        a = np.arange(4, dtype=np.float64).reshape((2, 2))
+        b = list(range(3))
+        c = ['x']
+        r = np.concatenate((a, a), axis=None)
+        assert_equal(r.dtype, a.dtype)
+        assert_equal(r.ndim, 1)
+        r = np.concatenate((a, b), axis=None)
+        assert_equal(r.size, a.size + len(b))
+        assert_equal(r.dtype, a.dtype)
+        r = np.concatenate((a, b, c), axis=None)
+        d = array(['0.0', '1.0', '2.0', '3.0',
+                   '0', '1', '2', 'x'])
+        assert_array_equal(r, d)
+
+        out = np.zeros(a.size + len(b))
+        r = np.concatenate((a, b), axis=None)
+        rout = np.concatenate((a, b), axis=None, out=out)
+        assert_(out is rout)
+        assert_equal(r, rout)
+
+    def test_large_concatenate_axis_None(self):
+        # When no axis is given, concatenate uses flattened versions.
+        # This also had a bug with many arrays (see gh-5979).
+        x = np.arange(1, 100)
+        r = np.concatenate(x, None)
+        assert_array_equal(x, r)
+
+        # This should probably be deprecated:
+        r = np.concatenate(x, 100)  # axis is >= MAXDIMS
+        assert_array_equal(x, r)
+
+    def test_concatenate(self):
+        # Test concatenate function
+        # One sequence returns unmodified (but as array)
+        r4 = list(range(4))
+        assert_array_equal(concatenate((r4,)), r4)
+        # Any sequence
+        assert_array_equal(concatenate((tuple(r4),)), r4)
+        assert_array_equal(concatenate((array(r4),)), r4)
+        # 1D default concatenation
+        r3 = list(range(3))
+        assert_array_equal(concatenate((r4, r3)), r4 + r3)
+        # Mixed sequence types
+        assert_array_equal(concatenate((tuple(r4), r3)), r4 + r3)
+        assert_array_equal(concatenate((array(r4), r3)), r4 + r3)
+        # Explicit axis specification
+        assert_array_equal(concatenate((r4, r3), 0), r4 + r3)
+        # Including negative
+        assert_array_equal(concatenate((r4, r3), -1), r4 + r3)
+        # 2D
+        a23 = array([[10, 11, 12], [13, 14, 15]])
+        a13 = array([[0, 1, 2]])
+        res = array([[10, 11, 12], [13, 14, 15], [0, 1, 2]])
+        assert_array_equal(concatenate((a23, a13)), res)
+        assert_array_equal(concatenate((a23, a13), 0), res)
+        assert_array_equal(concatenate((a23.T, a13.T), 1), res.T)
+        assert_array_equal(concatenate((a23.T, a13.T), -1), res.T)
+        # Arrays much match shape
+        assert_raises(ValueError, concatenate, (a23.T, a13.T), 0)
+        # 3D
+        res = arange(2 * 3 * 7).reshape((2, 3, 7))
+        a0 = res[..., :4]
+        a1 = res[..., 4:6]
+        a2 = res[..., 6:]
+        assert_array_equal(concatenate((a0, a1, a2), 2), res)
+        assert_array_equal(concatenate((a0, a1, a2), -1), res)
+        assert_array_equal(concatenate((a0.T, a1.T, a2.T), 0), res.T)
+
+        out = res.copy()
+        rout = concatenate((a0, a1, a2), 2, out=out)
+        assert_(out is rout)
+        assert_equal(res, rout)
+
+    def test_bad_out_shape(self):
+        a = array([1, 2])
+        b = array([3, 4])
+
+        assert_raises(ValueError, concatenate, (a, b), out=np.empty(5))
+        assert_raises(ValueError, concatenate, (a, b), out=np.empty((4,1)))
+        assert_raises(ValueError, concatenate, (a, b), out=np.empty((1,4)))
+        concatenate((a, b), out=np.empty(4))
+
+    def test_out_dtype(self):
+        out = np.empty(4, np.float32)
+        res = concatenate((array([1, 2]), array([3, 4])), out=out)
+        assert_(out is res)
+
+        out = np.empty(4, np.complex64)
+        res = concatenate((array([0.1, 0.2]), array([0.3, 0.4])), out=out)
+        assert_(out is res)
+
+        # invalid cast
+        out = np.empty(4, np.int32)
+        assert_raises(TypeError, concatenate,
+            (array([0.1, 0.2]), array([0.3, 0.4])), out=out)
+
+
+def test_stack():
+    # non-iterable input
+    assert_raises(TypeError, stack, 1)
+
+    # 0d input
+    for input_ in [(1, 2, 3),
+                   [np.int32(1), np.int32(2), np.int32(3)],
+                   [np.array(1), np.array(2), np.array(3)]]:
+        assert_array_equal(stack(input_), [1, 2, 3])
+    # 1d input examples
+    a = np.array([1, 2, 3])
+    b = np.array([4, 5, 6])
+    r1 = array([[1, 2, 3], [4, 5, 6]])
+    assert_array_equal(np.stack((a, b)), r1)
+    assert_array_equal(np.stack((a, b), axis=1), r1.T)
+    # all input types
+    assert_array_equal(np.stack(list([a, b])), r1)
+    assert_array_equal(np.stack(array([a, b])), r1)
+    # all shapes for 1d input
+    arrays = [np.random.randn(3) for _ in range(10)]
+    axes = [0, 1, -1, -2]
+    expected_shapes = [(10, 3), (3, 10), (3, 10), (10, 3)]
+    for axis, expected_shape in zip(axes, expected_shapes):
+        assert_equal(np.stack(arrays, axis).shape, expected_shape)
+    assert_raises_regex(np.AxisError, 'out of bounds', stack, arrays, axis=2)
+    assert_raises_regex(np.AxisError, 'out of bounds', stack, arrays, axis=-3)
+    # all shapes for 2d input
+    arrays = [np.random.randn(3, 4) for _ in range(10)]
+    axes = [0, 1, 2, -1, -2, -3]
+    expected_shapes = [(10, 3, 4), (3, 10, 4), (3, 4, 10),
+                       (3, 4, 10), (3, 10, 4), (10, 3, 4)]
+    for axis, expected_shape in zip(axes, expected_shapes):
+        assert_equal(np.stack(arrays, axis).shape, expected_shape)
+    # empty arrays
+    assert_(stack([[], [], []]).shape == (3, 0))
+    assert_(stack([[], [], []], axis=1).shape == (0, 3))
+    # out
+    out = np.zeros_like(r1)
+    np.stack((a, b), out=out)
+    assert_array_equal(out, r1)
+    # edge cases
+    assert_raises_regex(ValueError, 'need at least one array', stack, [])
+    assert_raises_regex(ValueError, 'must have the same shape',
+                        stack, [1, np.arange(3)])
+    assert_raises_regex(ValueError, 'must have the same shape',
+                        stack, [np.arange(3), 1])
+    assert_raises_regex(ValueError, 'must have the same shape',
+                        stack, [np.arange(3), 1], axis=1)
+    assert_raises_regex(ValueError, 'must have the same shape',
+                        stack, [np.zeros((3, 3)), np.zeros(3)], axis=1)
+    assert_raises_regex(ValueError, 'must have the same shape',
+                        stack, [np.arange(2), np.arange(3)])
+    # generator is deprecated
+    with assert_warns(FutureWarning):
+        result = stack((x for x in range(3)))
+    assert_array_equal(result, np.array([0, 1, 2]))
+
+
+class TestBlock:
+    @pytest.fixture(params=['block', 'force_concatenate', 'force_slicing'])
+    def block(self, request):
+        # blocking small arrays and large arrays go through different paths.
+        # the algorithm is triggered depending on the number of element
+        # copies required.
+        # We define a test fixture that forces most tests to go through
+        # both code paths.
+        # Ultimately, this should be removed if a single algorithm is found
+        # to be faster for both small and large arrays.
+        def _block_force_concatenate(arrays):
+            arrays, list_ndim, result_ndim, _ = _block_setup(arrays)
+            return _block_concatenate(arrays, list_ndim, result_ndim)
+
+        def _block_force_slicing(arrays):
+            arrays, list_ndim, result_ndim, _ = _block_setup(arrays)
+            return _block_slicing(arrays, list_ndim, result_ndim)
+
+        if request.param == 'force_concatenate':
+            return _block_force_concatenate
+        elif request.param == 'force_slicing':
+            return _block_force_slicing
+        elif request.param == 'block':
+            return block
+        else:
+            raise ValueError('Unknown blocking request. There is a typo in the tests.')
+
+    def test_returns_copy(self, block):
+        a = np.eye(3)
+        b = block(a)
+        b[0, 0] = 2
+        assert b[0, 0] != a[0, 0]
+
+    def test_block_total_size_estimate(self, block):
+        _, _, _, total_size = _block_setup([1])
+        assert total_size == 1
+
+        _, _, _, total_size = _block_setup([[1]])
+        assert total_size == 1
+
+        _, _, _, total_size = _block_setup([[1, 1]])
+        assert total_size == 2
+
+        _, _, _, total_size = _block_setup([[1], [1]])
+        assert total_size == 2
+
+        _, _, _, total_size = _block_setup([[1, 2], [3, 4]])
+        assert total_size == 4
+
+    def test_block_simple_row_wise(self, block):
+        a_2d = np.ones((2, 2))
+        b_2d = 2 * a_2d
+        desired = np.array([[1, 1, 2, 2],
+                            [1, 1, 2, 2]])
+        result = block([a_2d, b_2d])
+        assert_equal(desired, result)
+
+    def test_block_simple_column_wise(self, block):
+        a_2d = np.ones((2, 2))
+        b_2d = 2 * a_2d
+        expected = np.array([[1, 1],
+                             [1, 1],
+                             [2, 2],
+                             [2, 2]])
+        result = block([[a_2d], [b_2d]])
+        assert_equal(expected, result)
+
+    def test_block_with_1d_arrays_row_wise(self, block):
+        # # # 1-D vectors are treated as row arrays
+        a = np.array([1, 2, 3])
+        b = np.array([2, 3, 4])
+        expected = np.array([1, 2, 3, 2, 3, 4])
+        result = block([a, b])
+        assert_equal(expected, result)
+
+    def test_block_with_1d_arrays_multiple_rows(self, block):
+        a = np.array([1, 2, 3])
+        b = np.array([2, 3, 4])
+        expected = np.array([[1, 2, 3, 2, 3, 4],
+                             [1, 2, 3, 2, 3, 4]])
+        result = block([[a, b], [a, b]])
+        assert_equal(expected, result)
+
+    def test_block_with_1d_arrays_column_wise(self, block):
+        # # # 1-D vectors are treated as row arrays
+        a_1d = np.array([1, 2, 3])
+        b_1d = np.array([2, 3, 4])
+        expected = np.array([[1, 2, 3],
+                             [2, 3, 4]])
+        result = block([[a_1d], [b_1d]])
+        assert_equal(expected, result)
+
+    def test_block_mixed_1d_and_2d(self, block):
+        a_2d = np.ones((2, 2))
+        b_1d = np.array([2, 2])
+        result = block([[a_2d], [b_1d]])
+        expected = np.array([[1, 1],
+                             [1, 1],
+                             [2, 2]])
+        assert_equal(expected, result)
+
+    def test_block_complicated(self, block):
+        # a bit more complicated
+        one_2d = np.array([[1, 1, 1]])
+        two_2d = np.array([[2, 2, 2]])
+        three_2d = np.array([[3, 3, 3, 3, 3, 3]])
+        four_1d = np.array([4, 4, 4, 4, 4, 4])
+        five_0d = np.array(5)
+        six_1d = np.array([6, 6, 6, 6, 6])
+        zero_2d = np.zeros((2, 6))
+
+        expected = np.array([[1, 1, 1, 2, 2, 2],
+                             [3, 3, 3, 3, 3, 3],
+                             [4, 4, 4, 4, 4, 4],
+                             [5, 6, 6, 6, 6, 6],
+                             [0, 0, 0, 0, 0, 0],
+                             [0, 0, 0, 0, 0, 0]])
+
+        result = block([[one_2d, two_2d],
+                        [three_2d],
+                        [four_1d],
+                        [five_0d, six_1d],
+                        [zero_2d]])
+        assert_equal(result, expected)
+
+    def test_nested(self, block):
+        one = np.array([1, 1, 1])
+        two = np.array([[2, 2, 2], [2, 2, 2], [2, 2, 2]])
+        three = np.array([3, 3, 3])
+        four = np.array([4, 4, 4])
+        five = np.array(5)
+        six = np.array([6, 6, 6, 6, 6])
+        zero = np.zeros((2, 6))
+
+        result = block([
+            [
+                block([
+                   [one],
+                   [three],
+                   [four]
+                ]),
+                two
+            ],
+            [five, six],
+            [zero]
+        ])
+        expected = np.array([[1, 1, 1, 2, 2, 2],
+                             [3, 3, 3, 2, 2, 2],
+                             [4, 4, 4, 2, 2, 2],
+                             [5, 6, 6, 6, 6, 6],
+                             [0, 0, 0, 0, 0, 0],
+                             [0, 0, 0, 0, 0, 0]])
+
+        assert_equal(result, expected)
+
+    def test_3d(self, block):
+        a000 = np.ones((2, 2, 2), int) * 1
+
+        a100 = np.ones((3, 2, 2), int) * 2
+        a010 = np.ones((2, 3, 2), int) * 3
+        a001 = np.ones((2, 2, 3), int) * 4
+
+        a011 = np.ones((2, 3, 3), int) * 5
+        a101 = np.ones((3, 2, 3), int) * 6
+        a110 = np.ones((3, 3, 2), int) * 7
+
+        a111 = np.ones((3, 3, 3), int) * 8
+
+        result = block([
+            [
+                [a000, a001],
+                [a010, a011],
+            ],
+            [
+                [a100, a101],
+                [a110, a111],
+            ]
+        ])
+        expected = array([[[1, 1, 4, 4, 4],
+                           [1, 1, 4, 4, 4],
+                           [3, 3, 5, 5, 5],
+                           [3, 3, 5, 5, 5],
+                           [3, 3, 5, 5, 5]],
+
+                          [[1, 1, 4, 4, 4],
+                           [1, 1, 4, 4, 4],
+                           [3, 3, 5, 5, 5],
+                           [3, 3, 5, 5, 5],
+                           [3, 3, 5, 5, 5]],
+
+                          [[2, 2, 6, 6, 6],
+                           [2, 2, 6, 6, 6],
+                           [7, 7, 8, 8, 8],
+                           [7, 7, 8, 8, 8],
+                           [7, 7, 8, 8, 8]],
+
+                          [[2, 2, 6, 6, 6],
+                           [2, 2, 6, 6, 6],
+                           [7, 7, 8, 8, 8],
+                           [7, 7, 8, 8, 8],
+                           [7, 7, 8, 8, 8]],
+
+                          [[2, 2, 6, 6, 6],
+                           [2, 2, 6, 6, 6],
+                           [7, 7, 8, 8, 8],
+                           [7, 7, 8, 8, 8],
+                           [7, 7, 8, 8, 8]]])
+
+        assert_array_equal(result, expected)
+
+    def test_block_with_mismatched_shape(self, block):
+        a = np.array([0, 0])
+        b = np.eye(2)
+        assert_raises(ValueError, block, [a, b])
+        assert_raises(ValueError, block, [b, a])
+
+        to_block = [[np.ones((2,3)), np.ones((2,2))],
+                    [np.ones((2,2)), np.ones((2,2))]]
+        assert_raises(ValueError, block, to_block)
+    def test_no_lists(self, block):
+        assert_equal(block(1),         np.array(1))
+        assert_equal(block(np.eye(3)), np.eye(3))
+
+    def test_invalid_nesting(self, block):
+        msg = 'depths are mismatched'
+        assert_raises_regex(ValueError, msg, block, [1, [2]])
+        assert_raises_regex(ValueError, msg, block, [1, []])
+        assert_raises_regex(ValueError, msg, block, [[1], 2])
+        assert_raises_regex(ValueError, msg, block, [[], 2])
+        assert_raises_regex(ValueError, msg, block, [
+            [[1], [2]],
+            [[3, 4]],
+            [5]  # missing brackets
+        ])
+
+    def test_empty_lists(self, block):
+        assert_raises_regex(ValueError, 'empty', block, [])
+        assert_raises_regex(ValueError, 'empty', block, [[]])
+        assert_raises_regex(ValueError, 'empty', block, [[1], []])
+
+    def test_tuple(self, block):
+        assert_raises_regex(TypeError, 'tuple', block, ([1, 2], [3, 4]))
+        assert_raises_regex(TypeError, 'tuple', block, [(1, 2), (3, 4)])
+
+    def test_different_ndims(self, block):
+        a = 1.
+        b = 2 * np.ones((1, 2))
+        c = 3 * np.ones((1, 1, 3))
+
+        result = block([a, b, c])
+        expected = np.array([[[1., 2., 2., 3., 3., 3.]]])
+
+        assert_equal(result, expected)
+
+    def test_different_ndims_depths(self, block):
+        a = 1.
+        b = 2 * np.ones((1, 2))
+        c = 3 * np.ones((1, 2, 3))
+
+        result = block([[a, b], [c]])
+        expected = np.array([[[1., 2., 2.],
+                              [3., 3., 3.],
+                              [3., 3., 3.]]])
+
+        assert_equal(result, expected)
+
+    def test_block_memory_order(self, block):
+        # 3D
+        arr_c = np.zeros((3,)*3, order='C')
+        arr_f = np.zeros((3,)*3, order='F')
+
+        b_c = [[[arr_c, arr_c],
+                [arr_c, arr_c]],
+               [[arr_c, arr_c],
+                [arr_c, arr_c]]]
+
+        b_f = [[[arr_f, arr_f],
+                [arr_f, arr_f]],
+               [[arr_f, arr_f],
+                [arr_f, arr_f]]]
+
+        assert block(b_c).flags['C_CONTIGUOUS']
+        assert block(b_f).flags['F_CONTIGUOUS']
+
+        arr_c = np.zeros((3, 3), order='C')
+        arr_f = np.zeros((3, 3), order='F')
+        # 2D
+        b_c = [[arr_c, arr_c],
+               [arr_c, arr_c]]
+
+        b_f = [[arr_f, arr_f],
+               [arr_f, arr_f]]
+
+        assert block(b_c).flags['C_CONTIGUOUS']
+        assert block(b_f).flags['F_CONTIGUOUS']
+
+
+def test_block_dispatcher():
+    class ArrayLike:
+        pass
+    a = ArrayLike()
+    b = ArrayLike()
+    c = ArrayLike()
+    assert_equal(list(_block_dispatcher(a)), [a])
+    assert_equal(list(_block_dispatcher([a])), [a])
+    assert_equal(list(_block_dispatcher([a, b])), [a, b])
+    assert_equal(list(_block_dispatcher([[a], [b, [c]]])), [a, b, c])
+    # don't recurse into non-lists
+    assert_equal(list(_block_dispatcher((a, b))), [(a, b)])

venv/Lib/site-packages/numpy/core/tests/test_umath_accuracy.py

@@ -0,0 +1,59 @@
+import numpy as np
+import platform
+from os import path
+import sys
+import pytest
+from ctypes import c_longlong, c_double, c_float, c_int, cast, pointer, POINTER
+from numpy.testing import assert_array_max_ulp
+from numpy.core._multiarray_umath import __cpu_features__
+
+IS_AVX = __cpu_features__.get('AVX512F', False) or \
+        (__cpu_features__.get('FMA3', False) and __cpu_features__.get('AVX2', False))
+runtest = sys.platform.startswith('linux') and IS_AVX
+platform_skip = pytest.mark.skipif(not runtest,
+                                   reason="avoid testing inconsistent platform "
+                                   "library implementations")
+
+# convert string to hex function taken from:
+# https://stackoverflow.com/questions/1592158/convert-hex-to-float #
+def convert(s, datatype="np.float32"):
+    i = int(s, 16)                   # convert from hex to a Python int
+    if (datatype == "np.float64"):
+        cp = pointer(c_longlong(i))           # make this into a c long long integer
+        fp = cast(cp, POINTER(c_double))  # cast the int pointer to a double pointer
+    else:
+        cp = pointer(c_int(i))           # make this into a c integer
+        fp = cast(cp, POINTER(c_float))  # cast the int pointer to a float pointer
+
+    return fp.contents.value         # dereference the pointer, get the float
+
+str_to_float = np.vectorize(convert)
+files = ['umath-validation-set-exp',
+         'umath-validation-set-log',
+         'umath-validation-set-sin',
+         'umath-validation-set-cos']
+
+class TestAccuracy:
+    @platform_skip
+    def test_validate_transcendentals(self):
+        with np.errstate(all='ignore'):
+            for filename in files:
+                data_dir = path.join(path.dirname(__file__), 'data')
+                filepath = path.join(data_dir, filename)
+                with open(filepath) as fid:
+                    file_without_comments = (r for r in fid if not r[0] in ('$', '#'))
+                    data = np.genfromtxt(file_without_comments,
+                                         dtype=('|S39','|S39','|S39',int),
+                                         names=('type','input','output','ulperr'),
+                                         delimiter=',',
+                                         skip_header=1)
+                    npfunc = getattr(np, filename.split('-')[3])
+                    for datatype in np.unique(data['type']):
+                        data_subset = data[data['type'] == datatype]
+                        inval  = np.array(str_to_float(data_subset['input'].astype(str), data_subset['type'].astype(str)), dtype=eval(datatype))
+                        outval = np.array(str_to_float(data_subset['output'].astype(str), data_subset['type'].astype(str)), dtype=eval(datatype))
+                        perm = np.random.permutation(len(inval))
+                        inval = inval[perm]
+                        outval = outval[perm]
+                        maxulperr = data_subset['ulperr'].max()
+                        assert_array_max_ulp(npfunc(inval), outval, maxulperr)

venv/Lib/site-packages/numpy/core/tests/test_umath_complex.py

@@ -0,0 +1,610 @@
+import sys
+import platform
+import pytest
+
+import numpy as np
+# import the c-extension module directly since _arg is not exported via umath
+import numpy.core._multiarray_umath as ncu
+from numpy.testing import (
+    assert_raises, assert_equal, assert_array_equal, assert_almost_equal, assert_array_max_ulp
+    )
+
+# TODO: branch cuts (use Pauli code)
+# TODO: conj 'symmetry'
+# TODO: FPU exceptions
+
+# At least on Windows the results of many complex functions are not conforming
+# to the C99 standard. See ticket 1574.
+# Ditto for Solaris (ticket 1642) and OS X on PowerPC.
+#FIXME: this will probably change when we require full C99 campatibility
+with np.errstate(all='ignore'):
+    functions_seem_flaky = ((np.exp(complex(np.inf, 0)).imag != 0)
+                            or (np.log(complex(np.NZERO, 0)).imag != np.pi))
+# TODO: replace with a check on whether platform-provided C99 funcs are used
+xfail_complex_tests = (not sys.platform.startswith('linux') or functions_seem_flaky)
+
+# TODO This can be xfail when the generator functions are got rid of.
+platform_skip = pytest.mark.skipif(xfail_complex_tests,
+                                   reason="Inadequate C99 complex support")
+
+
+
+class TestCexp:
+    def test_simple(self):
+        check = check_complex_value
+        f = np.exp
+
+        check(f, 1, 0, np.exp(1), 0, False)
+        check(f, 0, 1, np.cos(1), np.sin(1), False)
+
+        ref = np.exp(1) * complex(np.cos(1), np.sin(1))
+        check(f, 1, 1, ref.real, ref.imag, False)
+
+    @platform_skip
+    def test_special_values(self):
+        # C99: Section G 6.3.1
+
+        check = check_complex_value
+        f = np.exp
+
+        # cexp(+-0 + 0i) is 1 + 0i
+        check(f, np.PZERO, 0, 1, 0, False)
+        check(f, np.NZERO, 0, 1, 0, False)
+
+        # cexp(x + infi) is nan + nani for finite x and raises 'invalid' FPU
+        # exception
+        check(f,  1, np.inf, np.nan, np.nan)
+        check(f, -1, np.inf, np.nan, np.nan)
+        check(f,  0, np.inf, np.nan, np.nan)
+
+        # cexp(inf + 0i) is inf + 0i
+        check(f,  np.inf, 0, np.inf, 0)
+
+        # cexp(-inf + yi) is +0 * (cos(y) + i sin(y)) for finite y
+        check(f,  -np.inf, 1, np.PZERO, np.PZERO)
+        check(f,  -np.inf, 0.75 * np.pi, np.NZERO, np.PZERO)
+
+        # cexp(inf + yi) is +inf * (cos(y) + i sin(y)) for finite y
+        check(f,  np.inf, 1, np.inf, np.inf)
+        check(f,  np.inf, 0.75 * np.pi, -np.inf, np.inf)
+
+        # cexp(-inf + inf i) is +-0 +- 0i (signs unspecified)
+        def _check_ninf_inf(dummy):
+            msgform = "cexp(-inf, inf) is (%f, %f), expected (+-0, +-0)"
+            with np.errstate(invalid='ignore'):
+                z = f(np.array(complex(-np.inf, np.inf)))
+                if z.real != 0 or z.imag != 0:
+                    raise AssertionError(msgform % (z.real, z.imag))
+
+        _check_ninf_inf(None)
+
+        # cexp(inf + inf i) is +-inf + NaNi and raised invalid FPU ex.
+        def _check_inf_inf(dummy):
+            msgform = "cexp(inf, inf) is (%f, %f), expected (+-inf, nan)"
+            with np.errstate(invalid='ignore'):
+                z = f(np.array(complex(np.inf, np.inf)))
+                if not np.isinf(z.real) or not np.isnan(z.imag):
+                    raise AssertionError(msgform % (z.real, z.imag))
+
+        _check_inf_inf(None)
+
+        # cexp(-inf + nan i) is +-0 +- 0i
+        def _check_ninf_nan(dummy):
+            msgform = "cexp(-inf, nan) is (%f, %f), expected (+-0, +-0)"
+            with np.errstate(invalid='ignore'):
+                z = f(np.array(complex(-np.inf, np.nan)))
+                if z.real != 0 or z.imag != 0:
+                    raise AssertionError(msgform % (z.real, z.imag))
+
+        _check_ninf_nan(None)
+
+        # cexp(inf + nan i) is +-inf + nan
+        def _check_inf_nan(dummy):
+            msgform = "cexp(-inf, nan) is (%f, %f), expected (+-inf, nan)"
+            with np.errstate(invalid='ignore'):
+                z = f(np.array(complex(np.inf, np.nan)))
+                if not np.isinf(z.real) or not np.isnan(z.imag):
+                    raise AssertionError(msgform % (z.real, z.imag))
+
+        _check_inf_nan(None)
+
+        # cexp(nan + yi) is nan + nani for y != 0 (optional: raises invalid FPU
+        # ex)
+        check(f, np.nan, 1, np.nan, np.nan)
+        check(f, np.nan, -1, np.nan, np.nan)
+
+        check(f, np.nan,  np.inf, np.nan, np.nan)
+        check(f, np.nan, -np.inf, np.nan, np.nan)
+
+        # cexp(nan + nani) is nan + nani
+        check(f, np.nan, np.nan, np.nan, np.nan)
+
+    # TODO This can be xfail when the generator functions are got rid of.
+    @pytest.mark.skip(reason="cexp(nan + 0I) is wrong on most platforms")
+    def test_special_values2(self):
+        # XXX: most implementations get it wrong here (including glibc <= 2.10)
+        # cexp(nan + 0i) is nan + 0i
+        check = check_complex_value
+        f = np.exp
+
+        check(f, np.nan, 0, np.nan, 0)
+
+class TestClog:
+    def test_simple(self):
+        x = np.array([1+0j, 1+2j])
+        y_r = np.log(np.abs(x)) + 1j * np.angle(x)
+        y = np.log(x)
+        for i in range(len(x)):
+            assert_almost_equal(y[i], y_r[i])
+
+    @platform_skip
+    @pytest.mark.skipif(platform.machine() == "armv5tel", reason="See gh-413.")
+    def test_special_values(self):
+        xl = []
+        yl = []
+
+        # From C99 std (Sec 6.3.2)
+        # XXX: check exceptions raised
+        # --- raise for invalid fails.
+
+        # clog(-0 + i0) returns -inf + i pi and raises the 'divide-by-zero'
+        # floating-point exception.
+        with np.errstate(divide='raise'):
+            x = np.array([np.NZERO], dtype=complex)
+            y = complex(-np.inf, np.pi)
+            assert_raises(FloatingPointError, np.log, x)
+        with np.errstate(divide='ignore'):
+            assert_almost_equal(np.log(x), y)
+
+        xl.append(x)
+        yl.append(y)
+
+        # clog(+0 + i0) returns -inf + i0 and raises the 'divide-by-zero'
+        # floating-point exception.
+        with np.errstate(divide='raise'):
+            x = np.array([0], dtype=complex)
+            y = complex(-np.inf, 0)
+            assert_raises(FloatingPointError, np.log, x)
+        with np.errstate(divide='ignore'):
+            assert_almost_equal(np.log(x), y)
+
+        xl.append(x)
+        yl.append(y)
+
+        # clog(x + i inf returns +inf + i pi /2, for finite x.
+        x = np.array([complex(1, np.inf)], dtype=complex)
+        y = complex(np.inf, 0.5 * np.pi)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        x = np.array([complex(-1, np.inf)], dtype=complex)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(x + iNaN) returns NaN + iNaN and optionally raises the
+        # 'invalid' floating- point exception, for finite x.
+        with np.errstate(invalid='raise'):
+            x = np.array([complex(1., np.nan)], dtype=complex)
+            y = complex(np.nan, np.nan)
+            #assert_raises(FloatingPointError, np.log, x)
+        with np.errstate(invalid='ignore'):
+            assert_almost_equal(np.log(x), y)
+
+        xl.append(x)
+        yl.append(y)
+
+        with np.errstate(invalid='raise'):
+            x = np.array([np.inf + 1j * np.nan], dtype=complex)
+            #assert_raises(FloatingPointError, np.log, x)
+        with np.errstate(invalid='ignore'):
+            assert_almost_equal(np.log(x), y)
+
+        xl.append(x)
+        yl.append(y)
+
+        # clog(- inf + iy) returns +inf + ipi , for finite positive-signed y.
+        x = np.array([-np.inf + 1j], dtype=complex)
+        y = complex(np.inf, np.pi)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(+ inf + iy) returns +inf + i0, for finite positive-signed y.
+        x = np.array([np.inf + 1j], dtype=complex)
+        y = complex(np.inf, 0)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(- inf + i inf) returns +inf + i3pi /4.
+        x = np.array([complex(-np.inf, np.inf)], dtype=complex)
+        y = complex(np.inf, 0.75 * np.pi)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(+ inf + i inf) returns +inf + ipi /4.
+        x = np.array([complex(np.inf, np.inf)], dtype=complex)
+        y = complex(np.inf, 0.25 * np.pi)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(+/- inf + iNaN) returns +inf + iNaN.
+        x = np.array([complex(np.inf, np.nan)], dtype=complex)
+        y = complex(np.inf, np.nan)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        x = np.array([complex(-np.inf, np.nan)], dtype=complex)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(NaN + iy) returns NaN + iNaN and optionally raises the
+        # 'invalid' floating-point exception, for finite y.
+        x = np.array([complex(np.nan, 1)], dtype=complex)
+        y = complex(np.nan, np.nan)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(NaN + i inf) returns +inf + iNaN.
+        x = np.array([complex(np.nan, np.inf)], dtype=complex)
+        y = complex(np.inf, np.nan)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(NaN + iNaN) returns NaN + iNaN.
+        x = np.array([complex(np.nan, np.nan)], dtype=complex)
+        y = complex(np.nan, np.nan)
+        assert_almost_equal(np.log(x), y)
+        xl.append(x)
+        yl.append(y)
+
+        # clog(conj(z)) = conj(clog(z)).
+        xa = np.array(xl, dtype=complex)
+        ya = np.array(yl, dtype=complex)
+        with np.errstate(divide='ignore'):
+            for i in range(len(xa)):
+                assert_almost_equal(np.log(xa[i].conj()), ya[i].conj())
+
+
+class TestCsqrt:
+
+    def test_simple(self):
+        # sqrt(1)
+        check_complex_value(np.sqrt, 1, 0, 1, 0)
+
+        # sqrt(1i)
+        rres = 0.5*np.sqrt(2)
+        ires = rres
+        check_complex_value(np.sqrt, 0, 1, rres, ires, False)
+
+        # sqrt(-1)
+        check_complex_value(np.sqrt, -1, 0, 0, 1)
+
+    def test_simple_conjugate(self):
+        ref = np.conj(np.sqrt(complex(1, 1)))
+
+        def f(z):
+            return np.sqrt(np.conj(z))
+
+        check_complex_value(f, 1, 1, ref.real, ref.imag, False)
+
+    #def test_branch_cut(self):
+    #    _check_branch_cut(f, -1, 0, 1, -1)
+
+    @platform_skip
+    def test_special_values(self):
+        # C99: Sec G 6.4.2
+
+        check = check_complex_value
+        f = np.sqrt
+
+        # csqrt(+-0 + 0i) is 0 + 0i
+        check(f, np.PZERO, 0, 0, 0)
+        check(f, np.NZERO, 0, 0, 0)
+
+        # csqrt(x + infi) is inf + infi for any x (including NaN)
+        check(f,  1, np.inf, np.inf, np.inf)
+        check(f, -1, np.inf, np.inf, np.inf)
+
+        check(f, np.PZERO, np.inf, np.inf, np.inf)
+        check(f, np.NZERO, np.inf, np.inf, np.inf)
+        check(f,   np.inf, np.inf, np.inf, np.inf)
+        check(f,  -np.inf, np.inf, np.inf, np.inf)
+        check(f,  -np.nan, np.inf, np.inf, np.inf)
+
+        # csqrt(x + nani) is nan + nani for any finite x
+        check(f,  1, np.nan, np.nan, np.nan)
+        check(f, -1, np.nan, np.nan, np.nan)
+        check(f,  0, np.nan, np.nan, np.nan)
+
+        # csqrt(-inf + yi) is +0 + infi for any finite y > 0
+        check(f, -np.inf, 1, np.PZERO, np.inf)
+
+        # csqrt(inf + yi) is +inf + 0i for any finite y > 0
+        check(f, np.inf, 1, np.inf, np.PZERO)
+
+        # csqrt(-inf + nani) is nan +- infi (both +i infi are valid)
+        def _check_ninf_nan(dummy):
+            msgform = "csqrt(-inf, nan) is (%f, %f), expected (nan, +-inf)"
+            z = np.sqrt(np.array(complex(-np.inf, np.nan)))
+            #Fixme: ugly workaround for isinf bug.
+            with np.errstate(invalid='ignore'):
+                if not (np.isnan(z.real) and np.isinf(z.imag)):
+                    raise AssertionError(msgform % (z.real, z.imag))
+
+        _check_ninf_nan(None)
+
+        # csqrt(+inf + nani) is inf + nani
+        check(f, np.inf, np.nan, np.inf, np.nan)
+
+        # csqrt(nan + yi) is nan + nani for any finite y (infinite handled in x
+        # + nani)
+        check(f, np.nan,       0, np.nan, np.nan)
+        check(f, np.nan,       1, np.nan, np.nan)
+        check(f, np.nan,  np.nan, np.nan, np.nan)
+
+        # XXX: check for conj(csqrt(z)) == csqrt(conj(z)) (need to fix branch
+        # cuts first)
+
+class TestCpow:
+    def setup(self):
+        self.olderr = np.seterr(invalid='ignore')
+
+    def teardown(self):
+        np.seterr(**self.olderr)
+
+    def test_simple(self):
+        x = np.array([1+1j, 0+2j, 1+2j, np.inf, np.nan])
+        y_r = x ** 2
+        y = np.power(x, 2)
+        for i in range(len(x)):
+            assert_almost_equal(y[i], y_r[i])
+
+    def test_scalar(self):
+        x = np.array([1, 1j,         2,  2.5+.37j, np.inf, np.nan])
+        y = np.array([1, 1j, -0.5+1.5j, -0.5+1.5j,      2,      3])
+        lx = list(range(len(x)))
+        # Compute the values for complex type in python
+        p_r = [complex(x[i]) ** complex(y[i]) for i in lx]
+        # Substitute a result allowed by C99 standard
+        p_r[4] = complex(np.inf, np.nan)
+        # Do the same with numpy complex scalars
+        n_r = [x[i] ** y[i] for i in lx]
+        for i in lx:
+            assert_almost_equal(n_r[i], p_r[i], err_msg='Loop %d\n' % i)
+
+    def test_array(self):
+        x = np.array([1, 1j,         2,  2.5+.37j, np.inf, np.nan])
+        y = np.array([1, 1j, -0.5+1.5j, -0.5+1.5j,      2,      3])
+        lx = list(range(len(x)))
+        # Compute the values for complex type in python
+        p_r = [complex(x[i]) ** complex(y[i]) for i in lx]
+        # Substitute a result allowed by C99 standard
+        p_r[4] = complex(np.inf, np.nan)
+        # Do the same with numpy arrays
+        n_r = x ** y
+        for i in lx:
+            assert_almost_equal(n_r[i], p_r[i], err_msg='Loop %d\n' % i)
+
+class TestCabs:
+    def setup(self):
+        self.olderr = np.seterr(invalid='ignore')
+
+    def teardown(self):
+        np.seterr(**self.olderr)
+
+    def test_simple(self):
+        x = np.array([1+1j, 0+2j, 1+2j, np.inf, np.nan])
+        y_r = np.array([np.sqrt(2.), 2, np.sqrt(5), np.inf, np.nan])
+        y = np.abs(x)
+        for i in range(len(x)):
+            assert_almost_equal(y[i], y_r[i])
+
+    def test_fabs(self):
+        # Test that np.abs(x +- 0j) == np.abs(x) (as mandated by C99 for cabs)
+        x = np.array([1+0j], dtype=complex)
+        assert_array_equal(np.abs(x), np.real(x))
+
+        x = np.array([complex(1, np.NZERO)], dtype=complex)
+        assert_array_equal(np.abs(x), np.real(x))
+
+        x = np.array([complex(np.inf, np.NZERO)], dtype=complex)
+        assert_array_equal(np.abs(x), np.real(x))
+
+        x = np.array([complex(np.nan, np.NZERO)], dtype=complex)
+        assert_array_equal(np.abs(x), np.real(x))
+
+    def test_cabs_inf_nan(self):
+        x, y = [], []
+
+        # cabs(+-nan + nani) returns nan
+        x.append(np.nan)
+        y.append(np.nan)
+        check_real_value(np.abs,  np.nan, np.nan, np.nan)
+
+        x.append(np.nan)
+        y.append(-np.nan)
+        check_real_value(np.abs, -np.nan, np.nan, np.nan)
+
+        # According to C99 standard, if exactly one of the real/part is inf and
+        # the other nan, then cabs should return inf
+        x.append(np.inf)
+        y.append(np.nan)
+        check_real_value(np.abs,  np.inf, np.nan, np.inf)
+
+        x.append(-np.inf)
+        y.append(np.nan)
+        check_real_value(np.abs, -np.inf, np.nan, np.inf)
+
+        # cabs(conj(z)) == conj(cabs(z)) (= cabs(z))
+        def f(a):
+            return np.abs(np.conj(a))
+
+        def g(a, b):
+            return np.abs(complex(a, b))
+
+        xa = np.array(x, dtype=complex)
+        for i in range(len(xa)):
+            ref = g(x[i], y[i])
+            check_real_value(f, x[i], y[i], ref)
+
+class TestCarg:
+    def test_simple(self):
+        check_real_value(ncu._arg, 1, 0, 0, False)
+        check_real_value(ncu._arg, 0, 1, 0.5*np.pi, False)
+
+        check_real_value(ncu._arg, 1, 1, 0.25*np.pi, False)
+        check_real_value(ncu._arg, np.PZERO, np.PZERO, np.PZERO)
+
+    # TODO This can be xfail when the generator functions are got rid of.
+    @pytest.mark.skip(
+        reason="Complex arithmetic with signed zero fails on most platforms")
+    def test_zero(self):
+        # carg(-0 +- 0i) returns +- pi
+        check_real_value(ncu._arg, np.NZERO, np.PZERO,  np.pi, False)
+        check_real_value(ncu._arg, np.NZERO, np.NZERO, -np.pi, False)
+
+        # carg(+0 +- 0i) returns +- 0
+        check_real_value(ncu._arg, np.PZERO, np.PZERO, np.PZERO)
+        check_real_value(ncu._arg, np.PZERO, np.NZERO, np.NZERO)
+
+        # carg(x +- 0i) returns +- 0 for x > 0
+        check_real_value(ncu._arg, 1, np.PZERO, np.PZERO, False)
+        check_real_value(ncu._arg, 1, np.NZERO, np.NZERO, False)
+
+        # carg(x +- 0i) returns +- pi for x < 0
+        check_real_value(ncu._arg, -1, np.PZERO,  np.pi, False)
+        check_real_value(ncu._arg, -1, np.NZERO, -np.pi, False)
+
+        # carg(+- 0 + yi) returns pi/2 for y > 0
+        check_real_value(ncu._arg, np.PZERO, 1, 0.5 * np.pi, False)
+        check_real_value(ncu._arg, np.NZERO, 1, 0.5 * np.pi, False)
+
+        # carg(+- 0 + yi) returns -pi/2 for y < 0
+        check_real_value(ncu._arg, np.PZERO, -1, 0.5 * np.pi, False)
+        check_real_value(ncu._arg, np.NZERO, -1, -0.5 * np.pi, False)
+
+    #def test_branch_cuts(self):
+    #    _check_branch_cut(ncu._arg, -1, 1j, -1, 1)
+
+    def test_special_values(self):
+        # carg(-np.inf +- yi) returns +-pi for finite y > 0
+        check_real_value(ncu._arg, -np.inf,  1,  np.pi, False)
+        check_real_value(ncu._arg, -np.inf, -1, -np.pi, False)
+
+        # carg(np.inf +- yi) returns +-0 for finite y > 0
+        check_real_value(ncu._arg, np.inf,  1, np.PZERO, False)
+        check_real_value(ncu._arg, np.inf, -1, np.NZERO, False)
+
+        # carg(x +- np.infi) returns +-pi/2 for finite x
+        check_real_value(ncu._arg, 1,  np.inf,  0.5 * np.pi, False)
+        check_real_value(ncu._arg, 1, -np.inf, -0.5 * np.pi, False)
+
+        # carg(-np.inf +- np.infi) returns +-3pi/4
+        check_real_value(ncu._arg, -np.inf,  np.inf,  0.75 * np.pi, False)
+        check_real_value(ncu._arg, -np.inf, -np.inf, -0.75 * np.pi, False)
+
+        # carg(np.inf +- np.infi) returns +-pi/4
+        check_real_value(ncu._arg, np.inf,  np.inf,  0.25 * np.pi, False)
+        check_real_value(ncu._arg, np.inf, -np.inf, -0.25 * np.pi, False)
+
+        # carg(x + yi) returns np.nan if x or y is nan
+        check_real_value(ncu._arg, np.nan,      0, np.nan, False)
+        check_real_value(ncu._arg,      0, np.nan, np.nan, False)
+
+        check_real_value(ncu._arg, np.nan, np.inf, np.nan, False)
+        check_real_value(ncu._arg, np.inf, np.nan, np.nan, False)
+
+
+def check_real_value(f, x1, y1, x, exact=True):
+    z1 = np.array([complex(x1, y1)])
+    if exact:
+        assert_equal(f(z1), x)
+    else:
+        assert_almost_equal(f(z1), x)
+
+
+def check_complex_value(f, x1, y1, x2, y2, exact=True):
+    z1 = np.array([complex(x1, y1)])
+    z2 = complex(x2, y2)
+    with np.errstate(invalid='ignore'):
+        if exact:
+            assert_equal(f(z1), z2)
+        else:
+            assert_almost_equal(f(z1), z2)
+
+class TestSpecialComplexAVX(object):
+    @pytest.mark.parametrize("stride", [-4,-2,-1,1,2,4])
+    @pytest.mark.parametrize("astype", [np.complex64, np.complex128])
+    def test_array(self, stride, astype):
+        arr = np.array([np.complex(np.nan , np.nan),
+                        np.complex(np.nan , np.inf),
+                        np.complex(np.inf , np.nan),
+                        np.complex(np.inf , np.inf),
+                        np.complex(0.     , np.inf),
+                        np.complex(np.inf , 0.),
+                        np.complex(0.     , 0.),
+                        np.complex(0.     , np.nan),
+                        np.complex(np.nan , 0.)], dtype=astype)
+        abs_true = np.array([np.nan, np.inf, np.inf, np.inf, np.inf, np.inf, 0., np.nan, np.nan], dtype=arr.real.dtype)
+        sq_true = np.array([np.complex(np.nan,  np.nan),
+                            np.complex(np.nan,  np.nan),
+                            np.complex(np.nan,  np.nan),
+                            np.complex(np.nan,  np.inf),
+                            np.complex(-np.inf, np.nan),
+                            np.complex(np.inf,  np.nan),
+                            np.complex(0.,     0.),
+                            np.complex(np.nan, np.nan),
+                            np.complex(np.nan, np.nan)], dtype=astype)
+        assert_equal(np.abs(arr[::stride]), abs_true[::stride])
+        with np.errstate(invalid='ignore'):
+            assert_equal(np.square(arr[::stride]), sq_true[::stride])
+
+class TestComplexAbsoluteAVX(object):
+    @pytest.mark.parametrize("arraysize", [1,2,3,4,5,6,7,8,9,10,11,13,15,17,18,19])
+    @pytest.mark.parametrize("stride", [-4,-3,-2,-1,1,2,3,4])
+    @pytest.mark.parametrize("astype", [np.complex64, np.complex128])
+    # test to ensure masking and strides work as intended in the AVX implementation
+    def test_array(self, arraysize, stride, astype):
+        arr = np.ones(arraysize, dtype=astype)
+        abs_true = np.ones(arraysize, dtype=arr.real.dtype)
+        assert_equal(np.abs(arr[::stride]), abs_true[::stride])
+
+# Testcase taken as is from https://github.com/numpy/numpy/issues/16660
+class TestComplexAbsoluteMixedDTypes(object):
+    @pytest.mark.parametrize("stride", [-4,-3,-2,-1,1,2,3,4])
+    @pytest.mark.parametrize("astype", [np.complex64, np.complex128])
+    @pytest.mark.parametrize("func", ['abs', 'square', 'conjugate'])
+    
+    def test_array(self, stride, astype, func):
+        dtype = [('template_id', '<i8'), ('bank_chisq','<f4'),
+                 ('bank_chisq_dof','<i8'), ('chisq', '<f4'), ('chisq_dof','<i8'),
+                 ('cont_chisq', '<f4'), ('psd_var_val', '<f4'), ('sg_chisq','<f4'),
+                 ('mycomplex', astype), ('time_index', '<i8')]
+        vec = np.array([
+               (0, 0., 0, -31.666483, 200, 0., 0.,  1.      ,  3.0+4.0j   ,  613090),
+               (1, 0., 0, 260.91525 ,  42, 0., 0.,  1.      ,  5.0+12.0j  ,  787315),
+               (1, 0., 0,  52.15155 ,  42, 0., 0.,  1.      ,  8.0+15.0j  ,  806641),
+               (1, 0., 0,  52.430195,  42, 0., 0.,  1.      ,  7.0+24.0j  , 1363540),
+               (2, 0., 0, 304.43646 ,  58, 0., 0.,  1.      ,  20.0+21.0j ,  787323),
+               (3, 0., 0, 299.42108 ,  52, 0., 0.,  1.      ,  12.0+35.0j ,  787332),
+               (4, 0., 0,  39.4836  ,  28, 0., 0.,  9.182192,  9.0+40.0j  ,  787304),
+               (4, 0., 0,  76.83787 ,  28, 0., 0.,  1.      ,  28.0+45.0j, 1321869),
+               (5, 0., 0, 143.26366 ,  24, 0., 0., 10.996129,  11.0+60.0j ,  787299)], dtype=dtype)
+        myfunc = getattr(np, func)
+        a = vec['mycomplex']
+        g = myfunc(a[::stride])
+        
+        b = vec['mycomplex'].copy()
+        h = myfunc(b[::stride])
+        
+        assert_array_max_ulp(h.real, g.real, 1)
+        assert_array_max_ulp(h.imag, g.imag, 1)

venv/Lib/site-packages/numpy/core/tests/test_unicode.py

@@ -0,0 +1,362 @@
+import numpy as np
+from numpy.testing import assert_, assert_equal, assert_array_equal
+
+def buffer_length(arr):
+    if isinstance(arr, str):
+        if not arr:
+            charmax = 0
+        else:
+            charmax = max([ord(c) for c in arr])
+        if charmax < 256:
+            size = 1
+        elif charmax < 65536:
+            size = 2
+        else:
+            size = 4
+        return size * len(arr)
+    v = memoryview(arr)
+    if v.shape is None:
+        return len(v) * v.itemsize
+    else:
+        return np.prod(v.shape) * v.itemsize
+
+# In both cases below we need to make sure that the byte swapped value (as
+# UCS4) is still a valid unicode:
+# Value that can be represented in UCS2 interpreters
+ucs2_value = u'\u0900'
+# Value that cannot be represented in UCS2 interpreters (but can in UCS4)
+ucs4_value = u'\U00100900'
+
+
+def test_string_cast():
+    str_arr = np.array(["1234", "1234\0\0"], dtype='S')
+    uni_arr1 = str_arr.astype('>U')
+    uni_arr2 = str_arr.astype('<U')
+
+    assert_(str_arr != uni_arr1)
+    assert_(str_arr != uni_arr2)
+    assert_array_equal(uni_arr1, uni_arr2)
+
+
+############################################################
+#    Creation tests
+############################################################
+
+class CreateZeros:
+    """Check the creation of zero-valued arrays"""
+
+    def content_check(self, ua, ua_scalar, nbytes):
+
+        # Check the length of the unicode base type
+        assert_(int(ua.dtype.str[2:]) == self.ulen)
+        # Check the length of the data buffer
+        assert_(buffer_length(ua) == nbytes)
+        # Small check that data in array element is ok
+        assert_(ua_scalar == u'')
+        # Encode to ascii and double check
+        assert_(ua_scalar.encode('ascii') == b'')
+        # Check buffer lengths for scalars
+        assert_(buffer_length(ua_scalar) == 0)
+
+    def test_zeros0D(self):
+        # Check creation of 0-dimensional objects
+        ua = np.zeros((), dtype='U%s' % self.ulen)
+        self.content_check(ua, ua[()], 4*self.ulen)
+
+    def test_zerosSD(self):
+        # Check creation of single-dimensional objects
+        ua = np.zeros((2,), dtype='U%s' % self.ulen)
+        self.content_check(ua, ua[0], 4*self.ulen*2)
+        self.content_check(ua, ua[1], 4*self.ulen*2)
+
+    def test_zerosMD(self):
+        # Check creation of multi-dimensional objects
+        ua = np.zeros((2, 3, 4), dtype='U%s' % self.ulen)
+        self.content_check(ua, ua[0, 0, 0], 4*self.ulen*2*3*4)
+        self.content_check(ua, ua[-1, -1, -1], 4*self.ulen*2*3*4)
+
+
+class TestCreateZeros_1(CreateZeros):
+    """Check the creation of zero-valued arrays (size 1)"""
+    ulen = 1
+
+
+class TestCreateZeros_2(CreateZeros):
+    """Check the creation of zero-valued arrays (size 2)"""
+    ulen = 2
+
+
+class TestCreateZeros_1009(CreateZeros):
+    """Check the creation of zero-valued arrays (size 1009)"""
+    ulen = 1009
+
+
+class CreateValues:
+    """Check the creation of unicode arrays with values"""
+
+    def content_check(self, ua, ua_scalar, nbytes):
+
+        # Check the length of the unicode base type
+        assert_(int(ua.dtype.str[2:]) == self.ulen)
+        # Check the length of the data buffer
+        assert_(buffer_length(ua) == nbytes)
+        # Small check that data in array element is ok
+        assert_(ua_scalar == self.ucs_value*self.ulen)
+        # Encode to UTF-8 and double check
+        assert_(ua_scalar.encode('utf-8') ==
+                        (self.ucs_value*self.ulen).encode('utf-8'))
+        # Check buffer lengths for scalars
+        if self.ucs_value == ucs4_value:
+            # In UCS2, the \U0010FFFF will be represented using a
+            # surrogate *pair*
+            assert_(buffer_length(ua_scalar) == 2*2*self.ulen)
+        else:
+            # In UCS2, the \uFFFF will be represented using a
+            # regular 2-byte word
+            assert_(buffer_length(ua_scalar) == 2*self.ulen)
+
+    def test_values0D(self):
+        # Check creation of 0-dimensional objects with values
+        ua = np.array(self.ucs_value*self.ulen, dtype='U%s' % self.ulen)
+        self.content_check(ua, ua[()], 4*self.ulen)
+
+    def test_valuesSD(self):
+        # Check creation of single-dimensional objects with values
+        ua = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen)
+        self.content_check(ua, ua[0], 4*self.ulen*2)
+        self.content_check(ua, ua[1], 4*self.ulen*2)
+
+    def test_valuesMD(self):
+        # Check creation of multi-dimensional objects with values
+        ua = np.array([[[self.ucs_value*self.ulen]*2]*3]*4, dtype='U%s' % self.ulen)
+        self.content_check(ua, ua[0, 0, 0], 4*self.ulen*2*3*4)
+        self.content_check(ua, ua[-1, -1, -1], 4*self.ulen*2*3*4)
+
+
+class TestCreateValues_1_UCS2(CreateValues):
+    """Check the creation of valued arrays (size 1, UCS2 values)"""
+    ulen = 1
+    ucs_value = ucs2_value
+
+
+class TestCreateValues_1_UCS4(CreateValues):
+    """Check the creation of valued arrays (size 1, UCS4 values)"""
+    ulen = 1
+    ucs_value = ucs4_value
+
+
+class TestCreateValues_2_UCS2(CreateValues):
+    """Check the creation of valued arrays (size 2, UCS2 values)"""
+    ulen = 2
+    ucs_value = ucs2_value
+
+
+class TestCreateValues_2_UCS4(CreateValues):
+    """Check the creation of valued arrays (size 2, UCS4 values)"""
+    ulen = 2
+    ucs_value = ucs4_value
+
+
+class TestCreateValues_1009_UCS2(CreateValues):
+    """Check the creation of valued arrays (size 1009, UCS2 values)"""
+    ulen = 1009
+    ucs_value = ucs2_value
+
+
+class TestCreateValues_1009_UCS4(CreateValues):
+    """Check the creation of valued arrays (size 1009, UCS4 values)"""
+    ulen = 1009
+    ucs_value = ucs4_value
+
+
+############################################################
+#    Assignment tests
+############################################################
+
+class AssignValues:
+    """Check the assignment of unicode arrays with values"""
+
+    def content_check(self, ua, ua_scalar, nbytes):
+
+        # Check the length of the unicode base type
+        assert_(int(ua.dtype.str[2:]) == self.ulen)
+        # Check the length of the data buffer
+        assert_(buffer_length(ua) == nbytes)
+        # Small check that data in array element is ok
+        assert_(ua_scalar == self.ucs_value*self.ulen)
+        # Encode to UTF-8 and double check
+        assert_(ua_scalar.encode('utf-8') ==
+                        (self.ucs_value*self.ulen).encode('utf-8'))
+        # Check buffer lengths for scalars
+        if self.ucs_value == ucs4_value:
+            # In UCS2, the \U0010FFFF will be represented using a
+            # surrogate *pair*
+            assert_(buffer_length(ua_scalar) == 2*2*self.ulen)
+        else:
+            # In UCS2, the \uFFFF will be represented using a
+            # regular 2-byte word
+            assert_(buffer_length(ua_scalar) == 2*self.ulen)
+
+    def test_values0D(self):
+        # Check assignment of 0-dimensional objects with values
+        ua = np.zeros((), dtype='U%s' % self.ulen)
+        ua[()] = self.ucs_value*self.ulen
+        self.content_check(ua, ua[()], 4*self.ulen)
+
+    def test_valuesSD(self):
+        # Check assignment of single-dimensional objects with values
+        ua = np.zeros((2,), dtype='U%s' % self.ulen)
+        ua[0] = self.ucs_value*self.ulen
+        self.content_check(ua, ua[0], 4*self.ulen*2)
+        ua[1] = self.ucs_value*self.ulen
+        self.content_check(ua, ua[1], 4*self.ulen*2)
+
+    def test_valuesMD(self):
+        # Check assignment of multi-dimensional objects with values
+        ua = np.zeros((2, 3, 4), dtype='U%s' % self.ulen)
+        ua[0, 0, 0] = self.ucs_value*self.ulen
+        self.content_check(ua, ua[0, 0, 0], 4*self.ulen*2*3*4)
+        ua[-1, -1, -1] = self.ucs_value*self.ulen
+        self.content_check(ua, ua[-1, -1, -1], 4*self.ulen*2*3*4)
+
+
+class TestAssignValues_1_UCS2(AssignValues):
+    """Check the assignment of valued arrays (size 1, UCS2 values)"""
+    ulen = 1
+    ucs_value = ucs2_value
+
+
+class TestAssignValues_1_UCS4(AssignValues):
+    """Check the assignment of valued arrays (size 1, UCS4 values)"""
+    ulen = 1
+    ucs_value = ucs4_value
+
+
+class TestAssignValues_2_UCS2(AssignValues):
+    """Check the assignment of valued arrays (size 2, UCS2 values)"""
+    ulen = 2
+    ucs_value = ucs2_value
+
+
+class TestAssignValues_2_UCS4(AssignValues):
+    """Check the assignment of valued arrays (size 2, UCS4 values)"""
+    ulen = 2
+    ucs_value = ucs4_value
+
+
+class TestAssignValues_1009_UCS2(AssignValues):
+    """Check the assignment of valued arrays (size 1009, UCS2 values)"""
+    ulen = 1009
+    ucs_value = ucs2_value
+
+
+class TestAssignValues_1009_UCS4(AssignValues):
+    """Check the assignment of valued arrays (size 1009, UCS4 values)"""
+    ulen = 1009
+    ucs_value = ucs4_value
+
+
+############################################################
+#    Byteorder tests
+############################################################
+
+class ByteorderValues:
+    """Check the byteorder of unicode arrays in round-trip conversions"""
+
+    def test_values0D(self):
+        # Check byteorder of 0-dimensional objects
+        ua = np.array(self.ucs_value*self.ulen, dtype='U%s' % self.ulen)
+        ua2 = ua.newbyteorder()
+        # This changes the interpretation of the data region (but not the
+        #  actual data), therefore the returned scalars are not
+        #  the same (they are byte-swapped versions of each other).
+        assert_(ua[()] != ua2[()])
+        ua3 = ua2.newbyteorder()
+        # Arrays must be equal after the round-trip
+        assert_equal(ua, ua3)
+
+    def test_valuesSD(self):
+        # Check byteorder of single-dimensional objects
+        ua = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen)
+        ua2 = ua.newbyteorder()
+        assert_((ua != ua2).all())
+        assert_(ua[-1] != ua2[-1])
+        ua3 = ua2.newbyteorder()
+        # Arrays must be equal after the round-trip
+        assert_equal(ua, ua3)
+
+    def test_valuesMD(self):
+        # Check byteorder of multi-dimensional objects
+        ua = np.array([[[self.ucs_value*self.ulen]*2]*3]*4,
+                      dtype='U%s' % self.ulen)
+        ua2 = ua.newbyteorder()
+        assert_((ua != ua2).all())
+        assert_(ua[-1, -1, -1] != ua2[-1, -1, -1])
+        ua3 = ua2.newbyteorder()
+        # Arrays must be equal after the round-trip
+        assert_equal(ua, ua3)
+
+    def test_values_cast(self):
+        # Check byteorder of when casting the array for a strided and
+        # contiguous array:
+        test1 = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen)
+        test2 = np.repeat(test1, 2)[::2]
+        for ua in (test1, test2):
+            ua2 = ua.astype(dtype=ua.dtype.newbyteorder())
+            assert_((ua == ua2).all())
+            assert_(ua[-1] == ua2[-1])
+            ua3 = ua2.astype(dtype=ua.dtype)
+            # Arrays must be equal after the round-trip
+            assert_equal(ua, ua3)
+
+    def test_values_updowncast(self):
+        # Check byteorder of when casting the array to a longer and shorter
+        # string length for strided and contiguous arrays
+        test1 = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen)
+        test2 = np.repeat(test1, 2)[::2]
+        for ua in (test1, test2):
+            # Cast to a longer type with zero padding
+            longer_type = np.dtype('U%s' % (self.ulen+1)).newbyteorder()
+            ua2 = ua.astype(dtype=longer_type)
+            assert_((ua == ua2).all())
+            assert_(ua[-1] == ua2[-1])
+            # Cast back again with truncating:
+            ua3 = ua2.astype(dtype=ua.dtype)
+            # Arrays must be equal after the round-trip
+            assert_equal(ua, ua3)
+
+
+class TestByteorder_1_UCS2(ByteorderValues):
+    """Check the byteorder in unicode (size 1, UCS2 values)"""
+    ulen = 1
+    ucs_value = ucs2_value
+
+
+class TestByteorder_1_UCS4(ByteorderValues):
+    """Check the byteorder in unicode (size 1, UCS4 values)"""
+    ulen = 1
+    ucs_value = ucs4_value
+
+
+class TestByteorder_2_UCS2(ByteorderValues):
+    """Check the byteorder in unicode (size 2, UCS2 values)"""
+    ulen = 2
+    ucs_value = ucs2_value
+
+
+class TestByteorder_2_UCS4(ByteorderValues):
+    """Check the byteorder in unicode (size 2, UCS4 values)"""
+    ulen = 2
+    ucs_value = ucs4_value
+
+
+class TestByteorder_1009_UCS2(ByteorderValues):
+    """Check the byteorder in unicode (size 1009, UCS2 values)"""
+    ulen = 1009
+    ucs_value = ucs2_value
+
+
+class TestByteorder_1009_UCS4(ByteorderValues):
+    """Check the byteorder in unicode (size 1009, UCS4 values)"""
+    ulen = 1009
+    ucs_value = ucs4_value