NET-Web-API-w-Angular/my-app/.angular/cache/17.1.3/vite/deps_temp_f5a2fd8f/chunk-L6IRO5SR.js

import {
  APP_BOOTSTRAP_LISTENER,
  APP_ID,
  ApplicationModule,
  ApplicationRef,
  Attribute,
  CSP_NONCE,
  ChangeDetectorRef,
  Console,
  DEFAULT_CURRENCY_CODE,
  Directive,
  ENVIRONMENT_INITIALIZER,
  ElementRef,
  EnvironmentInjector,
  ErrorHandler,
  EventEmitter,
  Host,
  IMAGE_CONFIG,
  IMAGE_CONFIG_DEFAULTS,
  INJECTOR_SCOPE,
  Inject,
  Injectable,
  InjectionToken,
  Injector,
  Input,
  InputFlags,
  IterableDiffers,
  KeyValueDiffers,
  LOCALE_ID,
  LocaleDataIndex,
  NgModule,
  NgModuleRef$1,
  NgZone,
  Observable,
  Optional,
  PLATFORM_ID,
  PLATFORM_INITIALIZER,
  PendingTasks,
  Pipe,
  Renderer2,
  RendererFactory2,
  RendererStyleFlags2,
  RuntimeError,
  SecurityContext,
  SkipSelf,
  TESTABILITY,
  TESTABILITY_GETTER,
  TemplateRef,
  Testability,
  TestabilityRegistry,
  TransferState,
  Version,
  ViewContainerRef,
  ViewEncapsulation$1,
  XSS_SECURITY_URL,
  __async,
  __objRest,
  __spreadProps,
  __spreadValues,
  _global,
  _sanitizeHtml,
  _sanitizeUrl,
  allowSanitizationBypassAndThrow,
  booleanAttribute,
  bypassSanitizationTrustHtml,
  bypassSanitizationTrustResourceUrl,
  bypassSanitizationTrustScript,
  bypassSanitizationTrustStyle,
  bypassSanitizationTrustUrl,
  concatMap,
  createNgModule,
  createPlatformFactory,
  filter,
  finalize,
  findLocaleData,
  formatRuntimeError,
  forwardRef,
  from,
  getLocalePluralCase,
  inject,
  internalCreateApplication,
  isPromise,
  isSubscribable,
  makeEnvironmentProviders,
  makeStateKey,
  map,
  numberAttribute,
  of,
  performanceMarkFeature,
  platformCore,
  runInInjectionContext,
  setClassMetadata,
  setDocument,
  stringify,
  switchMap,
  tap,
  truncateMiddle,
  untracked,
  unwrapSafeValue,
  whenStable,
  withDomHydration,
  ɵɵInputTransformsFeature,
  ɵɵNgOnChangesFeature,
  ɵɵdefineDirective,
  ɵɵdefineInjectable,
  ɵɵdefineInjector,
  ɵɵdefineNgModule,
  ɵɵdefinePipe,
  ɵɵdirectiveInject,
  ɵɵinject,
  ɵɵinjectAttribute,
  ɵɵstyleProp
} from "./chunk-JNM7CA4Q.js";

// node_modules/@angular/common/fesm2022/common.mjs
var _DOM = null;
function getDOM() {
  return _DOM;
}
function setRootDomAdapter(adapter) {
  _DOM ??= adapter;
}
var DomAdapter = class {
};
var DOCUMENT = new InjectionToken(ngDevMode ? "DocumentToken" : "");
var _PlatformLocation = class _PlatformLocation {
  historyGo(relativePosition) {
    throw new Error(ngDevMode ? "Not implemented" : "");
  }
};
_PlatformLocation.ɵfac = function PlatformLocation_Factory(t) {
  return new (t || _PlatformLocation)();
};
_PlatformLocation.ɵprov = ɵɵdefineInjectable({
  token: _PlatformLocation,
  factory: () => (() => inject(BrowserPlatformLocation))(),
  providedIn: "platform"
});
var PlatformLocation = _PlatformLocation;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PlatformLocation, [{
    type: Injectable,
    args: [{
      providedIn: "platform",
      useFactory: () => inject(BrowserPlatformLocation)
    }]
  }], null, null);
})();
var LOCATION_INITIALIZED = new InjectionToken(ngDevMode ? "Location Initialized" : "");
var _BrowserPlatformLocation = class _BrowserPlatformLocation extends PlatformLocation {
  constructor() {
    super();
    this._doc = inject(DOCUMENT);
    this._location = window.location;
    this._history = window.history;
  }
  getBaseHrefFromDOM() {
    return getDOM().getBaseHref(this._doc);
  }
  onPopState(fn) {
    const window2 = getDOM().getGlobalEventTarget(this._doc, "window");
    window2.addEventListener("popstate", fn, false);
    return () => window2.removeEventListener("popstate", fn);
  }
  onHashChange(fn) {
    const window2 = getDOM().getGlobalEventTarget(this._doc, "window");
    window2.addEventListener("hashchange", fn, false);
    return () => window2.removeEventListener("hashchange", fn);
  }
  get href() {
    return this._location.href;
  }
  get protocol() {
    return this._location.protocol;
  }
  get hostname() {
    return this._location.hostname;
  }
  get port() {
    return this._location.port;
  }
  get pathname() {
    return this._location.pathname;
  }
  get search() {
    return this._location.search;
  }
  get hash() {
    return this._location.hash;
  }
  set pathname(newPath) {
    this._location.pathname = newPath;
  }
  pushState(state, title, url) {
    this._history.pushState(state, title, url);
  }
  replaceState(state, title, url) {
    this._history.replaceState(state, title, url);
  }
  forward() {
    this._history.forward();
  }
  back() {
    this._history.back();
  }
  historyGo(relativePosition = 0) {
    this._history.go(relativePosition);
  }
  getState() {
    return this._history.state;
  }
};
_BrowserPlatformLocation.ɵfac = function BrowserPlatformLocation_Factory(t) {
  return new (t || _BrowserPlatformLocation)();
};
_BrowserPlatformLocation.ɵprov = ɵɵdefineInjectable({
  token: _BrowserPlatformLocation,
  factory: () => (() => new _BrowserPlatformLocation())(),
  providedIn: "platform"
});
var BrowserPlatformLocation = _BrowserPlatformLocation;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(BrowserPlatformLocation, [{
    type: Injectable,
    args: [{
      providedIn: "platform",
      useFactory: () => new BrowserPlatformLocation()
    }]
  }], () => [], null);
})();
function joinWithSlash(start, end) {
  if (start.length == 0) {
    return end;
  }
  if (end.length == 0) {
    return start;
  }
  let slashes = 0;
  if (start.endsWith("/")) {
    slashes++;
  }
  if (end.startsWith("/")) {
    slashes++;
  }
  if (slashes == 2) {
    return start + end.substring(1);
  }
  if (slashes == 1) {
    return start + end;
  }
  return start + "/" + end;
}
function stripTrailingSlash(url) {
  const match = url.match(/#|\?|$/);
  const pathEndIdx = match && match.index || url.length;
  const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === "/" ? 1 : 0);
  return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);
}
function normalizeQueryParams(params) {
  return params && params[0] !== "?" ? "?" + params : params;
}
var _LocationStrategy = class _LocationStrategy {
  historyGo(relativePosition) {
    throw new Error(ngDevMode ? "Not implemented" : "");
  }
};
_LocationStrategy.ɵfac = function LocationStrategy_Factory(t) {
  return new (t || _LocationStrategy)();
};
_LocationStrategy.ɵprov = ɵɵdefineInjectable({
  token: _LocationStrategy,
  factory: () => (() => inject(PathLocationStrategy))(),
  providedIn: "root"
});
var LocationStrategy = _LocationStrategy;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(LocationStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => inject(PathLocationStrategy)
    }]
  }], null, null);
})();
var APP_BASE_HREF = new InjectionToken(ngDevMode ? "appBaseHref" : "");
var _PathLocationStrategy = class _PathLocationStrategy extends LocationStrategy {
  constructor(_platformLocation, href) {
    super();
    this._platformLocation = _platformLocation;
    this._removeListenerFns = [];
    this._baseHref = href ?? this._platformLocation.getBaseHrefFromDOM() ?? inject(DOCUMENT).location?.origin ?? "";
  }
  /** @nodoc */
  ngOnDestroy() {
    while (this._removeListenerFns.length) {
      this._removeListenerFns.pop()();
    }
  }
  onPopState(fn) {
    this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));
  }
  getBaseHref() {
    return this._baseHref;
  }
  prepareExternalUrl(internal) {
    return joinWithSlash(this._baseHref, internal);
  }
  path(includeHash = false) {
    const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);
    const hash = this._platformLocation.hash;
    return hash && includeHash ? `${pathname}${hash}` : pathname;
  }
  pushState(state, title, url, queryParams) {
    const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
    this._platformLocation.pushState(state, title, externalUrl);
  }
  replaceState(state, title, url, queryParams) {
    const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
    this._platformLocation.replaceState(state, title, externalUrl);
  }
  forward() {
    this._platformLocation.forward();
  }
  back() {
    this._platformLocation.back();
  }
  getState() {
    return this._platformLocation.getState();
  }
  historyGo(relativePosition = 0) {
    this._platformLocation.historyGo?.(relativePosition);
  }
};
_PathLocationStrategy.ɵfac = function PathLocationStrategy_Factory(t) {
  return new (t || _PathLocationStrategy)(ɵɵinject(PlatformLocation), ɵɵinject(APP_BASE_HREF, 8));
};
_PathLocationStrategy.ɵprov = ɵɵdefineInjectable({
  token: _PathLocationStrategy,
  factory: _PathLocationStrategy.ɵfac,
  providedIn: "root"
});
var PathLocationStrategy = _PathLocationStrategy;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PathLocationStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: PlatformLocation
  }, {
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: Inject,
      args: [APP_BASE_HREF]
    }]
  }], null);
})();
var _HashLocationStrategy = class _HashLocationStrategy extends LocationStrategy {
  constructor(_platformLocation, _baseHref) {
    super();
    this._platformLocation = _platformLocation;
    this._baseHref = "";
    this._removeListenerFns = [];
    if (_baseHref != null) {
      this._baseHref = _baseHref;
    }
  }
  /** @nodoc */
  ngOnDestroy() {
    while (this._removeListenerFns.length) {
      this._removeListenerFns.pop()();
    }
  }
  onPopState(fn) {
    this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));
  }
  getBaseHref() {
    return this._baseHref;
  }
  path(includeHash = false) {
    const path = this._platformLocation.hash ?? "#";
    return path.length > 0 ? path.substring(1) : path;
  }
  prepareExternalUrl(internal) {
    const url = joinWithSlash(this._baseHref, internal);
    return url.length > 0 ? "#" + url : url;
  }
  pushState(state, title, path, queryParams) {
    let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));
    if (url.length == 0) {
      url = this._platformLocation.pathname;
    }
    this._platformLocation.pushState(state, title, url);
  }
  replaceState(state, title, path, queryParams) {
    let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));
    if (url.length == 0) {
      url = this._platformLocation.pathname;
    }
    this._platformLocation.replaceState(state, title, url);
  }
  forward() {
    this._platformLocation.forward();
  }
  back() {
    this._platformLocation.back();
  }
  getState() {
    return this._platformLocation.getState();
  }
  historyGo(relativePosition = 0) {
    this._platformLocation.historyGo?.(relativePosition);
  }
};
_HashLocationStrategy.ɵfac = function HashLocationStrategy_Factory(t) {
  return new (t || _HashLocationStrategy)(ɵɵinject(PlatformLocation), ɵɵinject(APP_BASE_HREF, 8));
};
_HashLocationStrategy.ɵprov = ɵɵdefineInjectable({
  token: _HashLocationStrategy,
  factory: _HashLocationStrategy.ɵfac
});
var HashLocationStrategy = _HashLocationStrategy;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HashLocationStrategy, [{
    type: Injectable
  }], () => [{
    type: PlatformLocation
  }, {
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: Inject,
      args: [APP_BASE_HREF]
    }]
  }], null);
})();
var _Location = class _Location {
  constructor(locationStrategy) {
    this._subject = new EventEmitter();
    this._urlChangeListeners = [];
    this._urlChangeSubscription = null;
    this._locationStrategy = locationStrategy;
    const baseHref = this._locationStrategy.getBaseHref();
    this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));
    this._locationStrategy.onPopState((ev) => {
      this._subject.emit({
        "url": this.path(true),
        "pop": true,
        "state": ev.state,
        "type": ev.type
      });
    });
  }
  /** @nodoc */
  ngOnDestroy() {
    this._urlChangeSubscription?.unsubscribe();
    this._urlChangeListeners = [];
  }
  /**
   * Normalizes the URL path for this location.
   *
   * @param includeHash True to include an anchor fragment in the path.
   *
   * @returns The normalized URL path.
   */
  // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is
  // removed.
  path(includeHash = false) {
    return this.normalize(this._locationStrategy.path(includeHash));
  }
  /**
   * Reports the current state of the location history.
   * @returns The current value of the `history.state` object.
   */
  getState() {
    return this._locationStrategy.getState();
  }
  /**
   * Normalizes the given path and compares to the current normalized path.
   *
   * @param path The given URL path.
   * @param query Query parameters.
   *
   * @returns True if the given URL path is equal to the current normalized path, false
   * otherwise.
   */
  isCurrentPathEqualTo(path, query = "") {
    return this.path() == this.normalize(path + normalizeQueryParams(query));
  }
  /**
   * Normalizes a URL path by stripping any trailing slashes.
   *
   * @param url String representing a URL.
   *
   * @returns The normalized URL string.
   */
  normalize(url) {
    return _Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));
  }
  /**
   * Normalizes an external URL path.
   * If the given URL doesn't begin with a leading slash (`'/'`), adds one
   * before normalizing. Adds a hash if `HashLocationStrategy` is
   * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.
   *
   * @param url String representing a URL.
   *
   * @returns  A normalized platform-specific URL.
   */
  prepareExternalUrl(url) {
    if (url && url[0] !== "/") {
      url = "/" + url;
    }
    return this._locationStrategy.prepareExternalUrl(url);
  }
  // TODO: rename this method to pushState
  /**
   * Changes the browser's URL to a normalized version of a given URL, and pushes a
   * new item onto the platform's history.
   *
   * @param path  URL path to normalize.
   * @param query Query parameters.
   * @param state Location history state.
   *
   */
  go(path, query = "", state = null) {
    this._locationStrategy.pushState(state, "", path, query);
    this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
  }
  /**
   * Changes the browser's URL to a normalized version of the given URL, and replaces
   * the top item on the platform's history stack.
   *
   * @param path  URL path to normalize.
   * @param query Query parameters.
   * @param state Location history state.
   */
  replaceState(path, query = "", state = null) {
    this._locationStrategy.replaceState(state, "", path, query);
    this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
  }
  /**
   * Navigates forward in the platform's history.
   */
  forward() {
    this._locationStrategy.forward();
  }
  /**
   * Navigates back in the platform's history.
   */
  back() {
    this._locationStrategy.back();
  }
  /**
   * Navigate to a specific page from session history, identified by its relative position to the
   * current page.
   *
   * @param relativePosition  Position of the target page in the history relative to the current
   *     page.
   * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`
   * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go
   * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs
   * when `relativePosition` equals 0.
   * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history
   */
  historyGo(relativePosition = 0) {
    this._locationStrategy.historyGo?.(relativePosition);
  }
  /**
   * Registers a URL change listener. Use to catch updates performed by the Angular
   * framework that are not detectible through "popstate" or "hashchange" events.
   *
   * @param fn The change handler function, which take a URL and a location history state.
   * @returns A function that, when executed, unregisters a URL change listener.
   */
  onUrlChange(fn) {
    this._urlChangeListeners.push(fn);
    this._urlChangeSubscription ??= this.subscribe((v) => {
      this._notifyUrlChangeListeners(v.url, v.state);
    });
    return () => {
      const fnIndex = this._urlChangeListeners.indexOf(fn);
      this._urlChangeListeners.splice(fnIndex, 1);
      if (this._urlChangeListeners.length === 0) {
        this._urlChangeSubscription?.unsubscribe();
        this._urlChangeSubscription = null;
      }
    };
  }
  /** @internal */
  _notifyUrlChangeListeners(url = "", state) {
    this._urlChangeListeners.forEach((fn) => fn(url, state));
  }
  /**
   * Subscribes to the platform's `popState` events.
   *
   * Note: `Location.go()` does not trigger the `popState` event in the browser. Use
   * `Location.onUrlChange()` to subscribe to URL changes instead.
   *
   * @param value Event that is triggered when the state history changes.
   * @param exception The exception to throw.
   *
   * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)
   *
   * @returns Subscribed events.
   */
  subscribe(onNext, onThrow, onReturn) {
    return this._subject.subscribe({
      next: onNext,
      error: onThrow,
      complete: onReturn
    });
  }
};
_Location.normalizeQueryParams = normalizeQueryParams;
_Location.joinWithSlash = joinWithSlash;
_Location.stripTrailingSlash = stripTrailingSlash;
_Location.ɵfac = function Location_Factory(t) {
  return new (t || _Location)(ɵɵinject(LocationStrategy));
};
_Location.ɵprov = ɵɵdefineInjectable({
  token: _Location,
  factory: () => createLocation(),
  providedIn: "root"
});
var Location = _Location;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Location, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      // See #23917
      useFactory: createLocation
    }]
  }], () => [{
    type: LocationStrategy
  }], null);
})();
function createLocation() {
  return new Location(ɵɵinject(LocationStrategy));
}
function _stripBasePath(basePath, url) {
  if (!basePath || !url.startsWith(basePath)) {
    return url;
  }
  const strippedUrl = url.substring(basePath.length);
  if (strippedUrl === "" || ["/", ";", "?", "#"].includes(strippedUrl[0])) {
    return strippedUrl;
  }
  return url;
}
function _stripIndexHtml(url) {
  return url.replace(/\/index.html$/, "");
}
function _stripOrigin(baseHref) {
  const isAbsoluteUrl2 = new RegExp("^(https?:)?//").test(baseHref);
  if (isAbsoluteUrl2) {
    const [, pathname] = baseHref.split(/\/\/[^\/]+/);
    return pathname;
  }
  return baseHref;
}
var CURRENCIES_EN = {
  "ADP": [void 0, void 0, 0],
  "AFN": [void 0, "؋", 0],
  "ALL": [void 0, void 0, 0],
  "AMD": [void 0, "֏", 2],
  "AOA": [void 0, "Kz"],
  "ARS": [void 0, "$"],
  "AUD": ["A$", "$"],
  "AZN": [void 0, "₼"],
  "BAM": [void 0, "KM"],
  "BBD": [void 0, "$"],
  "BDT": [void 0, "৳"],
  "BHD": [void 0, void 0, 3],
  "BIF": [void 0, void 0, 0],
  "BMD": [void 0, "$"],
  "BND": [void 0, "$"],
  "BOB": [void 0, "Bs"],
  "BRL": ["R$"],
  "BSD": [void 0, "$"],
  "BWP": [void 0, "P"],
  "BYN": [void 0, void 0, 2],
  "BYR": [void 0, void 0, 0],
  "BZD": [void 0, "$"],
  "CAD": ["CA$", "$", 2],
  "CHF": [void 0, void 0, 2],
  "CLF": [void 0, void 0, 4],
  "CLP": [void 0, "$", 0],
  "CNY": ["CN¥", "¥"],
  "COP": [void 0, "$", 2],
  "CRC": [void 0, "₡", 2],
  "CUC": [void 0, "$"],
  "CUP": [void 0, "$"],
  "CZK": [void 0, "Kč", 2],
  "DJF": [void 0, void 0, 0],
  "DKK": [void 0, "kr", 2],
  "DOP": [void 0, "$"],
  "EGP": [void 0, "E£"],
  "ESP": [void 0, "₧", 0],
  "EUR": ["€"],
  "FJD": [void 0, "$"],
  "FKP": [void 0, "£"],
  "GBP": ["£"],
  "GEL": [void 0, "₾"],
  "GHS": [void 0, "GH₵"],
  "GIP": [void 0, "£"],
  "GNF": [void 0, "FG", 0],
  "GTQ": [void 0, "Q"],
  "GYD": [void 0, "$", 2],
  "HKD": ["HK$", "$"],
  "HNL": [void 0, "L"],
  "HRK": [void 0, "kn"],
  "HUF": [void 0, "Ft", 2],
  "IDR": [void 0, "Rp", 2],
  "ILS": ["₪"],
  "INR": ["₹"],
  "IQD": [void 0, void 0, 0],
  "IRR": [void 0, void 0, 0],
  "ISK": [void 0, "kr", 0],
  "ITL": [void 0, void 0, 0],
  "JMD": [void 0, "$"],
  "JOD": [void 0, void 0, 3],
  "JPY": ["¥", void 0, 0],
  "KHR": [void 0, "៛"],
  "KMF": [void 0, "CF", 0],
  "KPW": [void 0, "₩", 0],
  "KRW": ["₩", void 0, 0],
  "KWD": [void 0, void 0, 3],
  "KYD": [void 0, "$"],
  "KZT": [void 0, "₸"],
  "LAK": [void 0, "₭", 0],
  "LBP": [void 0, "L£", 0],
  "LKR": [void 0, "Rs"],
  "LRD": [void 0, "$"],
  "LTL": [void 0, "Lt"],
  "LUF": [void 0, void 0, 0],
  "LVL": [void 0, "Ls"],
  "LYD": [void 0, void 0, 3],
  "MGA": [void 0, "Ar", 0],
  "MGF": [void 0, void 0, 0],
  "MMK": [void 0, "K", 0],
  "MNT": [void 0, "₮", 2],
  "MRO": [void 0, void 0, 0],
  "MUR": [void 0, "Rs", 2],
  "MXN": ["MX$", "$"],
  "MYR": [void 0, "RM"],
  "NAD": [void 0, "$"],
  "NGN": [void 0, "₦"],
  "NIO": [void 0, "C$"],
  "NOK": [void 0, "kr", 2],
  "NPR": [void 0, "Rs"],
  "NZD": ["NZ$", "$"],
  "OMR": [void 0, void 0, 3],
  "PHP": ["₱"],
  "PKR": [void 0, "Rs", 2],
  "PLN": [void 0, "zł"],
  "PYG": [void 0, "₲", 0],
  "RON": [void 0, "lei"],
  "RSD": [void 0, void 0, 0],
  "RUB": [void 0, "₽"],
  "RWF": [void 0, "RF", 0],
  "SBD": [void 0, "$"],
  "SEK": [void 0, "kr", 2],
  "SGD": [void 0, "$"],
  "SHP": [void 0, "£"],
  "SLE": [void 0, void 0, 2],
  "SLL": [void 0, void 0, 0],
  "SOS": [void 0, void 0, 0],
  "SRD": [void 0, "$"],
  "SSP": [void 0, "£"],
  "STD": [void 0, void 0, 0],
  "STN": [void 0, "Db"],
  "SYP": [void 0, "£", 0],
  "THB": [void 0, "฿"],
  "TMM": [void 0, void 0, 0],
  "TND": [void 0, void 0, 3],
  "TOP": [void 0, "T$"],
  "TRL": [void 0, void 0, 0],
  "TRY": [void 0, "₺"],
  "TTD": [void 0, "$"],
  "TWD": ["NT$", "$", 2],
  "TZS": [void 0, void 0, 2],
  "UAH": [void 0, "₴"],
  "UGX": [void 0, void 0, 0],
  "USD": ["$"],
  "UYI": [void 0, void 0, 0],
  "UYU": [void 0, "$"],
  "UYW": [void 0, void 0, 4],
  "UZS": [void 0, void 0, 2],
  "VEF": [void 0, "Bs", 2],
  "VND": ["₫", void 0, 0],
  "VUV": [void 0, void 0, 0],
  "XAF": ["FCFA", void 0, 0],
  "XCD": ["EC$", "$"],
  "XOF": ["F CFA", void 0, 0],
  "XPF": ["CFPF", void 0, 0],
  "XXX": ["¤"],
  "YER": [void 0, void 0, 0],
  "ZAR": [void 0, "R"],
  "ZMK": [void 0, void 0, 0],
  "ZMW": [void 0, "ZK"],
  "ZWD": [void 0, void 0, 0]
};
var NumberFormatStyle;
(function(NumberFormatStyle2) {
  NumberFormatStyle2[NumberFormatStyle2["Decimal"] = 0] = "Decimal";
  NumberFormatStyle2[NumberFormatStyle2["Percent"] = 1] = "Percent";
  NumberFormatStyle2[NumberFormatStyle2["Currency"] = 2] = "Currency";
  NumberFormatStyle2[NumberFormatStyle2["Scientific"] = 3] = "Scientific";
})(NumberFormatStyle || (NumberFormatStyle = {}));
var Plural;
(function(Plural2) {
  Plural2[Plural2["Zero"] = 0] = "Zero";
  Plural2[Plural2["One"] = 1] = "One";
  Plural2[Plural2["Two"] = 2] = "Two";
  Plural2[Plural2["Few"] = 3] = "Few";
  Plural2[Plural2["Many"] = 4] = "Many";
  Plural2[Plural2["Other"] = 5] = "Other";
})(Plural || (Plural = {}));
var FormStyle;
(function(FormStyle2) {
  FormStyle2[FormStyle2["Format"] = 0] = "Format";
  FormStyle2[FormStyle2["Standalone"] = 1] = "Standalone";
})(FormStyle || (FormStyle = {}));
var TranslationWidth;
(function(TranslationWidth2) {
  TranslationWidth2[TranslationWidth2["Narrow"] = 0] = "Narrow";
  TranslationWidth2[TranslationWidth2["Abbreviated"] = 1] = "Abbreviated";
  TranslationWidth2[TranslationWidth2["Wide"] = 2] = "Wide";
  TranslationWidth2[TranslationWidth2["Short"] = 3] = "Short";
})(TranslationWidth || (TranslationWidth = {}));
var FormatWidth;
(function(FormatWidth2) {
  FormatWidth2[FormatWidth2["Short"] = 0] = "Short";
  FormatWidth2[FormatWidth2["Medium"] = 1] = "Medium";
  FormatWidth2[FormatWidth2["Long"] = 2] = "Long";
  FormatWidth2[FormatWidth2["Full"] = 3] = "Full";
})(FormatWidth || (FormatWidth = {}));
var NumberSymbol;
(function(NumberSymbol2) {
  NumberSymbol2[NumberSymbol2["Decimal"] = 0] = "Decimal";
  NumberSymbol2[NumberSymbol2["Group"] = 1] = "Group";
  NumberSymbol2[NumberSymbol2["List"] = 2] = "List";
  NumberSymbol2[NumberSymbol2["PercentSign"] = 3] = "PercentSign";
  NumberSymbol2[NumberSymbol2["PlusSign"] = 4] = "PlusSign";
  NumberSymbol2[NumberSymbol2["MinusSign"] = 5] = "MinusSign";
  NumberSymbol2[NumberSymbol2["Exponential"] = 6] = "Exponential";
  NumberSymbol2[NumberSymbol2["SuperscriptingExponent"] = 7] = "SuperscriptingExponent";
  NumberSymbol2[NumberSymbol2["PerMille"] = 8] = "PerMille";
  NumberSymbol2[NumberSymbol2["Infinity"] = 9] = "Infinity";
  NumberSymbol2[NumberSymbol2["NaN"] = 10] = "NaN";
  NumberSymbol2[NumberSymbol2["TimeSeparator"] = 11] = "TimeSeparator";
  NumberSymbol2[NumberSymbol2["CurrencyDecimal"] = 12] = "CurrencyDecimal";
  NumberSymbol2[NumberSymbol2["CurrencyGroup"] = 13] = "CurrencyGroup";
})(NumberSymbol || (NumberSymbol = {}));
var WeekDay;
(function(WeekDay2) {
  WeekDay2[WeekDay2["Sunday"] = 0] = "Sunday";
  WeekDay2[WeekDay2["Monday"] = 1] = "Monday";
  WeekDay2[WeekDay2["Tuesday"] = 2] = "Tuesday";
  WeekDay2[WeekDay2["Wednesday"] = 3] = "Wednesday";
  WeekDay2[WeekDay2["Thursday"] = 4] = "Thursday";
  WeekDay2[WeekDay2["Friday"] = 5] = "Friday";
  WeekDay2[WeekDay2["Saturday"] = 6] = "Saturday";
})(WeekDay || (WeekDay = {}));
function getLocaleId(locale) {
  return findLocaleData(locale)[LocaleDataIndex.LocaleId];
}
function getLocaleDayPeriods(locale, formStyle, width) {
  const data = findLocaleData(locale);
  const amPmData = [data[LocaleDataIndex.DayPeriodsFormat], data[LocaleDataIndex.DayPeriodsStandalone]];
  const amPm = getLastDefinedValue(amPmData, formStyle);
  return getLastDefinedValue(amPm, width);
}
function getLocaleDayNames(locale, formStyle, width) {
  const data = findLocaleData(locale);
  const daysData = [data[LocaleDataIndex.DaysFormat], data[LocaleDataIndex.DaysStandalone]];
  const days = getLastDefinedValue(daysData, formStyle);
  return getLastDefinedValue(days, width);
}
function getLocaleMonthNames(locale, formStyle, width) {
  const data = findLocaleData(locale);
  const monthsData = [data[LocaleDataIndex.MonthsFormat], data[LocaleDataIndex.MonthsStandalone]];
  const months = getLastDefinedValue(monthsData, formStyle);
  return getLastDefinedValue(months, width);
}
function getLocaleEraNames(locale, width) {
  const data = findLocaleData(locale);
  const erasData = data[LocaleDataIndex.Eras];
  return getLastDefinedValue(erasData, width);
}
function getLocaleDateFormat(locale, width) {
  const data = findLocaleData(locale);
  return getLastDefinedValue(data[LocaleDataIndex.DateFormat], width);
}
function getLocaleTimeFormat(locale, width) {
  const data = findLocaleData(locale);
  return getLastDefinedValue(data[LocaleDataIndex.TimeFormat], width);
}
function getLocaleDateTimeFormat(locale, width) {
  const data = findLocaleData(locale);
  const dateTimeFormatData = data[LocaleDataIndex.DateTimeFormat];
  return getLastDefinedValue(dateTimeFormatData, width);
}
function getLocaleNumberSymbol(locale, symbol) {
  const data = findLocaleData(locale);
  const res = data[LocaleDataIndex.NumberSymbols][symbol];
  if (typeof res === "undefined") {
    if (symbol === NumberSymbol.CurrencyDecimal) {
      return data[LocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];
    } else if (symbol === NumberSymbol.CurrencyGroup) {
      return data[LocaleDataIndex.NumberSymbols][NumberSymbol.Group];
    }
  }
  return res;
}
function getLocaleNumberFormat(locale, type) {
  const data = findLocaleData(locale);
  return data[LocaleDataIndex.NumberFormats][type];
}
function getLocaleCurrencies(locale) {
  const data = findLocaleData(locale);
  return data[LocaleDataIndex.Currencies];
}
var getLocalePluralCase2 = getLocalePluralCase;
function checkFullData(data) {
  if (!data[LocaleDataIndex.ExtraData]) {
    throw new Error(`Missing extra locale data for the locale "${data[LocaleDataIndex.LocaleId]}". Use "registerLocaleData" to load new data. See the "I18n guide" on angular.io to know more.`);
  }
}
function getLocaleExtraDayPeriodRules(locale) {
  const data = findLocaleData(locale);
  checkFullData(data);
  const rules = data[LocaleDataIndex.ExtraData][
    2
    /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */
  ] || [];
  return rules.map((rule) => {
    if (typeof rule === "string") {
      return extractTime(rule);
    }
    return [extractTime(rule[0]), extractTime(rule[1])];
  });
}
function getLocaleExtraDayPeriods(locale, formStyle, width) {
  const data = findLocaleData(locale);
  checkFullData(data);
  const dayPeriodsData = [data[LocaleDataIndex.ExtraData][
    0
    /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */
  ], data[LocaleDataIndex.ExtraData][
    1
    /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */
  ]];
  const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];
  return getLastDefinedValue(dayPeriods, width) || [];
}
function getLastDefinedValue(data, index) {
  for (let i = index; i > -1; i--) {
    if (typeof data[i] !== "undefined") {
      return data[i];
    }
  }
  throw new Error("Locale data API: locale data undefined");
}
function extractTime(time) {
  const [h, m] = time.split(":");
  return {
    hours: +h,
    minutes: +m
  };
}
function getCurrencySymbol(code, format, locale = "en") {
  const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];
  const symbolNarrow = currency[
    1
    /* ɵCurrencyIndex.SymbolNarrow */
  ];
  if (format === "narrow" && typeof symbolNarrow === "string") {
    return symbolNarrow;
  }
  return currency[
    0
    /* ɵCurrencyIndex.Symbol */
  ] || code;
}
var DEFAULT_NB_OF_CURRENCY_DIGITS = 2;
function getNumberOfCurrencyDigits(code) {
  let digits;
  const currency = CURRENCIES_EN[code];
  if (currency) {
    digits = currency[
      2
      /* ɵCurrencyIndex.NbOfDigits */
    ];
  }
  return typeof digits === "number" ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;
}
var ISO8601_DATE_REGEX = /^(\d{4,})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/;
var NAMED_FORMATS = {};
var DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\s\S]*)/;
var ZoneWidth;
(function(ZoneWidth2) {
  ZoneWidth2[ZoneWidth2["Short"] = 0] = "Short";
  ZoneWidth2[ZoneWidth2["ShortGMT"] = 1] = "ShortGMT";
  ZoneWidth2[ZoneWidth2["Long"] = 2] = "Long";
  ZoneWidth2[ZoneWidth2["Extended"] = 3] = "Extended";
})(ZoneWidth || (ZoneWidth = {}));
var DateType;
(function(DateType2) {
  DateType2[DateType2["FullYear"] = 0] = "FullYear";
  DateType2[DateType2["Month"] = 1] = "Month";
  DateType2[DateType2["Date"] = 2] = "Date";
  DateType2[DateType2["Hours"] = 3] = "Hours";
  DateType2[DateType2["Minutes"] = 4] = "Minutes";
  DateType2[DateType2["Seconds"] = 5] = "Seconds";
  DateType2[DateType2["FractionalSeconds"] = 6] = "FractionalSeconds";
  DateType2[DateType2["Day"] = 7] = "Day";
})(DateType || (DateType = {}));
var TranslationType;
(function(TranslationType2) {
  TranslationType2[TranslationType2["DayPeriods"] = 0] = "DayPeriods";
  TranslationType2[TranslationType2["Days"] = 1] = "Days";
  TranslationType2[TranslationType2["Months"] = 2] = "Months";
  TranslationType2[TranslationType2["Eras"] = 3] = "Eras";
})(TranslationType || (TranslationType = {}));
function formatDate(value, format, locale, timezone) {
  let date = toDate(value);
  const namedFormat = getNamedFormat(locale, format);
  format = namedFormat || format;
  let parts = [];
  let match;
  while (format) {
    match = DATE_FORMATS_SPLIT.exec(format);
    if (match) {
      parts = parts.concat(match.slice(1));
      const part = parts.pop();
      if (!part) {
        break;
      }
      format = part;
    } else {
      parts.push(format);
      break;
    }
  }
  let dateTimezoneOffset = date.getTimezoneOffset();
  if (timezone) {
    dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
    date = convertTimezoneToLocal(date, timezone, true);
  }
  let text = "";
  parts.forEach((value2) => {
    const dateFormatter = getDateFormatter(value2);
    text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) : value2 === "''" ? "'" : value2.replace(/(^'|'$)/g, "").replace(/''/g, "'");
  });
  return text;
}
function createDate(year, month, date) {
  const newDate = /* @__PURE__ */ new Date(0);
  newDate.setFullYear(year, month, date);
  newDate.setHours(0, 0, 0);
  return newDate;
}
function getNamedFormat(locale, format) {
  const localeId = getLocaleId(locale);
  NAMED_FORMATS[localeId] ??= {};
  if (NAMED_FORMATS[localeId][format]) {
    return NAMED_FORMATS[localeId][format];
  }
  let formatValue = "";
  switch (format) {
    case "shortDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Short);
      break;
    case "mediumDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);
      break;
    case "longDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Long);
      break;
    case "fullDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Full);
      break;
    case "shortTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);
      break;
    case "mediumTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);
      break;
    case "longTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);
      break;
    case "fullTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);
      break;
    case "short":
      const shortTime = getNamedFormat(locale, "shortTime");
      const shortDate = getNamedFormat(locale, "shortDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);
      break;
    case "medium":
      const mediumTime = getNamedFormat(locale, "mediumTime");
      const mediumDate = getNamedFormat(locale, "mediumDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);
      break;
    case "long":
      const longTime = getNamedFormat(locale, "longTime");
      const longDate = getNamedFormat(locale, "longDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);
      break;
    case "full":
      const fullTime = getNamedFormat(locale, "fullTime");
      const fullDate = getNamedFormat(locale, "fullDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);
      break;
  }
  if (formatValue) {
    NAMED_FORMATS[localeId][format] = formatValue;
  }
  return formatValue;
}
function formatDateTime(str, opt_values) {
  if (opt_values) {
    str = str.replace(/\{([^}]+)}/g, function(match, key) {
      return opt_values != null && key in opt_values ? opt_values[key] : match;
    });
  }
  return str;
}
function padNumber(num, digits, minusSign = "-", trim, negWrap) {
  let neg = "";
  if (num < 0 || negWrap && num <= 0) {
    if (negWrap) {
      num = -num + 1;
    } else {
      num = -num;
      neg = minusSign;
    }
  }
  let strNum = String(num);
  while (strNum.length < digits) {
    strNum = "0" + strNum;
  }
  if (trim) {
    strNum = strNum.slice(strNum.length - digits);
  }
  return neg + strNum;
}
function formatFractionalSeconds(milliseconds, digits) {
  const strMs = padNumber(milliseconds, 3);
  return strMs.substring(0, digits);
}
function dateGetter(name, size, offset = 0, trim = false, negWrap = false) {
  return function(date, locale) {
    let part = getDatePart(name, date);
    if (offset > 0 || part > -offset) {
      part += offset;
    }
    if (name === DateType.Hours) {
      if (part === 0 && offset === -12) {
        part = 12;
      }
    } else if (name === DateType.FractionalSeconds) {
      return formatFractionalSeconds(part, size);
    }
    const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
    return padNumber(part, size, localeMinus, trim, negWrap);
  };
}
function getDatePart(part, date) {
  switch (part) {
    case DateType.FullYear:
      return date.getFullYear();
    case DateType.Month:
      return date.getMonth();
    case DateType.Date:
      return date.getDate();
    case DateType.Hours:
      return date.getHours();
    case DateType.Minutes:
      return date.getMinutes();
    case DateType.Seconds:
      return date.getSeconds();
    case DateType.FractionalSeconds:
      return date.getMilliseconds();
    case DateType.Day:
      return date.getDay();
    default:
      throw new Error(`Unknown DateType value "${part}".`);
  }
}
function dateStrGetter(name, width, form = FormStyle.Format, extended = false) {
  return function(date, locale) {
    return getDateTranslation(date, locale, name, width, form, extended);
  };
}
function getDateTranslation(date, locale, name, width, form, extended) {
  switch (name) {
    case TranslationType.Months:
      return getLocaleMonthNames(locale, form, width)[date.getMonth()];
    case TranslationType.Days:
      return getLocaleDayNames(locale, form, width)[date.getDay()];
    case TranslationType.DayPeriods:
      const currentHours = date.getHours();
      const currentMinutes = date.getMinutes();
      if (extended) {
        const rules = getLocaleExtraDayPeriodRules(locale);
        const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);
        const index = rules.findIndex((rule) => {
          if (Array.isArray(rule)) {
            const [from2, to] = rule;
            const afterFrom = currentHours >= from2.hours && currentMinutes >= from2.minutes;
            const beforeTo = currentHours < to.hours || currentHours === to.hours && currentMinutes < to.minutes;
            if (from2.hours < to.hours) {
              if (afterFrom && beforeTo) {
                return true;
              }
            } else if (afterFrom || beforeTo) {
              return true;
            }
          } else {
            if (rule.hours === currentHours && rule.minutes === currentMinutes) {
              return true;
            }
          }
          return false;
        });
        if (index !== -1) {
          return dayPeriods[index];
        }
      }
      return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];
    case TranslationType.Eras:
      return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];
    default:
      const unexpected = name;
      throw new Error(`unexpected translation type ${unexpected}`);
  }
}
function timeZoneGetter(width) {
  return function(date, locale, offset) {
    const zone = -1 * offset;
    const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
    const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);
    switch (width) {
      case ZoneWidth.Short:
        return (zone >= 0 ? "+" : "") + padNumber(hours, 2, minusSign) + padNumber(Math.abs(zone % 60), 2, minusSign);
      case ZoneWidth.ShortGMT:
        return "GMT" + (zone >= 0 ? "+" : "") + padNumber(hours, 1, minusSign);
      case ZoneWidth.Long:
        return "GMT" + (zone >= 0 ? "+" : "") + padNumber(hours, 2, minusSign) + ":" + padNumber(Math.abs(zone % 60), 2, minusSign);
      case ZoneWidth.Extended:
        if (offset === 0) {
          return "Z";
        } else {
          return (zone >= 0 ? "+" : "") + padNumber(hours, 2, minusSign) + ":" + padNumber(Math.abs(zone % 60), 2, minusSign);
        }
      default:
        throw new Error(`Unknown zone width "${width}"`);
    }
  };
}
var JANUARY = 0;
var THURSDAY = 4;
function getFirstThursdayOfYear(year) {
  const firstDayOfYear = createDate(year, JANUARY, 1).getDay();
  return createDate(year, 0, 1 + (firstDayOfYear <= THURSDAY ? THURSDAY : THURSDAY + 7) - firstDayOfYear);
}
function getThursdayThisIsoWeek(datetime) {
  const currentDay = datetime.getDay();
  const deltaToThursday = currentDay === 0 ? -3 : THURSDAY - currentDay;
  return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + deltaToThursday);
}
function weekGetter(size, monthBased = false) {
  return function(date, locale) {
    let result;
    if (monthBased) {
      const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;
      const today = date.getDate();
      result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);
    } else {
      const thisThurs = getThursdayThisIsoWeek(date);
      const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());
      const diff = thisThurs.getTime() - firstThurs.getTime();
      result = 1 + Math.round(diff / 6048e5);
    }
    return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  };
}
function weekNumberingYearGetter(size, trim = false) {
  return function(date, locale) {
    const thisThurs = getThursdayThisIsoWeek(date);
    const weekNumberingYear = thisThurs.getFullYear();
    return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);
  };
}
var DATE_FORMATS = {};
function getDateFormatter(format) {
  if (DATE_FORMATS[format]) {
    return DATE_FORMATS[format];
  }
  let formatter;
  switch (format) {
    case "G":
    case "GG":
    case "GGG":
      formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);
      break;
    case "GGGG":
      formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);
      break;
    case "GGGGG":
      formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);
      break;
    case "y":
      formatter = dateGetter(DateType.FullYear, 1, 0, false, true);
      break;
    case "yy":
      formatter = dateGetter(DateType.FullYear, 2, 0, true, true);
      break;
    case "yyy":
      formatter = dateGetter(DateType.FullYear, 3, 0, false, true);
      break;
    case "yyyy":
      formatter = dateGetter(DateType.FullYear, 4, 0, false, true);
      break;
    case "Y":
      formatter = weekNumberingYearGetter(1);
      break;
    case "YY":
      formatter = weekNumberingYearGetter(2, true);
      break;
    case "YYY":
      formatter = weekNumberingYearGetter(3);
      break;
    case "YYYY":
      formatter = weekNumberingYearGetter(4);
      break;
    case "M":
    case "L":
      formatter = dateGetter(DateType.Month, 1, 1);
      break;
    case "MM":
    case "LL":
      formatter = dateGetter(DateType.Month, 2, 1);
      break;
    case "MMM":
      formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);
      break;
    case "MMMM":
      formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);
      break;
    case "MMMMM":
      formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);
      break;
    case "LLL":
      formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);
      break;
    case "LLLL":
      formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);
      break;
    case "LLLLL":
      formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);
      break;
    case "w":
      formatter = weekGetter(1);
      break;
    case "ww":
      formatter = weekGetter(2);
      break;
    case "W":
      formatter = weekGetter(1, true);
      break;
    case "d":
      formatter = dateGetter(DateType.Date, 1);
      break;
    case "dd":
      formatter = dateGetter(DateType.Date, 2);
      break;
    case "c":
    case "cc":
      formatter = dateGetter(DateType.Day, 1);
      break;
    case "ccc":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);
      break;
    case "cccc":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);
      break;
    case "ccccc":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);
      break;
    case "cccccc":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);
      break;
    case "E":
    case "EE":
    case "EEE":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);
      break;
    case "EEEE":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);
      break;
    case "EEEEE":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);
      break;
    case "EEEEEE":
      formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);
      break;
    case "a":
    case "aa":
    case "aaa":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);
      break;
    case "aaaa":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);
      break;
    case "aaaaa":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);
      break;
    case "b":
    case "bb":
    case "bbb":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);
      break;
    case "bbbb":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);
      break;
    case "bbbbb":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);
      break;
    case "B":
    case "BB":
    case "BBB":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);
      break;
    case "BBBB":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);
      break;
    case "BBBBB":
      formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);
      break;
    case "h":
      formatter = dateGetter(DateType.Hours, 1, -12);
      break;
    case "hh":
      formatter = dateGetter(DateType.Hours, 2, -12);
      break;
    case "H":
      formatter = dateGetter(DateType.Hours, 1);
      break;
    case "HH":
      formatter = dateGetter(DateType.Hours, 2);
      break;
    case "m":
      formatter = dateGetter(DateType.Minutes, 1);
      break;
    case "mm":
      formatter = dateGetter(DateType.Minutes, 2);
      break;
    case "s":
      formatter = dateGetter(DateType.Seconds, 1);
      break;
    case "ss":
      formatter = dateGetter(DateType.Seconds, 2);
      break;
    case "S":
      formatter = dateGetter(DateType.FractionalSeconds, 1);
      break;
    case "SS":
      formatter = dateGetter(DateType.FractionalSeconds, 2);
      break;
    case "SSS":
      formatter = dateGetter(DateType.FractionalSeconds, 3);
      break;
    case "Z":
    case "ZZ":
    case "ZZZ":
      formatter = timeZoneGetter(ZoneWidth.Short);
      break;
    case "ZZZZZ":
      formatter = timeZoneGetter(ZoneWidth.Extended);
      break;
    case "O":
    case "OO":
    case "OOO":
    case "z":
    case "zz":
    case "zzz":
      formatter = timeZoneGetter(ZoneWidth.ShortGMT);
      break;
    case "OOOO":
    case "ZZZZ":
    case "zzzz":
      formatter = timeZoneGetter(ZoneWidth.Long);
      break;
    default:
      return null;
  }
  DATE_FORMATS[format] = formatter;
  return formatter;
}
function timezoneToOffset(timezone, fallback) {
  timezone = timezone.replace(/:/g, "");
  const requestedTimezoneOffset = Date.parse("Jan 01, 1970 00:00:00 " + timezone) / 6e4;
  return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;
}
function addDateMinutes(date, minutes) {
  date = new Date(date.getTime());
  date.setMinutes(date.getMinutes() + minutes);
  return date;
}
function convertTimezoneToLocal(date, timezone, reverse) {
  const reverseValue = reverse ? -1 : 1;
  const dateTimezoneOffset = date.getTimezoneOffset();
  const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
  return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));
}
function toDate(value) {
  if (isDate(value)) {
    return value;
  }
  if (typeof value === "number" && !isNaN(value)) {
    return new Date(value);
  }
  if (typeof value === "string") {
    value = value.trim();
    if (/^(\d{4}(-\d{1,2}(-\d{1,2})?)?)$/.test(value)) {
      const [y, m = 1, d = 1] = value.split("-").map((val) => +val);
      return createDate(y, m - 1, d);
    }
    const parsedNb = parseFloat(value);
    if (!isNaN(value - parsedNb)) {
      return new Date(parsedNb);
    }
    let match;
    if (match = value.match(ISO8601_DATE_REGEX)) {
      return isoStringToDate(match);
    }
  }
  const date = new Date(value);
  if (!isDate(date)) {
    throw new Error(`Unable to convert "${value}" into a date`);
  }
  return date;
}
function isoStringToDate(match) {
  const date = /* @__PURE__ */ new Date(0);
  let tzHour = 0;
  let tzMin = 0;
  const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;
  const timeSetter = match[8] ? date.setUTCHours : date.setHours;
  if (match[9]) {
    tzHour = Number(match[9] + match[10]);
    tzMin = Number(match[9] + match[11]);
  }
  dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));
  const h = Number(match[4] || 0) - tzHour;
  const m = Number(match[5] || 0) - tzMin;
  const s = Number(match[6] || 0);
  const ms = Math.floor(parseFloat("0." + (match[7] || 0)) * 1e3);
  timeSetter.call(date, h, m, s, ms);
  return date;
}
function isDate(value) {
  return value instanceof Date && !isNaN(value.valueOf());
}
var NUMBER_FORMAT_REGEXP = /^(\d+)?\.((\d+)(-(\d+))?)?$/;
var MAX_DIGITS = 22;
var DECIMAL_SEP = ".";
var ZERO_CHAR = "0";
var PATTERN_SEP = ";";
var GROUP_SEP = ",";
var DIGIT_CHAR = "#";
var CURRENCY_CHAR = "¤";
var PERCENT_CHAR = "%";
function formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {
  let formattedText = "";
  let isZero = false;
  if (!isFinite(value)) {
    formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);
  } else {
    let parsedNumber = parseNumber(value);
    if (isPercent) {
      parsedNumber = toPercent(parsedNumber);
    }
    let minInt = pattern.minInt;
    let minFraction = pattern.minFrac;
    let maxFraction = pattern.maxFrac;
    if (digitsInfo) {
      const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);
      if (parts === null) {
        throw new Error(`${digitsInfo} is not a valid digit info`);
      }
      const minIntPart = parts[1];
      const minFractionPart = parts[3];
      const maxFractionPart = parts[5];
      if (minIntPart != null) {
        minInt = parseIntAutoRadix(minIntPart);
      }
      if (minFractionPart != null) {
        minFraction = parseIntAutoRadix(minFractionPart);
      }
      if (maxFractionPart != null) {
        maxFraction = parseIntAutoRadix(maxFractionPart);
      } else if (minFractionPart != null && minFraction > maxFraction) {
        maxFraction = minFraction;
      }
    }
    roundNumber(parsedNumber, minFraction, maxFraction);
    let digits = parsedNumber.digits;
    let integerLen = parsedNumber.integerLen;
    const exponent = parsedNumber.exponent;
    let decimals = [];
    isZero = digits.every((d) => !d);
    for (; integerLen < minInt; integerLen++) {
      digits.unshift(0);
    }
    for (; integerLen < 0; integerLen++) {
      digits.unshift(0);
    }
    if (integerLen > 0) {
      decimals = digits.splice(integerLen, digits.length);
    } else {
      decimals = digits;
      digits = [0];
    }
    const groups = [];
    if (digits.length >= pattern.lgSize) {
      groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(""));
    }
    while (digits.length > pattern.gSize) {
      groups.unshift(digits.splice(-pattern.gSize, digits.length).join(""));
    }
    if (digits.length) {
      groups.unshift(digits.join(""));
    }
    formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));
    if (decimals.length) {
      formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join("");
    }
    if (exponent) {
      formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + "+" + exponent;
    }
  }
  if (value < 0 && !isZero) {
    formattedText = pattern.negPre + formattedText + pattern.negSuf;
  } else {
    formattedText = pattern.posPre + formattedText + pattern.posSuf;
  }
  return formattedText;
}
function formatCurrency(value, locale, currency, currencyCode, digitsInfo) {
  const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);
  const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);
  pattern.maxFrac = pattern.minFrac;
  const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);
  return res.replace(CURRENCY_CHAR, currency).replace(CURRENCY_CHAR, "").trim();
}
function formatPercent(value, locale, digitsInfo) {
  const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);
  const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);
  return res.replace(new RegExp(PERCENT_CHAR, "g"), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));
}
function formatNumber(value, locale, digitsInfo) {
  const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);
  const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);
}
function parseNumberFormat(format, minusSign = "-") {
  const p = {
    minInt: 1,
    minFrac: 0,
    maxFrac: 0,
    posPre: "",
    posSuf: "",
    negPre: "",
    negSuf: "",
    gSize: 0,
    lgSize: 0
  };
  const patternParts = format.split(PATTERN_SEP);
  const positive = patternParts[0];
  const negative = patternParts[1];
  const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ? positive.split(DECIMAL_SEP) : [positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1), positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)], integer = positiveParts[0], fraction = positiveParts[1] || "";
  p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));
  for (let i = 0; i < fraction.length; i++) {
    const ch = fraction.charAt(i);
    if (ch === ZERO_CHAR) {
      p.minFrac = p.maxFrac = i + 1;
    } else if (ch === DIGIT_CHAR) {
      p.maxFrac = i + 1;
    } else {
      p.posSuf += ch;
    }
  }
  const groups = integer.split(GROUP_SEP);
  p.gSize = groups[1] ? groups[1].length : 0;
  p.lgSize = groups[2] || groups[1] ? (groups[2] || groups[1]).length : 0;
  if (negative) {
    const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);
    p.negPre = negative.substring(0, pos).replace(/'/g, "");
    p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, "");
  } else {
    p.negPre = minusSign + p.posPre;
    p.negSuf = p.posSuf;
  }
  return p;
}
function toPercent(parsedNumber) {
  if (parsedNumber.digits[0] === 0) {
    return parsedNumber;
  }
  const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;
  if (parsedNumber.exponent) {
    parsedNumber.exponent += 2;
  } else {
    if (fractionLen === 0) {
      parsedNumber.digits.push(0, 0);
    } else if (fractionLen === 1) {
      parsedNumber.digits.push(0);
    }
    parsedNumber.integerLen += 2;
  }
  return parsedNumber;
}
function parseNumber(num) {
  let numStr = Math.abs(num) + "";
  let exponent = 0, digits, integerLen;
  let i, j, zeros;
  if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {
    numStr = numStr.replace(DECIMAL_SEP, "");
  }
  if ((i = numStr.search(/e/i)) > 0) {
    if (integerLen < 0)
      integerLen = i;
    integerLen += +numStr.slice(i + 1);
    numStr = numStr.substring(0, i);
  } else if (integerLen < 0) {
    integerLen = numStr.length;
  }
  for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) {
  }
  if (i === (zeros = numStr.length)) {
    digits = [0];
    integerLen = 1;
  } else {
    zeros--;
    while (numStr.charAt(zeros) === ZERO_CHAR)
      zeros--;
    integerLen -= i;
    digits = [];
    for (j = 0; i <= zeros; i++, j++) {
      digits[j] = Number(numStr.charAt(i));
    }
  }
  if (integerLen > MAX_DIGITS) {
    digits = digits.splice(0, MAX_DIGITS - 1);
    exponent = integerLen - 1;
    integerLen = 1;
  }
  return {
    digits,
    exponent,
    integerLen
  };
}
function roundNumber(parsedNumber, minFrac, maxFrac) {
  if (minFrac > maxFrac) {
    throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);
  }
  let digits = parsedNumber.digits;
  let fractionLen = digits.length - parsedNumber.integerLen;
  const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);
  let roundAt = fractionSize + parsedNumber.integerLen;
  let digit = digits[roundAt];
  if (roundAt > 0) {
    digits.splice(Math.max(parsedNumber.integerLen, roundAt));
    for (let j = roundAt; j < digits.length; j++) {
      digits[j] = 0;
    }
  } else {
    fractionLen = Math.max(0, fractionLen);
    parsedNumber.integerLen = 1;
    digits.length = Math.max(1, roundAt = fractionSize + 1);
    digits[0] = 0;
    for (let i = 1; i < roundAt; i++)
      digits[i] = 0;
  }
  if (digit >= 5) {
    if (roundAt - 1 < 0) {
      for (let k = 0; k > roundAt; k--) {
        digits.unshift(0);
        parsedNumber.integerLen++;
      }
      digits.unshift(1);
      parsedNumber.integerLen++;
    } else {
      digits[roundAt - 1]++;
    }
  }
  for (; fractionLen < Math.max(0, fractionSize); fractionLen++)
    digits.push(0);
  let dropTrailingZeros = fractionSize !== 0;
  const minLen = minFrac + parsedNumber.integerLen;
  const carry = digits.reduceRight(function(carry2, d, i, digits2) {
    d = d + carry2;
    digits2[i] = d < 10 ? d : d - 10;
    if (dropTrailingZeros) {
      if (digits2[i] === 0 && i >= minLen) {
        digits2.pop();
      } else {
        dropTrailingZeros = false;
      }
    }
    return d >= 10 ? 1 : 0;
  }, 0);
  if (carry) {
    digits.unshift(carry);
    parsedNumber.integerLen++;
  }
}
function parseIntAutoRadix(text) {
  const result = parseInt(text);
  if (isNaN(result)) {
    throw new Error("Invalid integer literal when parsing " + text);
  }
  return result;
}
var _NgLocalization = class _NgLocalization {
};
_NgLocalization.ɵfac = function NgLocalization_Factory(t) {
  return new (t || _NgLocalization)();
};
_NgLocalization.ɵprov = ɵɵdefineInjectable({
  token: _NgLocalization,
  factory: function NgLocalization_Factory(t) {
    let r = null;
    if (t) {
      r = new t();
    } else {
      r = ((locale) => new NgLocaleLocalization(locale))(ɵɵinject(LOCALE_ID));
    }
    return r;
  },
  providedIn: "root"
});
var NgLocalization = _NgLocalization;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgLocalization, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: (locale) => new NgLocaleLocalization(locale),
      deps: [LOCALE_ID]
    }]
  }], null, null);
})();
function getPluralCategory(value, cases, ngLocalization, locale) {
  let key = `=${value}`;
  if (cases.indexOf(key) > -1) {
    return key;
  }
  key = ngLocalization.getPluralCategory(value, locale);
  if (cases.indexOf(key) > -1) {
    return key;
  }
  if (cases.indexOf("other") > -1) {
    return "other";
  }
  throw new Error(`No plural message found for value "${value}"`);
}
var _NgLocaleLocalization = class _NgLocaleLocalization extends NgLocalization {
  constructor(locale) {
    super();
    this.locale = locale;
  }
  getPluralCategory(value, locale) {
    const plural = getLocalePluralCase2(locale || this.locale)(value);
    switch (plural) {
      case Plural.Zero:
        return "zero";
      case Plural.One:
        return "one";
      case Plural.Two:
        return "two";
      case Plural.Few:
        return "few";
      case Plural.Many:
        return "many";
      default:
        return "other";
    }
  }
};
_NgLocaleLocalization.ɵfac = function NgLocaleLocalization_Factory(t) {
  return new (t || _NgLocaleLocalization)(ɵɵinject(LOCALE_ID));
};
_NgLocaleLocalization.ɵprov = ɵɵdefineInjectable({
  token: _NgLocaleLocalization,
  factory: _NgLocaleLocalization.ɵfac
});
var NgLocaleLocalization = _NgLocaleLocalization;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgLocaleLocalization, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }], null);
})();
function parseCookieValue(cookieStr, name) {
  name = encodeURIComponent(name);
  for (const cookie of cookieStr.split(";")) {
    const eqIndex = cookie.indexOf("=");
    const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ""] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];
    if (cookieName.trim() === name) {
      return decodeURIComponent(cookieValue);
    }
  }
  return null;
}
var WS_REGEXP = /\s+/;
var EMPTY_ARRAY = [];
var _NgClass = class _NgClass {
  constructor(_ngEl, _renderer) {
    this._ngEl = _ngEl;
    this._renderer = _renderer;
    this.initialClasses = EMPTY_ARRAY;
    this.stateMap = /* @__PURE__ */ new Map();
  }
  set klass(value) {
    this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;
  }
  set ngClass(value) {
    this.rawClass = typeof value === "string" ? value.trim().split(WS_REGEXP) : value;
  }
  /*
  The NgClass directive uses the custom change detection algorithm for its inputs. The custom
  algorithm is necessary since inputs are represented as complex object or arrays that need to be
  deeply-compared.
     This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance
  might negatively impact runtime performance of the entire change detection cycle. The design of
  this algorithm is making sure that:
  - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when
  needed), even if references to bound objects change;
  - there is no memory allocation if nothing changes (even relatively modest memory allocation
  during the change detection cycle can result in GC pauses for some of the CD cycles).
     The algorithm works by iterating over the set of bound classes, staring with [class] binding and
  then going over [ngClass] binding. For each CSS class name:
  - check if it was seen before (this information is tracked in the state map) and if its value
  changed;
  - mark it as "touched" - names that are not marked are not present in the latest set of binding
  and we can remove such class name from the internal data structures;
     After iteration over all the CSS class names we've got data structure with all the information
  necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush
  changes to the DOM and reset internal data structures so those are ready for the next change
  detection cycle.
   */
  ngDoCheck() {
    for (const klass of this.initialClasses) {
      this._updateState(klass, true);
    }
    const rawClass = this.rawClass;
    if (Array.isArray(rawClass) || rawClass instanceof Set) {
      for (const klass of rawClass) {
        this._updateState(klass, true);
      }
    } else if (rawClass != null) {
      for (const klass of Object.keys(rawClass)) {
        this._updateState(klass, Boolean(rawClass[klass]));
      }
    }
    this._applyStateDiff();
  }
  _updateState(klass, nextEnabled) {
    const state = this.stateMap.get(klass);
    if (state !== void 0) {
      if (state.enabled !== nextEnabled) {
        state.changed = true;
        state.enabled = nextEnabled;
      }
      state.touched = true;
    } else {
      this.stateMap.set(klass, {
        enabled: nextEnabled,
        changed: true,
        touched: true
      });
    }
  }
  _applyStateDiff() {
    for (const stateEntry of this.stateMap) {
      const klass = stateEntry[0];
      const state = stateEntry[1];
      if (state.changed) {
        this._toggleClass(klass, state.enabled);
        state.changed = false;
      } else if (!state.touched) {
        if (state.enabled) {
          this._toggleClass(klass, false);
        }
        this.stateMap.delete(klass);
      }
      state.touched = false;
    }
  }
  _toggleClass(klass, enabled) {
    if (ngDevMode) {
      if (typeof klass !== "string") {
        throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${stringify(klass)}`);
      }
    }
    klass = klass.trim();
    if (klass.length > 0) {
      klass.split(WS_REGEXP).forEach((klass2) => {
        if (enabled) {
          this._renderer.addClass(this._ngEl.nativeElement, klass2);
        } else {
          this._renderer.removeClass(this._ngEl.nativeElement, klass2);
        }
      });
    }
  }
};
_NgClass.ɵfac = function NgClass_Factory(t) {
  return new (t || _NgClass)(ɵɵdirectiveInject(ElementRef), ɵɵdirectiveInject(Renderer2));
};
_NgClass.ɵdir = ɵɵdefineDirective({
  type: _NgClass,
  selectors: [["", "ngClass", ""]],
  inputs: {
    klass: [InputFlags.None, "class", "klass"],
    ngClass: "ngClass"
  },
  standalone: true
});
var NgClass = _NgClass;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgClass, [{
    type: Directive,
    args: [{
      selector: "[ngClass]",
      standalone: true
    }]
  }], () => [{
    type: ElementRef
  }, {
    type: Renderer2
  }], {
    klass: [{
      type: Input,
      args: ["class"]
    }],
    ngClass: [{
      type: Input,
      args: ["ngClass"]
    }]
  });
})();
var _NgComponentOutlet = class _NgComponentOutlet {
  constructor(_viewContainerRef) {
    this._viewContainerRef = _viewContainerRef;
    this.ngComponentOutlet = null;
    this._inputsUsed = /* @__PURE__ */ new Map();
  }
  _needToReCreateNgModuleInstance(changes) {
    return changes["ngComponentOutletNgModule"] !== void 0 || changes["ngComponentOutletNgModuleFactory"] !== void 0;
  }
  _needToReCreateComponentInstance(changes) {
    return changes["ngComponentOutlet"] !== void 0 || changes["ngComponentOutletContent"] !== void 0 || changes["ngComponentOutletInjector"] !== void 0 || this._needToReCreateNgModuleInstance(changes);
  }
  /** @nodoc */
  ngOnChanges(changes) {
    if (this._needToReCreateComponentInstance(changes)) {
      this._viewContainerRef.clear();
      this._inputsUsed.clear();
      this._componentRef = void 0;
      if (this.ngComponentOutlet) {
        const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;
        if (this._needToReCreateNgModuleInstance(changes)) {
          this._moduleRef?.destroy();
          if (this.ngComponentOutletNgModule) {
            this._moduleRef = createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));
          } else if (this.ngComponentOutletNgModuleFactory) {
            this._moduleRef = this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));
          } else {
            this._moduleRef = void 0;
          }
        }
        this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {
          injector,
          ngModuleRef: this._moduleRef,
          projectableNodes: this.ngComponentOutletContent
        });
      }
    }
  }
  /** @nodoc */
  ngDoCheck() {
    if (this._componentRef) {
      if (this.ngComponentOutletInputs) {
        for (const inputName of Object.keys(this.ngComponentOutletInputs)) {
          this._inputsUsed.set(inputName, true);
        }
      }
      this._applyInputStateDiff(this._componentRef);
    }
  }
  /** @nodoc */
  ngOnDestroy() {
    this._moduleRef?.destroy();
  }
  _applyInputStateDiff(componentRef) {
    for (const [inputName, touched] of this._inputsUsed) {
      if (!touched) {
        componentRef.setInput(inputName, void 0);
        this._inputsUsed.delete(inputName);
      } else {
        componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);
        this._inputsUsed.set(inputName, false);
      }
    }
  }
};
_NgComponentOutlet.ɵfac = function NgComponentOutlet_Factory(t) {
  return new (t || _NgComponentOutlet)(ɵɵdirectiveInject(ViewContainerRef));
};
_NgComponentOutlet.ɵdir = ɵɵdefineDirective({
  type: _NgComponentOutlet,
  selectors: [["", "ngComponentOutlet", ""]],
  inputs: {
    ngComponentOutlet: "ngComponentOutlet",
    ngComponentOutletInputs: "ngComponentOutletInputs",
    ngComponentOutletInjector: "ngComponentOutletInjector",
    ngComponentOutletContent: "ngComponentOutletContent",
    ngComponentOutletNgModule: "ngComponentOutletNgModule",
    ngComponentOutletNgModuleFactory: "ngComponentOutletNgModuleFactory"
  },
  standalone: true,
  features: [ɵɵNgOnChangesFeature]
});
var NgComponentOutlet = _NgComponentOutlet;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgComponentOutlet, [{
    type: Directive,
    args: [{
      selector: "[ngComponentOutlet]",
      standalone: true
    }]
  }], () => [{
    type: ViewContainerRef
  }], {
    ngComponentOutlet: [{
      type: Input
    }],
    ngComponentOutletInputs: [{
      type: Input
    }],
    ngComponentOutletInjector: [{
      type: Input
    }],
    ngComponentOutletContent: [{
      type: Input
    }],
    ngComponentOutletNgModule: [{
      type: Input
    }],
    ngComponentOutletNgModuleFactory: [{
      type: Input
    }]
  });
})();
function getParentInjector(injector) {
  const parentNgModule = injector.get(NgModuleRef$1);
  return parentNgModule.injector;
}
var NgForOfContext = class {
  constructor($implicit, ngForOf, index, count) {
    this.$implicit = $implicit;
    this.ngForOf = ngForOf;
    this.index = index;
    this.count = count;
  }
  get first() {
    return this.index === 0;
  }
  get last() {
    return this.index === this.count - 1;
  }
  get even() {
    return this.index % 2 === 0;
  }
  get odd() {
    return !this.even;
  }
};
var _NgForOf = class _NgForOf {
  /**
   * The value of the iterable expression, which can be used as a
   * [template input variable](guide/structural-directives#shorthand).
   */
  set ngForOf(ngForOf) {
    this._ngForOf = ngForOf;
    this._ngForOfDirty = true;
  }
  /**
   * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.
   *
   * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object
   * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)
   * as the key.
   *
   * `NgForOf` uses the computed key to associate items in an iterable with DOM elements
   * it produces for these items.
   *
   * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an
   * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a
   * primary key), and this iterable could be updated with new object instances that still
   * represent the same underlying entity (for example, when data is re-fetched from the server,
   * and the iterable is recreated and re-rendered, but most of the data is still the same).
   *
   * @see {@link TrackByFunction}
   */
  set ngForTrackBy(fn) {
    if ((typeof ngDevMode === "undefined" || ngDevMode) && fn != null && typeof fn !== "function") {
      console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. See https://angular.io/api/common/NgForOf#change-propagation for more information.`);
    }
    this._trackByFn = fn;
  }
  get ngForTrackBy() {
    return this._trackByFn;
  }
  constructor(_viewContainer, _template, _differs) {
    this._viewContainer = _viewContainer;
    this._template = _template;
    this._differs = _differs;
    this._ngForOf = null;
    this._ngForOfDirty = true;
    this._differ = null;
  }
  /**
   * A reference to the template that is stamped out for each item in the iterable.
   * @see [template reference variable](guide/template-reference-variables)
   */
  set ngForTemplate(value) {
    if (value) {
      this._template = value;
    }
  }
  /**
   * Applies the changes when needed.
   * @nodoc
   */
  ngDoCheck() {
    if (this._ngForOfDirty) {
      this._ngForOfDirty = false;
      const value = this._ngForOf;
      if (!this._differ && value) {
        if (typeof ngDevMode === "undefined" || ngDevMode) {
          try {
            this._differ = this._differs.find(value).create(this.ngForTrackBy);
          } catch {
            let errorMessage = `Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;
            if (typeof value === "object") {
              errorMessage += " Did you mean to use the keyvalue pipe?";
            }
            throw new RuntimeError(-2200, errorMessage);
          }
        } else {
          this._differ = this._differs.find(value).create(this.ngForTrackBy);
        }
      }
    }
    if (this._differ) {
      const changes = this._differ.diff(this._ngForOf);
      if (changes)
        this._applyChanges(changes);
    }
  }
  _applyChanges(changes) {
    const viewContainer = this._viewContainer;
    changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {
      if (item.previousIndex == null) {
        viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? void 0 : currentIndex);
      } else if (currentIndex == null) {
        viewContainer.remove(adjustedPreviousIndex === null ? void 0 : adjustedPreviousIndex);
      } else if (adjustedPreviousIndex !== null) {
        const view = viewContainer.get(adjustedPreviousIndex);
        viewContainer.move(view, currentIndex);
        applyViewChange(view, item);
      }
    });
    for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {
      const viewRef = viewContainer.get(i);
      const context = viewRef.context;
      context.index = i;
      context.count = ilen;
      context.ngForOf = this._ngForOf;
    }
    changes.forEachIdentityChange((record) => {
      const viewRef = viewContainer.get(record.currentIndex);
      applyViewChange(viewRef, record);
    });
  }
  /**
   * Asserts the correct type of the context for the template that `NgForOf` will render.
   *
   * The presence of this method is a signal to the Ivy template type-check compiler that the
   * `NgForOf` structural directive renders its template with a specific context type.
   */
  static ngTemplateContextGuard(dir, ctx) {
    return true;
  }
};
_NgForOf.ɵfac = function NgForOf_Factory(t) {
  return new (t || _NgForOf)(ɵɵdirectiveInject(ViewContainerRef), ɵɵdirectiveInject(TemplateRef), ɵɵdirectiveInject(IterableDiffers));
};
_NgForOf.ɵdir = ɵɵdefineDirective({
  type: _NgForOf,
  selectors: [["", "ngFor", "", "ngForOf", ""]],
  inputs: {
    ngForOf: "ngForOf",
    ngForTrackBy: "ngForTrackBy",
    ngForTemplate: "ngForTemplate"
  },
  standalone: true
});
var NgForOf = _NgForOf;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgForOf, [{
    type: Directive,
    args: [{
      selector: "[ngFor][ngForOf]",
      standalone: true
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }, {
    type: IterableDiffers
  }], {
    ngForOf: [{
      type: Input
    }],
    ngForTrackBy: [{
      type: Input
    }],
    ngForTemplate: [{
      type: Input
    }]
  });
})();
function applyViewChange(view, record) {
  view.context.$implicit = record.item;
}
function getTypeName(type) {
  return type["name"] || typeof type;
}
var _NgIf = class _NgIf {
  constructor(_viewContainer, templateRef) {
    this._viewContainer = _viewContainer;
    this._context = new NgIfContext();
    this._thenTemplateRef = null;
    this._elseTemplateRef = null;
    this._thenViewRef = null;
    this._elseViewRef = null;
    this._thenTemplateRef = templateRef;
  }
  /**
   * The Boolean expression to evaluate as the condition for showing a template.
   */
  set ngIf(condition) {
    this._context.$implicit = this._context.ngIf = condition;
    this._updateView();
  }
  /**
   * A template to show if the condition expression evaluates to true.
   */
  set ngIfThen(templateRef) {
    assertTemplate("ngIfThen", templateRef);
    this._thenTemplateRef = templateRef;
    this._thenViewRef = null;
    this._updateView();
  }
  /**
   * A template to show if the condition expression evaluates to false.
   */
  set ngIfElse(templateRef) {
    assertTemplate("ngIfElse", templateRef);
    this._elseTemplateRef = templateRef;
    this._elseViewRef = null;
    this._updateView();
  }
  _updateView() {
    if (this._context.$implicit) {
      if (!this._thenViewRef) {
        this._viewContainer.clear();
        this._elseViewRef = null;
        if (this._thenTemplateRef) {
          this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);
        }
      }
    } else {
      if (!this._elseViewRef) {
        this._viewContainer.clear();
        this._thenViewRef = null;
        if (this._elseTemplateRef) {
          this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);
        }
      }
    }
  }
  /**
   * Asserts the correct type of the context for the template that `NgIf` will render.
   *
   * The presence of this method is a signal to the Ivy template type-check compiler that the
   * `NgIf` structural directive renders its template with a specific context type.
   */
  static ngTemplateContextGuard(dir, ctx) {
    return true;
  }
};
_NgIf.ɵfac = function NgIf_Factory(t) {
  return new (t || _NgIf)(ɵɵdirectiveInject(ViewContainerRef), ɵɵdirectiveInject(TemplateRef));
};
_NgIf.ɵdir = ɵɵdefineDirective({
  type: _NgIf,
  selectors: [["", "ngIf", ""]],
  inputs: {
    ngIf: "ngIf",
    ngIfThen: "ngIfThen",
    ngIfElse: "ngIfElse"
  },
  standalone: true
});
var NgIf = _NgIf;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgIf, [{
    type: Directive,
    args: [{
      selector: "[ngIf]",
      standalone: true
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }], {
    ngIf: [{
      type: Input
    }],
    ngIfThen: [{
      type: Input
    }],
    ngIfElse: [{
      type: Input
    }]
  });
})();
var NgIfContext = class {
  constructor() {
    this.$implicit = null;
    this.ngIf = null;
  }
};
function assertTemplate(property, templateRef) {
  const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);
  if (!isTemplateRefOrNull) {
    throw new Error(`${property} must be a TemplateRef, but received '${stringify(templateRef)}'.`);
  }
}
var NG_SWITCH_USE_STRICT_EQUALS = true;
var SwitchView = class {
  constructor(_viewContainerRef, _templateRef) {
    this._viewContainerRef = _viewContainerRef;
    this._templateRef = _templateRef;
    this._created = false;
  }
  create() {
    this._created = true;
    this._viewContainerRef.createEmbeddedView(this._templateRef);
  }
  destroy() {
    this._created = false;
    this._viewContainerRef.clear();
  }
  enforceState(created) {
    if (created && !this._created) {
      this.create();
    } else if (!created && this._created) {
      this.destroy();
    }
  }
};
var _NgSwitch = class _NgSwitch {
  constructor() {
    this._defaultViews = [];
    this._defaultUsed = false;
    this._caseCount = 0;
    this._lastCaseCheckIndex = 0;
    this._lastCasesMatched = false;
  }
  set ngSwitch(newValue) {
    this._ngSwitch = newValue;
    if (this._caseCount === 0) {
      this._updateDefaultCases(true);
    }
  }
  /** @internal */
  _addCase() {
    return this._caseCount++;
  }
  /** @internal */
  _addDefault(view) {
    this._defaultViews.push(view);
  }
  /** @internal */
  _matchCase(value) {
    const matched = NG_SWITCH_USE_STRICT_EQUALS ? value === this._ngSwitch : value == this._ngSwitch;
    if ((typeof ngDevMode === "undefined" || ngDevMode) && matched !== (value == this._ngSwitch)) {
      console.warn(formatRuntimeError(2001, `As of Angular v17 the NgSwitch directive uses strict equality comparison === instead of == to match different cases. Previously the case value "${stringifyValue(value)}" matched switch expression value "${stringifyValue(this._ngSwitch)}", but this is no longer the case with the stricter equality check. Your comparison results return different results using === vs. == and you should adjust your ngSwitch expression and / or values to conform with the strict equality requirements.`));
    }
    this._lastCasesMatched ||= matched;
    this._lastCaseCheckIndex++;
    if (this._lastCaseCheckIndex === this._caseCount) {
      this._updateDefaultCases(!this._lastCasesMatched);
      this._lastCaseCheckIndex = 0;
      this._lastCasesMatched = false;
    }
    return matched;
  }
  _updateDefaultCases(useDefault) {
    if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {
      this._defaultUsed = useDefault;
      for (const defaultView of this._defaultViews) {
        defaultView.enforceState(useDefault);
      }
    }
  }
};
_NgSwitch.ɵfac = function NgSwitch_Factory(t) {
  return new (t || _NgSwitch)();
};
_NgSwitch.ɵdir = ɵɵdefineDirective({
  type: _NgSwitch,
  selectors: [["", "ngSwitch", ""]],
  inputs: {
    ngSwitch: "ngSwitch"
  },
  standalone: true
});
var NgSwitch = _NgSwitch;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgSwitch, [{
    type: Directive,
    args: [{
      selector: "[ngSwitch]",
      standalone: true
    }]
  }], null, {
    ngSwitch: [{
      type: Input
    }]
  });
})();
var _NgSwitchCase = class _NgSwitchCase {
  constructor(viewContainer, templateRef, ngSwitch) {
    this.ngSwitch = ngSwitch;
    if ((typeof ngDevMode === "undefined" || ngDevMode) && !ngSwitch) {
      throwNgSwitchProviderNotFoundError("ngSwitchCase", "NgSwitchCase");
    }
    ngSwitch._addCase();
    this._view = new SwitchView(viewContainer, templateRef);
  }
  /**
   * Performs case matching. For internal use only.
   * @nodoc
   */
  ngDoCheck() {
    this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));
  }
};
_NgSwitchCase.ɵfac = function NgSwitchCase_Factory(t) {
  return new (t || _NgSwitchCase)(ɵɵdirectiveInject(ViewContainerRef), ɵɵdirectiveInject(TemplateRef), ɵɵdirectiveInject(NgSwitch, 9));
};
_NgSwitchCase.ɵdir = ɵɵdefineDirective({
  type: _NgSwitchCase,
  selectors: [["", "ngSwitchCase", ""]],
  inputs: {
    ngSwitchCase: "ngSwitchCase"
  },
  standalone: true
});
var NgSwitchCase = _NgSwitchCase;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgSwitchCase, [{
    type: Directive,
    args: [{
      selector: "[ngSwitchCase]",
      standalone: true
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }, {
    type: NgSwitch,
    decorators: [{
      type: Optional
    }, {
      type: Host
    }]
  }], {
    ngSwitchCase: [{
      type: Input
    }]
  });
})();
var _NgSwitchDefault = class _NgSwitchDefault {
  constructor(viewContainer, templateRef, ngSwitch) {
    if ((typeof ngDevMode === "undefined" || ngDevMode) && !ngSwitch) {
      throwNgSwitchProviderNotFoundError("ngSwitchDefault", "NgSwitchDefault");
    }
    ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));
  }
};
_NgSwitchDefault.ɵfac = function NgSwitchDefault_Factory(t) {
  return new (t || _NgSwitchDefault)(ɵɵdirectiveInject(ViewContainerRef), ɵɵdirectiveInject(TemplateRef), ɵɵdirectiveInject(NgSwitch, 9));
};
_NgSwitchDefault.ɵdir = ɵɵdefineDirective({
  type: _NgSwitchDefault,
  selectors: [["", "ngSwitchDefault", ""]],
  standalone: true
});
var NgSwitchDefault = _NgSwitchDefault;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgSwitchDefault, [{
    type: Directive,
    args: [{
      selector: "[ngSwitchDefault]",
      standalone: true
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }, {
    type: NgSwitch,
    decorators: [{
      type: Optional
    }, {
      type: Host
    }]
  }], null);
})();
function throwNgSwitchProviderNotFoundError(attrName, directiveName) {
  throw new RuntimeError(2e3, `An element with the "${attrName}" attribute (matching the "${directiveName}" directive) must be located inside an element with the "ngSwitch" attribute (matching "NgSwitch" directive)`);
}
function stringifyValue(value) {
  return typeof value === "string" ? `'${value}'` : String(value);
}
var _NgPlural = class _NgPlural {
  constructor(_localization) {
    this._localization = _localization;
    this._caseViews = {};
  }
  set ngPlural(value) {
    this._updateView(value);
  }
  addCase(value, switchView) {
    this._caseViews[value] = switchView;
  }
  _updateView(switchValue) {
    this._clearViews();
    const cases = Object.keys(this._caseViews);
    const key = getPluralCategory(switchValue, cases, this._localization);
    this._activateView(this._caseViews[key]);
  }
  _clearViews() {
    if (this._activeView)
      this._activeView.destroy();
  }
  _activateView(view) {
    if (view) {
      this._activeView = view;
      this._activeView.create();
    }
  }
};
_NgPlural.ɵfac = function NgPlural_Factory(t) {
  return new (t || _NgPlural)(ɵɵdirectiveInject(NgLocalization));
};
_NgPlural.ɵdir = ɵɵdefineDirective({
  type: _NgPlural,
  selectors: [["", "ngPlural", ""]],
  inputs: {
    ngPlural: "ngPlural"
  },
  standalone: true
});
var NgPlural = _NgPlural;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgPlural, [{
    type: Directive,
    args: [{
      selector: "[ngPlural]",
      standalone: true
    }]
  }], () => [{
    type: NgLocalization
  }], {
    ngPlural: [{
      type: Input
    }]
  });
})();
var _NgPluralCase = class _NgPluralCase {
  constructor(value, template, viewContainer, ngPlural) {
    this.value = value;
    const isANumber = !isNaN(Number(value));
    ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));
  }
};
_NgPluralCase.ɵfac = function NgPluralCase_Factory(t) {
  return new (t || _NgPluralCase)(ɵɵinjectAttribute("ngPluralCase"), ɵɵdirectiveInject(TemplateRef), ɵɵdirectiveInject(ViewContainerRef), ɵɵdirectiveInject(NgPlural, 1));
};
_NgPluralCase.ɵdir = ɵɵdefineDirective({
  type: _NgPluralCase,
  selectors: [["", "ngPluralCase", ""]],
  standalone: true
});
var NgPluralCase = _NgPluralCase;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgPluralCase, [{
    type: Directive,
    args: [{
      selector: "[ngPluralCase]",
      standalone: true
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Attribute,
      args: ["ngPluralCase"]
    }]
  }, {
    type: TemplateRef
  }, {
    type: ViewContainerRef
  }, {
    type: NgPlural,
    decorators: [{
      type: Host
    }]
  }], null);
})();
var _NgStyle = class _NgStyle {
  constructor(_ngEl, _differs, _renderer) {
    this._ngEl = _ngEl;
    this._differs = _differs;
    this._renderer = _renderer;
    this._ngStyle = null;
    this._differ = null;
  }
  set ngStyle(values) {
    this._ngStyle = values;
    if (!this._differ && values) {
      this._differ = this._differs.find(values).create();
    }
  }
  ngDoCheck() {
    if (this._differ) {
      const changes = this._differ.diff(this._ngStyle);
      if (changes) {
        this._applyChanges(changes);
      }
    }
  }
  _setStyle(nameAndUnit, value) {
    const [name, unit] = nameAndUnit.split(".");
    const flags = name.indexOf("-") === -1 ? void 0 : RendererStyleFlags2.DashCase;
    if (value != null) {
      this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);
    } else {
      this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);
    }
  }
  _applyChanges(changes) {
    changes.forEachRemovedItem((record) => this._setStyle(record.key, null));
    changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));
    changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));
  }
};
_NgStyle.ɵfac = function NgStyle_Factory(t) {
  return new (t || _NgStyle)(ɵɵdirectiveInject(ElementRef), ɵɵdirectiveInject(KeyValueDiffers), ɵɵdirectiveInject(Renderer2));
};
_NgStyle.ɵdir = ɵɵdefineDirective({
  type: _NgStyle,
  selectors: [["", "ngStyle", ""]],
  inputs: {
    ngStyle: "ngStyle"
  },
  standalone: true
});
var NgStyle = _NgStyle;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgStyle, [{
    type: Directive,
    args: [{
      selector: "[ngStyle]",
      standalone: true
    }]
  }], () => [{
    type: ElementRef
  }, {
    type: KeyValueDiffers
  }, {
    type: Renderer2
  }], {
    ngStyle: [{
      type: Input,
      args: ["ngStyle"]
    }]
  });
})();
var _NgTemplateOutlet = class _NgTemplateOutlet {
  constructor(_viewContainerRef) {
    this._viewContainerRef = _viewContainerRef;
    this._viewRef = null;
    this.ngTemplateOutletContext = null;
    this.ngTemplateOutlet = null;
    this.ngTemplateOutletInjector = null;
  }
  ngOnChanges(changes) {
    if (this._shouldRecreateView(changes)) {
      const viewContainerRef = this._viewContainerRef;
      if (this._viewRef) {
        viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));
      }
      if (!this.ngTemplateOutlet) {
        this._viewRef = null;
        return;
      }
      const viewContext = this._createContextForwardProxy();
      this._viewRef = viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, viewContext, {
        injector: this.ngTemplateOutletInjector ?? void 0
      });
    }
  }
  /**
   * We need to re-create existing embedded view if either is true:
   * - the outlet changed.
   * - the injector changed.
   */
  _shouldRecreateView(changes) {
    return !!changes["ngTemplateOutlet"] || !!changes["ngTemplateOutletInjector"];
  }
  /**
   * For a given outlet instance, we create a proxy object that delegates
   * to the user-specified context. This allows changing, or swapping out
   * the context object completely without having to destroy/re-create the view.
   */
  _createContextForwardProxy() {
    return new Proxy({}, {
      set: (_target, prop, newValue) => {
        if (!this.ngTemplateOutletContext) {
          return false;
        }
        return Reflect.set(this.ngTemplateOutletContext, prop, newValue);
      },
      get: (_target, prop, receiver) => {
        if (!this.ngTemplateOutletContext) {
          return void 0;
        }
        return Reflect.get(this.ngTemplateOutletContext, prop, receiver);
      }
    });
  }
};
_NgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) {
  return new (t || _NgTemplateOutlet)(ɵɵdirectiveInject(ViewContainerRef));
};
_NgTemplateOutlet.ɵdir = ɵɵdefineDirective({
  type: _NgTemplateOutlet,
  selectors: [["", "ngTemplateOutlet", ""]],
  inputs: {
    ngTemplateOutletContext: "ngTemplateOutletContext",
    ngTemplateOutlet: "ngTemplateOutlet",
    ngTemplateOutletInjector: "ngTemplateOutletInjector"
  },
  standalone: true,
  features: [ɵɵNgOnChangesFeature]
});
var NgTemplateOutlet = _NgTemplateOutlet;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgTemplateOutlet, [{
    type: Directive,
    args: [{
      selector: "[ngTemplateOutlet]",
      standalone: true
    }]
  }], () => [{
    type: ViewContainerRef
  }], {
    ngTemplateOutletContext: [{
      type: Input
    }],
    ngTemplateOutlet: [{
      type: Input
    }],
    ngTemplateOutletInjector: [{
      type: Input
    }]
  });
})();
var COMMON_DIRECTIVES = [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase];
function invalidPipeArgumentError(type, value) {
  return new RuntimeError(2100, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${stringify(type)}'`);
}
var SubscribableStrategy = class {
  createSubscription(async, updateLatestValue) {
    return untracked(() => async.subscribe({
      next: updateLatestValue,
      error: (e) => {
        throw e;
      }
    }));
  }
  dispose(subscription) {
    untracked(() => subscription.unsubscribe());
  }
};
var PromiseStrategy = class {
  createSubscription(async, updateLatestValue) {
    return async.then(updateLatestValue, (e) => {
      throw e;
    });
  }
  dispose(subscription) {
  }
};
var _promiseStrategy = new PromiseStrategy();
var _subscribableStrategy = new SubscribableStrategy();
var _AsyncPipe = class _AsyncPipe {
  constructor(ref) {
    this._latestValue = null;
    this._subscription = null;
    this._obj = null;
    this._strategy = null;
    this._ref = ref;
  }
  ngOnDestroy() {
    if (this._subscription) {
      this._dispose();
    }
    this._ref = null;
  }
  transform(obj) {
    if (!this._obj) {
      if (obj) {
        this._subscribe(obj);
      }
      return this._latestValue;
    }
    if (obj !== this._obj) {
      this._dispose();
      return this.transform(obj);
    }
    return this._latestValue;
  }
  _subscribe(obj) {
    this._obj = obj;
    this._strategy = this._selectStrategy(obj);
    this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));
  }
  _selectStrategy(obj) {
    if (isPromise(obj)) {
      return _promiseStrategy;
    }
    if (isSubscribable(obj)) {
      return _subscribableStrategy;
    }
    throw invalidPipeArgumentError(_AsyncPipe, obj);
  }
  _dispose() {
    this._strategy.dispose(this._subscription);
    this._latestValue = null;
    this._subscription = null;
    this._obj = null;
  }
  _updateLatestValue(async, value) {
    if (async === this._obj) {
      this._latestValue = value;
      this._ref.markForCheck();
    }
  }
};
_AsyncPipe.ɵfac = function AsyncPipe_Factory(t) {
  return new (t || _AsyncPipe)(ɵɵdirectiveInject(ChangeDetectorRef, 16));
};
_AsyncPipe.ɵpipe = ɵɵdefinePipe({
  name: "async",
  type: _AsyncPipe,
  pure: false,
  standalone: true
});
var AsyncPipe = _AsyncPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(AsyncPipe, [{
    type: Pipe,
    args: [{
      name: "async",
      pure: false,
      standalone: true
    }]
  }], () => [{
    type: ChangeDetectorRef
  }], null);
})();
var _LowerCasePipe = class _LowerCasePipe {
  transform(value) {
    if (value == null)
      return null;
    if (typeof value !== "string") {
      throw invalidPipeArgumentError(_LowerCasePipe, value);
    }
    return value.toLowerCase();
  }
};
_LowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) {
  return new (t || _LowerCasePipe)();
};
_LowerCasePipe.ɵpipe = ɵɵdefinePipe({
  name: "lowercase",
  type: _LowerCasePipe,
  pure: true,
  standalone: true
});
var LowerCasePipe = _LowerCasePipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(LowerCasePipe, [{
    type: Pipe,
    args: [{
      name: "lowercase",
      standalone: true
    }]
  }], null, null);
})();
var unicodeWordMatch = /(?:[0-9A-Za-z\xAA\xB5\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0370-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386\u0388-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u048A-\u052F\u0531-\u0556\u0559\u0560-\u0588\u05D0-\u05EA\u05EF-\u05F2\u0620-\u064A\u066E\u066F\u0671-\u06D3\u06D5\u06E5\u06E6\u06EE\u06EF\u06FA-\u06FC\u06FF\u0710\u0712-\u072F\u074D-\u07A5\u07B1\u07CA-\u07EA\u07F4\u07F5\u07FA\u0800-\u0815\u081A\u0824\u0828\u0840-\u0858\u0860-\u086A\u0870-\u0887\u0889-\u088E\u08A0-\u08C9\u0904-\u0939\u093D\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BD\u09CE\u09DC\u09DD\u09DF-\u09E1\u09F0\u09F1\u09FC\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A59-\u0A5C\u0A5E\u0A72-\u0A74\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABD\u0AD0\u0AE0\u0AE1\u0AF9\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3D\u0B5C\u0B5D\u0B5F-\u0B61\u0B71\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BD0\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D\u0C58-\u0C5A\u0C5D\u0C60\u0C61\u0C80\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBD\u0CDD\u0CDE\u0CE0\u0CE1\u0CF1\u0CF2\u0D04-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D\u0D4E\u0D54-\u0D56\u0D5F-\u0D61\u0D7A-\u0D7F\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0E01-\u0E30\u0E32\u0E33\u0E40-\u0E46\u0E81\u0E82\u0E84\u0E86-\u0E8A\u0E8C-\u0EA3\u0EA5\u0EA7-\u0EB0\u0EB2\u0EB3\u0EBD\u0EC0-\u0EC4\u0EC6\u0EDC-\u0EDF\u0F00\u0F40-\u0F47\u0F49-\u0F6C\u0F88-\u0F8C\u1000-\u102A\u103F\u1050-\u1055\u105A-\u105D\u1061\u1065\u1066\u106E-\u1070\u1075-\u1081\u108E\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16F1-\u16F8\u1700-\u1711\u171F-\u1731\u1740-\u1751\u1760-\u176C\u176E-\u1770\u1780-\u17B3\u17D7\u17DC\u1820-\u1878\u1880-\u1884\u1887-\u18A8\u18AA\u18B0-\u18F5\u1900-\u191E\u1950-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u1A00-\u1A16\u1A20-\u1A54\u1AA7\u1B05-\u1B33\u1B45-\u1B4C\u1B83-\u1BA0\u1BAE\u1BAF\u1BBA-\u1BE5\u1C00-\u1C23\u1C4D-\u1C4F\u1C5A-\u1C7D\u1C80-\u1C88\u1C90-\u1CBA\u1CBD-\u1CBF\u1CE9-\u1CEC\u1CEE-\u1CF3\u1CF5\u1CF6\u1CFA\u1D00-\u1DBF\u1E00-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u2071\u207F\u2090-\u209C\u2102\u2107\u210A-\u2113\u2115\u2119-\u211D\u2124\u2126\u2128\u212A-\u212D\u212F-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2183\u2184\u2C00-\u2CE4\u2CEB-\u2CEE\u2CF2\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D80-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u2E2F\u3005\u3006\u3031-\u3035\u303B\u303C\u3041-\u3096\u309D-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312F\u3131-\u318E\u31A0-\u31BF\u31F0-\u31FF\u3400-\u4DBF\u4E00-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA61F\uA62A\uA62B\uA640-\uA66E\uA67F-\uA69D\uA6A0-\uA6E5\uA717-\uA71F\uA722-\uA788\uA78B-\uA7CA\uA7D0\uA7D1\uA7D3\uA7D5-\uA7D9\uA7F2-\uA801\uA803-\uA805\uA807-\uA80A\uA80C-\uA822\uA840-\uA873\uA882-\uA8B3\uA8F2-\uA8F7\uA8FB\uA8FD\uA8FE\uA90A-\uA925\uA930-\uA946\uA960-\uA97C\uA984-\uA9B2\uA9CF\uA9E0-\uA9E4\uA9E6-\uA9EF\uA9FA-\uA9FE\uAA00-\uAA28\uAA40-\uAA42\uAA44-\uAA4B\uAA60-\uAA76\uAA7A\uAA7E-\uAAAF\uAAB1\uAAB5\uAAB6\uAAB9-\uAABD\uAAC0\uAAC2\uAADB-\uAADD\uAAE0-\uAAEA\uAAF2-\uAAF4\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB69\uAB70-\uABE2\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D\uFB1F-\uFB28\uFB2A-\uFB3
var _TitleCasePipe = class _TitleCasePipe {
  transform(value) {
    if (value == null)
      return null;
    if (typeof value !== "string") {
      throw invalidPipeArgumentError(_TitleCasePipe, value);
    }
    return value.replace(unicodeWordMatch, (txt) => txt[0].toUpperCase() + txt.slice(1).toLowerCase());
  }
};
_TitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) {
  return new (t || _TitleCasePipe)();
};
_TitleCasePipe.ɵpipe = ɵɵdefinePipe({
  name: "titlecase",
  type: _TitleCasePipe,
  pure: true,
  standalone: true
});
var TitleCasePipe = _TitleCasePipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(TitleCasePipe, [{
    type: Pipe,
    args: [{
      name: "titlecase",
      standalone: true
    }]
  }], null, null);
})();
var _UpperCasePipe = class _UpperCasePipe {
  transform(value) {
    if (value == null)
      return null;
    if (typeof value !== "string") {
      throw invalidPipeArgumentError(_UpperCasePipe, value);
    }
    return value.toUpperCase();
  }
};
_UpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) {
  return new (t || _UpperCasePipe)();
};
_UpperCasePipe.ɵpipe = ɵɵdefinePipe({
  name: "uppercase",
  type: _UpperCasePipe,
  pure: true,
  standalone: true
});
var UpperCasePipe = _UpperCasePipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(UpperCasePipe, [{
    type: Pipe,
    args: [{
      name: "uppercase",
      standalone: true
    }]
  }], null, null);
})();
var DEFAULT_DATE_FORMAT = "mediumDate";
var DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken(ngDevMode ? "DATE_PIPE_DEFAULT_TIMEZONE" : "");
var DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken(ngDevMode ? "DATE_PIPE_DEFAULT_OPTIONS" : "");
var _DatePipe = class _DatePipe {
  constructor(locale, defaultTimezone, defaultOptions) {
    this.locale = locale;
    this.defaultTimezone = defaultTimezone;
    this.defaultOptions = defaultOptions;
  }
  transform(value, format, timezone, locale) {
    if (value == null || value === "" || value !== value)
      return null;
    try {
      const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;
      const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? void 0;
      return formatDate(value, _format, locale || this.locale, _timezone);
    } catch (error) {
      throw invalidPipeArgumentError(_DatePipe, error.message);
    }
  }
};
_DatePipe.ɵfac = function DatePipe_Factory(t) {
  return new (t || _DatePipe)(ɵɵdirectiveInject(LOCALE_ID, 16), ɵɵdirectiveInject(DATE_PIPE_DEFAULT_TIMEZONE, 24), ɵɵdirectiveInject(DATE_PIPE_DEFAULT_OPTIONS, 24));
};
_DatePipe.ɵpipe = ɵɵdefinePipe({
  name: "date",
  type: _DatePipe,
  pure: true,
  standalone: true
});
var DatePipe = _DatePipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DatePipe, [{
    type: Pipe,
    args: [{
      name: "date",
      standalone: true
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DATE_PIPE_DEFAULT_TIMEZONE]
    }, {
      type: Optional
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DATE_PIPE_DEFAULT_OPTIONS]
    }, {
      type: Optional
    }]
  }], null);
})();
var _INTERPOLATION_REGEXP = /#/g;
var _I18nPluralPipe = class _I18nPluralPipe {
  constructor(_localization) {
    this._localization = _localization;
  }
  /**
   * @param value the number to be formatted
   * @param pluralMap an object that mimics the ICU format, see
   * https://unicode-org.github.io/icu/userguide/format_parse/messages/.
   * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by
   * default).
   */
  transform(value, pluralMap, locale) {
    if (value == null)
      return "";
    if (typeof pluralMap !== "object" || pluralMap === null) {
      throw invalidPipeArgumentError(_I18nPluralPipe, pluralMap);
    }
    const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);
    return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());
  }
};
_I18nPluralPipe.ɵfac = function I18nPluralPipe_Factory(t) {
  return new (t || _I18nPluralPipe)(ɵɵdirectiveInject(NgLocalization, 16));
};
_I18nPluralPipe.ɵpipe = ɵɵdefinePipe({
  name: "i18nPlural",
  type: _I18nPluralPipe,
  pure: true,
  standalone: true
});
var I18nPluralPipe = _I18nPluralPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(I18nPluralPipe, [{
    type: Pipe,
    args: [{
      name: "i18nPlural",
      standalone: true
    }]
  }], () => [{
    type: NgLocalization
  }], null);
})();
var _I18nSelectPipe = class _I18nSelectPipe {
  /**
   * @param value a string to be internationalized.
   * @param mapping an object that indicates the text that should be displayed
   * for different values of the provided `value`.
   */
  transform(value, mapping) {
    if (value == null)
      return "";
    if (typeof mapping !== "object" || typeof value !== "string") {
      throw invalidPipeArgumentError(_I18nSelectPipe, mapping);
    }
    if (mapping.hasOwnProperty(value)) {
      return mapping[value];
    }
    if (mapping.hasOwnProperty("other")) {
      return mapping["other"];
    }
    return "";
  }
};
_I18nSelectPipe.ɵfac = function I18nSelectPipe_Factory(t) {
  return new (t || _I18nSelectPipe)();
};
_I18nSelectPipe.ɵpipe = ɵɵdefinePipe({
  name: "i18nSelect",
  type: _I18nSelectPipe,
  pure: true,
  standalone: true
});
var I18nSelectPipe = _I18nSelectPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(I18nSelectPipe, [{
    type: Pipe,
    args: [{
      name: "i18nSelect",
      standalone: true
    }]
  }], null, null);
})();
var _JsonPipe = class _JsonPipe {
  /**
   * @param value A value of any type to convert into a JSON-format string.
   */
  transform(value) {
    return JSON.stringify(value, null, 2);
  }
};
_JsonPipe.ɵfac = function JsonPipe_Factory(t) {
  return new (t || _JsonPipe)();
};
_JsonPipe.ɵpipe = ɵɵdefinePipe({
  name: "json",
  type: _JsonPipe,
  pure: false,
  standalone: true
});
var JsonPipe = _JsonPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(JsonPipe, [{
    type: Pipe,
    args: [{
      name: "json",
      pure: false,
      standalone: true
    }]
  }], null, null);
})();
function makeKeyValuePair(key, value) {
  return {
    key,
    value
  };
}
var _KeyValuePipe = class _KeyValuePipe {
  constructor(differs) {
    this.differs = differs;
    this.keyValues = [];
    this.compareFn = defaultComparator;
  }
  transform(input, compareFn = defaultComparator) {
    if (!input || !(input instanceof Map) && typeof input !== "object") {
      return null;
    }
    this.differ ??= this.differs.find(input).create();
    const differChanges = this.differ.diff(input);
    const compareFnChanged = compareFn !== this.compareFn;
    if (differChanges) {
      this.keyValues = [];
      differChanges.forEachItem((r) => {
        this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));
      });
    }
    if (differChanges || compareFnChanged) {
      this.keyValues.sort(compareFn);
      this.compareFn = compareFn;
    }
    return this.keyValues;
  }
};
_KeyValuePipe.ɵfac = function KeyValuePipe_Factory(t) {
  return new (t || _KeyValuePipe)(ɵɵdirectiveInject(KeyValueDiffers, 16));
};
_KeyValuePipe.ɵpipe = ɵɵdefinePipe({
  name: "keyvalue",
  type: _KeyValuePipe,
  pure: false,
  standalone: true
});
var KeyValuePipe = _KeyValuePipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(KeyValuePipe, [{
    type: Pipe,
    args: [{
      name: "keyvalue",
      pure: false,
      standalone: true
    }]
  }], () => [{
    type: KeyValueDiffers
  }], null);
})();
function defaultComparator(keyValueA, keyValueB) {
  const a = keyValueA.key;
  const b = keyValueB.key;
  if (a === b)
    return 0;
  if (a === void 0)
    return 1;
  if (b === void 0)
    return -1;
  if (a === null)
    return 1;
  if (b === null)
    return -1;
  if (typeof a == "string" && typeof b == "string") {
    return a < b ? -1 : 1;
  }
  if (typeof a == "number" && typeof b == "number") {
    return a - b;
  }
  if (typeof a == "boolean" && typeof b == "boolean") {
    return a < b ? -1 : 1;
  }
  const aString = String(a);
  const bString = String(b);
  return aString == bString ? 0 : aString < bString ? -1 : 1;
}
var _DecimalPipe = class _DecimalPipe {
  constructor(_locale) {
    this._locale = _locale;
  }
  /**
   * @param value The value to be formatted.
   * @param digitsInfo Sets digit and decimal representation.
   * [See more](#digitsinfo).
   * @param locale Specifies what locale format rules to use.
   * [See more](#locale).
   */
  transform(value, digitsInfo, locale) {
    if (!isValue(value))
      return null;
    locale ||= this._locale;
    try {
      const num = strToNumber(value);
      return formatNumber(num, locale, digitsInfo);
    } catch (error) {
      throw invalidPipeArgumentError(_DecimalPipe, error.message);
    }
  }
};
_DecimalPipe.ɵfac = function DecimalPipe_Factory(t) {
  return new (t || _DecimalPipe)(ɵɵdirectiveInject(LOCALE_ID, 16));
};
_DecimalPipe.ɵpipe = ɵɵdefinePipe({
  name: "number",
  type: _DecimalPipe,
  pure: true,
  standalone: true
});
var DecimalPipe = _DecimalPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DecimalPipe, [{
    type: Pipe,
    args: [{
      name: "number",
      standalone: true
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }], null);
})();
var _PercentPipe = class _PercentPipe {
  constructor(_locale) {
    this._locale = _locale;
  }
  /**
   *
   * @param value The number to be formatted as a percentage.
   * @param digitsInfo Decimal representation options, specified by a string
   * in the following format:<br>
   * <code>{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}</code>.
   *   - `minIntegerDigits`: The minimum number of integer digits before the decimal point.
   * Default is `1`.
   *   - `minFractionDigits`: The minimum number of digits after the decimal point.
   * Default is `0`.
   *   - `maxFractionDigits`: The maximum number of digits after the decimal point.
   * Default is `0`.
   * @param locale A locale code for the locale format rules to use.
   * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
   * See [Setting your app locale](guide/i18n-common-locale-id).
   */
  transform(value, digitsInfo, locale) {
    if (!isValue(value))
      return null;
    locale ||= this._locale;
    try {
      const num = strToNumber(value);
      return formatPercent(num, locale, digitsInfo);
    } catch (error) {
      throw invalidPipeArgumentError(_PercentPipe, error.message);
    }
  }
};
_PercentPipe.ɵfac = function PercentPipe_Factory(t) {
  return new (t || _PercentPipe)(ɵɵdirectiveInject(LOCALE_ID, 16));
};
_PercentPipe.ɵpipe = ɵɵdefinePipe({
  name: "percent",
  type: _PercentPipe,
  pure: true,
  standalone: true
});
var PercentPipe = _PercentPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PercentPipe, [{
    type: Pipe,
    args: [{
      name: "percent",
      standalone: true
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }], null);
})();
var _CurrencyPipe = class _CurrencyPipe {
  constructor(_locale, _defaultCurrencyCode = "USD") {
    this._locale = _locale;
    this._defaultCurrencyCode = _defaultCurrencyCode;
  }
  /**
   *
   * @param value The number to be formatted as currency.
   * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,
   * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be
   * configured using the `DEFAULT_CURRENCY_CODE` injection token.
   * @param display The format for the currency indicator. One of the following:
   *   - `code`: Show the code (such as `USD`).
   *   - `symbol`(default): Show the symbol (such as `$`).
   *   - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their
   * currency.
   * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the
   * locale has no narrow symbol, uses the standard symbol for the locale.
   *   - String: Use the given string value instead of a code or a symbol.
   * For example, an empty string will suppress the currency & symbol.
   *   - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.
   *
   * @param digitsInfo Decimal representation options, specified by a string
   * in the following format:<br>
   * <code>{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}</code>.
   *   - `minIntegerDigits`: The minimum number of integer digits before the decimal point.
   * Default is `1`.
   *   - `minFractionDigits`: The minimum number of digits after the decimal point.
   * Default is `2`.
   *   - `maxFractionDigits`: The maximum number of digits after the decimal point.
   * Default is `2`.
   * If not provided, the number will be formatted with the proper amount of digits,
   * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.
   * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.
   * @param locale A locale code for the locale format rules to use.
   * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
   * See [Setting your app locale](guide/i18n-common-locale-id).
   */
  transform(value, currencyCode = this._defaultCurrencyCode, display = "symbol", digitsInfo, locale) {
    if (!isValue(value))
      return null;
    locale ||= this._locale;
    if (typeof display === "boolean") {
      if ((typeof ngDevMode === "undefined" || ngDevMode) && console && console.warn) {
        console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are "code", "symbol" or "symbol-narrow".`);
      }
      display = display ? "symbol" : "code";
    }
    let currency = currencyCode || this._defaultCurrencyCode;
    if (display !== "code") {
      if (display === "symbol" || display === "symbol-narrow") {
        currency = getCurrencySymbol(currency, display === "symbol" ? "wide" : "narrow", locale);
      } else {
        currency = display;
      }
    }
    try {
      const num = strToNumber(value);
      return formatCurrency(num, locale, currency, currencyCode, digitsInfo);
    } catch (error) {
      throw invalidPipeArgumentError(_CurrencyPipe, error.message);
    }
  }
};
_CurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) {
  return new (t || _CurrencyPipe)(ɵɵdirectiveInject(LOCALE_ID, 16), ɵɵdirectiveInject(DEFAULT_CURRENCY_CODE, 16));
};
_CurrencyPipe.ɵpipe = ɵɵdefinePipe({
  name: "currency",
  type: _CurrencyPipe,
  pure: true,
  standalone: true
});
var CurrencyPipe = _CurrencyPipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(CurrencyPipe, [{
    type: Pipe,
    args: [{
      name: "currency",
      standalone: true
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DEFAULT_CURRENCY_CODE]
    }]
  }], null);
})();
function isValue(value) {
  return !(value == null || value === "" || value !== value);
}
function strToNumber(value) {
  if (typeof value === "string" && !isNaN(Number(value) - parseFloat(value))) {
    return Number(value);
  }
  if (typeof value !== "number") {
    throw new Error(`${value} is not a number`);
  }
  return value;
}
var _SlicePipe = class _SlicePipe {
  transform(value, start, end) {
    if (value == null)
      return null;
    if (!this.supports(value)) {
      throw invalidPipeArgumentError(_SlicePipe, value);
    }
    return value.slice(start, end);
  }
  supports(obj) {
    return typeof obj === "string" || Array.isArray(obj);
  }
};
_SlicePipe.ɵfac = function SlicePipe_Factory(t) {
  return new (t || _SlicePipe)();
};
_SlicePipe.ɵpipe = ɵɵdefinePipe({
  name: "slice",
  type: _SlicePipe,
  pure: false,
  standalone: true
});
var SlicePipe = _SlicePipe;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(SlicePipe, [{
    type: Pipe,
    args: [{
      name: "slice",
      pure: false,
      standalone: true
    }]
  }], null, null);
})();
var COMMON_PIPES = [AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe];
var _CommonModule = class _CommonModule {
};
_CommonModule.ɵfac = function CommonModule_Factory(t) {
  return new (t || _CommonModule)();
};
_CommonModule.ɵmod = ɵɵdefineNgModule({
  type: _CommonModule,
  imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe],
  exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe]
});
_CommonModule.ɵinj = ɵɵdefineInjector({});
var CommonModule = _CommonModule;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(CommonModule, [{
    type: NgModule,
    args: [{
      imports: [COMMON_DIRECTIVES, COMMON_PIPES],
      exports: [COMMON_DIRECTIVES, COMMON_PIPES]
    }]
  }], null, null);
})();
var PLATFORM_BROWSER_ID = "browser";
var PLATFORM_SERVER_ID = "server";
function isPlatformBrowser(platformId) {
  return platformId === PLATFORM_BROWSER_ID;
}
function isPlatformServer(platformId) {
  return platformId === PLATFORM_SERVER_ID;
}
var VERSION = new Version("17.1.3");
var _ViewportScroller = class _ViewportScroller {
};
_ViewportScroller.ɵprov = ɵɵdefineInjectable({
  token: _ViewportScroller,
  providedIn: "root",
  factory: () => isPlatformBrowser(inject(PLATFORM_ID)) ? new BrowserViewportScroller(inject(DOCUMENT), window) : new NullViewportScroller()
});
var ViewportScroller = _ViewportScroller;
var BrowserViewportScroller = class {
  constructor(document2, window2) {
    this.document = document2;
    this.window = window2;
    this.offset = () => [0, 0];
  }
  /**
   * Configures the top offset used when scrolling to an anchor.
   * @param offset A position in screen coordinates (a tuple with x and y values)
   * or a function that returns the top offset position.
   *
   */
  setOffset(offset) {
    if (Array.isArray(offset)) {
      this.offset = () => offset;
    } else {
      this.offset = offset;
    }
  }
  /**
   * Retrieves the current scroll position.
   * @returns The position in screen coordinates.
   */
  getScrollPosition() {
    return [this.window.scrollX, this.window.scrollY];
  }
  /**
   * Sets the scroll position.
   * @param position The new position in screen coordinates.
   */
  scrollToPosition(position) {
    this.window.scrollTo(position[0], position[1]);
  }
  /**
   * Scrolls to an element and attempts to focus the element.
   *
   * Note that the function name here is misleading in that the target string may be an ID for a
   * non-anchor element.
   *
   * @param target The ID of an element or name of the anchor.
   *
   * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document
   * @see https://html.spec.whatwg.org/#scroll-to-fragid
   */
  scrollToAnchor(target) {
    const elSelected = findAnchorFromDocument(this.document, target);
    if (elSelected) {
      this.scrollToElement(elSelected);
      elSelected.focus();
    }
  }
  /**
   * Disables automatic scroll restoration provided by the browser.
   */
  setHistoryScrollRestoration(scrollRestoration) {
    this.window.history.scrollRestoration = scrollRestoration;
  }
  /**
   * Scrolls to an element using the native offset and the specified offset set on this scroller.
   *
   * The offset can be used when we know that there is a floating header and scrolling naively to an
   * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.
   */
  scrollToElement(el) {
    const rect = el.getBoundingClientRect();
    const left = rect.left + this.window.pageXOffset;
    const top = rect.top + this.window.pageYOffset;
    const offset = this.offset();
    this.window.scrollTo(left - offset[0], top - offset[1]);
  }
};
function findAnchorFromDocument(document2, target) {
  const documentResult = document2.getElementById(target) || document2.getElementsByName(target)[0];
  if (documentResult) {
    return documentResult;
  }
  if (typeof document2.createTreeWalker === "function" && document2.body && typeof document2.body.attachShadow === "function") {
    const treeWalker = document2.createTreeWalker(document2.body, NodeFilter.SHOW_ELEMENT);
    let currentNode = treeWalker.currentNode;
    while (currentNode) {
      const shadowRoot = currentNode.shadowRoot;
      if (shadowRoot) {
        const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name="${target}"]`);
        if (result) {
          return result;
        }
      }
      currentNode = treeWalker.nextNode();
    }
  }
  return null;
}
var NullViewportScroller = class {
  /**
   * Empty implementation
   */
  setOffset(offset) {
  }
  /**
   * Empty implementation
   */
  getScrollPosition() {
    return [0, 0];
  }
  /**
   * Empty implementation
   */
  scrollToPosition(position) {
  }
  /**
   * Empty implementation
   */
  scrollToAnchor(anchor) {
  }
  /**
   * Empty implementation
   */
  setHistoryScrollRestoration(scrollRestoration) {
  }
};
var XhrFactory = class {
};
function getUrl(src, win) {
  return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);
}
function isAbsoluteUrl(src) {
  return /^https?:\/\//.test(src);
}
function extractHostname(url) {
  return isAbsoluteUrl(url) ? new URL(url).hostname : url;
}
function isValidPath(path) {
  const isString = typeof path === "string";
  if (!isString || path.trim() === "") {
    return false;
  }
  try {
    const url = new URL(path);
    return true;
  } catch {
    return false;
  }
}
function normalizePath(path) {
  return path.endsWith("/") ? path.slice(0, -1) : path;
}
function normalizeSrc(src) {
  return src.startsWith("/") ? src.slice(1) : src;
}
var noopImageLoader = (config) => config.src;
var IMAGE_LOADER = new InjectionToken(ngDevMode ? "ImageLoader" : "", {
  providedIn: "root",
  factory: () => noopImageLoader
});
function createImageLoader(buildUrlFn, exampleUrls) {
  return function provideImageLoader(path) {
    if (!isValidPath(path)) {
      throwInvalidPathError(path, exampleUrls || []);
    }
    path = normalizePath(path);
    const loaderFn = (config) => {
      if (isAbsoluteUrl(config.src)) {
        throwUnexpectedAbsoluteUrlError(path, config.src);
      }
      return buildUrlFn(path, __spreadProps(__spreadValues({}, config), {
        src: normalizeSrc(config.src)
      }));
    };
    const providers = [{
      provide: IMAGE_LOADER,
      useValue: loaderFn
    }];
    return providers;
  };
}
function throwInvalidPathError(path, exampleUrls) {
  throw new RuntimeError(2959, ngDevMode && `Image loader has detected an invalid path (\`${path}\`). To fix this, supply a path using one of the following formats: ${exampleUrls.join(" or ")}`);
}
function throwUnexpectedAbsoluteUrlError(path, url) {
  throw new RuntimeError(2959, ngDevMode && `Image loader has detected a \`<img>\` tag with an invalid \`ngSrc\` attribute: ${url}. This image loader expects \`ngSrc\` to be a relative URL - however the provided value is an absolute URL. To fix this, provide \`ngSrc\` as a path relative to the base URL configured for this loader (\`${path}\`).`);
}
var provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ["https://<ZONE>/cdn-cgi/image/<OPTIONS>/<SOURCE-IMAGE>"] : void 0);
function createCloudflareUrl(path, config) {
  let params = `format=auto`;
  if (config.width) {
    params += `,width=${config.width}`;
  }
  return `${path}/cdn-cgi/image/${params}/${config.src}`;
}
var cloudinaryLoaderInfo = {
  name: "Cloudinary",
  testUrl: isCloudinaryUrl
};
var CLOUDINARY_LOADER_REGEX = /https?\:\/\/[^\/]+\.cloudinary\.com\/.+/;
function isCloudinaryUrl(url) {
  return CLOUDINARY_LOADER_REGEX.test(url);
}
var provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ? ["https://res.cloudinary.com/mysite", "https://mysite.cloudinary.com", "https://subdomain.mysite.com"] : void 0);
function createCloudinaryUrl(path, config) {
  let params = `f_auto,q_auto`;
  if (config.width) {
    params += `,w_${config.width}`;
  }
  return `${path}/image/upload/${params}/${config.src}`;
}
var imageKitLoaderInfo = {
  name: "ImageKit",
  testUrl: isImageKitUrl
};
var IMAGE_KIT_LOADER_REGEX = /https?\:\/\/[^\/]+\.imagekit\.io\/.+/;
function isImageKitUrl(url) {
  return IMAGE_KIT_LOADER_REGEX.test(url);
}
var provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ["https://ik.imagekit.io/mysite", "https://subdomain.mysite.com"] : void 0);
function createImagekitUrl(path, config) {
  const {
    src,
    width
  } = config;
  let urlSegments;
  if (width) {
    const params = `tr:w-${width}`;
    urlSegments = [path, params, src];
  } else {
    urlSegments = [path, src];
  }
  return urlSegments.join("/");
}
var imgixLoaderInfo = {
  name: "Imgix",
  testUrl: isImgixUrl
};
var IMGIX_LOADER_REGEX = /https?\:\/\/[^\/]+\.imgix\.net\/.+/;
function isImgixUrl(url) {
  return IMGIX_LOADER_REGEX.test(url);
}
var provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ["https://somepath.imgix.net/"] : void 0);
function createImgixUrl(path, config) {
  const url = new URL(`${path}/${config.src}`);
  url.searchParams.set("auto", "format");
  if (config.width) {
    url.searchParams.set("w", config.width.toString());
  }
  return url.href;
}
function imgDirectiveDetails(ngSrc, includeNgSrc = true) {
  const ngSrcInfo = includeNgSrc ? `(activated on an <img> element with the \`ngSrc="${ngSrc}"\`) ` : "";
  return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;
}
function assertDevMode(checkName) {
  if (!ngDevMode) {
    throw new RuntimeError(2958, `Unexpected invocation of the ${checkName} in the prod mode. Please make sure that the prod mode is enabled for production builds.`);
  }
}
var _LCPImageObserver = class _LCPImageObserver {
  constructor() {
    this.images = /* @__PURE__ */ new Map();
    this.window = null;
    this.observer = null;
    assertDevMode("LCP checker");
    const win = inject(DOCUMENT).defaultView;
    if (typeof win !== "undefined" && typeof PerformanceObserver !== "undefined") {
      this.window = win;
      this.observer = this.initPerformanceObserver();
    }
  }
  /**
   * Inits PerformanceObserver and subscribes to LCP events.
   * Based on https://web.dev/lcp/#measure-lcp-in-javascript
   */
  initPerformanceObserver() {
    const observer = new PerformanceObserver((entryList) => {
      const entries = entryList.getEntries();
      if (entries.length === 0)
        return;
      const lcpElement = entries[entries.length - 1];
      const imgSrc = lcpElement.element?.src ?? "";
      if (imgSrc.startsWith("data:") || imgSrc.startsWith("blob:"))
        return;
      const img = this.images.get(imgSrc);
      if (!img)
        return;
      if (!img.priority && !img.alreadyWarnedPriority) {
        img.alreadyWarnedPriority = true;
        logMissingPriorityError(imgSrc);
      }
      if (img.modified && !img.alreadyWarnedModified) {
        img.alreadyWarnedModified = true;
        logModifiedWarning(imgSrc);
      }
    });
    observer.observe({
      type: "largest-contentful-paint",
      buffered: true
    });
    return observer;
  }
  registerImage(rewrittenSrc, originalNgSrc, isPriority) {
    if (!this.observer)
      return;
    const newObservedImageState = {
      priority: isPriority,
      modified: false,
      alreadyWarnedModified: false,
      alreadyWarnedPriority: false
    };
    this.images.set(getUrl(rewrittenSrc, this.window).href, newObservedImageState);
  }
  unregisterImage(rewrittenSrc) {
    if (!this.observer)
      return;
    this.images.delete(getUrl(rewrittenSrc, this.window).href);
  }
  updateImage(originalSrc, newSrc) {
    const originalUrl = getUrl(originalSrc, this.window).href;
    const img = this.images.get(originalUrl);
    if (img) {
      img.modified = true;
      this.images.set(getUrl(newSrc, this.window).href, img);
      this.images.delete(originalUrl);
    }
  }
  ngOnDestroy() {
    if (!this.observer)
      return;
    this.observer.disconnect();
    this.images.clear();
  }
};
_LCPImageObserver.ɵfac = function LCPImageObserver_Factory(t) {
  return new (t || _LCPImageObserver)();
};
_LCPImageObserver.ɵprov = ɵɵdefineInjectable({
  token: _LCPImageObserver,
  factory: _LCPImageObserver.ɵfac,
  providedIn: "root"
});
var LCPImageObserver = _LCPImageObserver;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(LCPImageObserver, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [], null);
})();
function logMissingPriorityError(ngSrc) {
  const directiveDetails = imgDirectiveDetails(ngSrc);
  console.error(formatRuntimeError(2955, `${directiveDetails} this image is the Largest Contentful Paint (LCP) element but was not marked "priority". This image should be marked "priority" in order to prioritize its loading. To fix this, add the "priority" attribute.`));
}
function logModifiedWarning(ngSrc) {
  const directiveDetails = imgDirectiveDetails(ngSrc);
  console.warn(formatRuntimeError(2964, `${directiveDetails} this image is the Largest Contentful Paint (LCP) element and has had its "ngSrc" attribute modified. This can cause slower loading performance. It is recommended not to modify the "ngSrc" property on any image which could be the LCP element.`));
}
var INTERNAL_PRECONNECT_CHECK_BLOCKLIST = /* @__PURE__ */ new Set(["localhost", "127.0.0.1", "0.0.0.0"]);
var PRECONNECT_CHECK_BLOCKLIST = new InjectionToken(ngDevMode ? "PRECONNECT_CHECK_BLOCKLIST" : "");
var _PreconnectLinkChecker = class _PreconnectLinkChecker {
  constructor() {
    this.document = inject(DOCUMENT);
    this.preconnectLinks = null;
    this.alreadySeen = /* @__PURE__ */ new Set();
    this.window = null;
    this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);
    assertDevMode("preconnect link checker");
    const win = this.document.defaultView;
    if (typeof win !== "undefined") {
      this.window = win;
    }
    const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, {
      optional: true
    });
    if (blocklist) {
      this.populateBlocklist(blocklist);
    }
  }
  populateBlocklist(origins) {
    if (Array.isArray(origins)) {
      deepForEach(origins, (origin) => {
        this.blocklist.add(extractHostname(origin));
      });
    } else {
      this.blocklist.add(extractHostname(origins));
    }
  }
  /**
   * Checks that a preconnect resource hint exists in the head for the
   * given src.
   *
   * @param rewrittenSrc src formatted with loader
   * @param originalNgSrc ngSrc value
   */
  assertPreconnect(rewrittenSrc, originalNgSrc) {
    if (!this.window)
      return;
    const imgUrl = getUrl(rewrittenSrc, this.window);
    if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))
      return;
    this.alreadySeen.add(imgUrl.origin);
    this.preconnectLinks ??= this.queryPreconnectLinks();
    if (!this.preconnectLinks.has(imgUrl.origin)) {
      console.warn(formatRuntimeError(2956, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this image. Preconnecting to the origin(s) that serve priority images ensures that these images are delivered as soon as possible. To fix this, please add the following element into the <head> of the document:
  <link rel="preconnect" href="${imgUrl.origin}">`));
    }
  }
  queryPreconnectLinks() {
    const preconnectUrls = /* @__PURE__ */ new Set();
    const selector = "link[rel=preconnect]";
    const links = Array.from(this.document.querySelectorAll(selector));
    for (let link of links) {
      const url = getUrl(link.href, this.window);
      preconnectUrls.add(url.origin);
    }
    return preconnectUrls;
  }
  ngOnDestroy() {
    this.preconnectLinks?.clear();
    this.alreadySeen.clear();
  }
};
_PreconnectLinkChecker.ɵfac = function PreconnectLinkChecker_Factory(t) {
  return new (t || _PreconnectLinkChecker)();
};
_PreconnectLinkChecker.ɵprov = ɵɵdefineInjectable({
  token: _PreconnectLinkChecker,
  factory: _PreconnectLinkChecker.ɵfac,
  providedIn: "root"
});
var PreconnectLinkChecker = _PreconnectLinkChecker;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PreconnectLinkChecker, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [], null);
})();
function deepForEach(input, fn) {
  for (let value of input) {
    Array.isArray(value) ? deepForEach(value, fn) : fn(value);
  }
}
var DEFAULT_PRELOADED_IMAGES_LIMIT = 5;
var PRELOADED_IMAGES = new InjectionToken("NG_OPTIMIZED_PRELOADED_IMAGES", {
  providedIn: "root",
  factory: () => /* @__PURE__ */ new Set()
});
var _PreloadLinkCreator = class _PreloadLinkCreator {
  constructor() {
    this.preloadedImages = inject(PRELOADED_IMAGES);
    this.document = inject(DOCUMENT);
  }
  /**
   * @description Add a preload `<link>` to the `<head>` of the `index.html` that is served from the
   * server while using Angular Universal and SSR to kick off image loads for high priority images.
   *
   * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)
   * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`
   * respectively, on the preload `<link>` tag so that the correctly sized image is preloaded from
   * the CDN.
   *
   * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}
   *
   * @param renderer The `Renderer2` passed in from the directive
   * @param src The original src of the image that is set on the `ngSrc` input.
   * @param srcset The parsed and formatted srcset created from the `ngSrcset` input
   * @param sizes The value of the `sizes` attribute passed in to the `<img>` tag
   */
  createPreloadLinkTag(renderer, src, srcset, sizes) {
    if (ngDevMode) {
      if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {
        throw new RuntimeError(2961, ngDevMode && `The \`NgOptimizedImage\` directive has detected that more than ${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. This might negatively affect an overall performance of the page. To fix this, remove the "priority" attribute from images with less priority.`);
      }
    }
    if (this.preloadedImages.has(src)) {
      return;
    }
    this.preloadedImages.add(src);
    const preload = renderer.createElement("link");
    renderer.setAttribute(preload, "as", "image");
    renderer.setAttribute(preload, "href", src);
    renderer.setAttribute(preload, "rel", "preload");
    renderer.setAttribute(preload, "fetchpriority", "high");
    if (sizes) {
      renderer.setAttribute(preload, "imageSizes", sizes);
    }
    if (srcset) {
      renderer.setAttribute(preload, "imageSrcset", srcset);
    }
    renderer.appendChild(this.document.head, preload);
  }
};
_PreloadLinkCreator.ɵfac = function PreloadLinkCreator_Factory(t) {
  return new (t || _PreloadLinkCreator)();
};
_PreloadLinkCreator.ɵprov = ɵɵdefineInjectable({
  token: _PreloadLinkCreator,
  factory: _PreloadLinkCreator.ɵfac,
  providedIn: "root"
});
var PreloadLinkCreator = _PreloadLinkCreator;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PreloadLinkCreator, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
var BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;
var VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\s*\d+w\s*(,|$)){1,})$/;
var VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\s*\d+(\.\d+)?x\s*(,|$)){1,})$/;
var ABSOLUTE_SRCSET_DENSITY_CAP = 3;
var RECOMMENDED_SRCSET_DENSITY_CAP = 2;
var DENSITY_SRCSET_MULTIPLIERS = [1, 2];
var VIEWPORT_BREAKPOINT_CUTOFF = 640;
var ASPECT_RATIO_TOLERANCE = 0.1;
var OVERSIZED_IMAGE_TOLERANCE = 1e3;
var FIXED_SRCSET_WIDTH_LIMIT = 1920;
var FIXED_SRCSET_HEIGHT_LIMIT = 1080;
var BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo];
var _NgOptimizedImage = class _NgOptimizedImage {
  constructor() {
    this.imageLoader = inject(IMAGE_LOADER);
    this.config = processConfig(inject(IMAGE_CONFIG));
    this.renderer = inject(Renderer2);
    this.imgElement = inject(ElementRef).nativeElement;
    this.injector = inject(Injector);
    this.isServer = isPlatformServer(inject(PLATFORM_ID));
    this.preloadLinkCreator = inject(PreloadLinkCreator);
    this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;
    this._renderedSrc = null;
    this.priority = false;
    this.disableOptimizedSrcset = false;
    this.fill = false;
  }
  /** @nodoc */
  ngOnInit() {
    performanceMarkFeature("NgOptimizedImage");
    if (ngDevMode) {
      const ngZone = this.injector.get(NgZone);
      assertNonEmptyInput(this, "ngSrc", this.ngSrc);
      assertValidNgSrcset(this, this.ngSrcset);
      assertNoConflictingSrc(this);
      if (this.ngSrcset) {
        assertNoConflictingSrcset(this);
      }
      assertNotBase64Image(this);
      assertNotBlobUrl(this);
      if (this.fill) {
        assertEmptyWidthAndHeight(this);
        ngZone.runOutsideAngular(() => assertNonZeroRenderedHeight(this, this.imgElement, this.renderer));
      } else {
        assertNonEmptyWidthAndHeight(this);
        if (this.height !== void 0) {
          assertGreaterThanZero(this, this.height, "height");
        }
        if (this.width !== void 0) {
          assertGreaterThanZero(this, this.width, "width");
        }
        ngZone.runOutsideAngular(() => assertNoImageDistortion(this, this.imgElement, this.renderer));
      }
      assertValidLoadingInput(this);
      if (!this.ngSrcset) {
        assertNoComplexSizes(this);
      }
      assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);
      assertNoNgSrcsetWithoutLoader(this, this.imageLoader);
      assertNoLoaderParamsWithoutLoader(this, this.imageLoader);
      if (this.lcpObserver !== null) {
        const ngZone2 = this.injector.get(NgZone);
        ngZone2.runOutsideAngular(() => {
          this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc, this.priority);
        });
      }
      if (this.priority) {
        const checker = this.injector.get(PreconnectLinkChecker);
        checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);
      }
    }
    this.setHostAttributes();
  }
  setHostAttributes() {
    if (this.fill) {
      this.sizes ||= "100vw";
    } else {
      this.setHostAttribute("width", this.width.toString());
      this.setHostAttribute("height", this.height.toString());
    }
    this.setHostAttribute("loading", this.getLoadingBehavior());
    this.setHostAttribute("fetchpriority", this.getFetchPriority());
    this.setHostAttribute("ng-img", "true");
    const rewrittenSrcset = this.updateSrcAndSrcset();
    if (this.sizes) {
      this.setHostAttribute("sizes", this.sizes);
    }
    if (this.isServer && this.priority) {
      this.preloadLinkCreator.createPreloadLinkTag(this.renderer, this.getRewrittenSrc(), rewrittenSrcset, this.sizes);
    }
  }
  /** @nodoc */
  ngOnChanges(changes) {
    if (ngDevMode) {
      assertNoPostInitInputChange(this, changes, ["ngSrcset", "width", "height", "priority", "fill", "loading", "sizes", "loaderParams", "disableOptimizedSrcset"]);
    }
    if (changes["ngSrc"] && !changes["ngSrc"].isFirstChange()) {
      const oldSrc = this._renderedSrc;
      this.updateSrcAndSrcset(true);
      const newSrc = this._renderedSrc;
      if (this.lcpObserver !== null && oldSrc && newSrc && oldSrc !== newSrc) {
        const ngZone = this.injector.get(NgZone);
        ngZone.runOutsideAngular(() => {
          this.lcpObserver?.updateImage(oldSrc, newSrc);
        });
      }
    }
  }
  callImageLoader(configWithoutCustomParams) {
    let augmentedConfig = configWithoutCustomParams;
    if (this.loaderParams) {
      augmentedConfig.loaderParams = this.loaderParams;
    }
    return this.imageLoader(augmentedConfig);
  }
  getLoadingBehavior() {
    if (!this.priority && this.loading !== void 0) {
      return this.loading;
    }
    return this.priority ? "eager" : "lazy";
  }
  getFetchPriority() {
    return this.priority ? "high" : "auto";
  }
  getRewrittenSrc() {
    if (!this._renderedSrc) {
      const imgConfig = {
        src: this.ngSrc
      };
      this._renderedSrc = this.callImageLoader(imgConfig);
    }
    return this._renderedSrc;
  }
  getRewrittenSrcset() {
    const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);
    const finalSrcs = this.ngSrcset.split(",").filter((src) => src !== "").map((srcStr) => {
      srcStr = srcStr.trim();
      const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;
      return `${this.callImageLoader({
        src: this.ngSrc,
        width
      })} ${srcStr}`;
    });
    return finalSrcs.join(", ");
  }
  getAutomaticSrcset() {
    if (this.sizes) {
      return this.getResponsiveSrcset();
    } else {
      return this.getFixedSrcset();
    }
  }
  getResponsiveSrcset() {
    const {
      breakpoints
    } = this.config;
    let filteredBreakpoints = breakpoints;
    if (this.sizes?.trim() === "100vw") {
      filteredBreakpoints = breakpoints.filter((bp) => bp >= VIEWPORT_BREAKPOINT_CUTOFF);
    }
    const finalSrcs = filteredBreakpoints.map((bp) => `${this.callImageLoader({
      src: this.ngSrc,
      width: bp
    })} ${bp}w`);
    return finalSrcs.join(", ");
  }
  updateSrcAndSrcset(forceSrcRecalc = false) {
    if (forceSrcRecalc) {
      this._renderedSrc = null;
    }
    const rewrittenSrc = this.getRewrittenSrc();
    this.setHostAttribute("src", rewrittenSrc);
    let rewrittenSrcset = void 0;
    if (this.ngSrcset) {
      rewrittenSrcset = this.getRewrittenSrcset();
    } else if (this.shouldGenerateAutomaticSrcset()) {
      rewrittenSrcset = this.getAutomaticSrcset();
    }
    if (rewrittenSrcset) {
      this.setHostAttribute("srcset", rewrittenSrcset);
    }
    return rewrittenSrcset;
  }
  getFixedSrcset() {
    const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map((multiplier) => `${this.callImageLoader({
      src: this.ngSrc,
      width: this.width * multiplier
    })} ${multiplier}x`);
    return finalSrcs.join(", ");
  }
  shouldGenerateAutomaticSrcset() {
    let oversizedImage = false;
    if (!this.sizes) {
      oversizedImage = this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT;
    }
    return !this.disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader && !oversizedImage;
  }
  /** @nodoc */
  ngOnDestroy() {
    if (ngDevMode) {
      if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {
        this.lcpObserver.unregisterImage(this._renderedSrc);
      }
    }
  }
  setHostAttribute(name, value) {
    this.renderer.setAttribute(this.imgElement, name, value);
  }
};
_NgOptimizedImage.ɵfac = function NgOptimizedImage_Factory(t) {
  return new (t || _NgOptimizedImage)();
};
_NgOptimizedImage.ɵdir = ɵɵdefineDirective({
  type: _NgOptimizedImage,
  selectors: [["img", "ngSrc", ""]],
  hostVars: 8,
  hostBindings: function NgOptimizedImage_HostBindings(rf, ctx) {
    if (rf & 2) {
      ɵɵstyleProp("position", ctx.fill ? "absolute" : null)("width", ctx.fill ? "100%" : null)("height", ctx.fill ? "100%" : null)("inset", ctx.fill ? "0px" : null);
    }
  },
  inputs: {
    ngSrc: [InputFlags.HasDecoratorInputTransform, "ngSrc", "ngSrc", unwrapSafeUrl],
    ngSrcset: "ngSrcset",
    sizes: "sizes",
    width: [InputFlags.HasDecoratorInputTransform, "width", "width", numberAttribute],
    height: [InputFlags.HasDecoratorInputTransform, "height", "height", numberAttribute],
    loading: "loading",
    priority: [InputFlags.HasDecoratorInputTransform, "priority", "priority", booleanAttribute],
    loaderParams: "loaderParams",
    disableOptimizedSrcset: [InputFlags.HasDecoratorInputTransform, "disableOptimizedSrcset", "disableOptimizedSrcset", booleanAttribute],
    fill: [InputFlags.HasDecoratorInputTransform, "fill", "fill", booleanAttribute],
    src: "src",
    srcset: "srcset"
  },
  standalone: true,
  features: [ɵɵInputTransformsFeature, ɵɵNgOnChangesFeature]
});
var NgOptimizedImage = _NgOptimizedImage;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgOptimizedImage, [{
    type: Directive,
    args: [{
      standalone: true,
      selector: "img[ngSrc]",
      host: {
        "[style.position]": 'fill ? "absolute" : null',
        "[style.width]": 'fill ? "100%" : null',
        "[style.height]": 'fill ? "100%" : null',
        "[style.inset]": 'fill ? "0px" : null'
      }
    }]
  }], null, {
    ngSrc: [{
      type: Input,
      args: [{
        required: true,
        transform: unwrapSafeUrl
      }]
    }],
    ngSrcset: [{
      type: Input
    }],
    sizes: [{
      type: Input
    }],
    width: [{
      type: Input,
      args: [{
        transform: numberAttribute
      }]
    }],
    height: [{
      type: Input,
      args: [{
        transform: numberAttribute
      }]
    }],
    loading: [{
      type: Input
    }],
    priority: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    loaderParams: [{
      type: Input
    }],
    disableOptimizedSrcset: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    fill: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    src: [{
      type: Input
    }],
    srcset: [{
      type: Input
    }]
  });
})();
function processConfig(config) {
  let sortedBreakpoints = {};
  if (config.breakpoints) {
    sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);
  }
  return Object.assign({}, IMAGE_CONFIG_DEFAULTS, config, sortedBreakpoints);
}
function assertNoConflictingSrc(dir) {
  if (dir.src) {
    throw new RuntimeError(2950, `${imgDirectiveDetails(dir.ngSrc)} both \`src\` and \`ngSrc\` have been set. Supplying both of these attributes breaks lazy loading. The NgOptimizedImage directive sets \`src\` itself based on the value of \`ngSrc\`. To fix this, please remove the \`src\` attribute.`);
  }
}
function assertNoConflictingSrcset(dir) {
  if (dir.srcset) {
    throw new RuntimeError(2951, `${imgDirectiveDetails(dir.ngSrc)} both \`srcset\` and \`ngSrcset\` have been set. Supplying both of these attributes breaks lazy loading. The NgOptimizedImage directive sets \`srcset\` itself based on the value of \`ngSrcset\`. To fix this, please remove the \`srcset\` attribute.`);
  }
}
function assertNotBase64Image(dir) {
  let ngSrc = dir.ngSrc.trim();
  if (ngSrc.startsWith("data:")) {
    if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {
      ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + "...";
    }
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc, false)} \`ngSrc\` is a Base64-encoded string (${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. To fix this, disable the NgOptimizedImage directive for this element by removing \`ngSrc\` and using a standard \`src\` attribute instead.`);
  }
}
function assertNoComplexSizes(dir) {
  let sizes = dir.sizes;
  if (sizes?.match(/((\)|,)\s|^)\d+px/)) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc, false)} \`sizes\` was set to a string including pixel values. For automatic \`srcset\` generation, \`sizes\` must only include responsive values, such as \`sizes="50vw"\` or \`sizes="(min-width: 768px) 50vw, 100vw"\`. To fix this, modify the \`sizes\` attribute, or provide your own \`ngSrcset\` value directly.`);
  }
}
function assertNotBlobUrl(dir) {
  const ngSrc = dir.ngSrc.trim();
  if (ngSrc.startsWith("blob:")) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`ngSrc\` was set to a blob URL (${ngSrc}). Blob URLs are not supported by the NgOptimizedImage directive. To fix this, disable the NgOptimizedImage directive for this element by removing \`ngSrc\` and using a regular \`src\` attribute instead.`);
  }
}
function assertNonEmptyInput(dir, name, value) {
  const isString = typeof value === "string";
  const isEmptyString = isString && value.trim() === "";
  if (!isString || isEmptyString) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`${name}\` has an invalid value (\`${value}\`). To fix this, change the value to a non-empty string.`);
  }
}
function assertValidNgSrcset(dir, value) {
  if (value == null)
    return;
  assertNonEmptyInput(dir, "ngSrcset", value);
  const stringVal = value;
  const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);
  const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);
  if (isValidDensityDescriptor) {
    assertUnderDensityCap(dir, stringVal);
  }
  const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;
  if (!isValidSrcset) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`ngSrcset\` has an invalid value (\`${value}\`). To fix this, supply \`ngSrcset\` using a comma-separated list of one or more width descriptors (e.g. "100w, 200w") or density descriptors (e.g. "1x, 2x").`);
  }
}
function assertUnderDensityCap(dir, value) {
  const underDensityCap = value.split(",").every((num) => num === "" || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);
  if (!underDensityCap) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the \`ngSrcset\` contains an unsupported image density:\`${value}\`. NgOptimizedImage generally recommends a max image density of ${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for most use cases. Images that will be pinch-zoomed are typically the primary use case for ${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);
  }
}
function postInitInputChangeError(dir, inputName) {
  let reason;
  if (inputName === "width" || inputName === "height") {
    reason = `Changing \`${inputName}\` may result in different attribute value applied to the underlying image element and cause layout shifts on a page.`;
  } else {
    reason = `Changing the \`${inputName}\` would have no effect on the underlying image element, because the resource loading has already occurred.`;
  }
  return new RuntimeError(2953, `${imgDirectiveDetails(dir.ngSrc)} \`${inputName}\` was updated after initialization. The NgOptimizedImage directive will not react to this input change. ${reason} To fix this, either switch \`${inputName}\` to a static value or wrap the image element in an *ngIf that is gated on the necessary value.`);
}
function assertNoPostInitInputChange(dir, changes, inputs) {
  inputs.forEach((input) => {
    const isUpdated = changes.hasOwnProperty(input);
    if (isUpdated && !changes[input].isFirstChange()) {
      if (input === "ngSrc") {
        dir = {
          ngSrc: changes[input].previousValue
        };
      }
      throw postInitInputChangeError(dir, input);
    }
  });
}
function assertGreaterThanZero(dir, inputValue, inputName) {
  const validNumber = typeof inputValue === "number" && inputValue > 0;
  const validString = typeof inputValue === "string" && /^\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;
  if (!validNumber && !validString) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`${inputName}\` has an invalid value. To fix this, provide \`${inputName}\` as a number greater than 0.`);
  }
}
function assertNoImageDistortion(dir, img, renderer) {
  const removeLoadListenerFn = renderer.listen(img, "load", () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
    const computedStyle = window.getComputedStyle(img);
    let renderedWidth = parseFloat(computedStyle.getPropertyValue("width"));
    let renderedHeight = parseFloat(computedStyle.getPropertyValue("height"));
    const boxSizing = computedStyle.getPropertyValue("box-sizing");
    if (boxSizing === "border-box") {
      const paddingTop = computedStyle.getPropertyValue("padding-top");
      const paddingRight = computedStyle.getPropertyValue("padding-right");
      const paddingBottom = computedStyle.getPropertyValue("padding-bottom");
      const paddingLeft = computedStyle.getPropertyValue("padding-left");
      renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);
      renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);
    }
    const renderedAspectRatio = renderedWidth / renderedHeight;
    const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;
    const intrinsicWidth = img.naturalWidth;
    const intrinsicHeight = img.naturalHeight;
    const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;
    const suppliedWidth = dir.width;
    const suppliedHeight = dir.height;
    const suppliedAspectRatio = suppliedWidth / suppliedHeight;
    const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;
    const stylingDistortion = nonZeroRenderedDimensions && Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;
    if (inaccurateDimensions) {
      console.warn(formatRuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match the aspect ratio indicated by the width and height attributes. 
Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h (aspect-ratio: ${round(intrinsicAspectRatio)}). 
Supplied width and height attributes: ${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${round(suppliedAspectRatio)}). 
To fix this, update the width and height attributes.`));
    } else if (stylingDistortion) {
      console.warn(formatRuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image does not match the image's intrinsic aspect ratio. 
Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h (aspect-ratio: ${round(intrinsicAspectRatio)}). 
Rendered image size: ${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ${round(renderedAspectRatio)}). 
This issue can occur if "width" and "height" attributes are added to an image without updating the corresponding image styling. To fix this, adjust image styling. In most cases, adding "height: auto" or "width: auto" to the image styling will fix this issue.`));
    } else if (!dir.ngSrcset && nonZeroRenderedDimensions) {
      const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;
      const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;
      const oversizedWidth = intrinsicWidth - recommendedWidth >= OVERSIZED_IMAGE_TOLERANCE;
      const oversizedHeight = intrinsicHeight - recommendedHeight >= OVERSIZED_IMAGE_TOLERANCE;
      if (oversizedWidth || oversizedHeight) {
        console.warn(formatRuntimeError(2960, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly larger than necessary. 
Rendered image size: ${renderedWidth}w x ${renderedHeight}h. 
Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. 
Recommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. 
Note: Recommended intrinsic image size is calculated assuming a maximum DPR of ${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image or consider using the "ngSrcset" and "sizes" attributes.`));
      }
    }
  });
  const removeErrorListenerFn = renderer.listen(img, "error", () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
  });
}
function assertNonEmptyWidthAndHeight(dir) {
  let missingAttributes = [];
  if (dir.width === void 0)
    missingAttributes.push("width");
  if (dir.height === void 0)
    missingAttributes.push("height");
  if (missingAttributes.length > 0) {
    throw new RuntimeError(2954, `${imgDirectiveDetails(dir.ngSrc)} these required attributes are missing: ${missingAttributes.map((attr) => `"${attr}"`).join(", ")}. Including "width" and "height" attributes will prevent image-related layout shifts. To fix this, include "width" and "height" attributes on the image tag or turn on "fill" mode with the \`fill\` attribute.`);
  }
}
function assertEmptyWidthAndHeight(dir) {
  if (dir.width || dir.height) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the attributes \`height\` and/or \`width\` are present along with the \`fill\` attribute. Because \`fill\` mode causes an image to fill its containing element, the size attributes have no effect and should be removed.`);
  }
}
function assertNonZeroRenderedHeight(dir, img, renderer) {
  const removeLoadListenerFn = renderer.listen(img, "load", () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
    const renderedHeight = img.clientHeight;
    if (dir.fill && renderedHeight === 0) {
      console.warn(formatRuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. This is likely because the containing element does not have the CSS 'position' property set to one of the following: "relative", "fixed", or "absolute". To fix this problem, make sure the container element has the CSS 'position' property defined and the height of the element is not zero.`));
    }
  });
  const removeErrorListenerFn = renderer.listen(img, "error", () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
  });
}
function assertValidLoadingInput(dir) {
  if (dir.loading && dir.priority) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the \`loading\` attribute was used on an image that was marked "priority". Setting \`loading\` on priority images is not allowed because these images will always be eagerly loaded. To fix this, remove the “loading” attribute from the priority image.`);
  }
  const validInputs = ["auto", "eager", "lazy"];
  if (typeof dir.loading === "string" && !validInputs.includes(dir.loading)) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the \`loading\` attribute has an invalid value (\`${dir.loading}\`). To fix this, provide a valid value ("lazy", "eager", or "auto").`);
  }
}
function assertNotMissingBuiltInLoader(ngSrc, imageLoader) {
  if (imageLoader === noopImageLoader) {
    let builtInLoaderName = "";
    for (const loader of BUILT_IN_LOADERS) {
      if (loader.testUrl(ngSrc)) {
        builtInLoaderName = loader.name;
        break;
      }
    }
    if (builtInLoaderName) {
      console.warn(formatRuntimeError(2962, `NgOptimizedImage: It looks like your images may be hosted on the ${builtInLoaderName} CDN, but your app is not using Angular's built-in loader for that CDN. We recommend switching to use the built-in by calling \`provide${builtInLoaderName}Loader()\` in your \`providers\` and passing it your instance's base URL. If you don't want to use the built-in loader, define a custom loader function using IMAGE_LOADER to silence this warning.`));
    }
  }
}
function assertNoNgSrcsetWithoutLoader(dir, imageLoader) {
  if (dir.ngSrcset && imageLoader === noopImageLoader) {
    console.warn(formatRuntimeError(2963, `${imgDirectiveDetails(dir.ngSrc)} the \`ngSrcset\` attribute is present but no image loader is configured (i.e. the default one is being used), which would result in the same image being used for all configured sizes. To fix this, provide a loader or remove the \`ngSrcset\` attribute from the image.`));
  }
}
function assertNoLoaderParamsWithoutLoader(dir, imageLoader) {
  if (dir.loaderParams && imageLoader === noopImageLoader) {
    console.warn(formatRuntimeError(2963, `${imgDirectiveDetails(dir.ngSrc)} the \`loaderParams\` attribute is present but no image loader is configured (i.e. the default one is being used), which means that the loaderParams data will not be consumed and will not affect the URL. To fix this, provide a custom loader or remove the \`loaderParams\` attribute from the image.`));
  }
}
function round(input) {
  return Number.isInteger(input) ? input : input.toFixed(2);
}
function unwrapSafeUrl(value) {
  if (typeof value === "string") {
    return value;
  }
  return unwrapSafeValue(value);
}

// node_modules/@angular/common/fesm2022/http.mjs
var HttpHandler = class {
};
var HttpBackend = class {
};
var HttpHeaders = class _HttpHeaders {
  /**  Constructs a new HTTP header object with the given values.*/
  constructor(headers) {
    this.normalizedNames = /* @__PURE__ */ new Map();
    this.lazyUpdate = null;
    if (!headers) {
      this.headers = /* @__PURE__ */ new Map();
    } else if (typeof headers === "string") {
      this.lazyInit = () => {
        this.headers = /* @__PURE__ */ new Map();
        headers.split("\n").forEach((line) => {
          const index = line.indexOf(":");
          if (index > 0) {
            const name = line.slice(0, index);
            const key = name.toLowerCase();
            const value = line.slice(index + 1).trim();
            this.maybeSetNormalizedName(name, key);
            if (this.headers.has(key)) {
              this.headers.get(key).push(value);
            } else {
              this.headers.set(key, [value]);
            }
          }
        });
      };
    } else if (typeof Headers !== "undefined" && headers instanceof Headers) {
      this.headers = /* @__PURE__ */ new Map();
      headers.forEach((values, name) => {
        this.setHeaderEntries(name, values);
      });
    } else {
      this.lazyInit = () => {
        if (typeof ngDevMode === "undefined" || ngDevMode) {
          assertValidHeaders(headers);
        }
        this.headers = /* @__PURE__ */ new Map();
        Object.entries(headers).forEach(([name, values]) => {
          this.setHeaderEntries(name, values);
        });
      };
    }
  }
  /**
   * Checks for existence of a given header.
   *
   * @param name The header name to check for existence.
   *
   * @returns True if the header exists, false otherwise.
   */
  has(name) {
    this.init();
    return this.headers.has(name.toLowerCase());
  }
  /**
   * Retrieves the first value of a given header.
   *
   * @param name The header name.
   *
   * @returns The value string if the header exists, null otherwise
   */
  get(name) {
    this.init();
    const values = this.headers.get(name.toLowerCase());
    return values && values.length > 0 ? values[0] : null;
  }
  /**
   * Retrieves the names of the headers.
   *
   * @returns A list of header names.
   */
  keys() {
    this.init();
    return Array.from(this.normalizedNames.values());
  }
  /**
   * Retrieves a list of values for a given header.
   *
   * @param name The header name from which to retrieve values.
   *
   * @returns A string of values if the header exists, null otherwise.
   */
  getAll(name) {
    this.init();
    return this.headers.get(name.toLowerCase()) || null;
  }
  /**
   * Appends a new value to the existing set of values for a header
   * and returns them in a clone of the original instance.
   *
   * @param name The header name for which to append the values.
   * @param value The value to append.
   *
   * @returns A clone of the HTTP headers object with the value appended to the given header.
   */
  append(name, value) {
    return this.clone({
      name,
      value,
      op: "a"
    });
  }
  /**
   * Sets or modifies a value for a given header in a clone of the original instance.
   * If the header already exists, its value is replaced with the given value
   * in the returned object.
   *
   * @param name The header name.
   * @param value The value or values to set or override for the given header.
   *
   * @returns A clone of the HTTP headers object with the newly set header value.
   */
  set(name, value) {
    return this.clone({
      name,
      value,
      op: "s"
    });
  }
  /**
   * Deletes values for a given header in a clone of the original instance.
   *
   * @param name The header name.
   * @param value The value or values to delete for the given header.
   *
   * @returns A clone of the HTTP headers object with the given value deleted.
   */
  delete(name, value) {
    return this.clone({
      name,
      value,
      op: "d"
    });
  }
  maybeSetNormalizedName(name, lcName) {
    if (!this.normalizedNames.has(lcName)) {
      this.normalizedNames.set(lcName, name);
    }
  }
  init() {
    if (!!this.lazyInit) {
      if (this.lazyInit instanceof _HttpHeaders) {
        this.copyFrom(this.lazyInit);
      } else {
        this.lazyInit();
      }
      this.lazyInit = null;
      if (!!this.lazyUpdate) {
        this.lazyUpdate.forEach((update) => this.applyUpdate(update));
        this.lazyUpdate = null;
      }
    }
  }
  copyFrom(other) {
    other.init();
    Array.from(other.headers.keys()).forEach((key) => {
      this.headers.set(key, other.headers.get(key));
      this.normalizedNames.set(key, other.normalizedNames.get(key));
    });
  }
  clone(update) {
    const clone = new _HttpHeaders();
    clone.lazyInit = !!this.lazyInit && this.lazyInit instanceof _HttpHeaders ? this.lazyInit : this;
    clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);
    return clone;
  }
  applyUpdate(update) {
    const key = update.name.toLowerCase();
    switch (update.op) {
      case "a":
      case "s":
        let value = update.value;
        if (typeof value === "string") {
          value = [value];
        }
        if (value.length === 0) {
          return;
        }
        this.maybeSetNormalizedName(update.name, key);
        const base = (update.op === "a" ? this.headers.get(key) : void 0) || [];
        base.push(...value);
        this.headers.set(key, base);
        break;
      case "d":
        const toDelete = update.value;
        if (!toDelete) {
          this.headers.delete(key);
          this.normalizedNames.delete(key);
        } else {
          let existing = this.headers.get(key);
          if (!existing) {
            return;
          }
          existing = existing.filter((value2) => toDelete.indexOf(value2) === -1);
          if (existing.length === 0) {
            this.headers.delete(key);
            this.normalizedNames.delete(key);
          } else {
            this.headers.set(key, existing);
          }
        }
        break;
    }
  }
  setHeaderEntries(name, values) {
    const headerValues = (Array.isArray(values) ? values : [values]).map((value) => value.toString());
    const key = name.toLowerCase();
    this.headers.set(key, headerValues);
    this.maybeSetNormalizedName(name, key);
  }
  /**
   * @internal
   */
  forEach(fn) {
    this.init();
    Array.from(this.normalizedNames.keys()).forEach((key) => fn(this.normalizedNames.get(key), this.headers.get(key)));
  }
};
function assertValidHeaders(headers) {
  for (const [key, value] of Object.entries(headers)) {
    if (!(typeof value === "string" || typeof value === "number") && !Array.isArray(value)) {
      throw new Error(`Unexpected value of the \`${key}\` header provided. Expecting either a string, a number or an array, but got: \`${value}\`.`);
    }
  }
}
var HttpUrlEncodingCodec = class {
  /**
   * Encodes a key name for a URL parameter or query-string.
   * @param key The key name.
   * @returns The encoded key name.
   */
  encodeKey(key) {
    return standardEncoding(key);
  }
  /**
   * Encodes the value of a URL parameter or query-string.
   * @param value The value.
   * @returns The encoded value.
   */
  encodeValue(value) {
    return standardEncoding(value);
  }
  /**
   * Decodes an encoded URL parameter or query-string key.
   * @param key The encoded key name.
   * @returns The decoded key name.
   */
  decodeKey(key) {
    return decodeURIComponent(key);
  }
  /**
   * Decodes an encoded URL parameter or query-string value.
   * @param value The encoded value.
   * @returns The decoded value.
   */
  decodeValue(value) {
    return decodeURIComponent(value);
  }
};
function paramParser(rawParams, codec) {
  const map2 = /* @__PURE__ */ new Map();
  if (rawParams.length > 0) {
    const params = rawParams.replace(/^\?/, "").split("&");
    params.forEach((param) => {
      const eqIdx = param.indexOf("=");
      const [key, val] = eqIdx == -1 ? [codec.decodeKey(param), ""] : [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];
      const list = map2.get(key) || [];
      list.push(val);
      map2.set(key, list);
    });
  }
  return map2;
}
var STANDARD_ENCODING_REGEX = /%(\d[a-f0-9])/gi;
var STANDARD_ENCODING_REPLACEMENTS = {
  "40": "@",
  "3A": ":",
  "24": "$",
  "2C": ",",
  "3B": ";",
  "3D": "=",
  "3F": "?",
  "2F": "/"
};
function standardEncoding(v) {
  return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);
}
function valueToString(value) {
  return `${value}`;
}
var HttpParams = class _HttpParams {
  constructor(options = {}) {
    this.updates = null;
    this.cloneFrom = null;
    this.encoder = options.encoder || new HttpUrlEncodingCodec();
    if (!!options.fromString) {
      if (!!options.fromObject) {
        throw new Error(`Cannot specify both fromString and fromObject.`);
      }
      this.map = paramParser(options.fromString, this.encoder);
    } else if (!!options.fromObject) {
      this.map = /* @__PURE__ */ new Map();
      Object.keys(options.fromObject).forEach((key) => {
        const value = options.fromObject[key];
        const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];
        this.map.set(key, values);
      });
    } else {
      this.map = null;
    }
  }
  /**
   * Reports whether the body includes one or more values for a given parameter.
   * @param param The parameter name.
   * @returns True if the parameter has one or more values,
   * false if it has no value or is not present.
   */
  has(param) {
    this.init();
    return this.map.has(param);
  }
  /**
   * Retrieves the first value for a parameter.
   * @param param The parameter name.
   * @returns The first value of the given parameter,
   * or `null` if the parameter is not present.
   */
  get(param) {
    this.init();
    const res = this.map.get(param);
    return !!res ? res[0] : null;
  }
  /**
   * Retrieves all values for a  parameter.
   * @param param The parameter name.
   * @returns All values in a string array,
   * or `null` if the parameter not present.
   */
  getAll(param) {
    this.init();
    return this.map.get(param) || null;
  }
  /**
   * Retrieves all the parameters for this body.
   * @returns The parameter names in a string array.
   */
  keys() {
    this.init();
    return Array.from(this.map.keys());
  }
  /**
   * Appends a new value to existing values for a parameter.
   * @param param The parameter name.
   * @param value The new value to add.
   * @return A new body with the appended value.
   */
  append(param, value) {
    return this.clone({
      param,
      value,
      op: "a"
    });
  }
  /**
   * Constructs a new body with appended values for the given parameter name.
   * @param params parameters and values
   * @return A new body with the new value.
   */
  appendAll(params) {
    const updates = [];
    Object.keys(params).forEach((param) => {
      const value = params[param];
      if (Array.isArray(value)) {
        value.forEach((_value) => {
          updates.push({
            param,
            value: _value,
            op: "a"
          });
        });
      } else {
        updates.push({
          param,
          value,
          op: "a"
        });
      }
    });
    return this.clone(updates);
  }
  /**
   * Replaces the value for a parameter.
   * @param param The parameter name.
   * @param value The new value.
   * @return A new body with the new value.
   */
  set(param, value) {
    return this.clone({
      param,
      value,
      op: "s"
    });
  }
  /**
   * Removes a given value or all values from a parameter.
   * @param param The parameter name.
   * @param value The value to remove, if provided.
   * @return A new body with the given value removed, or with all values
   * removed if no value is specified.
   */
  delete(param, value) {
    return this.clone({
      param,
      value,
      op: "d"
    });
  }
  /**
   * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are
   * separated by `&`s.
   */
  toString() {
    this.init();
    return this.keys().map((key) => {
      const eKey = this.encoder.encodeKey(key);
      return this.map.get(key).map((value) => eKey + "=" + this.encoder.encodeValue(value)).join("&");
    }).filter((param) => param !== "").join("&");
  }
  clone(update) {
    const clone = new _HttpParams({
      encoder: this.encoder
    });
    clone.cloneFrom = this.cloneFrom || this;
    clone.updates = (this.updates || []).concat(update);
    return clone;
  }
  init() {
    if (this.map === null) {
      this.map = /* @__PURE__ */ new Map();
    }
    if (this.cloneFrom !== null) {
      this.cloneFrom.init();
      this.cloneFrom.keys().forEach((key) => this.map.set(key, this.cloneFrom.map.get(key)));
      this.updates.forEach((update) => {
        switch (update.op) {
          case "a":
          case "s":
            const base = (update.op === "a" ? this.map.get(update.param) : void 0) || [];
            base.push(valueToString(update.value));
            this.map.set(update.param, base);
            break;
          case "d":
            if (update.value !== void 0) {
              let base2 = this.map.get(update.param) || [];
              const idx = base2.indexOf(valueToString(update.value));
              if (idx !== -1) {
                base2.splice(idx, 1);
              }
              if (base2.length > 0) {
                this.map.set(update.param, base2);
              } else {
                this.map.delete(update.param);
              }
            } else {
              this.map.delete(update.param);
              break;
            }
        }
      });
      this.cloneFrom = this.updates = null;
    }
  }
};
var HttpContext = class {
  constructor() {
    this.map = /* @__PURE__ */ new Map();
  }
  /**
   * Store a value in the context. If a value is already present it will be overwritten.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   * @param value The value to store.
   *
   * @returns A reference to itself for easy chaining.
   */
  set(token, value) {
    this.map.set(token, value);
    return this;
  }
  /**
   * Retrieve the value associated with the given token.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   *
   * @returns The stored value or default if one is defined.
   */
  get(token) {
    if (!this.map.has(token)) {
      this.map.set(token, token.defaultValue());
    }
    return this.map.get(token);
  }
  /**
   * Delete the value associated with the given token.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   *
   * @returns A reference to itself for easy chaining.
   */
  delete(token) {
    this.map.delete(token);
    return this;
  }
  /**
   * Checks for existence of a given token.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   *
   * @returns True if the token exists, false otherwise.
   */
  has(token) {
    return this.map.has(token);
  }
  /**
   * @returns a list of tokens currently stored in the context.
   */
  keys() {
    return this.map.keys();
  }
};
function mightHaveBody(method) {
  switch (method) {
    case "DELETE":
    case "GET":
    case "HEAD":
    case "OPTIONS":
    case "JSONP":
      return false;
    default:
      return true;
  }
}
function isArrayBuffer(value) {
  return typeof ArrayBuffer !== "undefined" && value instanceof ArrayBuffer;
}
function isBlob(value) {
  return typeof Blob !== "undefined" && value instanceof Blob;
}
function isFormData(value) {
  return typeof FormData !== "undefined" && value instanceof FormData;
}
function isUrlSearchParams(value) {
  return typeof URLSearchParams !== "undefined" && value instanceof URLSearchParams;
}
var HttpRequest = class _HttpRequest {
  constructor(method, url, third, fourth) {
    this.url = url;
    this.body = null;
    this.reportProgress = false;
    this.withCredentials = false;
    this.responseType = "json";
    this.method = method.toUpperCase();
    let options;
    if (mightHaveBody(this.method) || !!fourth) {
      this.body = third !== void 0 ? third : null;
      options = fourth;
    } else {
      options = third;
    }
    if (options) {
      this.reportProgress = !!options.reportProgress;
      this.withCredentials = !!options.withCredentials;
      if (!!options.responseType) {
        this.responseType = options.responseType;
      }
      if (!!options.headers) {
        this.headers = options.headers;
      }
      if (!!options.context) {
        this.context = options.context;
      }
      if (!!options.params) {
        this.params = options.params;
      }
      this.transferCache = options.transferCache;
    }
    this.headers ??= new HttpHeaders();
    this.context ??= new HttpContext();
    if (!this.params) {
      this.params = new HttpParams();
      this.urlWithParams = url;
    } else {
      const params = this.params.toString();
      if (params.length === 0) {
        this.urlWithParams = url;
      } else {
        const qIdx = url.indexOf("?");
        const sep = qIdx === -1 ? "?" : qIdx < url.length - 1 ? "&" : "";
        this.urlWithParams = url + sep + params;
      }
    }
  }
  /**
   * Transform the free-form body into a serialized format suitable for
   * transmission to the server.
   */
  serializeBody() {
    if (this.body === null) {
      return null;
    }
    if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) || isUrlSearchParams(this.body) || typeof this.body === "string") {
      return this.body;
    }
    if (this.body instanceof HttpParams) {
      return this.body.toString();
    }
    if (typeof this.body === "object" || typeof this.body === "boolean" || Array.isArray(this.body)) {
      return JSON.stringify(this.body);
    }
    return this.body.toString();
  }
  /**
   * Examine the body and attempt to infer an appropriate MIME type
   * for it.
   *
   * If no such type can be inferred, this method will return `null`.
   */
  detectContentTypeHeader() {
    if (this.body === null) {
      return null;
    }
    if (isFormData(this.body)) {
      return null;
    }
    if (isBlob(this.body)) {
      return this.body.type || null;
    }
    if (isArrayBuffer(this.body)) {
      return null;
    }
    if (typeof this.body === "string") {
      return "text/plain";
    }
    if (this.body instanceof HttpParams) {
      return "application/x-www-form-urlencoded;charset=UTF-8";
    }
    if (typeof this.body === "object" || typeof this.body === "number" || typeof this.body === "boolean") {
      return "application/json";
    }
    return null;
  }
  clone(update = {}) {
    const method = update.method || this.method;
    const url = update.url || this.url;
    const responseType = update.responseType || this.responseType;
    const body = update.body !== void 0 ? update.body : this.body;
    const withCredentials = update.withCredentials !== void 0 ? update.withCredentials : this.withCredentials;
    const reportProgress = update.reportProgress !== void 0 ? update.reportProgress : this.reportProgress;
    let headers = update.headers || this.headers;
    let params = update.params || this.params;
    const context = update.context ?? this.context;
    if (update.setHeaders !== void 0) {
      headers = Object.keys(update.setHeaders).reduce((headers2, name) => headers2.set(name, update.setHeaders[name]), headers);
    }
    if (update.setParams) {
      params = Object.keys(update.setParams).reduce((params2, param) => params2.set(param, update.setParams[param]), params);
    }
    return new _HttpRequest(method, url, body, {
      params,
      headers,
      context,
      reportProgress,
      responseType,
      withCredentials
    });
  }
};
var HttpEventType;
(function(HttpEventType2) {
  HttpEventType2[HttpEventType2["Sent"] = 0] = "Sent";
  HttpEventType2[HttpEventType2["UploadProgress"] = 1] = "UploadProgress";
  HttpEventType2[HttpEventType2["ResponseHeader"] = 2] = "ResponseHeader";
  HttpEventType2[HttpEventType2["DownloadProgress"] = 3] = "DownloadProgress";
  HttpEventType2[HttpEventType2["Response"] = 4] = "Response";
  HttpEventType2[HttpEventType2["User"] = 5] = "User";
})(HttpEventType || (HttpEventType = {}));
var HttpResponseBase = class {
  /**
   * Super-constructor for all responses.
   *
   * The single parameter accepted is an initialization hash. Any properties
   * of the response passed there will override the default values.
   */
  constructor(init, defaultStatus = HttpStatusCode.Ok, defaultStatusText = "OK") {
    this.headers = init.headers || new HttpHeaders();
    this.status = init.status !== void 0 ? init.status : defaultStatus;
    this.statusText = init.statusText || defaultStatusText;
    this.url = init.url || null;
    this.ok = this.status >= 200 && this.status < 300;
  }
};
var HttpHeaderResponse = class _HttpHeaderResponse extends HttpResponseBase {
  /**
   * Create a new `HttpHeaderResponse` with the given parameters.
   */
  constructor(init = {}) {
    super(init);
    this.type = HttpEventType.ResponseHeader;
  }
  /**
   * Copy this `HttpHeaderResponse`, overriding its contents with the
   * given parameter hash.
   */
  clone(update = {}) {
    return new _HttpHeaderResponse({
      headers: update.headers || this.headers,
      status: update.status !== void 0 ? update.status : this.status,
      statusText: update.statusText || this.statusText,
      url: update.url || this.url || void 0
    });
  }
};
var HttpResponse = class _HttpResponse extends HttpResponseBase {
  /**
   * Construct a new `HttpResponse`.
   */
  constructor(init = {}) {
    super(init);
    this.type = HttpEventType.Response;
    this.body = init.body !== void 0 ? init.body : null;
  }
  clone(update = {}) {
    return new _HttpResponse({
      body: update.body !== void 0 ? update.body : this.body,
      headers: update.headers || this.headers,
      status: update.status !== void 0 ? update.status : this.status,
      statusText: update.statusText || this.statusText,
      url: update.url || this.url || void 0
    });
  }
};
var HttpErrorResponse = class extends HttpResponseBase {
  constructor(init) {
    super(init, 0, "Unknown Error");
    this.name = "HttpErrorResponse";
    this.ok = false;
    if (this.status >= 200 && this.status < 300) {
      this.message = `Http failure during parsing for ${init.url || "(unknown url)"}`;
    } else {
      this.message = `Http failure response for ${init.url || "(unknown url)"}: ${init.status} ${init.statusText}`;
    }
    this.error = init.error || null;
  }
};
var HttpStatusCode;
(function(HttpStatusCode2) {
  HttpStatusCode2[HttpStatusCode2["Continue"] = 100] = "Continue";
  HttpStatusCode2[HttpStatusCode2["SwitchingProtocols"] = 101] = "SwitchingProtocols";
  HttpStatusCode2[HttpStatusCode2["Processing"] = 102] = "Processing";
  HttpStatusCode2[HttpStatusCode2["EarlyHints"] = 103] = "EarlyHints";
  HttpStatusCode2[HttpStatusCode2["Ok"] = 200] = "Ok";
  HttpStatusCode2[HttpStatusCode2["Created"] = 201] = "Created";
  HttpStatusCode2[HttpStatusCode2["Accepted"] = 202] = "Accepted";
  HttpStatusCode2[HttpStatusCode2["NonAuthoritativeInformation"] = 203] = "NonAuthoritativeInformation";
  HttpStatusCode2[HttpStatusCode2["NoContent"] = 204] = "NoContent";
  HttpStatusCode2[HttpStatusCode2["ResetContent"] = 205] = "ResetContent";
  HttpStatusCode2[HttpStatusCode2["PartialContent"] = 206] = "PartialContent";
  HttpStatusCode2[HttpStatusCode2["MultiStatus"] = 207] = "MultiStatus";
  HttpStatusCode2[HttpStatusCode2["AlreadyReported"] = 208] = "AlreadyReported";
  HttpStatusCode2[HttpStatusCode2["ImUsed"] = 226] = "ImUsed";
  HttpStatusCode2[HttpStatusCode2["MultipleChoices"] = 300] = "MultipleChoices";
  HttpStatusCode2[HttpStatusCode2["MovedPermanently"] = 301] = "MovedPermanently";
  HttpStatusCode2[HttpStatusCode2["Found"] = 302] = "Found";
  HttpStatusCode2[HttpStatusCode2["SeeOther"] = 303] = "SeeOther";
  HttpStatusCode2[HttpStatusCode2["NotModified"] = 304] = "NotModified";
  HttpStatusCode2[HttpStatusCode2["UseProxy"] = 305] = "UseProxy";
  HttpStatusCode2[HttpStatusCode2["Unused"] = 306] = "Unused";
  HttpStatusCode2[HttpStatusCode2["TemporaryRedirect"] = 307] = "TemporaryRedirect";
  HttpStatusCode2[HttpStatusCode2["PermanentRedirect"] = 308] = "PermanentRedirect";
  HttpStatusCode2[HttpStatusCode2["BadRequest"] = 400] = "BadRequest";
  HttpStatusCode2[HttpStatusCode2["Unauthorized"] = 401] = "Unauthorized";
  HttpStatusCode2[HttpStatusCode2["PaymentRequired"] = 402] = "PaymentRequired";
  HttpStatusCode2[HttpStatusCode2["Forbidden"] = 403] = "Forbidden";
  HttpStatusCode2[HttpStatusCode2["NotFound"] = 404] = "NotFound";
  HttpStatusCode2[HttpStatusCode2["MethodNotAllowed"] = 405] = "MethodNotAllowed";
  HttpStatusCode2[HttpStatusCode2["NotAcceptable"] = 406] = "NotAcceptable";
  HttpStatusCode2[HttpStatusCode2["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired";
  HttpStatusCode2[HttpStatusCode2["RequestTimeout"] = 408] = "RequestTimeout";
  HttpStatusCode2[HttpStatusCode2["Conflict"] = 409] = "Conflict";
  HttpStatusCode2[HttpStatusCode2["Gone"] = 410] = "Gone";
  HttpStatusCode2[HttpStatusCode2["LengthRequired"] = 411] = "LengthRequired";
  HttpStatusCode2[HttpStatusCode2["PreconditionFailed"] = 412] = "PreconditionFailed";
  HttpStatusCode2[HttpStatusCode2["PayloadTooLarge"] = 413] = "PayloadTooLarge";
  HttpStatusCode2[HttpStatusCode2["UriTooLong"] = 414] = "UriTooLong";
  HttpStatusCode2[HttpStatusCode2["UnsupportedMediaType"] = 415] = "UnsupportedMediaType";
  HttpStatusCode2[HttpStatusCode2["RangeNotSatisfiable"] = 416] = "RangeNotSatisfiable";
  HttpStatusCode2[HttpStatusCode2["ExpectationFailed"] = 417] = "ExpectationFailed";
  HttpStatusCode2[HttpStatusCode2["ImATeapot"] = 418] = "ImATeapot";
  HttpStatusCode2[HttpStatusCode2["MisdirectedRequest"] = 421] = "MisdirectedRequest";
  HttpStatusCode2[HttpStatusCode2["UnprocessableEntity"] = 422] = "UnprocessableEntity";
  HttpStatusCode2[HttpStatusCode2["Locked"] = 423] = "Locked";
  HttpStatusCode2[HttpStatusCode2["FailedDependency"] = 424] = "FailedDependency";
  HttpStatusCode2[HttpStatusCode2["TooEarly"] = 425] = "TooEarly";
  HttpStatusCode2[HttpStatusCode2["UpgradeRequired"] = 426] = "UpgradeRequired";
  HttpStatusCode2[HttpStatusCode2["PreconditionRequired"] = 428] = "PreconditionRequired";
  HttpStatusCode2[HttpStatusCode2["TooManyRequests"] = 429] = "TooManyRequests";
  HttpStatusCode2[HttpStatusCode2["RequestHeaderFieldsTooLarge"] = 431] = "RequestHeaderFieldsTooLarge";
  HttpStatusCode2[HttpStatusCode2["UnavailableForLegalReasons"] = 451] = "UnavailableForLegalReasons";
  HttpStatusCode2[HttpStatusCode2["InternalServerError"] = 500] = "InternalServerError";
  HttpStatusCode2[HttpStatusCode2["NotImplemented"] = 501] = "NotImplemented";
  HttpStatusCode2[HttpStatusCode2["BadGateway"] = 502] = "BadGateway";
  HttpStatusCode2[HttpStatusCode2["ServiceUnavailable"] = 503] = "ServiceUnavailable";
  HttpStatusCode2[HttpStatusCode2["GatewayTimeout"] = 504] = "GatewayTimeout";
  HttpStatusCode2[HttpStatusCode2["HttpVersionNotSupported"] = 505] = "HttpVersionNotSupported";
  HttpStatusCode2[HttpStatusCode2["VariantAlsoNegotiates"] = 506] = "VariantAlsoNegotiates";
  HttpStatusCode2[HttpStatusCode2["InsufficientStorage"] = 507] = "InsufficientStorage";
  HttpStatusCode2[HttpStatusCode2["LoopDetected"] = 508] = "LoopDetected";
  HttpStatusCode2[HttpStatusCode2["NotExtended"] = 510] = "NotExtended";
  HttpStatusCode2[HttpStatusCode2["NetworkAuthenticationRequired"] = 511] = "NetworkAuthenticationRequired";
})(HttpStatusCode || (HttpStatusCode = {}));
function addBody(options, body) {
  return {
    body,
    headers: options.headers,
    context: options.context,
    observe: options.observe,
    params: options.params,
    reportProgress: options.reportProgress,
    responseType: options.responseType,
    withCredentials: options.withCredentials,
    transferCache: options.transferCache
  };
}
var _HttpClient = class _HttpClient {
  constructor(handler) {
    this.handler = handler;
  }
  /**
   * Constructs an observable for a generic HTTP request that, when subscribed,
   * fires the request through the chain of registered interceptors and on to the
   * server.
   *
   * You can pass an `HttpRequest` directly as the only parameter. In this case,
   * the call returns an observable of the raw `HttpEvent` stream.
   *
   * Alternatively you can pass an HTTP method as the first parameter,
   * a URL string as the second, and an options hash containing the request body as the third.
   * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the
   * type of returned observable.
   *   * The `responseType` value determines how a successful response body is parsed.
   *   * If `responseType` is the default `json`, you can pass a type interface for the resulting
   * object as a type parameter to the call.
   *
   * The `observe` value determines the return type, according to what you are interested in
   * observing.
   *   * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including
   * progress events by default.
   *   * An `observe` value of response returns an observable of `HttpResponse<T>`,
   * where the `T` parameter depends on the `responseType` and any optionally provided type
   * parameter.
   *   * An `observe` value of body returns an observable of `<T>` with the same `T` body type.
   *
   */
  request(first, url, options = {}) {
    let req;
    if (first instanceof HttpRequest) {
      req = first;
    } else {
      let headers = void 0;
      if (options.headers instanceof HttpHeaders) {
        headers = options.headers;
      } else {
        headers = new HttpHeaders(options.headers);
      }
      let params = void 0;
      if (!!options.params) {
        if (options.params instanceof HttpParams) {
          params = options.params;
        } else {
          params = new HttpParams({
            fromObject: options.params
          });
        }
      }
      req = new HttpRequest(first, url, options.body !== void 0 ? options.body : null, {
        headers,
        context: options.context,
        params,
        reportProgress: options.reportProgress,
        // By default, JSON is assumed to be returned for all calls.
        responseType: options.responseType || "json",
        withCredentials: options.withCredentials,
        transferCache: options.transferCache
      });
    }
    const events$ = of(req).pipe(concatMap((req2) => this.handler.handle(req2)));
    if (first instanceof HttpRequest || options.observe === "events") {
      return events$;
    }
    const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));
    switch (options.observe || "body") {
      case "body":
        switch (req.responseType) {
          case "arraybuffer":
            return res$.pipe(map((res) => {
              if (res.body !== null && !(res.body instanceof ArrayBuffer)) {
                throw new Error("Response is not an ArrayBuffer.");
              }
              return res.body;
            }));
          case "blob":
            return res$.pipe(map((res) => {
              if (res.body !== null && !(res.body instanceof Blob)) {
                throw new Error("Response is not a Blob.");
              }
              return res.body;
            }));
          case "text":
            return res$.pipe(map((res) => {
              if (res.body !== null && typeof res.body !== "string") {
                throw new Error("Response is not a string.");
              }
              return res.body;
            }));
          case "json":
          default:
            return res$.pipe(map((res) => res.body));
        }
      case "response":
        return res$;
      default:
        throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);
    }
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `DELETE` request to execute on the server. See the individual overloads for
   * details on the return type.
   *
   * @param url     The endpoint URL.
   * @param options The HTTP options to send with the request.
   *
   */
  delete(url, options = {}) {
    return this.request("DELETE", url, options);
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `GET` request to execute on the server. See the individual overloads for
   * details on the return type.
   */
  get(url, options = {}) {
    return this.request("GET", url, options);
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `HEAD` request to execute on the server. The `HEAD` method returns
   * meta information about the resource without transferring the
   * resource itself. See the individual overloads for
   * details on the return type.
   */
  head(url, options = {}) {
    return this.request("HEAD", url, options);
  }
  /**
   * Constructs an `Observable` that, when subscribed, causes a request with the special method
   * `JSONP` to be dispatched via the interceptor pipeline.
   * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain
   * API endpoints that don't support newer,
   * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.
   * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the
   * requests even if the API endpoint is not located on the same domain (origin) as the client-side
   * application making the request.
   * The endpoint API must support JSONP callback for JSONP requests to work.
   * The resource API returns the JSON response wrapped in a callback function.
   * You can pass the callback function name as one of the query parameters.
   * Note that JSONP requests can only be used with `GET` requests.
   *
   * @param url The resource URL.
   * @param callbackParam The callback function name.
   *
   */
  jsonp(url, callbackParam) {
    return this.request("JSONP", url, {
      params: new HttpParams().append(callbackParam, "JSONP_CALLBACK"),
      observe: "body",
      responseType: "json"
    });
  }
  /**
   * Constructs an `Observable` that, when subscribed, causes the configured
   * `OPTIONS` request to execute on the server. This method allows the client
   * to determine the supported HTTP methods and other capabilities of an endpoint,
   * without implying a resource action. See the individual overloads for
   * details on the return type.
   */
  options(url, options = {}) {
    return this.request("OPTIONS", url, options);
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `PATCH` request to execute on the server. See the individual overloads for
   * details on the return type.
   */
  patch(url, body, options = {}) {
    return this.request("PATCH", url, addBody(options, body));
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `POST` request to execute on the server. The server responds with the location of
   * the replaced resource. See the individual overloads for
   * details on the return type.
   */
  post(url, body, options = {}) {
    return this.request("POST", url, addBody(options, body));
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `PUT` request to execute on the server. The `PUT` method replaces an existing resource
   * with a new set of values.
   * See the individual overloads for details on the return type.
   */
  put(url, body, options = {}) {
    return this.request("PUT", url, addBody(options, body));
  }
};
_HttpClient.ɵfac = function HttpClient_Factory(t) {
  return new (t || _HttpClient)(ɵɵinject(HttpHandler));
};
_HttpClient.ɵprov = ɵɵdefineInjectable({
  token: _HttpClient,
  factory: _HttpClient.ɵfac
});
var HttpClient = _HttpClient;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClient, [{
    type: Injectable
  }], () => [{
    type: HttpHandler
  }], null);
})();
var XSSI_PREFIX$1 = /^\)\]\}',?\n/;
var REQUEST_URL_HEADER = `X-Request-URL`;
function getResponseUrl$1(response) {
  if (response.url) {
    return response.url;
  }
  const xRequestUrl = REQUEST_URL_HEADER.toLocaleLowerCase();
  return response.headers.get(xRequestUrl);
}
var _FetchBackend = class _FetchBackend {
  constructor() {
    this.fetchImpl = inject(FetchFactory, {
      optional: true
    })?.fetch ?? fetch.bind(globalThis);
    this.ngZone = inject(NgZone);
  }
  handle(request) {
    return new Observable((observer) => {
      const aborter = new AbortController();
      this.doRequest(request, aborter.signal, observer).then(noop, (error) => observer.error(new HttpErrorResponse({
        error
      })));
      return () => aborter.abort();
    });
  }
  doRequest(request, signal, observer) {
    return __async(this, null, function* () {
      const init = this.createRequestInit(request);
      let response;
      try {
        const fetchPromise = this.fetchImpl(request.urlWithParams, __spreadValues({
          signal
        }, init));
        silenceSuperfluousUnhandledPromiseRejection(fetchPromise);
        observer.next({
          type: HttpEventType.Sent
        });
        response = yield fetchPromise;
      } catch (error) {
        observer.error(new HttpErrorResponse({
          error,
          status: error.status ?? 0,
          statusText: error.statusText,
          url: request.urlWithParams,
          headers: error.headers
        }));
        return;
      }
      const headers = new HttpHeaders(response.headers);
      const statusText = response.statusText;
      const url = getResponseUrl$1(response) ?? request.urlWithParams;
      let status = response.status;
      let body = null;
      if (request.reportProgress) {
        observer.next(new HttpHeaderResponse({
          headers,
          status,
          statusText,
          url
        }));
      }
      if (response.body) {
        const contentLength = response.headers.get("content-length");
        const chunks = [];
        const reader = response.body.getReader();
        let receivedLength = 0;
        let decoder;
        let partialText;
        const reqZone = typeof Zone !== "undefined" && Zone.current;
        yield this.ngZone.runOutsideAngular(() => __async(this, null, function* () {
          while (true) {
            const {
              done,
              value
            } = yield reader.read();
            if (done) {
              break;
            }
            chunks.push(value);
            receivedLength += value.length;
            if (request.reportProgress) {
              partialText = request.responseType === "text" ? (partialText ?? "") + (decoder ??= new TextDecoder()).decode(value, {
                stream: true
              }) : void 0;
              const reportProgress = () => observer.next({
                type: HttpEventType.DownloadProgress,
                total: contentLength ? +contentLength : void 0,
                loaded: receivedLength,
                partialText
              });
              reqZone ? reqZone.run(reportProgress) : reportProgress();
            }
          }
        }));
        const chunksAll = this.concatChunks(chunks, receivedLength);
        try {
          const contentType = response.headers.get("Content-Type") ?? "";
          body = this.parseBody(request, chunksAll, contentType);
        } catch (error) {
          observer.error(new HttpErrorResponse({
            error,
            headers: new HttpHeaders(response.headers),
            status: response.status,
            statusText: response.statusText,
            url: getResponseUrl$1(response) ?? request.urlWithParams
          }));
          return;
        }
      }
      if (status === 0) {
        status = body ? HttpStatusCode.Ok : 0;
      }
      const ok = status >= 200 && status < 300;
      if (ok) {
        observer.next(new HttpResponse({
          body,
          headers,
          status,
          statusText,
          url
        }));
        observer.complete();
      } else {
        observer.error(new HttpErrorResponse({
          error: body,
          headers,
          status,
          statusText,
          url
        }));
      }
    });
  }
  parseBody(request, binContent, contentType) {
    switch (request.responseType) {
      case "json":
        const text = new TextDecoder().decode(binContent).replace(XSSI_PREFIX$1, "");
        return text === "" ? null : JSON.parse(text);
      case "text":
        return new TextDecoder().decode(binContent);
      case "blob":
        return new Blob([binContent], {
          type: contentType
        });
      case "arraybuffer":
        return binContent.buffer;
    }
  }
  createRequestInit(req) {
    const headers = {};
    const credentials = req.withCredentials ? "include" : void 0;
    req.headers.forEach((name, values) => headers[name] = values.join(","));
    headers["Accept"] ??= "application/json, text/plain, */*";
    if (!headers["Content-Type"]) {
      const detectedType = req.detectContentTypeHeader();
      if (detectedType !== null) {
        headers["Content-Type"] = detectedType;
      }
    }
    return {
      body: req.serializeBody(),
      method: req.method,
      headers,
      credentials
    };
  }
  concatChunks(chunks, totalLength) {
    const chunksAll = new Uint8Array(totalLength);
    let position = 0;
    for (const chunk of chunks) {
      chunksAll.set(chunk, position);
      position += chunk.length;
    }
    return chunksAll;
  }
};
_FetchBackend.ɵfac = function FetchBackend_Factory(t) {
  return new (t || _FetchBackend)();
};
_FetchBackend.ɵprov = ɵɵdefineInjectable({
  token: _FetchBackend,
  factory: _FetchBackend.ɵfac
});
var FetchBackend = _FetchBackend;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(FetchBackend, [{
    type: Injectable
  }], null, null);
})();
var FetchFactory = class {
};
function noop() {
}
function silenceSuperfluousUnhandledPromiseRejection(promise) {
  promise.then(noop, noop);
}
function interceptorChainEndFn(req, finalHandlerFn) {
  return finalHandlerFn(req);
}
function adaptLegacyInterceptorToChain(chainTailFn, interceptor) {
  return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {
    handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn)
  });
}
function chainedInterceptorFn(chainTailFn, interceptorFn, injector) {
  return (initialRequest, finalHandlerFn) => runInInjectionContext(injector, () => interceptorFn(initialRequest, (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn)));
}
var HTTP_INTERCEPTORS = new InjectionToken(ngDevMode ? "HTTP_INTERCEPTORS" : "");
var HTTP_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? "HTTP_INTERCEPTOR_FNS" : "");
var HTTP_ROOT_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? "HTTP_ROOT_INTERCEPTOR_FNS" : "");
var PRIMARY_HTTP_BACKEND = new InjectionToken(ngDevMode ? "PRIMARY_HTTP_BACKEND" : "");
function legacyInterceptorFnFactory() {
  let chain = null;
  return (req, handler) => {
    if (chain === null) {
      const interceptors = inject(HTTP_INTERCEPTORS, {
        optional: true
      }) ?? [];
      chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);
    }
    const pendingTasks = inject(PendingTasks);
    const taskId = pendingTasks.add();
    return chain(req, handler).pipe(finalize(() => pendingTasks.remove(taskId)));
  };
}
var fetchBackendWarningDisplayed = false;
var _HttpInterceptorHandler = class _HttpInterceptorHandler extends HttpHandler {
  constructor(backend, injector) {
    super();
    this.backend = backend;
    this.injector = injector;
    this.chain = null;
    this.pendingTasks = inject(PendingTasks);
    const primaryHttpBackend = inject(PRIMARY_HTTP_BACKEND, {
      optional: true
    });
    this.backend = primaryHttpBackend ?? backend;
    if ((typeof ngDevMode === "undefined" || ngDevMode) && !fetchBackendWarningDisplayed) {
      const isServer = isPlatformServer(injector.get(PLATFORM_ID));
      if (isServer && !(this.backend instanceof FetchBackend)) {
        fetchBackendWarningDisplayed = true;
        injector.get(Console).warn(formatRuntimeError(2801, "Angular detected that `HttpClient` is not configured to use `fetch` APIs. It's strongly recommended to enable `fetch` for applications that use Server-Side Rendering for better performance and compatibility. To enable `fetch`, add the `withFetch()` to the `provideHttpClient()` call at the root of the application."));
      }
    }
  }
  handle(initialRequest) {
    if (this.chain === null) {
      const dedupedInterceptorFns = Array.from(/* @__PURE__ */ new Set([...this.injector.get(HTTP_INTERCEPTOR_FNS), ...this.injector.get(HTTP_ROOT_INTERCEPTOR_FNS, [])]));
      this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);
    }
    const taskId = this.pendingTasks.add();
    return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest)).pipe(finalize(() => this.pendingTasks.remove(taskId)));
  }
};
_HttpInterceptorHandler.ɵfac = function HttpInterceptorHandler_Factory(t) {
  return new (t || _HttpInterceptorHandler)(ɵɵinject(HttpBackend), ɵɵinject(EnvironmentInjector));
};
_HttpInterceptorHandler.ɵprov = ɵɵdefineInjectable({
  token: _HttpInterceptorHandler,
  factory: _HttpInterceptorHandler.ɵfac
});
var HttpInterceptorHandler = _HttpInterceptorHandler;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpInterceptorHandler, [{
    type: Injectable
  }], () => [{
    type: HttpBackend
  }, {
    type: EnvironmentInjector
  }], null);
})();
var nextRequestId = 0;
var foreignDocument;
var JSONP_ERR_NO_CALLBACK = "JSONP injected script did not invoke callback.";
var JSONP_ERR_WRONG_METHOD = "JSONP requests must use JSONP request method.";
var JSONP_ERR_WRONG_RESPONSE_TYPE = "JSONP requests must use Json response type.";
var JSONP_ERR_HEADERS_NOT_SUPPORTED = "JSONP requests do not support headers.";
var JsonpCallbackContext = class {
};
function jsonpCallbackContext() {
  if (typeof window === "object") {
    return window;
  }
  return {};
}
var _JsonpClientBackend = class _JsonpClientBackend {
  constructor(callbackMap, document2) {
    this.callbackMap = callbackMap;
    this.document = document2;
    this.resolvedPromise = Promise.resolve();
  }
  /**
   * Get the name of the next callback method, by incrementing the global `nextRequestId`.
   */
  nextCallback() {
    return `ng_jsonp_callback_${nextRequestId++}`;
  }
  /**
   * Processes a JSONP request and returns an event stream of the results.
   * @param req The request object.
   * @returns An observable of the response events.
   *
   */
  handle(req) {
    if (req.method !== "JSONP") {
      throw new Error(JSONP_ERR_WRONG_METHOD);
    } else if (req.responseType !== "json") {
      throw new Error(JSONP_ERR_WRONG_RESPONSE_TYPE);
    }
    if (req.headers.keys().length > 0) {
      throw new Error(JSONP_ERR_HEADERS_NOT_SUPPORTED);
    }
    return new Observable((observer) => {
      const callback = this.nextCallback();
      const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`);
      const node = this.document.createElement("script");
      node.src = url;
      let body = null;
      let finished = false;
      this.callbackMap[callback] = (data) => {
        delete this.callbackMap[callback];
        body = data;
        finished = true;
      };
      const cleanup = () => {
        if (node.parentNode) {
          node.parentNode.removeChild(node);
        }
        delete this.callbackMap[callback];
      };
      const onLoad = (event) => {
        this.resolvedPromise.then(() => {
          cleanup();
          if (!finished) {
            observer.error(new HttpErrorResponse({
              url,
              status: 0,
              statusText: "JSONP Error",
              error: new Error(JSONP_ERR_NO_CALLBACK)
            }));
            return;
          }
          observer.next(new HttpResponse({
            body,
            status: HttpStatusCode.Ok,
            statusText: "OK",
            url
          }));
          observer.complete();
        });
      };
      const onError = (error) => {
        cleanup();
        observer.error(new HttpErrorResponse({
          error,
          status: 0,
          statusText: "JSONP Error",
          url
        }));
      };
      node.addEventListener("load", onLoad);
      node.addEventListener("error", onError);
      this.document.body.appendChild(node);
      observer.next({
        type: HttpEventType.Sent
      });
      return () => {
        if (!finished) {
          this.removeListeners(node);
        }
        cleanup();
      };
    });
  }
  removeListeners(script) {
    foreignDocument ??= this.document.implementation.createHTMLDocument();
    foreignDocument.adoptNode(script);
  }
};
_JsonpClientBackend.ɵfac = function JsonpClientBackend_Factory(t) {
  return new (t || _JsonpClientBackend)(ɵɵinject(JsonpCallbackContext), ɵɵinject(DOCUMENT));
};
_JsonpClientBackend.ɵprov = ɵɵdefineInjectable({
  token: _JsonpClientBackend,
  factory: _JsonpClientBackend.ɵfac
});
var JsonpClientBackend = _JsonpClientBackend;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(JsonpClientBackend, [{
    type: Injectable
  }], () => [{
    type: JsonpCallbackContext
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
function jsonpInterceptorFn(req, next) {
  if (req.method === "JSONP") {
    return inject(JsonpClientBackend).handle(req);
  }
  return next(req);
}
var _JsonpInterceptor = class _JsonpInterceptor {
  constructor(injector) {
    this.injector = injector;
  }
  /**
   * Identifies and handles a given JSONP request.
   * @param initialRequest The outgoing request object to handle.
   * @param next The next interceptor in the chain, or the backend
   * if no interceptors remain in the chain.
   * @returns An observable of the event stream.
   */
  intercept(initialRequest, next) {
    return runInInjectionContext(this.injector, () => jsonpInterceptorFn(initialRequest, (downstreamRequest) => next.handle(downstreamRequest)));
  }
};
_JsonpInterceptor.ɵfac = function JsonpInterceptor_Factory(t) {
  return new (t || _JsonpInterceptor)(ɵɵinject(EnvironmentInjector));
};
_JsonpInterceptor.ɵprov = ɵɵdefineInjectable({
  token: _JsonpInterceptor,
  factory: _JsonpInterceptor.ɵfac
});
var JsonpInterceptor = _JsonpInterceptor;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(JsonpInterceptor, [{
    type: Injectable
  }], () => [{
    type: EnvironmentInjector
  }], null);
})();
var XSSI_PREFIX = /^\)\]\}',?\n/;
function getResponseUrl(xhr) {
  if ("responseURL" in xhr && xhr.responseURL) {
    return xhr.responseURL;
  }
  if (/^X-Request-URL:/m.test(xhr.getAllResponseHeaders())) {
    return xhr.getResponseHeader("X-Request-URL");
  }
  return null;
}
var _HttpXhrBackend = class _HttpXhrBackend {
  constructor(xhrFactory) {
    this.xhrFactory = xhrFactory;
  }
  /**
   * Processes a request and returns a stream of response events.
   * @param req The request object.
   * @returns An observable of the response events.
   */
  handle(req) {
    if (req.method === "JSONP") {
      throw new RuntimeError(-2800, (typeof ngDevMode === "undefined" || ngDevMode) && `Cannot make a JSONP request without JSONP support. To fix the problem, either add the \`withJsonpSupport()\` call (if \`provideHttpClient()\` is used) or import the \`HttpClientJsonpModule\` in the root NgModule.`);
    }
    const xhrFactory = this.xhrFactory;
    const source = xhrFactory.ɵloadImpl ? from(xhrFactory.ɵloadImpl()) : of(null);
    return source.pipe(switchMap(() => {
      return new Observable((observer) => {
        const xhr = xhrFactory.build();
        xhr.open(req.method, req.urlWithParams);
        if (req.withCredentials) {
          xhr.withCredentials = true;
        }
        req.headers.forEach((name, values) => xhr.setRequestHeader(name, values.join(",")));
        if (!req.headers.has("Accept")) {
          xhr.setRequestHeader("Accept", "application/json, text/plain, */*");
        }
        if (!req.headers.has("Content-Type")) {
          const detectedType = req.detectContentTypeHeader();
          if (detectedType !== null) {
            xhr.setRequestHeader("Content-Type", detectedType);
          }
        }
        if (req.responseType) {
          const responseType = req.responseType.toLowerCase();
          xhr.responseType = responseType !== "json" ? responseType : "text";
        }
        const reqBody = req.serializeBody();
        let headerResponse = null;
        const partialFromXhr = () => {
          if (headerResponse !== null) {
            return headerResponse;
          }
          const statusText = xhr.statusText || "OK";
          const headers = new HttpHeaders(xhr.getAllResponseHeaders());
          const url = getResponseUrl(xhr) || req.url;
          headerResponse = new HttpHeaderResponse({
            headers,
            status: xhr.status,
            statusText,
            url
          });
          return headerResponse;
        };
        const onLoad = () => {
          let {
            headers,
            status,
            statusText,
            url
          } = partialFromXhr();
          let body = null;
          if (status !== HttpStatusCode.NoContent) {
            body = typeof xhr.response === "undefined" ? xhr.responseText : xhr.response;
          }
          if (status === 0) {
            status = !!body ? HttpStatusCode.Ok : 0;
          }
          let ok = status >= 200 && status < 300;
          if (req.responseType === "json" && typeof body === "string") {
            const originalBody = body;
            body = body.replace(XSSI_PREFIX, "");
            try {
              body = body !== "" ? JSON.parse(body) : null;
            } catch (error) {
              body = originalBody;
              if (ok) {
                ok = false;
                body = {
                  error,
                  text: body
                };
              }
            }
          }
          if (ok) {
            observer.next(new HttpResponse({
              body,
              headers,
              status,
              statusText,
              url: url || void 0
            }));
            observer.complete();
          } else {
            observer.error(new HttpErrorResponse({
              // The error in this case is the response body (error from the server).
              error: body,
              headers,
              status,
              statusText,
              url: url || void 0
            }));
          }
        };
        const onError = (error) => {
          const {
            url
          } = partialFromXhr();
          const res = new HttpErrorResponse({
            error,
            status: xhr.status || 0,
            statusText: xhr.statusText || "Unknown Error",
            url: url || void 0
          });
          observer.error(res);
        };
        let sentHeaders = false;
        const onDownProgress = (event) => {
          if (!sentHeaders) {
            observer.next(partialFromXhr());
            sentHeaders = true;
          }
          let progressEvent = {
            type: HttpEventType.DownloadProgress,
            loaded: event.loaded
          };
          if (event.lengthComputable) {
            progressEvent.total = event.total;
          }
          if (req.responseType === "text" && !!xhr.responseText) {
            progressEvent.partialText = xhr.responseText;
          }
          observer.next(progressEvent);
        };
        const onUpProgress = (event) => {
          let progress = {
            type: HttpEventType.UploadProgress,
            loaded: event.loaded
          };
          if (event.lengthComputable) {
            progress.total = event.total;
          }
          observer.next(progress);
        };
        xhr.addEventListener("load", onLoad);
        xhr.addEventListener("error", onError);
        xhr.addEventListener("timeout", onError);
        xhr.addEventListener("abort", onError);
        if (req.reportProgress) {
          xhr.addEventListener("progress", onDownProgress);
          if (reqBody !== null && xhr.upload) {
            xhr.upload.addEventListener("progress", onUpProgress);
          }
        }
        xhr.send(reqBody);
        observer.next({
          type: HttpEventType.Sent
        });
        return () => {
          xhr.removeEventListener("error", onError);
          xhr.removeEventListener("abort", onError);
          xhr.removeEventListener("load", onLoad);
          xhr.removeEventListener("timeout", onError);
          if (req.reportProgress) {
            xhr.removeEventListener("progress", onDownProgress);
            if (reqBody !== null && xhr.upload) {
              xhr.upload.removeEventListener("progress", onUpProgress);
            }
          }
          if (xhr.readyState !== xhr.DONE) {
            xhr.abort();
          }
        };
      });
    }));
  }
};
_HttpXhrBackend.ɵfac = function HttpXhrBackend_Factory(t) {
  return new (t || _HttpXhrBackend)(ɵɵinject(XhrFactory));
};
_HttpXhrBackend.ɵprov = ɵɵdefineInjectable({
  token: _HttpXhrBackend,
  factory: _HttpXhrBackend.ɵfac
});
var HttpXhrBackend = _HttpXhrBackend;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpXhrBackend, [{
    type: Injectable
  }], () => [{
    type: XhrFactory
  }], null);
})();
var XSRF_ENABLED = new InjectionToken(ngDevMode ? "XSRF_ENABLED" : "");
var XSRF_DEFAULT_COOKIE_NAME = "XSRF-TOKEN";
var XSRF_COOKIE_NAME = new InjectionToken(ngDevMode ? "XSRF_COOKIE_NAME" : "", {
  providedIn: "root",
  factory: () => XSRF_DEFAULT_COOKIE_NAME
});
var XSRF_DEFAULT_HEADER_NAME = "X-XSRF-TOKEN";
var XSRF_HEADER_NAME = new InjectionToken(ngDevMode ? "XSRF_HEADER_NAME" : "", {
  providedIn: "root",
  factory: () => XSRF_DEFAULT_HEADER_NAME
});
var HttpXsrfTokenExtractor = class {
};
var _HttpXsrfCookieExtractor = class _HttpXsrfCookieExtractor {
  constructor(doc, platform, cookieName) {
    this.doc = doc;
    this.platform = platform;
    this.cookieName = cookieName;
    this.lastCookieString = "";
    this.lastToken = null;
    this.parseCount = 0;
  }
  getToken() {
    if (this.platform === "server") {
      return null;
    }
    const cookieString = this.doc.cookie || "";
    if (cookieString !== this.lastCookieString) {
      this.parseCount++;
      this.lastToken = parseCookieValue(cookieString, this.cookieName);
      this.lastCookieString = cookieString;
    }
    return this.lastToken;
  }
};
_HttpXsrfCookieExtractor.ɵfac = function HttpXsrfCookieExtractor_Factory(t) {
  return new (t || _HttpXsrfCookieExtractor)(ɵɵinject(DOCUMENT), ɵɵinject(PLATFORM_ID), ɵɵinject(XSRF_COOKIE_NAME));
};
_HttpXsrfCookieExtractor.ɵprov = ɵɵdefineInjectable({
  token: _HttpXsrfCookieExtractor,
  factory: _HttpXsrfCookieExtractor.ɵfac
});
var HttpXsrfCookieExtractor = _HttpXsrfCookieExtractor;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpXsrfCookieExtractor, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [PLATFORM_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [XSRF_COOKIE_NAME]
    }]
  }], null);
})();
function xsrfInterceptorFn(req, next) {
  const lcUrl = req.url.toLowerCase();
  if (!inject(XSRF_ENABLED) || req.method === "GET" || req.method === "HEAD" || lcUrl.startsWith("http://") || lcUrl.startsWith("https://")) {
    return next(req);
  }
  const token = inject(HttpXsrfTokenExtractor).getToken();
  const headerName = inject(XSRF_HEADER_NAME);
  if (token != null && !req.headers.has(headerName)) {
    req = req.clone({
      headers: req.headers.set(headerName, token)
    });
  }
  return next(req);
}
var _HttpXsrfInterceptor = class _HttpXsrfInterceptor {
  constructor(injector) {
    this.injector = injector;
  }
  intercept(initialRequest, next) {
    return runInInjectionContext(this.injector, () => xsrfInterceptorFn(initialRequest, (downstreamRequest) => next.handle(downstreamRequest)));
  }
};
_HttpXsrfInterceptor.ɵfac = function HttpXsrfInterceptor_Factory(t) {
  return new (t || _HttpXsrfInterceptor)(ɵɵinject(EnvironmentInjector));
};
_HttpXsrfInterceptor.ɵprov = ɵɵdefineInjectable({
  token: _HttpXsrfInterceptor,
  factory: _HttpXsrfInterceptor.ɵfac
});
var HttpXsrfInterceptor = _HttpXsrfInterceptor;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpXsrfInterceptor, [{
    type: Injectable
  }], () => [{
    type: EnvironmentInjector
  }], null);
})();
var HttpFeatureKind;
(function(HttpFeatureKind2) {
  HttpFeatureKind2[HttpFeatureKind2["Interceptors"] = 0] = "Interceptors";
  HttpFeatureKind2[HttpFeatureKind2["LegacyInterceptors"] = 1] = "LegacyInterceptors";
  HttpFeatureKind2[HttpFeatureKind2["CustomXsrfConfiguration"] = 2] = "CustomXsrfConfiguration";
  HttpFeatureKind2[HttpFeatureKind2["NoXsrfProtection"] = 3] = "NoXsrfProtection";
  HttpFeatureKind2[HttpFeatureKind2["JsonpSupport"] = 4] = "JsonpSupport";
  HttpFeatureKind2[HttpFeatureKind2["RequestsMadeViaParent"] = 5] = "RequestsMadeViaParent";
  HttpFeatureKind2[HttpFeatureKind2["Fetch"] = 6] = "Fetch";
})(HttpFeatureKind || (HttpFeatureKind = {}));
function makeHttpFeature(kind, providers) {
  return {
    ɵkind: kind,
    ɵproviders: providers
  };
}
function provideHttpClient(...features) {
  if (ngDevMode) {
    const featureKinds = new Set(features.map((f) => f.ɵkind));
    if (featureKinds.has(HttpFeatureKind.NoXsrfProtection) && featureKinds.has(HttpFeatureKind.CustomXsrfConfiguration)) {
      throw new Error(ngDevMode ? `Configuration error: found both withXsrfConfiguration() and withNoXsrfProtection() in the same call to provideHttpClient(), which is a contradiction.` : "");
    }
  }
  const providers = [HttpClient, HttpXhrBackend, HttpInterceptorHandler, {
    provide: HttpHandler,
    useExisting: HttpInterceptorHandler
  }, {
    provide: HttpBackend,
    useExisting: HttpXhrBackend
  }, {
    provide: HTTP_INTERCEPTOR_FNS,
    useValue: xsrfInterceptorFn,
    multi: true
  }, {
    provide: XSRF_ENABLED,
    useValue: true
  }, {
    provide: HttpXsrfTokenExtractor,
    useClass: HttpXsrfCookieExtractor
  }];
  for (const feature of features) {
    providers.push(...feature.ɵproviders);
  }
  return makeEnvironmentProviders(providers);
}
var LEGACY_INTERCEPTOR_FN = new InjectionToken(ngDevMode ? "LEGACY_INTERCEPTOR_FN" : "");
function withInterceptorsFromDi() {
  return makeHttpFeature(HttpFeatureKind.LegacyInterceptors, [{
    provide: LEGACY_INTERCEPTOR_FN,
    useFactory: legacyInterceptorFnFactory
  }, {
    provide: HTTP_INTERCEPTOR_FNS,
    useExisting: LEGACY_INTERCEPTOR_FN,
    multi: true
  }]);
}
function withXsrfConfiguration({
  cookieName,
  headerName
}) {
  const providers = [];
  if (cookieName !== void 0) {
    providers.push({
      provide: XSRF_COOKIE_NAME,
      useValue: cookieName
    });
  }
  if (headerName !== void 0) {
    providers.push({
      provide: XSRF_HEADER_NAME,
      useValue: headerName
    });
  }
  return makeHttpFeature(HttpFeatureKind.CustomXsrfConfiguration, providers);
}
function withNoXsrfProtection() {
  return makeHttpFeature(HttpFeatureKind.NoXsrfProtection, [{
    provide: XSRF_ENABLED,
    useValue: false
  }]);
}
function withJsonpSupport() {
  return makeHttpFeature(HttpFeatureKind.JsonpSupport, [JsonpClientBackend, {
    provide: JsonpCallbackContext,
    useFactory: jsonpCallbackContext
  }, {
    provide: HTTP_INTERCEPTOR_FNS,
    useValue: jsonpInterceptorFn,
    multi: true
  }]);
}
var _HttpClientXsrfModule = class _HttpClientXsrfModule {
  /**
   * Disable the default XSRF protection.
   */
  static disable() {
    return {
      ngModule: _HttpClientXsrfModule,
      providers: [withNoXsrfProtection().ɵproviders]
    };
  }
  /**
   * Configure XSRF protection.
   * @param options An object that can specify either or both
   * cookie name or header name.
   * - Cookie name default is `XSRF-TOKEN`.
   * - Header name default is `X-XSRF-TOKEN`.
   *
   */
  static withOptions(options = {}) {
    return {
      ngModule: _HttpClientXsrfModule,
      providers: withXsrfConfiguration(options).ɵproviders
    };
  }
};
_HttpClientXsrfModule.ɵfac = function HttpClientXsrfModule_Factory(t) {
  return new (t || _HttpClientXsrfModule)();
};
_HttpClientXsrfModule.ɵmod = ɵɵdefineNgModule({
  type: _HttpClientXsrfModule
});
_HttpClientXsrfModule.ɵinj = ɵɵdefineInjector({
  providers: [HttpXsrfInterceptor, {
    provide: HTTP_INTERCEPTORS,
    useExisting: HttpXsrfInterceptor,
    multi: true
  }, {
    provide: HttpXsrfTokenExtractor,
    useClass: HttpXsrfCookieExtractor
  }, withXsrfConfiguration({
    cookieName: XSRF_DEFAULT_COOKIE_NAME,
    headerName: XSRF_DEFAULT_HEADER_NAME
  }).ɵproviders, {
    provide: XSRF_ENABLED,
    useValue: true
  }]
});
var HttpClientXsrfModule = _HttpClientXsrfModule;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClientXsrfModule, [{
    type: NgModule,
    args: [{
      providers: [HttpXsrfInterceptor, {
        provide: HTTP_INTERCEPTORS,
        useExisting: HttpXsrfInterceptor,
        multi: true
      }, {
        provide: HttpXsrfTokenExtractor,
        useClass: HttpXsrfCookieExtractor
      }, withXsrfConfiguration({
        cookieName: XSRF_DEFAULT_COOKIE_NAME,
        headerName: XSRF_DEFAULT_HEADER_NAME
      }).ɵproviders, {
        provide: XSRF_ENABLED,
        useValue: true
      }]
    }]
  }], null, null);
})();
var _HttpClientModule = class _HttpClientModule {
};
_HttpClientModule.ɵfac = function HttpClientModule_Factory(t) {
  return new (t || _HttpClientModule)();
};
_HttpClientModule.ɵmod = ɵɵdefineNgModule({
  type: _HttpClientModule
});
_HttpClientModule.ɵinj = ɵɵdefineInjector({
  providers: [provideHttpClient(withInterceptorsFromDi())]
});
var HttpClientModule = _HttpClientModule;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClientModule, [{
    type: NgModule,
    args: [{
      /**
       * Configures the [dependency injector](guide/glossary#injector) where it is imported
       * with supporting services for HTTP communications.
       */
      providers: [provideHttpClient(withInterceptorsFromDi())]
    }]
  }], null, null);
})();
var _HttpClientJsonpModule = class _HttpClientJsonpModule {
};
_HttpClientJsonpModule.ɵfac = function HttpClientJsonpModule_Factory(t) {
  return new (t || _HttpClientJsonpModule)();
};
_HttpClientJsonpModule.ɵmod = ɵɵdefineNgModule({
  type: _HttpClientJsonpModule
});
_HttpClientJsonpModule.ɵinj = ɵɵdefineInjector({
  providers: [withJsonpSupport().ɵproviders]
});
var HttpClientJsonpModule = _HttpClientJsonpModule;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClientJsonpModule, [{
    type: NgModule,
    args: [{
      providers: [withJsonpSupport().ɵproviders]
    }]
  }], null, null);
})();
var BODY = "b";
var HEADERS = "h";
var STATUS = "s";
var STATUS_TEXT = "st";
var URL2 = "u";
var RESPONSE_TYPE = "rt";
var CACHE_OPTIONS = new InjectionToken(ngDevMode ? "HTTP_TRANSFER_STATE_CACHE_OPTIONS" : "");
var ALLOWED_METHODS = ["GET", "HEAD"];
function transferCacheInterceptorFn(req, next) {
  const _a = inject(CACHE_OPTIONS), {
    isCacheActive
  } = _a, globalOptions = __objRest(_a, [
    "isCacheActive"
  ]);
  const {
    transferCache: requestOptions,
    method: requestMethod
  } = req;
  if (!isCacheActive || // POST requests are allowed either globally or at request level
  requestMethod === "POST" && !globalOptions.includePostRequests && !requestOptions || requestMethod !== "POST" && !ALLOWED_METHODS.includes(requestMethod) || requestOptions === false || //
  globalOptions.filter?.(req) === false) {
    return next(req);
  }
  const transferState = inject(TransferState);
  const storeKey = makeCacheKey(req);
  const response = transferState.get(storeKey, null);
  let headersToInclude = globalOptions.includeHeaders;
  if (typeof requestOptions === "object" && requestOptions.includeHeaders) {
    headersToInclude = requestOptions.includeHeaders;
  }
  if (response) {
    const {
      [BODY]: undecodedBody,
      [RESPONSE_TYPE]: responseType,
      [HEADERS]: httpHeaders,
      [STATUS]: status,
      [STATUS_TEXT]: statusText,
      [URL2]: url
    } = response;
    let body = undecodedBody;
    switch (responseType) {
      case "arraybuffer":
        body = new TextEncoder().encode(undecodedBody).buffer;
        break;
      case "blob":
        body = new Blob([undecodedBody]);
        break;
    }
    let headers = new HttpHeaders(httpHeaders);
    if (typeof ngDevMode === "undefined" || ngDevMode) {
      headers = appendMissingHeadersDetection(req.url, headers, headersToInclude ?? []);
    }
    return of(new HttpResponse({
      body,
      headers,
      status,
      statusText,
      url
    }));
  }
  return next(req).pipe(tap((event) => {
    if (event instanceof HttpResponse) {
      transferState.set(storeKey, {
        [BODY]: event.body,
        [HEADERS]: getFilteredHeaders(event.headers, headersToInclude),
        [STATUS]: event.status,
        [STATUS_TEXT]: event.statusText,
        [URL2]: event.url || "",
        [RESPONSE_TYPE]: req.responseType
      });
    }
  }));
}
function getFilteredHeaders(headers, includeHeaders) {
  if (!includeHeaders) {
    return {};
  }
  const headersMap = {};
  for (const key of includeHeaders) {
    const values = headers.getAll(key);
    if (values !== null) {
      headersMap[key] = values;
    }
  }
  return headersMap;
}
function makeCacheKey(request) {
  const {
    params,
    method,
    responseType,
    url
  } = request;
  const encodedParams = params.keys().sort().map((k) => `${k}=${params.getAll(k)}`).join("&");
  const key = method + "." + responseType + "." + url + "?" + encodedParams;
  const hash = generateHash(key);
  return makeStateKey(hash);
}
function generateHash(value) {
  let hash = 0;
  for (const char of value) {
    hash = Math.imul(31, hash) + char.charCodeAt(0) << 0;
  }
  hash += 2147483647 + 1;
  return hash.toString();
}
function withHttpTransferCache(cacheOptions) {
  return [{
    provide: CACHE_OPTIONS,
    useFactory: () => {
      performanceMarkFeature("NgHttpTransferCache");
      return __spreadValues({
        isCacheActive: true
      }, cacheOptions);
    }
  }, {
    provide: HTTP_ROOT_INTERCEPTOR_FNS,
    useValue: transferCacheInterceptorFn,
    multi: true,
    deps: [TransferState, CACHE_OPTIONS]
  }, {
    provide: APP_BOOTSTRAP_LISTENER,
    multi: true,
    useFactory: () => {
      const appRef = inject(ApplicationRef);
      const cacheState = inject(CACHE_OPTIONS);
      return () => {
        whenStable(appRef).then(() => {
          cacheState.isCacheActive = false;
        });
      };
    }
  }];
}
function appendMissingHeadersDetection(url, headers, headersToInclude) {
  const warningProduced = /* @__PURE__ */ new Set();
  return new Proxy(headers, {
    get(target, prop) {
      const value = Reflect.get(target, prop);
      const methods = /* @__PURE__ */ new Set(["get", "has", "getAll"]);
      if (typeof value !== "function" || !methods.has(prop)) {
        return value;
      }
      return (headerName) => {
        const key = (prop + ":" + headerName).toLowerCase();
        if (!headersToInclude.includes(headerName) && !warningProduced.has(key)) {
          warningProduced.add(key);
          const truncatedUrl = truncateMiddle(url);
          console.warn(formatRuntimeError(2802, `Angular detected that the \`${headerName}\` header is accessed, but the value of the header was not transferred from the server to the client by the HttpTransferCache. To include the value of the \`${headerName}\` header for the \`${truncatedUrl}\` request, use the \`includeHeaders\` list. The \`includeHeaders\` can be defined either on a request level by adding the \`transferCache\` parameter, or on an application level by adding the \`httpCacheTransfer.includeHeaders\` argument to the \`provideClientHydration()\` call. `));
        }
        return value.apply(target, [headerName]);
      };
    }
  });
}

// node_modules/@angular/platform-browser/fesm2022/platform-browser.mjs
var GenericBrowserDomAdapter = class extends DomAdapter {
  constructor() {
    super(...arguments);
    this.supportsDOMEvents = true;
  }
};
var BrowserDomAdapter = class _BrowserDomAdapter extends GenericBrowserDomAdapter {
  static makeCurrent() {
    setRootDomAdapter(new _BrowserDomAdapter());
  }
  onAndCancel(el, evt, listener) {
    el.addEventListener(evt, listener);
    return () => {
      el.removeEventListener(evt, listener);
    };
  }
  dispatchEvent(el, evt) {
    el.dispatchEvent(evt);
  }
  remove(node) {
    if (node.parentNode) {
      node.parentNode.removeChild(node);
    }
  }
  createElement(tagName, doc) {
    doc = doc || this.getDefaultDocument();
    return doc.createElement(tagName);
  }
  createHtmlDocument() {
    return document.implementation.createHTMLDocument("fakeTitle");
  }
  getDefaultDocument() {
    return document;
  }
  isElementNode(node) {
    return node.nodeType === Node.ELEMENT_NODE;
  }
  isShadowRoot(node) {
    return node instanceof DocumentFragment;
  }
  /** @deprecated No longer being used in Ivy code. To be removed in version 14. */
  getGlobalEventTarget(doc, target) {
    if (target === "window") {
      return window;
    }
    if (target === "document") {
      return doc;
    }
    if (target === "body") {
      return doc.body;
    }
    return null;
  }
  getBaseHref(doc) {
    const href = getBaseElementHref();
    return href == null ? null : relativePath(href);
  }
  resetBaseElement() {
    baseElement = null;
  }
  getUserAgent() {
    return window.navigator.userAgent;
  }
  getCookie(name) {
    return parseCookieValue(document.cookie, name);
  }
};
var baseElement = null;
function getBaseElementHref() {
  baseElement = baseElement || document.querySelector("base");
  return baseElement ? baseElement.getAttribute("href") : null;
}
function relativePath(url) {
  return new URL(url, document.baseURI).pathname;
}
var BrowserGetTestability = class {
  addToWindow(registry) {
    _global["getAngularTestability"] = (elem, findInAncestors = true) => {
      const testability = registry.findTestabilityInTree(elem, findInAncestors);
      if (testability == null) {
        throw new RuntimeError(5103, (typeof ngDevMode === "undefined" || ngDevMode) && "Could not find testability for element.");
      }
      return testability;
    };
    _global["getAllAngularTestabilities"] = () => registry.getAllTestabilities();
    _global["getAllAngularRootElements"] = () => registry.getAllRootElements();
    const whenAllStable = (callback) => {
      const testabilities = _global["getAllAngularTestabilities"]();
      let count = testabilities.length;
      const decrement = function() {
        count--;
        if (count == 0) {
          callback();
        }
      };
      testabilities.forEach((testability) => {
        testability.whenStable(decrement);
      });
    };
    if (!_global["frameworkStabilizers"]) {
      _global["frameworkStabilizers"] = [];
    }
    _global["frameworkStabilizers"].push(whenAllStable);
  }
  findTestabilityInTree(registry, elem, findInAncestors) {
    if (elem == null) {
      return null;
    }
    const t = registry.getTestability(elem);
    if (t != null) {
      return t;
    } else if (!findInAncestors) {
      return null;
    }
    if (getDOM().isShadowRoot(elem)) {
      return this.findTestabilityInTree(registry, elem.host, true);
    }
    return this.findTestabilityInTree(registry, elem.parentElement, true);
  }
};
var _BrowserXhr = class _BrowserXhr {
  build() {
    return new XMLHttpRequest();
  }
};
_BrowserXhr.ɵfac = function BrowserXhr_Factory(t) {
  return new (t || _BrowserXhr)();
};
_BrowserXhr.ɵprov = ɵɵdefineInjectable({
  token: _BrowserXhr,
  factory: _BrowserXhr.ɵfac
});
var BrowserXhr = _BrowserXhr;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(BrowserXhr, [{
    type: Injectable
  }], null, null);
})();
var EVENT_MANAGER_PLUGINS = new InjectionToken(ngDevMode ? "EventManagerPlugins" : "");
var _EventManager = class _EventManager {
  /**
   * Initializes an instance of the event-manager service.
   */
  constructor(plugins, _zone) {
    this._zone = _zone;
    this._eventNameToPlugin = /* @__PURE__ */ new Map();
    plugins.forEach((plugin) => {
      plugin.manager = this;
    });
    this._plugins = plugins.slice().reverse();
  }
  /**
   * Registers a handler for a specific element and event.
   *
   * @param element The HTML element to receive event notifications.
   * @param eventName The name of the event to listen for.
   * @param handler A function to call when the notification occurs. Receives the
   * event object as an argument.
   * @returns  A callback function that can be used to remove the handler.
   */
  addEventListener(element, eventName, handler) {
    const plugin = this._findPluginFor(eventName);
    return plugin.addEventListener(element, eventName, handler);
  }
  /**
   * Retrieves the compilation zone in which event listeners are registered.
   */
  getZone() {
    return this._zone;
  }
  /** @internal */
  _findPluginFor(eventName) {
    let plugin = this._eventNameToPlugin.get(eventName);
    if (plugin) {
      return plugin;
    }
    const plugins = this._plugins;
    plugin = plugins.find((plugin2) => plugin2.supports(eventName));
    if (!plugin) {
      throw new RuntimeError(5101, (typeof ngDevMode === "undefined" || ngDevMode) && `No event manager plugin found for event ${eventName}`);
    }
    this._eventNameToPlugin.set(eventName, plugin);
    return plugin;
  }
};
_EventManager.ɵfac = function EventManager_Factory(t) {
  return new (t || _EventManager)(ɵɵinject(EVENT_MANAGER_PLUGINS), ɵɵinject(NgZone));
};
_EventManager.ɵprov = ɵɵdefineInjectable({
  token: _EventManager,
  factory: _EventManager.ɵfac
});
var EventManager = _EventManager;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(EventManager, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [EVENT_MANAGER_PLUGINS]
    }]
  }, {
    type: NgZone
  }], null);
})();
var EventManagerPlugin = class {
  // TODO: remove (has some usage in G3)
  constructor(_doc) {
    this._doc = _doc;
  }
};
var APP_ID_ATTRIBUTE_NAME = "ng-app-id";
var _SharedStylesHost = class _SharedStylesHost {
  constructor(doc, appId, nonce, platformId = {}) {
    this.doc = doc;
    this.appId = appId;
    this.nonce = nonce;
    this.platformId = platformId;
    this.styleRef = /* @__PURE__ */ new Map();
    this.hostNodes = /* @__PURE__ */ new Set();
    this.styleNodesInDOM = this.collectServerRenderedStyles();
    this.platformIsServer = isPlatformServer(platformId);
    this.resetHostNodes();
  }
  addStyles(styles) {
    for (const style of styles) {
      const usageCount = this.changeUsageCount(style, 1);
      if (usageCount === 1) {
        this.onStyleAdded(style);
      }
    }
  }
  removeStyles(styles) {
    for (const style of styles) {
      const usageCount = this.changeUsageCount(style, -1);
      if (usageCount <= 0) {
        this.onStyleRemoved(style);
      }
    }
  }
  ngOnDestroy() {
    const styleNodesInDOM = this.styleNodesInDOM;
    if (styleNodesInDOM) {
      styleNodesInDOM.forEach((node) => node.remove());
      styleNodesInDOM.clear();
    }
    for (const style of this.getAllStyles()) {
      this.onStyleRemoved(style);
    }
    this.resetHostNodes();
  }
  addHost(hostNode) {
    this.hostNodes.add(hostNode);
    for (const style of this.getAllStyles()) {
      this.addStyleToHost(hostNode, style);
    }
  }
  removeHost(hostNode) {
    this.hostNodes.delete(hostNode);
  }
  getAllStyles() {
    return this.styleRef.keys();
  }
  onStyleAdded(style) {
    for (const host of this.hostNodes) {
      this.addStyleToHost(host, style);
    }
  }
  onStyleRemoved(style) {
    const styleRef = this.styleRef;
    styleRef.get(style)?.elements?.forEach((node) => node.remove());
    styleRef.delete(style);
  }
  collectServerRenderedStyles() {
    const styles = this.doc.head?.querySelectorAll(`style[${APP_ID_ATTRIBUTE_NAME}="${this.appId}"]`);
    if (styles?.length) {
      const styleMap = /* @__PURE__ */ new Map();
      styles.forEach((style) => {
        if (style.textContent != null) {
          styleMap.set(style.textContent, style);
        }
      });
      return styleMap;
    }
    return null;
  }
  changeUsageCount(style, delta) {
    const map2 = this.styleRef;
    if (map2.has(style)) {
      const styleRefValue = map2.get(style);
      styleRefValue.usage += delta;
      return styleRefValue.usage;
    }
    map2.set(style, {
      usage: delta,
      elements: []
    });
    return delta;
  }
  getStyleElement(host, style) {
    const styleNodesInDOM = this.styleNodesInDOM;
    const styleEl = styleNodesInDOM?.get(style);
    if (styleEl?.parentNode === host) {
      styleNodesInDOM.delete(style);
      styleEl.removeAttribute(APP_ID_ATTRIBUTE_NAME);
      if (typeof ngDevMode === "undefined" || ngDevMode) {
        styleEl.setAttribute("ng-style-reused", "");
      }
      return styleEl;
    } else {
      const styleEl2 = this.doc.createElement("style");
      if (this.nonce) {
        styleEl2.setAttribute("nonce", this.nonce);
      }
      styleEl2.textContent = style;
      if (this.platformIsServer) {
        styleEl2.setAttribute(APP_ID_ATTRIBUTE_NAME, this.appId);
      }
      host.appendChild(styleEl2);
      return styleEl2;
    }
  }
  addStyleToHost(host, style) {
    const styleEl = this.getStyleElement(host, style);
    const styleRef = this.styleRef;
    const styleElRef = styleRef.get(style)?.elements;
    if (styleElRef) {
      styleElRef.push(styleEl);
    } else {
      styleRef.set(style, {
        elements: [styleEl],
        usage: 1
      });
    }
  }
  resetHostNodes() {
    const hostNodes = this.hostNodes;
    hostNodes.clear();
    hostNodes.add(this.doc.head);
  }
};
_SharedStylesHost.ɵfac = function SharedStylesHost_Factory(t) {
  return new (t || _SharedStylesHost)(ɵɵinject(DOCUMENT), ɵɵinject(APP_ID), ɵɵinject(CSP_NONCE, 8), ɵɵinject(PLATFORM_ID));
};
_SharedStylesHost.ɵprov = ɵɵdefineInjectable({
  token: _SharedStylesHost,
  factory: _SharedStylesHost.ɵfac
});
var SharedStylesHost = _SharedStylesHost;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(SharedStylesHost, [{
    type: Injectable
  }], () => [{
    type: Document,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [APP_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [CSP_NONCE]
    }, {
      type: Optional
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [PLATFORM_ID]
    }]
  }], null);
})();
var NAMESPACE_URIS = {
  "svg": "http://www.w3.org/2000/svg",
  "xhtml": "http://www.w3.org/1999/xhtml",
  "xlink": "http://www.w3.org/1999/xlink",
  "xml": "http://www.w3.org/XML/1998/namespace",
  "xmlns": "http://www.w3.org/2000/xmlns/",
  "math": "http://www.w3.org/1998/MathML/"
};
var COMPONENT_REGEX = /%COMP%/g;
var COMPONENT_VARIABLE = "%COMP%";
var HOST_ATTR = `_nghost-${COMPONENT_VARIABLE}`;
var CONTENT_ATTR = `_ngcontent-${COMPONENT_VARIABLE}`;
var REMOVE_STYLES_ON_COMPONENT_DESTROY_DEFAULT = true;
var REMOVE_STYLES_ON_COMPONENT_DESTROY = new InjectionToken(ngDevMode ? "RemoveStylesOnCompDestroy" : "", {
  providedIn: "root",
  factory: () => REMOVE_STYLES_ON_COMPONENT_DESTROY_DEFAULT
});
function shimContentAttribute(componentShortId) {
  return CONTENT_ATTR.replace(COMPONENT_REGEX, componentShortId);
}
function shimHostAttribute(componentShortId) {
  return HOST_ATTR.replace(COMPONENT_REGEX, componentShortId);
}
function shimStylesContent(compId, styles) {
  return styles.map((s) => s.replace(COMPONENT_REGEX, compId));
}
var _DomRendererFactory2 = class _DomRendererFactory2 {
  constructor(eventManager, sharedStylesHost, appId, removeStylesOnCompDestroy, doc, platformId, ngZone, nonce = null) {
    this.eventManager = eventManager;
    this.sharedStylesHost = sharedStylesHost;
    this.appId = appId;
    this.removeStylesOnCompDestroy = removeStylesOnCompDestroy;
    this.doc = doc;
    this.platformId = platformId;
    this.ngZone = ngZone;
    this.nonce = nonce;
    this.rendererByCompId = /* @__PURE__ */ new Map();
    this.platformIsServer = isPlatformServer(platformId);
    this.defaultRenderer = new DefaultDomRenderer2(eventManager, doc, ngZone, this.platformIsServer);
  }
  createRenderer(element, type) {
    if (!element || !type) {
      return this.defaultRenderer;
    }
    if (this.platformIsServer && type.encapsulation === ViewEncapsulation$1.ShadowDom) {
      type = __spreadProps(__spreadValues({}, type), {
        encapsulation: ViewEncapsulation$1.Emulated
      });
    }
    const renderer = this.getOrCreateRenderer(element, type);
    if (renderer instanceof EmulatedEncapsulationDomRenderer2) {
      renderer.applyToHost(element);
    } else if (renderer instanceof NoneEncapsulationDomRenderer) {
      renderer.applyStyles();
    }
    return renderer;
  }
  getOrCreateRenderer(element, type) {
    const rendererByCompId = this.rendererByCompId;
    let renderer = rendererByCompId.get(type.id);
    if (!renderer) {
      const doc = this.doc;
      const ngZone = this.ngZone;
      const eventManager = this.eventManager;
      const sharedStylesHost = this.sharedStylesHost;
      const removeStylesOnCompDestroy = this.removeStylesOnCompDestroy;
      const platformIsServer = this.platformIsServer;
      switch (type.encapsulation) {
        case ViewEncapsulation$1.Emulated:
          renderer = new EmulatedEncapsulationDomRenderer2(eventManager, sharedStylesHost, type, this.appId, removeStylesOnCompDestroy, doc, ngZone, platformIsServer);
          break;
        case ViewEncapsulation$1.ShadowDom:
          return new ShadowDomRenderer(eventManager, sharedStylesHost, element, type, doc, ngZone, this.nonce, platformIsServer);
        default:
          renderer = new NoneEncapsulationDomRenderer(eventManager, sharedStylesHost, type, removeStylesOnCompDestroy, doc, ngZone, platformIsServer);
          break;
      }
      rendererByCompId.set(type.id, renderer);
    }
    return renderer;
  }
  ngOnDestroy() {
    this.rendererByCompId.clear();
  }
};
_DomRendererFactory2.ɵfac = function DomRendererFactory2_Factory(t) {
  return new (t || _DomRendererFactory2)(ɵɵinject(EventManager), ɵɵinject(SharedStylesHost), ɵɵinject(APP_ID), ɵɵinject(REMOVE_STYLES_ON_COMPONENT_DESTROY), ɵɵinject(DOCUMENT), ɵɵinject(PLATFORM_ID), ɵɵinject(NgZone), ɵɵinject(CSP_NONCE));
};
_DomRendererFactory2.ɵprov = ɵɵdefineInjectable({
  token: _DomRendererFactory2,
  factory: _DomRendererFactory2.ɵfac
});
var DomRendererFactory2 = _DomRendererFactory2;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomRendererFactory2, [{
    type: Injectable
  }], () => [{
    type: EventManager
  }, {
    type: SharedStylesHost
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [APP_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [REMOVE_STYLES_ON_COMPONENT_DESTROY]
    }]
  }, {
    type: Document,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: Object,
    decorators: [{
      type: Inject,
      args: [PLATFORM_ID]
    }]
  }, {
    type: NgZone
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [CSP_NONCE]
    }]
  }], null);
})();
var DefaultDomRenderer2 = class {
  constructor(eventManager, doc, ngZone, platformIsServer) {
    this.eventManager = eventManager;
    this.doc = doc;
    this.ngZone = ngZone;
    this.platformIsServer = platformIsServer;
    this.data = /* @__PURE__ */ Object.create(null);
    this.throwOnSyntheticProps = true;
    this.destroyNode = null;
  }
  destroy() {
  }
  createElement(name, namespace) {
    if (namespace) {
      return this.doc.createElementNS(NAMESPACE_URIS[namespace] || namespace, name);
    }
    return this.doc.createElement(name);
  }
  createComment(value) {
    return this.doc.createComment(value);
  }
  createText(value) {
    return this.doc.createTextNode(value);
  }
  appendChild(parent, newChild) {
    const targetParent = isTemplateNode(parent) ? parent.content : parent;
    targetParent.appendChild(newChild);
  }
  insertBefore(parent, newChild, refChild) {
    if (parent) {
      const targetParent = isTemplateNode(parent) ? parent.content : parent;
      targetParent.insertBefore(newChild, refChild);
    }
  }
  removeChild(parent, oldChild) {
    if (parent) {
      parent.removeChild(oldChild);
    }
  }
  selectRootElement(selectorOrNode, preserveContent) {
    let el = typeof selectorOrNode === "string" ? this.doc.querySelector(selectorOrNode) : selectorOrNode;
    if (!el) {
      throw new RuntimeError(-5104, (typeof ngDevMode === "undefined" || ngDevMode) && `The selector "${selectorOrNode}" did not match any elements`);
    }
    if (!preserveContent) {
      el.textContent = "";
    }
    return el;
  }
  parentNode(node) {
    return node.parentNode;
  }
  nextSibling(node) {
    return node.nextSibling;
  }
  setAttribute(el, name, value, namespace) {
    if (namespace) {
      name = namespace + ":" + name;
      const namespaceUri = NAMESPACE_URIS[namespace];
      if (namespaceUri) {
        el.setAttributeNS(namespaceUri, name, value);
      } else {
        el.setAttribute(name, value);
      }
    } else {
      el.setAttribute(name, value);
    }
  }
  removeAttribute(el, name, namespace) {
    if (namespace) {
      const namespaceUri = NAMESPACE_URIS[namespace];
      if (namespaceUri) {
        el.removeAttributeNS(namespaceUri, name);
      } else {
        el.removeAttribute(`${namespace}:${name}`);
      }
    } else {
      el.removeAttribute(name);
    }
  }
  addClass(el, name) {
    el.classList.add(name);
  }
  removeClass(el, name) {
    el.classList.remove(name);
  }
  setStyle(el, style, value, flags) {
    if (flags & (RendererStyleFlags2.DashCase | RendererStyleFlags2.Important)) {
      el.style.setProperty(style, value, flags & RendererStyleFlags2.Important ? "important" : "");
    } else {
      el.style[style] = value;
    }
  }
  removeStyle(el, style, flags) {
    if (flags & RendererStyleFlags2.DashCase) {
      el.style.removeProperty(style);
    } else {
      el.style[style] = "";
    }
  }
  setProperty(el, name, value) {
    if (el == null) {
      return;
    }
    (typeof ngDevMode === "undefined" || ngDevMode) && this.throwOnSyntheticProps && checkNoSyntheticProp(name, "property");
    el[name] = value;
  }
  setValue(node, value) {
    node.nodeValue = value;
  }
  listen(target, event, callback) {
    (typeof ngDevMode === "undefined" || ngDevMode) && this.throwOnSyntheticProps && checkNoSyntheticProp(event, "listener");
    if (typeof target === "string") {
      target = getDOM().getGlobalEventTarget(this.doc, target);
      if (!target) {
        throw new Error(`Unsupported event target ${target} for event ${event}`);
      }
    }
    return this.eventManager.addEventListener(target, event, this.decoratePreventDefault(callback));
  }
  decoratePreventDefault(eventHandler) {
    return (event) => {
      if (event === "__ngUnwrap__") {
        return eventHandler;
      }
      const allowDefaultBehavior = this.platformIsServer ? this.ngZone.runGuarded(() => eventHandler(event)) : eventHandler(event);
      if (allowDefaultBehavior === false) {
        event.preventDefault();
      }
      return void 0;
    };
  }
};
var AT_CHARCODE = (() => "@".charCodeAt(0))();
function checkNoSyntheticProp(name, nameKind) {
  if (name.charCodeAt(0) === AT_CHARCODE) {
    throw new RuntimeError(5105, `Unexpected synthetic ${nameKind} ${name} found. Please make sure that:
  - Either \`BrowserAnimationsModule\` or \`NoopAnimationsModule\` are imported in your application.
  - There is corresponding configuration for the animation named \`${name}\` defined in the \`animations\` field of the \`@Component\` decorator (see https://angular.io/api/core/Component#animations).`);
  }
}
function isTemplateNode(node) {
  return node.tagName === "TEMPLATE" && node.content !== void 0;
}
var ShadowDomRenderer = class extends DefaultDomRenderer2 {
  constructor(eventManager, sharedStylesHost, hostEl, component, doc, ngZone, nonce, platformIsServer) {
    super(eventManager, doc, ngZone, platformIsServer);
    this.sharedStylesHost = sharedStylesHost;
    this.hostEl = hostEl;
    this.shadowRoot = hostEl.attachShadow({
      mode: "open"
    });
    this.sharedStylesHost.addHost(this.shadowRoot);
    const styles = shimStylesContent(component.id, component.styles);
    for (const style of styles) {
      const styleEl = document.createElement("style");
      if (nonce) {
        styleEl.setAttribute("nonce", nonce);
      }
      styleEl.textContent = style;
      this.shadowRoot.appendChild(styleEl);
    }
  }
  nodeOrShadowRoot(node) {
    return node === this.hostEl ? this.shadowRoot : node;
  }
  appendChild(parent, newChild) {
    return super.appendChild(this.nodeOrShadowRoot(parent), newChild);
  }
  insertBefore(parent, newChild, refChild) {
    return super.insertBefore(this.nodeOrShadowRoot(parent), newChild, refChild);
  }
  removeChild(parent, oldChild) {
    return super.removeChild(this.nodeOrShadowRoot(parent), oldChild);
  }
  parentNode(node) {
    return this.nodeOrShadowRoot(super.parentNode(this.nodeOrShadowRoot(node)));
  }
  destroy() {
    this.sharedStylesHost.removeHost(this.shadowRoot);
  }
};
var NoneEncapsulationDomRenderer = class extends DefaultDomRenderer2 {
  constructor(eventManager, sharedStylesHost, component, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, compId) {
    super(eventManager, doc, ngZone, platformIsServer);
    this.sharedStylesHost = sharedStylesHost;
    this.removeStylesOnCompDestroy = removeStylesOnCompDestroy;
    this.styles = compId ? shimStylesContent(compId, component.styles) : component.styles;
  }
  applyStyles() {
    this.sharedStylesHost.addStyles(this.styles);
  }
  destroy() {
    if (!this.removeStylesOnCompDestroy) {
      return;
    }
    this.sharedStylesHost.removeStyles(this.styles);
  }
};
var EmulatedEncapsulationDomRenderer2 = class extends NoneEncapsulationDomRenderer {
  constructor(eventManager, sharedStylesHost, component, appId, removeStylesOnCompDestroy, doc, ngZone, platformIsServer) {
    const compId = appId + "-" + component.id;
    super(eventManager, sharedStylesHost, component, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, compId);
    this.contentAttr = shimContentAttribute(compId);
    this.hostAttr = shimHostAttribute(compId);
  }
  applyToHost(element) {
    this.applyStyles();
    this.setAttribute(element, this.hostAttr, "");
  }
  createElement(parent, name) {
    const el = super.createElement(parent, name);
    super.setAttribute(el, this.contentAttr, "");
    return el;
  }
};
var _DomEventsPlugin = class _DomEventsPlugin extends EventManagerPlugin {
  constructor(doc) {
    super(doc);
  }
  // This plugin should come last in the list of plugins, because it accepts all
  // events.
  supports(eventName) {
    return true;
  }
  addEventListener(element, eventName, handler) {
    element.addEventListener(eventName, handler, false);
    return () => this.removeEventListener(element, eventName, handler);
  }
  removeEventListener(target, eventName, callback) {
    return target.removeEventListener(eventName, callback);
  }
};
_DomEventsPlugin.ɵfac = function DomEventsPlugin_Factory(t) {
  return new (t || _DomEventsPlugin)(ɵɵinject(DOCUMENT));
};
_DomEventsPlugin.ɵprov = ɵɵdefineInjectable({
  token: _DomEventsPlugin,
  factory: _DomEventsPlugin.ɵfac
});
var DomEventsPlugin = _DomEventsPlugin;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomEventsPlugin, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var MODIFIER_KEYS = ["alt", "control", "meta", "shift"];
var _keyMap = {
  "\b": "Backspace",
  "	": "Tab",
  "": "Delete",
  "\x1B": "Escape",
  "Del": "Delete",
  "Esc": "Escape",
  "Left": "ArrowLeft",
  "Right": "ArrowRight",
  "Up": "ArrowUp",
  "Down": "ArrowDown",
  "Menu": "ContextMenu",
  "Scroll": "ScrollLock",
  "Win": "OS"
};
var MODIFIER_KEY_GETTERS = {
  "alt": (event) => event.altKey,
  "control": (event) => event.ctrlKey,
  "meta": (event) => event.metaKey,
  "shift": (event) => event.shiftKey
};
var _KeyEventsPlugin = class _KeyEventsPlugin extends EventManagerPlugin {
  /**
   * Initializes an instance of the browser plug-in.
   * @param doc The document in which key events will be detected.
   */
  constructor(doc) {
    super(doc);
  }
  /**
   * Reports whether a named key event is supported.
   * @param eventName The event name to query.
   * @return True if the named key event is supported.
   */
  supports(eventName) {
    return _KeyEventsPlugin.parseEventName(eventName) != null;
  }
  /**
   * Registers a handler for a specific element and key event.
   * @param element The HTML element to receive event notifications.
   * @param eventName The name of the key event to listen for.
   * @param handler A function to call when the notification occurs. Receives the
   * event object as an argument.
   * @returns The key event that was registered.
   */
  addEventListener(element, eventName, handler) {
    const parsedEvent = _KeyEventsPlugin.parseEventName(eventName);
    const outsideHandler = _KeyEventsPlugin.eventCallback(parsedEvent["fullKey"], handler, this.manager.getZone());
    return this.manager.getZone().runOutsideAngular(() => {
      return getDOM().onAndCancel(element, parsedEvent["domEventName"], outsideHandler);
    });
  }
  /**
   * Parses the user provided full keyboard event definition and normalizes it for
   * later internal use. It ensures the string is all lowercase, converts special
   * characters to a standard spelling, and orders all the values consistently.
   *
   * @param eventName The name of the key event to listen for.
   * @returns an object with the full, normalized string, and the dom event name
   * or null in the case when the event doesn't match a keyboard event.
   */
  static parseEventName(eventName) {
    const parts = eventName.toLowerCase().split(".");
    const domEventName = parts.shift();
    if (parts.length === 0 || !(domEventName === "keydown" || domEventName === "keyup")) {
      return null;
    }
    const key = _KeyEventsPlugin._normalizeKey(parts.pop());
    let fullKey = "";
    let codeIX = parts.indexOf("code");
    if (codeIX > -1) {
      parts.splice(codeIX, 1);
      fullKey = "code.";
    }
    MODIFIER_KEYS.forEach((modifierName) => {
      const index = parts.indexOf(modifierName);
      if (index > -1) {
        parts.splice(index, 1);
        fullKey += modifierName + ".";
      }
    });
    fullKey += key;
    if (parts.length != 0 || key.length === 0) {
      return null;
    }
    const result = {};
    result["domEventName"] = domEventName;
    result["fullKey"] = fullKey;
    return result;
  }
  /**
   * Determines whether the actual keys pressed match the configured key code string.
   * The `fullKeyCode` event is normalized in the `parseEventName` method when the
   * event is attached to the DOM during the `addEventListener` call. This is unseen
   * by the end user and is normalized for internal consistency and parsing.
   *
   * @param event The keyboard event.
   * @param fullKeyCode The normalized user defined expected key event string
   * @returns boolean.
   */
  static matchEventFullKeyCode(event, fullKeyCode) {
    let keycode = _keyMap[event.key] || event.key;
    let key = "";
    if (fullKeyCode.indexOf("code.") > -1) {
      keycode = event.code;
      key = "code.";
    }
    if (keycode == null || !keycode)
      return false;
    keycode = keycode.toLowerCase();
    if (keycode === " ") {
      keycode = "space";
    } else if (keycode === ".") {
      keycode = "dot";
    }
    MODIFIER_KEYS.forEach((modifierName) => {
      if (modifierName !== keycode) {
        const modifierGetter = MODIFIER_KEY_GETTERS[modifierName];
        if (modifierGetter(event)) {
          key += modifierName + ".";
        }
      }
    });
    key += keycode;
    return key === fullKeyCode;
  }
  /**
   * Configures a handler callback for a key event.
   * @param fullKey The event name that combines all simultaneous keystrokes.
   * @param handler The function that responds to the key event.
   * @param zone The zone in which the event occurred.
   * @returns A callback function.
   */
  static eventCallback(fullKey, handler, zone) {
    return (event) => {
      if (_KeyEventsPlugin.matchEventFullKeyCode(event, fullKey)) {
        zone.runGuarded(() => handler(event));
      }
    };
  }
  /** @internal */
  static _normalizeKey(keyName) {
    return keyName === "esc" ? "escape" : keyName;
  }
};
_KeyEventsPlugin.ɵfac = function KeyEventsPlugin_Factory(t) {
  return new (t || _KeyEventsPlugin)(ɵɵinject(DOCUMENT));
};
_KeyEventsPlugin.ɵprov = ɵɵdefineInjectable({
  token: _KeyEventsPlugin,
  factory: _KeyEventsPlugin.ɵfac
});
var KeyEventsPlugin = _KeyEventsPlugin;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(KeyEventsPlugin, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
function bootstrapApplication(rootComponent, options) {
  return internalCreateApplication(__spreadValues({
    rootComponent
  }, createProvidersConfig(options)));
}
function createApplication(options) {
  return internalCreateApplication(createProvidersConfig(options));
}
function createProvidersConfig(options) {
  return {
    appProviders: [...BROWSER_MODULE_PROVIDERS, ...options?.providers ?? []],
    platformProviders: INTERNAL_BROWSER_PLATFORM_PROVIDERS
  };
}
function provideProtractorTestingSupport() {
  return [...TESTABILITY_PROVIDERS];
}
function initDomAdapter() {
  BrowserDomAdapter.makeCurrent();
}
function errorHandler() {
  return new ErrorHandler();
}
function _document() {
  setDocument(document);
  return document;
}
var INTERNAL_BROWSER_PLATFORM_PROVIDERS = [{
  provide: PLATFORM_ID,
  useValue: PLATFORM_BROWSER_ID
}, {
  provide: PLATFORM_INITIALIZER,
  useValue: initDomAdapter,
  multi: true
}, {
  provide: DOCUMENT,
  useFactory: _document,
  deps: []
}];
var platformBrowser = createPlatformFactory(platformCore, "browser", INTERNAL_BROWSER_PLATFORM_PROVIDERS);
var BROWSER_MODULE_PROVIDERS_MARKER = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "BrowserModule Providers Marker" : "");
var TESTABILITY_PROVIDERS = [{
  provide: TESTABILITY_GETTER,
  useClass: BrowserGetTestability,
  deps: []
}, {
  provide: TESTABILITY,
  useClass: Testability,
  deps: [NgZone, TestabilityRegistry, TESTABILITY_GETTER]
}, {
  provide: Testability,
  // Also provide as `Testability` for backwards-compatibility.
  useClass: Testability,
  deps: [NgZone, TestabilityRegistry, TESTABILITY_GETTER]
}];
var BROWSER_MODULE_PROVIDERS = [{
  provide: INJECTOR_SCOPE,
  useValue: "root"
}, {
  provide: ErrorHandler,
  useFactory: errorHandler,
  deps: []
}, {
  provide: EVENT_MANAGER_PLUGINS,
  useClass: DomEventsPlugin,
  multi: true,
  deps: [DOCUMENT, NgZone, PLATFORM_ID]
}, {
  provide: EVENT_MANAGER_PLUGINS,
  useClass: KeyEventsPlugin,
  multi: true,
  deps: [DOCUMENT]
}, DomRendererFactory2, SharedStylesHost, EventManager, {
  provide: RendererFactory2,
  useExisting: DomRendererFactory2
}, {
  provide: XhrFactory,
  useClass: BrowserXhr,
  deps: []
}, typeof ngDevMode === "undefined" || ngDevMode ? {
  provide: BROWSER_MODULE_PROVIDERS_MARKER,
  useValue: true
} : []];
var _BrowserModule = class _BrowserModule {
  constructor(providersAlreadyPresent) {
    if ((typeof ngDevMode === "undefined" || ngDevMode) && providersAlreadyPresent) {
      throw new RuntimeError(5100, `Providers from the \`BrowserModule\` have already been loaded. If you need access to common directives such as NgIf and NgFor, import the \`CommonModule\` instead.`);
    }
  }
  /**
   * Configures a browser-based app to transition from a server-rendered app, if
   * one is present on the page.
   *
   * @param params An object containing an identifier for the app to transition.
   * The ID must match between the client and server versions of the app.
   * @returns The reconfigured `BrowserModule` to import into the app's root `AppModule`.
   *
   * @deprecated Use {@link APP_ID} instead to set the application ID.
   */
  static withServerTransition(params) {
    return {
      ngModule: _BrowserModule,
      providers: [{
        provide: APP_ID,
        useValue: params.appId
      }]
    };
  }
};
_BrowserModule.ɵfac = function BrowserModule_Factory(t) {
  return new (t || _BrowserModule)(ɵɵinject(BROWSER_MODULE_PROVIDERS_MARKER, 12));
};
_BrowserModule.ɵmod = ɵɵdefineNgModule({
  type: _BrowserModule,
  exports: [CommonModule, ApplicationModule]
});
_BrowserModule.ɵinj = ɵɵdefineInjector({
  providers: [...BROWSER_MODULE_PROVIDERS, ...TESTABILITY_PROVIDERS],
  imports: [CommonModule, ApplicationModule]
});
var BrowserModule = _BrowserModule;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(BrowserModule, [{
    type: NgModule,
    args: [{
      providers: [...BROWSER_MODULE_PROVIDERS, ...TESTABILITY_PROVIDERS],
      exports: [CommonModule, ApplicationModule]
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: SkipSelf
    }, {
      type: Inject,
      args: [BROWSER_MODULE_PROVIDERS_MARKER]
    }]
  }], null);
})();
var _Meta = class _Meta {
  constructor(_doc) {
    this._doc = _doc;
    this._dom = getDOM();
  }
  /**
   * Retrieves or creates a specific `<meta>` tag element in the current HTML document.
   * In searching for an existing tag, Angular attempts to match the `name` or `property` attribute
   * values in the provided tag definition, and verifies that all other attribute values are equal.
   * If an existing element is found, it is returned and is not modified in any way.
   * @param tag The definition of a `<meta>` element to match or create.
   * @param forceCreation True to create a new element without checking whether one already exists.
   * @returns The existing element with the same attributes and values if found,
   * the new element if no match is found, or `null` if the tag parameter is not defined.
   */
  addTag(tag, forceCreation = false) {
    if (!tag)
      return null;
    return this._getOrCreateElement(tag, forceCreation);
  }
  /**
   * Retrieves or creates a set of `<meta>` tag elements in the current HTML document.
   * In searching for an existing tag, Angular attempts to match the `name` or `property` attribute
   * values in the provided tag definition, and verifies that all other attribute values are equal.
   * @param tags An array of tag definitions to match or create.
   * @param forceCreation True to create new elements without checking whether they already exist.
   * @returns The matching elements if found, or the new elements.
   */
  addTags(tags, forceCreation = false) {
    if (!tags)
      return [];
    return tags.reduce((result, tag) => {
      if (tag) {
        result.push(this._getOrCreateElement(tag, forceCreation));
      }
      return result;
    }, []);
  }
  /**
   * Retrieves a `<meta>` tag element in the current HTML document.
   * @param attrSelector The tag attribute and value to match against, in the format
   * `"tag_attribute='value string'"`.
   * @returns The matching element, if any.
   */
  getTag(attrSelector) {
    if (!attrSelector)
      return null;
    return this._doc.querySelector(`meta[${attrSelector}]`) || null;
  }
  /**
   * Retrieves a set of `<meta>` tag elements in the current HTML document.
   * @param attrSelector The tag attribute and value to match against, in the format
   * `"tag_attribute='value string'"`.
   * @returns The matching elements, if any.
   */
  getTags(attrSelector) {
    if (!attrSelector)
      return [];
    const list = this._doc.querySelectorAll(`meta[${attrSelector}]`);
    return list ? [].slice.call(list) : [];
  }
  /**
   * Modifies an existing `<meta>` tag element in the current HTML document.
   * @param tag The tag description with which to replace the existing tag content.
   * @param selector A tag attribute and value to match against, to identify
   * an existing tag. A string in the format `"tag_attribute=`value string`"`.
   * If not supplied, matches a tag with the same `name` or `property` attribute value as the
   * replacement tag.
   * @return The modified element.
   */
  updateTag(tag, selector) {
    if (!tag)
      return null;
    selector = selector || this._parseSelector(tag);
    const meta = this.getTag(selector);
    if (meta) {
      return this._setMetaElementAttributes(tag, meta);
    }
    return this._getOrCreateElement(tag, true);
  }
  /**
   * Removes an existing `<meta>` tag element from the current HTML document.
   * @param attrSelector A tag attribute and value to match against, to identify
   * an existing tag. A string in the format `"tag_attribute=`value string`"`.
   */
  removeTag(attrSelector) {
    this.removeTagElement(this.getTag(attrSelector));
  }
  /**
   * Removes an existing `<meta>` tag element from the current HTML document.
   * @param meta The tag definition to match against to identify an existing tag.
   */
  removeTagElement(meta) {
    if (meta) {
      this._dom.remove(meta);
    }
  }
  _getOrCreateElement(meta, forceCreation = false) {
    if (!forceCreation) {
      const selector = this._parseSelector(meta);
      const elem = this.getTags(selector).filter((elem2) => this._containsAttributes(meta, elem2))[0];
      if (elem !== void 0)
        return elem;
    }
    const element = this._dom.createElement("meta");
    this._setMetaElementAttributes(meta, element);
    const head = this._doc.getElementsByTagName("head")[0];
    head.appendChild(element);
    return element;
  }
  _setMetaElementAttributes(tag, el) {
    Object.keys(tag).forEach((prop) => el.setAttribute(this._getMetaKeyMap(prop), tag[prop]));
    return el;
  }
  _parseSelector(tag) {
    const attr = tag.name ? "name" : "property";
    return `${attr}="${tag[attr]}"`;
  }
  _containsAttributes(tag, elem) {
    return Object.keys(tag).every((key) => elem.getAttribute(this._getMetaKeyMap(key)) === tag[key]);
  }
  _getMetaKeyMap(prop) {
    return META_KEYS_MAP[prop] || prop;
  }
};
_Meta.ɵfac = function Meta_Factory(t) {
  return new (t || _Meta)(ɵɵinject(DOCUMENT));
};
_Meta.ɵprov = ɵɵdefineInjectable({
  token: _Meta,
  factory: _Meta.ɵfac,
  providedIn: "root"
});
var Meta = _Meta;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Meta, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var META_KEYS_MAP = {
  httpEquiv: "http-equiv"
};
var _Title = class _Title {
  constructor(_doc) {
    this._doc = _doc;
  }
  /**
   * Get the title of the current HTML document.
   */
  getTitle() {
    return this._doc.title;
  }
  /**
   * Set the title of the current HTML document.
   * @param newTitle
   */
  setTitle(newTitle) {
    this._doc.title = newTitle || "";
  }
};
_Title.ɵfac = function Title_Factory(t) {
  return new (t || _Title)(ɵɵinject(DOCUMENT));
};
_Title.ɵprov = ɵɵdefineInjectable({
  token: _Title,
  factory: _Title.ɵfac,
  providedIn: "root"
});
var Title = _Title;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Title, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
function exportNgVar(name, value) {
  if (typeof COMPILED === "undefined" || !COMPILED) {
    const ng = _global["ng"] = _global["ng"] || {};
    ng[name] = value;
  }
}
var ChangeDetectionPerfRecord = class {
  constructor(msPerTick, numTicks) {
    this.msPerTick = msPerTick;
    this.numTicks = numTicks;
  }
};
var AngularProfiler = class {
  constructor(ref) {
    this.appRef = ref.injector.get(ApplicationRef);
  }
  // tslint:disable:no-console
  /**
   * Exercises change detection in a loop and then prints the average amount of
   * time in milliseconds how long a single round of change detection takes for
   * the current state of the UI. It runs a minimum of 5 rounds for a minimum
   * of 500 milliseconds.
   *
   * Optionally, a user may pass a `config` parameter containing a map of
   * options. Supported options are:
   *
   * `record` (boolean) - causes the profiler to record a CPU profile while
   * it exercises the change detector. Example:
   *
   * ```
   * ng.profiler.timeChangeDetection({record: true})
   * ```
   */
  timeChangeDetection(config) {
    const record = config && config["record"];
    const profileName = "Change Detection";
    if (record && "profile" in console && typeof console.profile === "function") {
      console.profile(profileName);
    }
    const start = performance.now();
    let numTicks = 0;
    while (numTicks < 5 || performance.now() - start < 500) {
      this.appRef.tick();
      numTicks++;
    }
    const end = performance.now();
    if (record && "profileEnd" in console && typeof console.profileEnd === "function") {
      console.profileEnd(profileName);
    }
    const msPerTick = (end - start) / numTicks;
    console.log(`ran ${numTicks} change detection cycles`);
    console.log(`${msPerTick.toFixed(2)} ms per check`);
    return new ChangeDetectionPerfRecord(msPerTick, numTicks);
  }
};
var PROFILER_GLOBAL_NAME = "profiler";
function enableDebugTools(ref) {
  exportNgVar(PROFILER_GLOBAL_NAME, new AngularProfiler(ref));
  return ref;
}
function disableDebugTools() {
  exportNgVar(PROFILER_GLOBAL_NAME, null);
}
var By = class {
  /**
   * Match all nodes.
   *
   * @usageNotes
   * ### Example
   *
   * {@example platform-browser/dom/debug/ts/by/by.ts region='by_all'}
   */
  static all() {
    return () => true;
  }
  /**
   * Match elements by the given CSS selector.
   *
   * @usageNotes
   * ### Example
   *
   * {@example platform-browser/dom/debug/ts/by/by.ts region='by_css'}
   */
  static css(selector) {
    return (debugElement) => {
      return debugElement.nativeElement != null ? elementMatches(debugElement.nativeElement, selector) : false;
    };
  }
  /**
   * Match nodes that have the given directive present.
   *
   * @usageNotes
   * ### Example
   *
   * {@example platform-browser/dom/debug/ts/by/by.ts region='by_directive'}
   */
  static directive(type) {
    return (debugNode) => debugNode.providerTokens.indexOf(type) !== -1;
  }
};
function elementMatches(n, selector) {
  if (getDOM().isElementNode(n)) {
    return n.matches && n.matches(selector) || n.msMatchesSelector && n.msMatchesSelector(selector) || n.webkitMatchesSelector && n.webkitMatchesSelector(selector);
  }
  return false;
}
var EVENT_NAMES = {
  // pan
  "pan": true,
  "panstart": true,
  "panmove": true,
  "panend": true,
  "pancancel": true,
  "panleft": true,
  "panright": true,
  "panup": true,
  "pandown": true,
  // pinch
  "pinch": true,
  "pinchstart": true,
  "pinchmove": true,
  "pinchend": true,
  "pinchcancel": true,
  "pinchin": true,
  "pinchout": true,
  // press
  "press": true,
  "pressup": true,
  // rotate
  "rotate": true,
  "rotatestart": true,
  "rotatemove": true,
  "rotateend": true,
  "rotatecancel": true,
  // swipe
  "swipe": true,
  "swipeleft": true,
  "swiperight": true,
  "swipeup": true,
  "swipedown": true,
  // tap
  "tap": true,
  "doubletap": true
};
var HAMMER_GESTURE_CONFIG = new InjectionToken("HammerGestureConfig");
var HAMMER_LOADER = new InjectionToken("HammerLoader");
var _HammerGestureConfig = class _HammerGestureConfig {
  constructor() {
    this.events = [];
    this.overrides = {};
  }
  /**
   * Creates a [HammerJS Manager](https://hammerjs.github.io/api/#hammermanager)
   * and attaches it to a given HTML element.
   * @param element The element that will recognize gestures.
   * @returns A HammerJS event-manager object.
   */
  buildHammer(element) {
    const mc = new Hammer(element, this.options);
    mc.get("pinch").set({
      enable: true
    });
    mc.get("rotate").set({
      enable: true
    });
    for (const eventName in this.overrides) {
      mc.get(eventName).set(this.overrides[eventName]);
    }
    return mc;
  }
};
_HammerGestureConfig.ɵfac = function HammerGestureConfig_Factory(t) {
  return new (t || _HammerGestureConfig)();
};
_HammerGestureConfig.ɵprov = ɵɵdefineInjectable({
  token: _HammerGestureConfig,
  factory: _HammerGestureConfig.ɵfac
});
var HammerGestureConfig = _HammerGestureConfig;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HammerGestureConfig, [{
    type: Injectable
  }], null, null);
})();
var _HammerGesturesPlugin = class _HammerGesturesPlugin extends EventManagerPlugin {
  constructor(doc, _config, console2, loader) {
    super(doc);
    this._config = _config;
    this.console = console2;
    this.loader = loader;
    this._loaderPromise = null;
  }
  supports(eventName) {
    if (!EVENT_NAMES.hasOwnProperty(eventName.toLowerCase()) && !this.isCustomEvent(eventName)) {
      return false;
    }
    if (!window.Hammer && !this.loader) {
      if (typeof ngDevMode === "undefined" || ngDevMode) {
        this.console.warn(`The "${eventName}" event cannot be bound because Hammer.JS is not loaded and no custom loader has been specified.`);
      }
      return false;
    }
    return true;
  }
  addEventListener(element, eventName, handler) {
    const zone = this.manager.getZone();
    eventName = eventName.toLowerCase();
    if (!window.Hammer && this.loader) {
      this._loaderPromise = this._loaderPromise || zone.runOutsideAngular(() => this.loader());
      let cancelRegistration = false;
      let deregister = () => {
        cancelRegistration = true;
      };
      zone.runOutsideAngular(() => this._loaderPromise.then(() => {
        if (!window.Hammer) {
          if (typeof ngDevMode === "undefined" || ngDevMode) {
            this.console.warn(`The custom HAMMER_LOADER completed, but Hammer.JS is not present.`);
          }
          deregister = () => {
          };
          return;
        }
        if (!cancelRegistration) {
          deregister = this.addEventListener(element, eventName, handler);
        }
      }).catch(() => {
        if (typeof ngDevMode === "undefined" || ngDevMode) {
          this.console.warn(`The "${eventName}" event cannot be bound because the custom Hammer.JS loader failed.`);
        }
        deregister = () => {
        };
      }));
      return () => {
        deregister();
      };
    }
    return zone.runOutsideAngular(() => {
      const mc = this._config.buildHammer(element);
      const callback = function(eventObj) {
        zone.runGuarded(function() {
          handler(eventObj);
        });
      };
      mc.on(eventName, callback);
      return () => {
        mc.off(eventName, callback);
        if (typeof mc.destroy === "function") {
          mc.destroy();
        }
      };
    });
  }
  isCustomEvent(eventName) {
    return this._config.events.indexOf(eventName) > -1;
  }
};
_HammerGesturesPlugin.ɵfac = function HammerGesturesPlugin_Factory(t) {
  return new (t || _HammerGesturesPlugin)(ɵɵinject(DOCUMENT), ɵɵinject(HAMMER_GESTURE_CONFIG), ɵɵinject(Console), ɵɵinject(HAMMER_LOADER, 8));
};
_HammerGesturesPlugin.ɵprov = ɵɵdefineInjectable({
  token: _HammerGesturesPlugin,
  factory: _HammerGesturesPlugin.ɵfac
});
var HammerGesturesPlugin = _HammerGesturesPlugin;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HammerGesturesPlugin, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: HammerGestureConfig,
    decorators: [{
      type: Inject,
      args: [HAMMER_GESTURE_CONFIG]
    }]
  }, {
    type: Console
  }, {
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: Inject,
      args: [HAMMER_LOADER]
    }]
  }], null);
})();
var _HammerModule = class _HammerModule {
};
_HammerModule.ɵfac = function HammerModule_Factory(t) {
  return new (t || _HammerModule)();
};
_HammerModule.ɵmod = ɵɵdefineNgModule({
  type: _HammerModule
});
_HammerModule.ɵinj = ɵɵdefineInjector({
  providers: [{
    provide: EVENT_MANAGER_PLUGINS,
    useClass: HammerGesturesPlugin,
    multi: true,
    deps: [DOCUMENT, HAMMER_GESTURE_CONFIG, Console, [new Optional(), HAMMER_LOADER]]
  }, {
    provide: HAMMER_GESTURE_CONFIG,
    useClass: HammerGestureConfig,
    deps: []
  }]
});
var HammerModule = _HammerModule;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HammerModule, [{
    type: NgModule,
    args: [{
      providers: [{
        provide: EVENT_MANAGER_PLUGINS,
        useClass: HammerGesturesPlugin,
        multi: true,
        deps: [DOCUMENT, HAMMER_GESTURE_CONFIG, Console, [new Optional(), HAMMER_LOADER]]
      }, {
        provide: HAMMER_GESTURE_CONFIG,
        useClass: HammerGestureConfig,
        deps: []
      }]
    }]
  }], null, null);
})();
var _DomSanitizer = class _DomSanitizer {
};
_DomSanitizer.ɵfac = function DomSanitizer_Factory(t) {
  return new (t || _DomSanitizer)();
};
_DomSanitizer.ɵprov = ɵɵdefineInjectable({
  token: _DomSanitizer,
  factory: function DomSanitizer_Factory(t) {
    let r = null;
    if (t) {
      r = new (t || _DomSanitizer)();
    } else {
      r = ɵɵinject(DomSanitizerImpl);
    }
    return r;
  },
  providedIn: "root"
});
var DomSanitizer = _DomSanitizer;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomSanitizer, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useExisting: forwardRef(() => DomSanitizerImpl)
    }]
  }], null, null);
})();
var _DomSanitizerImpl = class _DomSanitizerImpl extends DomSanitizer {
  constructor(_doc) {
    super();
    this._doc = _doc;
  }
  sanitize(ctx, value) {
    if (value == null)
      return null;
    switch (ctx) {
      case SecurityContext.NONE:
        return value;
      case SecurityContext.HTML:
        if (allowSanitizationBypassAndThrow(
          value,
          "HTML"
          /* BypassType.Html */
        )) {
          return unwrapSafeValue(value);
        }
        return _sanitizeHtml(this._doc, String(value)).toString();
      case SecurityContext.STYLE:
        if (allowSanitizationBypassAndThrow(
          value,
          "Style"
          /* BypassType.Style */
        )) {
          return unwrapSafeValue(value);
        }
        return value;
      case SecurityContext.SCRIPT:
        if (allowSanitizationBypassAndThrow(
          value,
          "Script"
          /* BypassType.Script */
        )) {
          return unwrapSafeValue(value);
        }
        throw new RuntimeError(5200, (typeof ngDevMode === "undefined" || ngDevMode) && "unsafe value used in a script context");
      case SecurityContext.URL:
        if (allowSanitizationBypassAndThrow(
          value,
          "URL"
          /* BypassType.Url */
        )) {
          return unwrapSafeValue(value);
        }
        return _sanitizeUrl(String(value));
      case SecurityContext.RESOURCE_URL:
        if (allowSanitizationBypassAndThrow(
          value,
          "ResourceURL"
          /* BypassType.ResourceUrl */
        )) {
          return unwrapSafeValue(value);
        }
        throw new RuntimeError(5201, (typeof ngDevMode === "undefined" || ngDevMode) && `unsafe value used in a resource URL context (see ${XSS_SECURITY_URL})`);
      default:
        throw new RuntimeError(5202, (typeof ngDevMode === "undefined" || ngDevMode) && `Unexpected SecurityContext ${ctx} (see ${XSS_SECURITY_URL})`);
    }
  }
  bypassSecurityTrustHtml(value) {
    return bypassSanitizationTrustHtml(value);
  }
  bypassSecurityTrustStyle(value) {
    return bypassSanitizationTrustStyle(value);
  }
  bypassSecurityTrustScript(value) {
    return bypassSanitizationTrustScript(value);
  }
  bypassSecurityTrustUrl(value) {
    return bypassSanitizationTrustUrl(value);
  }
  bypassSecurityTrustResourceUrl(value) {
    return bypassSanitizationTrustResourceUrl(value);
  }
};
_DomSanitizerImpl.ɵfac = function DomSanitizerImpl_Factory(t) {
  return new (t || _DomSanitizerImpl)(ɵɵinject(DOCUMENT));
};
_DomSanitizerImpl.ɵprov = ɵɵdefineInjectable({
  token: _DomSanitizerImpl,
  factory: _DomSanitizerImpl.ɵfac,
  providedIn: "root"
});
var DomSanitizerImpl = _DomSanitizerImpl;
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomSanitizerImpl, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var HydrationFeatureKind;
(function(HydrationFeatureKind2) {
  HydrationFeatureKind2[HydrationFeatureKind2["NoHttpTransferCache"] = 0] = "NoHttpTransferCache";
  HydrationFeatureKind2[HydrationFeatureKind2["HttpTransferCacheOptions"] = 1] = "HttpTransferCacheOptions";
})(HydrationFeatureKind || (HydrationFeatureKind = {}));
function hydrationFeature(ɵkind, ɵproviders = [], ɵoptions = {}) {
  return {
    ɵkind,
    ɵproviders
  };
}
function withNoHttpTransferCache() {
  return hydrationFeature(HydrationFeatureKind.NoHttpTransferCache);
}
function withHttpTransferCacheOptions(options) {
  return hydrationFeature(HydrationFeatureKind.HttpTransferCacheOptions, withHttpTransferCache(options));
}
function provideZoneJsCompatibilityDetector() {
  return [{
    provide: ENVIRONMENT_INITIALIZER,
    useValue: () => {
      const ngZone = inject(NgZone);
      if (ngZone.constructor !== NgZone) {
        const console2 = inject(Console);
        const message = formatRuntimeError(-5e3, "Angular detected that hydration was enabled for an application that uses a custom or a noop Zone.js implementation. This is not yet a fully supported configuration.");
        console2.warn(message);
      }
    },
    multi: true
  }];
}
function provideClientHydration(...features) {
  const providers = [];
  const featuresKind = /* @__PURE__ */ new Set();
  const hasHttpTransferCacheOptions = featuresKind.has(HydrationFeatureKind.HttpTransferCacheOptions);
  for (const {
    ɵproviders,
    ɵkind
  } of features) {
    featuresKind.add(ɵkind);
    if (ɵproviders.length) {
      providers.push(ɵproviders);
    }
  }
  if (typeof ngDevMode !== "undefined" && ngDevMode && featuresKind.has(HydrationFeatureKind.NoHttpTransferCache) && hasHttpTransferCacheOptions) {
    throw new Error("Configuration error: found both withHttpTransferCacheOptions() and withNoHttpTransferCache() in the same call to provideClientHydration(), which is a contradiction.");
  }
  return makeEnvironmentProviders([typeof ngDevMode !== "undefined" && ngDevMode ? provideZoneJsCompatibilityDetector() : [], withDomHydration(), featuresKind.has(HydrationFeatureKind.NoHttpTransferCache) || hasHttpTransferCacheOptions ? [] : withHttpTransferCache({}), providers]);
}
var VERSION2 = new Version("17.1.3");
var makeStateKey2 = makeStateKey;
var TransferState2 = TransferState;

export {
  getDOM,
  DOCUMENT,
  LOCATION_INITIALIZED,
  LocationStrategy,
  PathLocationStrategy,
  HashLocationStrategy,
  Location,
  ViewportScroller,
  BrowserDomAdapter,
  BrowserGetTestability,
  EVENT_MANAGER_PLUGINS,
  EventManager,
  EventManagerPlugin,
  SharedStylesHost,
  REMOVE_STYLES_ON_COMPONENT_DESTROY,
  DomRendererFactory2,
  DomEventsPlugin,
  KeyEventsPlugin,
  bootstrapApplication,
  createApplication,
  provideProtractorTestingSupport,
  initDomAdapter,
  INTERNAL_BROWSER_PLATFORM_PROVIDERS,
  platformBrowser,
  BrowserModule,
  Meta,
  Title,
  enableDebugTools,
  disableDebugTools,
  By,
  HAMMER_GESTURE_CONFIG,
  HAMMER_LOADER,
  HammerGestureConfig,
  HammerGesturesPlugin,
  HammerModule,
  DomSanitizer,
  DomSanitizerImpl,
  HydrationFeatureKind,
  withNoHttpTransferCache,
  withHttpTransferCacheOptions,
  provideClientHydration,
  VERSION2 as VERSION,
  makeStateKey2 as makeStateKey,
  TransferState2 as TransferState
};
/*! Bundled license information:

@angular/common/fesm2022/common.mjs:
  (**
   * @license Angular v17.1.3
   * (c) 2010-2022 Google LLC. https://angular.io/
   * License: MIT
   *)

@angular/common/fesm2022/http.mjs:
  (**
   * @license Angular v17.1.3
   * (c) 2010-2022 Google LLC. https://angular.io/
   * License: MIT
   *)

@angular/platform-browser/fesm2022/platform-browser.mjs:
  (**
   * @license Angular v17.1.3
   * (c) 2010-2022 Google LLC. https://angular.io/
   * License: MIT
   *)
*/
//# sourceMappingURL=chunk-L6IRO5SR.js.map